FI65986C - (s)-1-aryloxi-2-propanolderivat anvaendbara som mellanprodukter vid framstaellning av (s)-1-aryloxi-3-amino-2-propanolderivat - Google Patents
(s)-1-aryloxi-2-propanolderivat anvaendbara som mellanprodukter vid framstaellning av (s)-1-aryloxi-3-amino-2-propanolderivat Download PDFInfo
- Publication number
- FI65986C FI65986C FI3242/74A FI324274A FI65986C FI 65986 C FI65986 C FI 65986C FI 3242/74 A FI3242/74 A FI 3242/74A FI 324274 A FI324274 A FI 324274A FI 65986 C FI65986 C FI 65986C
- Authority
- FI
- Finland
- Prior art keywords
- group
- carbon atoms
- naphthyl
- amino
- phenyl
- Prior art date
Links
- -1 hydroxy, amino, hydroxyiminomethyl Chemical group 0.000 claims description 72
- 125000004432 carbon atom Chemical group C* 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- 125000003342 alkenyl group Chemical group 0.000 claims description 7
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 7
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 5
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 5
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 claims description 3
- 125000002252 acyl group Chemical group 0.000 claims description 3
- 125000004423 acyloxy group Chemical group 0.000 claims description 3
- 125000005083 alkoxyalkoxy group Chemical group 0.000 claims description 3
- 125000003282 alkyl amino group Chemical group 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- 125000000304 alkynyl group Chemical group 0.000 claims description 3
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 3
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 3
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 claims description 3
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 3
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 claims description 3
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 claims description 3
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 claims description 3
- 125000004230 chromenyl group Chemical group O1C(C=CC2=CC=CC=C12)* 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000005159 cyanoalkoxy group Chemical group 0.000 claims description 3
- 125000004966 cyanoalkyl group Chemical group 0.000 claims description 3
- 125000000723 dihydrobenzofuranyl group Chemical group O1C(CC2=C1C=CC=C2)* 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000005020 hydroxyalkenyl group Chemical group 0.000 claims description 3
- 125000005113 hydroxyalkoxy group Chemical group 0.000 claims description 3
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 claims description 3
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 claims description 3
- 125000001041 indolyl group Chemical group 0.000 claims description 3
- 125000001624 naphthyl group Chemical group 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 3
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 claims description 3
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 claims description 2
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 2
- 125000001769 aryl amino group Chemical group 0.000 claims description 2
- 125000005110 aryl thio group Chemical group 0.000 claims description 2
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 2
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 claims description 2
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 claims description 2
- 239000000047 product Substances 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 2
- 125000000335 thiazolyl group Chemical group 0.000 claims description 2
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical group C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 claims 2
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 claims 2
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 claims 2
- 206010008631 Cholera Diseases 0.000 claims 1
- 125000004450 alkenylene group Chemical group 0.000 claims 1
- 125000004104 aryloxy group Chemical group 0.000 claims 1
- 239000006227 byproduct Substances 0.000 claims 1
- 239000003086 colorant Substances 0.000 claims 1
- 230000001404 mediated effect Effects 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 42
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- 150000001875 compounds Chemical class 0.000 description 26
- 239000000203 mixture Substances 0.000 description 18
- 239000000243 solution Substances 0.000 description 17
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 9
- 239000007858 starting material Substances 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N hydrochloric acid Substances Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- 239000007787 solid Substances 0.000 description 5
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N 2-propanol Substances CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- YBPAYPRLUDCSEY-UHFFFAOYSA-N p-hydroxyphenylacetoamide Natural products NC(=O)CC1=CC=C(O)C=C1 YBPAYPRLUDCSEY-UHFFFAOYSA-N 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 239000004593 Epoxy Substances 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 230000000903 blocking effect Effects 0.000 description 3
- 150000002009 diols Chemical class 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 150000002924 oxiranes Chemical class 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- DTDBWQMKXKHERX-LBPRGKRZSA-N [(2S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxy]propyl] 4-methylbenzenesulfonate Chemical compound C(C)(C)(C)OC[C@@H](COS(=O)(=O)C1=CC=C(C=C1)C)O DTDBWQMKXKHERX-LBPRGKRZSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hcl hcl Chemical compound Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- HBMUWOSOGHUWSS-UHFFFAOYSA-N (2-hydroxy-3-phenylmethoxypropyl) 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCC(O)COCC1=CC=CC=C1 HBMUWOSOGHUWSS-UHFFFAOYSA-N 0.000 description 1
- JPWDLYMEUNBLIR-ZCFIWIBFSA-N (2r)-3-[(2-methylpropan-2-yl)oxy]propane-1,2-diol Chemical compound CC(C)(C)OC[C@H](O)CO JPWDLYMEUNBLIR-ZCFIWIBFSA-N 0.000 description 1
- ASVZARXJSBYDCV-GFCCVEGCSA-N 2-[(2S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxy]propoxy]benzonitrile Chemical compound C(#N)C1=C(OC[C@H](COC(C)(C)C)O)C=CC=C1 ASVZARXJSBYDCV-GFCCVEGCSA-N 0.000 description 1
- YTTFGUYTPJYRBQ-LBPRGKRZSA-N 2-[(2s)-2-hydroxy-3-(propan-2-ylamino)propoxy]benzonitrile Chemical compound CC(C)NC[C@H](O)COC1=CC=CC=C1C#N YTTFGUYTPJYRBQ-LBPRGKRZSA-N 0.000 description 1
- CHZCERSEMVWNHL-UHFFFAOYSA-N 2-hydroxybenzonitrile Chemical compound OC1=CC=CC=C1C#N CHZCERSEMVWNHL-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- KMNGNJCCNKBBCI-UHFFFAOYSA-N Cl.C1(=CC=CC2=CC=CC=C12)C(C)(C)Cl Chemical compound Cl.C1(=CC=CC2=CC=CC=C12)C(C)(C)Cl KMNGNJCCNKBBCI-UHFFFAOYSA-N 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- FQYUMYWMJTYZTK-UHFFFAOYSA-N Phenyl glycidyl ether Chemical compound C1OC1COC1=CC=CC=C1 FQYUMYWMJTYZTK-UHFFFAOYSA-N 0.000 description 1
- BQOWUDKEXDCGQS-UHFFFAOYSA-N [CH]1CCCC1 Chemical compound [CH]1CCCC1 BQOWUDKEXDCGQS-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- BLNWTAHYTCHDJH-UHFFFAOYSA-O hydroxy(oxo)azanium Chemical compound O[NH+]=O BLNWTAHYTCHDJH-UHFFFAOYSA-O 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000000654 isopropylidene group Chemical group C(C)(C)=* 0.000 description 1
- 230000005415 magnetization Effects 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- 125000004149 thio group Chemical group *S* 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Substances CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/12—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms
- C07D303/18—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms by etherified hydroxyl radicals
- C07D303/20—Ethers with hydroxy compounds containing no oxirane rings
- C07D303/22—Ethers with hydroxy compounds containing no oxirane rings with monohydroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/63—Esters of sulfonic acids
- C07C309/72—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C309/73—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton to carbon atoms of non-condensed six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Epoxy Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5207773 | 1973-11-09 | ||
| GB5207773A GB1458392A (en) | 1973-11-09 | 1973-11-09 | Optically-active 1-aryloxy-2,3-epoxypropane derivatives |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI324274A7 FI324274A7 (enExample) | 1975-05-10 |
| FI65986B FI65986B (fi) | 1984-04-30 |
| FI65986C true FI65986C (fi) | 1984-08-10 |
Family
ID=10462547
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI3242/74A FI65986C (fi) | 1973-11-09 | 1974-11-07 | (s)-1-aryloxi-2-propanolderivat anvaendbara som mellanprodukter vid framstaellning av (s)-1-aryloxi-3-amino-2-propanolderivat |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4085136A (enExample) |
| JP (1) | JPS617412B2 (enExample) |
| CH (1) | CH611866A5 (enExample) |
| DE (1) | DE2453324A1 (enExample) |
| DK (1) | DK155085C (enExample) |
| FI (1) | FI65986C (enExample) |
| FR (1) | FR2250752B1 (enExample) |
| GB (1) | GB1458392A (enExample) |
| NO (1) | NO145056C (enExample) |
| SE (1) | SE425971B (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2330383A1 (fr) * | 1975-11-06 | 1977-06-03 | Synthelabo | Nouveaux ethers de phenols substitues, leurs sels, leur preparation et les medicaments qui les renferment |
| DE2839475A1 (de) * | 1978-09-11 | 1980-03-20 | Dolorgiet Arzneimittelfabrik | Isopropylamin-verbindungen, verfahren zu ihrer herstellung und sie enthaltende arzneimittel |
| US4342783A (en) * | 1980-06-30 | 1982-08-03 | Synthelabo | Anti-glaucoma agent |
| US4396629A (en) * | 1980-12-29 | 1983-08-02 | Sterling Drug Inc. | Compositions, processes and method |
| DE3319027A1 (de) * | 1983-05-26 | 1984-11-29 | Boehringer Mannheim Gmbh, 6800 Mannheim | Verfahren zur herstellung von optisch aktiven carbazol-derivaten, neue r- und s-carbazol-derivate, sowie arzneimittel, die diese verbindungen enthalten |
| JPS6087237A (ja) * | 1983-10-19 | 1985-05-16 | Toyo Sutoufuaa Chem:Kk | 光学活性なケトンの製造方法 |
| JPS60184039A (ja) * | 1984-03-01 | 1985-09-19 | Toyo Sutoufuaa Chem:Kk | 光学活性なケトンの製造方法 |
| GB8419683D0 (en) * | 1984-08-02 | 1984-09-05 | Erba Farmitalia | 3-substituted derivatives of 1-amino-2-hydroxy-propane |
| AU589594B2 (en) * | 1985-02-13 | 1989-10-19 | Gist-Brocades N.V. | Process for the preparation of arylglycidyl ethers and 3-substituted 1-alkylamino-2-propanlos |
| US4956284A (en) * | 1985-02-13 | 1990-09-11 | Gist-Brocades N.V. | Process for producing 4-(2-methoxyethyl)-phenyl-glycidyl ether and/or metoprolol |
| GB8503666D0 (en) * | 1985-02-13 | 1985-03-13 | Shell Int Research | Producing 4-(2-methoxyethyl)-phenylglycidyl ether |
| US4945182A (en) * | 1985-12-24 | 1990-07-31 | Merck & Co., Inc. | Oculoselective beta-blockers |
| GB8607312D0 (en) * | 1986-03-25 | 1986-04-30 | Ici Plc | Therapeutic agents |
| GB8618324D0 (en) * | 1986-07-28 | 1986-09-03 | Shell Int Research | Phenylacetate/atenolol |
| US5223646A (en) * | 1989-12-27 | 1993-06-29 | Daiso Company, Ltd. | Process for producing optically active atenolol and intermediate thereof |
| JPH0674243B2 (ja) * | 1989-12-27 | 1994-09-21 | ダイソー株式会社 | 光学純度の高い光学活性アテノロール塩及びアテノロールの製法 |
| SE468211B (sv) * | 1990-01-22 | 1992-11-23 | Nobel Chemicals Ab | Flerstegsfoerfarande foer framstaellning av homokirala aminer |
| SE9000207L (sv) * | 1990-01-22 | 1991-07-23 | Nobel Chemicals Ab | Laekemedel samt anvaendningen av detsamma |
| ZW1992A1 (en) * | 1991-02-25 | 1993-09-22 | Janssen Pharmaceutica Nv | 4-/(2-benzotiazolyl)methylamino/-b-/(3,4-difluorephenoxy)methyl/-1-piperidine ethanol |
| US6946566B2 (en) | 2002-07-31 | 2005-09-20 | Daiso Co., Ltd. | Process for preparation of optically active halogeno hydroxypropyl compound and glycidyl compound |
| US6982349B1 (en) | 2003-10-31 | 2006-01-03 | Emcure Pharmaceuticals Limited | Process for producing atenolol of high optical purity |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1069343A (en) * | 1963-09-10 | 1967-05-17 | Ici Ltd | Propanolamine derivatives |
| US3494939A (en) * | 1964-03-09 | 1970-02-10 | Minnesota Mining & Mfg | Glycidoxy - bisnuclear - phenolic ethers of oxa-substituted aliphatic diols and triols |
| US3686320A (en) * | 1965-03-25 | 1972-08-22 | Fisons Pharmaceuticals Ltd | Bis-phenoxy compounds |
| GB1136919A (en) * | 1965-06-16 | 1968-12-18 | Ici Ltd | Amines |
| DE1668055B2 (de) * | 1967-03-10 | 1973-09-06 | Farbwerke Hoechst AG, vormals Mei ster Lucius & Bruning, 6000 Frankfurt | Basisch substituierte cyclopentylphenolaether, deren salze mit physiologisch vertraeglichen saeuren und verfahren zu deren herstellung |
| BE755071A (fr) * | 1969-09-17 | 1971-02-22 | Warner Lambert Pharmaceutical | Procede de resolution de la dl-5-/3-(terbutylamino)-2- hydroxy-propoxy/-3,4-dihydro-1(2h) naphtalenone |
| GB1410513A (en) | 1971-10-27 | 1975-10-15 | Syntex Inc | 3-thiazol-2-oxy-propane derivatives |
-
1973
- 1973-11-09 GB GB5207773A patent/GB1458392A/en not_active Expired
-
1974
- 1974-11-07 SE SE7414017A patent/SE425971B/xx not_active IP Right Cessation
- 1974-11-07 FI FI3242/74A patent/FI65986C/fi active
- 1974-11-07 DK DK581474A patent/DK155085C/da active
- 1974-11-07 NO NO744023A patent/NO145056C/no unknown
- 1974-11-08 JP JP49128841A patent/JPS617412B2/ja not_active Expired
- 1974-11-08 CH CH1499674A patent/CH611866A5/xx not_active IP Right Cessation
- 1974-11-08 FR FR7437127A patent/FR2250752B1/fr not_active Expired
- 1974-11-11 DE DE19742453324 patent/DE2453324A1/de active Granted
-
1976
- 1976-06-09 US US05/694,323 patent/US4085136A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| NO744023L (enExample) | 1975-06-02 |
| DK581474A (enExample) | 1975-07-07 |
| SE7414017L (enExample) | 1975-05-12 |
| FI324274A7 (enExample) | 1975-05-10 |
| CH611866A5 (enExample) | 1979-06-29 |
| JPS5077331A (enExample) | 1975-06-24 |
| DK155085C (da) | 1989-06-26 |
| FR2250752A1 (enExample) | 1975-06-06 |
| DK155085B (da) | 1989-02-06 |
| SE425971B (sv) | 1982-11-29 |
| NO145056C (no) | 1982-01-04 |
| FR2250752B1 (enExample) | 1979-03-16 |
| GB1458392A (en) | 1976-12-15 |
| DE2453324C2 (enExample) | 1989-07-06 |
| JPS617412B2 (enExample) | 1986-03-06 |
| FI65986B (fi) | 1984-04-30 |
| US4085136A (en) | 1978-04-18 |
| DE2453324A1 (de) | 1975-05-22 |
| NO145056B (no) | 1981-09-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI65986C (fi) | (s)-1-aryloxi-2-propanolderivat anvaendbara som mellanprodukter vid framstaellning av (s)-1-aryloxi-3-amino-2-propanolderivat | |
| FI61890B (fi) | Nytt foerfarande foer framstaellning av terapeutiskt anvaendbara 2-aryloximetylmorfoliner | |
| EP0249610B1 (en) | Synthesis of optically active aryloxypropanolamines and arylethanolamines | |
| EP0248879A1 (en) | Synthesis of aryloxypropanolamines and arylethanolamines | |
| JP4468369B2 (ja) | ある種のトリフルオロメチル置換アルコールの立体選択的合成 | |
| US4182911A (en) | Optically-active 1-aryloxy-2-propanol intermediates of (S)-absolute configuration | |
| GB1598668A (en) | Indolyloxymethyl-2-oxazolidinone derivatives and their use in the preparation of 1-amino-3-(indolyloxy)-2-propanols | |
| US4408063A (en) | Preparation of epihalohydrin enantiomers | |
| FI62060C (fi) | Foerfarande foer framstaellning av beta-blockerande substituerad 2-hydroxi-3-(2-acyl-4-ureido-fenoxi)-propylaminderivat | |
| KR100519691B1 (ko) | 알킬옥시 퓨라논 유도체의 제조방법, 상기 방법으로 얻은화합물 및 상기 화합물의 용도 | |
| US4851550A (en) | Process for the preparation of cyclic aliphatic orthocarbonic esters new cyclic orthocarbonic esters | |
| US4588824A (en) | Preparation of epihalohydrin enantiomers | |
| US5043495A (en) | Process of separation and purification of a propargyl alcohols | |
| Obase et al. | Synthesis and adrenergic β-blocking activity of some propanolamine derivatives | |
| HU191682B (en) | Process for preparing 1-benzyl-azetidin-3-ol derivatives | |
| HU196197B (en) | Process for producing mono- and bifunctional anthraquinone-(oxy-2,3-oxidopropane) derivatives and pharmaceutics comprising the same | |
| FI66856C (fi) | Foerfarande foer framstaellning av nya hjaertstimulerande alkanolaminderivat | |
| US5461156A (en) | Stereocontrolled synthesis of cis-bicyclic compounds | |
| Renuga et al. | Diastereoselective synthesis of 2, 2′-thiobis-and 2, 2′-sulfonylbis-(2-aroyl-3-aryloxiranes) | |
| KR100418327B1 (ko) | 신규의 아지리딘 유도체 및 그 제조방법 | |
| Paulvannan et al. | Asymmetric Synthesis of Mercaptoalcohols-Matrix Metalloproteinase Inhibitors | |
| EP0219505B1 (en) | Stereoselective process and chiral intermediates for aryloxydropanolamines | |
| US3472850A (en) | Method for the production of 2-substituted - 4 - amino - 5 - acylamidomethyl-pyrimidine | |
| JP3225107B2 (ja) | 光学活性2−プロパノール誘導体の製造法 | |
| US2579500A (en) | N-(phenoxyisopropyl)-n-thenylbeta-halo-ethylamines |