FI58928C - Foerfarande och katalysatorsystem foer laogtryckspolymerisering av eten enbart eller tillsammans med en alfa-olefin med 3-6 kolatomer - Google Patents
Foerfarande och katalysatorsystem foer laogtryckspolymerisering av eten enbart eller tillsammans med en alfa-olefin med 3-6 kolatomer Download PDFInfo
- Publication number
- FI58928C FI58928C FI1987/73A FI198773A FI58928C FI 58928 C FI58928 C FI 58928C FI 1987/73 A FI1987/73 A FI 1987/73A FI 198773 A FI198773 A FI 198773A FI 58928 C FI58928 C FI 58928C
- Authority
- FI
- Finland
- Prior art keywords
- aluminum
- magnesium
- halide
- reaction
- catalyst
- Prior art date
Links
- 239000003054 catalyst Substances 0.000 claims description 80
- -1 magnesium halide Chemical class 0.000 claims description 50
- 229910052782 aluminium Inorganic materials 0.000 claims description 42
- 239000010936 titanium Substances 0.000 claims description 39
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 26
- 239000011777 magnesium Substances 0.000 claims description 25
- 125000004432 carbon atom Chemical group C* 0.000 claims description 20
- 150000001875 compounds Chemical class 0.000 claims description 20
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical group [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 17
- 239000007787 solid Substances 0.000 claims description 17
- 229910052749 magnesium Inorganic materials 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 16
- 229910052719 titanium Inorganic materials 0.000 claims description 16
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 13
- 239000005977 Ethylene Substances 0.000 claims description 13
- 238000002360 preparation method Methods 0.000 claims description 13
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 12
- 230000008569 process Effects 0.000 claims description 11
- 150000004831 organic oxygen compounds Chemical class 0.000 claims description 10
- 229910052726 zirconium Inorganic materials 0.000 claims description 10
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 9
- 230000003197 catalytic effect Effects 0.000 claims description 9
- 229910052720 vanadium Inorganic materials 0.000 claims description 8
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical group [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 claims description 8
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 7
- 239000011575 calcium Substances 0.000 claims description 7
- 150000004820 halides Chemical class 0.000 claims description 7
- 229910052725 zinc Inorganic materials 0.000 claims description 7
- 239000011701 zinc Substances 0.000 claims description 7
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 6
- 150000001336 alkenes Chemical class 0.000 claims description 6
- 229910052791 calcium Inorganic materials 0.000 claims description 6
- 229930195733 hydrocarbon Natural products 0.000 claims description 5
- 239000004215 Carbon black (E152) Substances 0.000 claims description 4
- 239000000347 magnesium hydroxide Substances 0.000 claims description 4
- 229910001862 magnesium hydroxide Inorganic materials 0.000 claims description 4
- 150000001350 alkyl halides Chemical class 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 claims description 3
- 150000002430 hydrocarbons Chemical class 0.000 claims description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims 2
- 238000006243 chemical reaction Methods 0.000 description 62
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 43
- 239000004698 Polyethylene Substances 0.000 description 36
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical class [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 35
- 238000006116 polymerization reaction Methods 0.000 description 32
- 229920000573 polyethylene Polymers 0.000 description 21
- 229910052751 metal Inorganic materials 0.000 description 19
- 239000002184 metal Substances 0.000 description 19
- 235000011147 magnesium chloride Nutrition 0.000 description 18
- 239000000203 mixture Substances 0.000 description 16
- 229920000642 polymer Polymers 0.000 description 14
- 230000000694 effects Effects 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- 239000000460 chlorine Substances 0.000 description 11
- 239000003085 diluting agent Substances 0.000 description 11
- 239000007788 liquid Substances 0.000 description 11
- YHWCPXVTRSHPNY-UHFFFAOYSA-N butan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCC[O-].CCCC[O-].CCCC[O-].CCCC[O-] YHWCPXVTRSHPNY-UHFFFAOYSA-N 0.000 description 10
- 239000012429 reaction media Substances 0.000 description 9
- 238000000926 separation method Methods 0.000 description 9
- 150000002894 organic compounds Chemical class 0.000 description 8
- 229910052723 transition metal Inorganic materials 0.000 description 8
- 150000003624 transition metals Chemical class 0.000 description 8
- 229910052801 chlorine Inorganic materials 0.000 description 7
- 238000000921 elemental analysis Methods 0.000 description 7
- 239000000155 melt Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 229910001629 magnesium chloride Inorganic materials 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- 150000008064 anhydrides Chemical class 0.000 description 5
- 229910001507 metal halide Inorganic materials 0.000 description 5
- 150000005309 metal halides Chemical class 0.000 description 5
- 150000002739 metals Chemical class 0.000 description 5
- 229920000098 polyolefin Polymers 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- 150000003623 transition metal compounds Chemical class 0.000 description 5
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 5
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- 150000001335 aliphatic alkanes Chemical class 0.000 description 4
- 150000004703 alkoxides Chemical class 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 150000001924 cycloalkanes Chemical class 0.000 description 4
- 150000001993 dienes Chemical class 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 4
- 239000000178 monomer Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 3
- 229910021380 Manganese Chloride Inorganic materials 0.000 description 3
- GLFNIEUTAYBVOC-UHFFFAOYSA-L Manganese chloride Chemical compound Cl[Mn]Cl GLFNIEUTAYBVOC-UHFFFAOYSA-L 0.000 description 3
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 239000001110 calcium chloride Substances 0.000 description 3
- 235000011148 calcium chloride Nutrition 0.000 description 3
- 238000007334 copolymerization reaction Methods 0.000 description 3
- UWNADWZGEHDQAB-UHFFFAOYSA-N i-Pr2C2H4i-Pr2 Natural products CC(C)CCC(C)C UWNADWZGEHDQAB-UHFFFAOYSA-N 0.000 description 3
- 235000012254 magnesium hydroxide Nutrition 0.000 description 3
- 229910052748 manganese Inorganic materials 0.000 description 3
- 239000011572 manganese Substances 0.000 description 3
- 239000011565 manganese chloride Substances 0.000 description 3
- 235000002867 manganese chloride Nutrition 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 229910052718 tin Inorganic materials 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 239000011592 zinc chloride Substances 0.000 description 3
- 235000005074 zinc chloride Nutrition 0.000 description 3
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 239000012190 activator Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000004791 alkyl magnesium halides Chemical class 0.000 description 2
- 238000010668 complexation reaction Methods 0.000 description 2
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229920001903 high density polyethylene Polymers 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 239000003701 inert diluent Substances 0.000 description 2
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 2
- ORUIBWPALBXDOA-UHFFFAOYSA-L magnesium fluoride Chemical compound [F-].[F-].[Mg+2] ORUIBWPALBXDOA-UHFFFAOYSA-L 0.000 description 2
- 229910001635 magnesium fluoride Inorganic materials 0.000 description 2
- 229940099607 manganese chloride Drugs 0.000 description 2
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 150000002902 organometallic compounds Chemical class 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical group C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 2
- RRKODOZNUZCUBN-CCAGOZQPSA-N (1z,3z)-cycloocta-1,3-diene Chemical compound C1CC\C=C/C=C\C1 RRKODOZNUZCUBN-CCAGOZQPSA-N 0.000 description 1
- RYSXWUYLAWPLES-MTOQALJVSA-N (Z)-4-hydroxypent-3-en-2-one titanium Chemical compound [Ti].C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O RYSXWUYLAWPLES-MTOQALJVSA-N 0.000 description 1
- PEIHRCIDUUJQCQ-UHFFFAOYSA-N 1,3-bis(ethenyl)cyclohexane Chemical compound C=CC1CCCC(C=C)C1 PEIHRCIDUUJQCQ-UHFFFAOYSA-N 0.000 description 1
- XTBYRVXNZACGQT-UHFFFAOYSA-N 1-bromo-2-ethynyl-4,5-dimethoxybenzene Chemical group COC1=CC(Br)=C(C#C)C=C1OC XTBYRVXNZACGQT-UHFFFAOYSA-N 0.000 description 1
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 1
- HECLRDQVFMWTQS-RGOKHQFPSA-N 1755-01-7 Chemical compound C1[C@H]2[C@@H]3CC=C[C@@H]3[C@@H]1C=C2 HECLRDQVFMWTQS-RGOKHQFPSA-N 0.000 description 1
- XAGFODPZIPBFFR-NJFSPNSNSA-N Aluminium-29 Chemical compound [29Al] XAGFODPZIPBFFR-NJFSPNSNSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- KOXQASYUVUTQFX-UHFFFAOYSA-N [Mg].CCCl Chemical compound [Mg].CCCl KOXQASYUVUTQFX-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- XAGFODPZIPBFFR-OUBTZVSYSA-N aluminium-28 atom Chemical compound [28Al] XAGFODPZIPBFFR-OUBTZVSYSA-N 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 238000000071 blow moulding Methods 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- ASCHNMXUWBEZDM-UHFFFAOYSA-N chloridodioxygen(.) Chemical compound [O]OCl ASCHNMXUWBEZDM-UHFFFAOYSA-N 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- HQWPLXHWEZZGKY-UHFFFAOYSA-N diethylzinc Chemical group CC[Zn]CC HQWPLXHWEZZGKY-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N dodecane Chemical class CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 210000003746 feather Anatomy 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 239000001282 iso-butane Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- IUYHWZFSGMZEOG-UHFFFAOYSA-M magnesium;propane;chloride Chemical group [Mg+2].[Cl-].C[CH-]C IUYHWZFSGMZEOG-UHFFFAOYSA-M 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- SJYNFBVQFBRSIB-UHFFFAOYSA-N norbornadiene Chemical compound C1=CC2C=CC1C2 SJYNFBVQFBRSIB-UHFFFAOYSA-N 0.000 description 1
- 150000002927 oxygen compounds Chemical class 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000011949 solid catalyst Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- RWWNQEOPUOCKGR-UHFFFAOYSA-N tetraethyltin Chemical group CC[Sn](CC)(CC)CC RWWNQEOPUOCKGR-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F4/00—Polymerisation catalysts
- C08F4/02—Carriers therefor
- C08F4/022—Magnesium halide as support anhydrous or hydrated or complexed by means of a Lewis base for Ziegler-type catalysts
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F2410/00—Features related to the catalyst preparation, the catalyst use or to the deactivation of the catalyst
- C08F2410/04—Dual catalyst, i.e. use of two different catalysts, where none of the catalysts is a metallocene
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| LU65587 | 1972-06-22 | ||
| LU65587A LU65587A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1972-06-22 | 1972-06-22 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI58928B FI58928B (fi) | 1981-01-30 |
| FI58928C true FI58928C (fi) | 1981-05-11 |
Family
ID=19727083
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI1987/73A FI58928C (fi) | 1972-06-22 | 1973-06-20 | Foerfarande och katalysatorsystem foer laogtryckspolymerisering av eten enbart eller tillsammans med en alfa-olefin med 3-6 kolatomer |
Country Status (31)
Families Citing this family (77)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1035396B (it) * | 1974-04-22 | 1979-10-20 | Dow Chemical Co | Catalizzatore dim polimerizzazime oi alta efficienza e relativo procedimento di produzione e di impiego |
| US4192772A (en) | 1975-04-14 | 1980-03-11 | Solvay & Cie | Solid catalyst and process for the preparation thereof |
| LU72278A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1975-04-14 | 1977-02-03 | ||
| IT1038179B (it) * | 1975-05-16 | 1979-11-20 | Montedison Spa | Procedimento di polimerizzazione di alfa olefine con almeno treatoni di carbonto |
| SE434749B (sv) * | 1975-06-12 | 1984-08-13 | Montedison Spa | Katalysatorkomponenter for polymerisation av olefiner samt forfarande for framstellning av dessa katalysatorkomponenter |
| NL7613855A (nl) * | 1975-12-18 | 1977-06-21 | Sumitomo Chemical Co | Werkwijze voor het polymeriseren van olefinen. |
| NL171273C (nl) * | 1976-05-24 | 1983-03-01 | Stamicarbon | Werkwijze voor het polymeriseren van alkenen en werkwijze voor het bereiden van een chroomoxyde-op drager-katalysator. |
| US4242479A (en) * | 1976-12-23 | 1980-12-30 | Showa Yuka Kabushiki Kaisha | Process for producing an improved ethylenic polymer |
| LU77489A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1977-06-06 | 1979-01-19 | ||
| NO155245C (no) * | 1978-07-24 | 1987-03-04 | Phillips Petroleum Co | Fremgangsmaate til fremstilling av en polymerisasjonskatalysator og anvendelse av katalysatoren til alkenpolymerisering. |
| IT1100285B (it) * | 1978-11-21 | 1985-09-28 | Euteco Spa | Catalizzatori con supporti misti per la cmo- e co-polimezzazione di alfa-olefine |
| US4347157A (en) | 1979-04-25 | 1982-08-31 | Sumitomo Chemical Company, Limited | Catalysts for the polymerization of olefins |
| US4363746A (en) | 1979-05-29 | 1982-12-14 | Phillips Petroleum Company | Composition of matter and method of preparing same, catalyst, method of producing the catalyst and polymerization process employing the catalyst |
| JPS5695909A (en) * | 1979-12-28 | 1981-08-03 | Nippon Oil Co Ltd | Preparation of polyolefin |
| US4363902A (en) * | 1980-03-17 | 1982-12-14 | Wacker-Chemie Gmbh | Process and heavy metal catalyst for the polymerization of α-olefins, particularly polyethylene |
| US4384087A (en) * | 1980-03-24 | 1983-05-17 | Phillips Petroleum Company | Composition of matter and method of preparing same, catalyst, method of producing the catalyst and polymerization process employing the catalyst |
| IT1132230B (it) | 1980-07-24 | 1986-06-25 | Anic Spa | Procedimento per la produzione dell'enzima colesterolo-esterasi e per idrolisi degli esteri con acidi grassi del colesterolo mediante l'impiego dell'enzima stesso |
| US4394291A (en) * | 1981-03-04 | 1983-07-19 | Phillips Petroleum Company | Polyolefin polymerization process and catalyst |
| US4399055A (en) * | 1981-05-01 | 1983-08-16 | Mitsubishi Petrochemical Company Limited | Carrier of catalyst and catalyst component composed of the carrier, for polymerization of olefins, as well as processes for production thereof |
| US4384982A (en) | 1981-05-18 | 1983-05-24 | Phillips Petroleum Company | Process and catalyst for olefin polymerization |
| US4391736A (en) | 1981-06-05 | 1983-07-05 | Phillips Petroleum Company | Alpha-olefin polymerization |
| US4354009A (en) * | 1981-07-30 | 1982-10-12 | Union Carbide Corporation | Catalyst composition for copolymerizing ethylene |
| US4451626A (en) * | 1981-10-22 | 1984-05-29 | The Dow Chemical Company | Process for polymerizing alpha-olefins |
| US4409126A (en) * | 1981-10-22 | 1983-10-11 | The Dow Chemical Company | Ultra high efficiency catalyst for polymerizing olefins |
| US4497906A (en) * | 1982-02-16 | 1985-02-05 | Sumitomo Chemical Company, Limited | Solid catalyst component for olefin polymerization |
| US4550094A (en) * | 1982-02-16 | 1985-10-29 | Sumitomo Chemical Company, Limited | Solid catalyst component for olefin polymerization |
| US4526943A (en) * | 1982-07-29 | 1985-07-02 | The Dow Chemical Company | Process for polymerizing olefins in the presence of a catalyst prepared from organomagnesium compound, organic hydroxyl-containing compound, reducing halide source and transition metal compound |
| US4699961A (en) * | 1982-09-30 | 1987-10-13 | E. I. Du Pont De Nemours & Co. | High efficiency catalysts for varying olefin polymer molecular weight distribution |
| US4675368A (en) * | 1982-10-04 | 1987-06-23 | Solvay & Cie. | Process for inhibiting crust formation in reactors during alpha-olefin prepolymerization modification of Ziegler catalyst |
| US4492768A (en) * | 1983-08-19 | 1985-01-08 | Phillips Petroleum Company | Polyolefin polymerization process and catalyst |
| US4503159A (en) * | 1983-08-19 | 1985-03-05 | Phillips Petroleum Company | Polyolefin polymerization process and catalyst |
| US4585749A (en) * | 1983-09-28 | 1986-04-29 | Phillips Petroleum Company | Process for the preparation of an olefin polymerization catalyst |
| IT1212779B (it) * | 1983-10-14 | 1989-11-30 | Enichimica Secondaria | Procedimento per la polimerizzazione di etilene e per la copolimerizzazione di etilene con alfa-olefine e catalizzatore relativo. |
| US4520121A (en) * | 1983-10-28 | 1985-05-28 | Inkrott Kenneth E | Magnesium halide hydrates and polymerization catalysts prepared therefrom |
| US4672096A (en) * | 1984-04-04 | 1987-06-09 | Mobil Oil Corporation | Catalyst composition for polymerizing alpha-olefins |
| US4593009A (en) * | 1984-04-04 | 1986-06-03 | Mobil Oil Corporation | Catalyst composition for polymerizing alpha-olefins |
| US4618662A (en) * | 1984-04-23 | 1986-10-21 | Mobil Oil Corporation | Catalyst composition for polymerizing alpha-olefins |
| US4562168A (en) * | 1984-05-17 | 1985-12-31 | Phillips Petroleum Company | Catalyst and olefin polymerization |
| FR2565591B1 (fr) * | 1984-06-08 | 1986-08-29 | Inst Francais Du Petrole | Procede de fabrication d'un copolymere ethylene-butene-1 a partir d'ethylene |
| US4544716A (en) * | 1984-06-22 | 1985-10-01 | Phillips Petroleum Company | Polyolefin polymerization process and catalyst |
| US4783512A (en) * | 1985-05-20 | 1988-11-08 | The Dow Chemical Company | Process for polymerizing olefins in the presence of a catalyst prepared from organomagnesium compound, organic hydroxyl-containing compound, reducing halide source and transition metal compound |
| US5055533A (en) * | 1986-01-24 | 1991-10-08 | Mobil Oil Corporation | Process for polymerizing alpha-olefins with trimethylaluminum-activated catalyst |
| USRE33683E (en) * | 1986-01-24 | 1991-09-03 | Mobil Oil Corporation | Catalyst composition for polymerizing alpha-olefins |
| US4888318A (en) * | 1986-01-24 | 1989-12-19 | Mobil Oil Corporation | Catalyst composition for polymerizing alpha-olefins |
| IT1190319B (it) * | 1986-04-17 | 1988-02-16 | Enichem Polimeri | Procedimento per la preparazione di polietilene a bassa o media densita' e catalizzatori adatti allo scopo |
| IT1203330B (it) * | 1987-02-06 | 1989-02-15 | Enichem Base Spa | Componente di catalizzatore e catalizzatore per la polimerizzazione dell'etilene o la co-polimerizzazione dell-etilene con alfa-olefine |
| JPH0717709B2 (ja) * | 1987-11-13 | 1995-03-01 | 日本石油株式会社 | 超高分子量ポリエチレンの製造方法 |
| FR2624122B1 (fr) * | 1987-12-03 | 1991-11-08 | Solvay | Procede pour la polymerisation des alpha-olefines, complexes catalytiques solides utilisables pour cette polymerisation et procede pour leur preparation |
| US4833111A (en) * | 1988-01-14 | 1989-05-23 | Mobil Oil Corporation | Catalyst composition for polymerizing alpha-olefin polymers of narrow molecular weight distribution |
| US4849389A (en) * | 1988-01-14 | 1989-07-18 | Mobil Oil Corporation | Catalyst composition for polymerizing alpha-olefin polymers of narrow molecular weight distribution |
| US4954470A (en) * | 1988-01-14 | 1990-09-04 | Mobil Oil Corporation | Chlorinated alcohol-containing catalyst composition for polymerizing alpha-olefins |
| FR2627495B1 (fr) * | 1988-02-22 | 1992-01-17 | Solvay | Solide catalytique utilisable pour la polymerisation des alpha-olefines, procede pour sa preparation et procede de polymerisation des alpha-olefines en presence d'un systeme catalytique comprenant ce solide |
| DE69119628T2 (de) * | 1990-03-16 | 1996-12-05 | Polimeri Europa Srl | Katalysator auf Träger für Ethylenpolymerisation oder -copolymerisation mit alpha-Olefinen, seine Herstellung und seine Anwendung |
| US5114897A (en) * | 1990-04-18 | 1992-05-19 | The Dow Chemical Company | Catalyst and process for polymerizing olefins |
| US5045612A (en) * | 1990-04-18 | 1991-09-03 | The Dow Chemical Company | Catalyst and process for polymerizing olefins |
| IT1252041B (it) * | 1990-10-11 | 1995-05-29 | Enimont Anic Srl | Componente solido di catalizzatore per la (co)polimerizzazione dell'etilene |
| IT1251785B (it) * | 1991-07-12 | 1995-05-26 | Enichem Polimeri | Procedimento per la preparazione di un componente solido di catalizzatore per la (co)polimerizzazione di etilene |
| IT1251796B (it) * | 1991-07-15 | 1995-05-26 | Himont Inc | Componenti e catalizzatori per la polimerizzazione di etilene |
| IT1252069B (it) * | 1991-11-25 | 1995-05-29 | Enichem Elastomers | Processo per la preparazione di copolimeri elastomerici dell'etilene |
| US5260245A (en) * | 1992-10-19 | 1993-11-09 | Mobil Oil Corporation | High activity polyethylene catalysts |
| US5258345A (en) * | 1992-11-20 | 1993-11-02 | Mobil Oil Corporation | High-activity polyethylene catalysts |
| US5330951A (en) * | 1992-12-09 | 1994-07-19 | Mobil Oil Corporation | Catalyst composition for polymerizing alpha-olefin |
| CA2174766C (en) * | 1993-11-18 | 2005-06-21 | Robert Ivan Mink | A catalyst composition for the copolymerization of ethylene |
| US5740784A (en) * | 1995-05-25 | 1998-04-21 | Pleasurecraft Marine Engine Co. | Fuel control system |
| US6191239B1 (en) | 1998-02-18 | 2001-02-20 | Eastman Chemical Company | Process for producing polyethylene |
| US6271321B1 (en) | 1998-02-18 | 2001-08-07 | Eastman Chemical Company | Process for producing polyethylene |
| US6228957B1 (en) | 1998-02-18 | 2001-05-08 | Eastman Chemical Company | Process for producing polyethlene |
| US6534613B2 (en) | 1998-02-18 | 2003-03-18 | Eastman Chemical Company | Process for producing polyethylene |
| US6291613B1 (en) | 1998-10-27 | 2001-09-18 | Eastman Chemical Company | Process for the polymerization of olefins |
| WO2000024790A2 (en) | 1998-10-27 | 2000-05-04 | Eastman Chemical Company | Process for the polymerization of olefins; polyethylenes, a nd films and articles produced therefrom |
| US6300432B1 (en) | 1999-03-30 | 2001-10-09 | Eastman Chemical Company | Process for producing polyolefins |
| WO2000058374A1 (en) | 1999-03-30 | 2000-10-05 | Eastman Chemical Company | Process for producing polyolefins |
| US6417299B1 (en) | 1999-06-07 | 2002-07-09 | Eastman Chemical Company | Process for producing ethylene/olefin interpolymers |
| IT1397080B1 (it) | 2009-11-23 | 2012-12-28 | Polimeri Europa Spa | Catalizzatore di tipo ziegler-natta per la (co)polimerizzazione delle alfa-olefine con elevata produttivita' |
| JP5890316B2 (ja) * | 2009-12-23 | 2016-03-22 | バーゼル・ポリオレフィン・イタリア・ソチエタ・ア・レスポンサビリタ・リミタータ | 塩化マグネシウム水付加体とそれから得られる触媒成分 |
| IT1403278B1 (it) | 2010-12-20 | 2013-10-17 | Polimeri Europa Spa | Precursore di catalizzatore e catalizzatore per la (co)polimerizzazione delle alfa-olefine ad alta temperatura |
| WO2014120028A1 (en) | 2013-01-29 | 2014-08-07 | Ux2 Centrum Technologiczne Sp. Z.O.O. | The lock of the connection set for structural elements, the connection set with locks and the method of joining constructional elements with the use of the connection set |
Family Cites Families (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3400110A (en) * | 1963-08-01 | 1968-09-03 | Solvay | Polymerization of olefins in the presence of a catalyst comprising an organometallic compound and the reaction product of a transition metal compound and a hydroxychloride of a bivalent metal |
| US3326877A (en) * | 1963-11-13 | 1967-06-20 | Cabot Corp | Catalysts and process for polymerization |
| US3450682A (en) * | 1963-11-14 | 1969-06-17 | Mitsui Petrochemical Ind | Process for preparation of crystalline high polymers of olefins |
| FR1488961A (fr) * | 1963-11-21 | 1967-07-21 | Inst Francais Du Petrole | Nouveau procédé de polymérisation d'oléfines |
| NL136306C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1965-11-04 | |||
| DE1634581A1 (de) | 1966-03-10 | 1970-06-25 | Fondedile S P A Sa | Konischer Unterfundierungspfahl und Verfahren zu dessen Herstellung |
| FR94558E (fr) * | 1966-10-21 | 1969-09-12 | Solvay | Procédé pour la polymérisation et la copolymérisation des oléfines. |
| DE1958488U (de) | 1966-12-01 | 1967-04-06 | Stetefeld K G Ing | Feuchteschutzgeraet fuer lagertanks. |
| GB1208242A (en) * | 1968-02-03 | 1970-10-07 | Chisso Corp | Improvements in and relating to the polymerisation of alpha-olefins |
| NL157609B (nl) * | 1968-05-06 | 1978-08-15 | Montedison Spa | Werkwijze om een katalysator te bereiden om alkenen te polymeriseren, alsmede gevormde voorwerpen, vervaardigd volgens deze werkwijze. |
| BG17623A3 (bg) * | 1968-06-27 | 1973-11-10 | Hoechst Aktiengesellschaft | Метод за полимеризация на алфаолефини |
| FR1582543A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1968-07-01 | 1969-10-03 | ||
| CA920299A (en) * | 1968-08-01 | 1973-01-30 | Mitsui Petrochemical Industries | Process for the polymerization and/or copolymerization of olefins with use of ziegler-type catalytsts supported on carrier |
| US3644318A (en) * | 1968-08-21 | 1972-02-22 | Hoechst Ag | Process for the polymerization of olefins |
| US3642760A (en) * | 1968-10-14 | 1972-02-15 | Solvay | Polymerization and copolymerization of diolefins |
| US3803105A (en) * | 1969-01-10 | 1974-04-09 | Montedison Spa | Polymerization catalysts |
| GB1299862A (en) * | 1969-01-23 | 1972-12-13 | Shell Int Research | Improvements in or relating to the catalytic polymerisation of olefins |
| NL136668C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1969-01-24 | |||
| SE367327B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1969-03-24 | 1974-05-27 | Montedison Spa | |
| NL163523C (nl) * | 1970-07-31 | 1983-11-16 | Montedison Spa | Werkwijze om een polymerisatiekatalysator te bereiden. |
| DE2043508A1 (de) * | 1970-09-02 | 1972-03-16 | Farbwerke Hoechst AG, vorm. Meister Lucius & Brüning, 6000 Frankfurt | Verfahren zur Herstellung von Polyolefinen |
| NL7113778A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1970-10-13 | 1972-04-17 | ||
| NL170962C (nl) * | 1971-04-06 | 1983-01-17 | Montedison Spa | Werkwijze om katalysatoren te bereiden om alkenen te polymeriseren. |
| BE791676A (fr) * | 1971-12-08 | 1973-05-21 | Solvay | Procédé pour la polymérisation des oléfines |
| US3819599A (en) * | 1972-05-31 | 1974-06-25 | Standard Oil Co | Catalyst and process for the polymerization of ethylene and terminal olefins |
-
1972
- 1972-06-22 LU LU65587A patent/LU65587A1/xx unknown
-
1973
- 1973-04-19 CH CH569273A patent/CH563414A5/xx not_active IP Right Cessation
- 1973-04-20 IT IT23350/73A patent/IT982819B/it active
- 1973-05-05 ES ES414456A patent/ES414456A1/es not_active Expired
- 1973-05-07 BG BG023521A patent/BG26813A3/xx unknown
- 1973-05-15 ZA ZA733283A patent/ZA733283B/xx unknown
- 1973-05-16 DE DE2324766A patent/DE2324766C2/de not_active Expired
- 1973-05-17 RO RO7300074815A patent/RO63666A/ro unknown
- 1973-05-17 TR TR17453A patent/TR17453A/xx unknown
- 1973-05-18 AR AR248100A patent/AR194550A1/es active
- 1973-05-18 AU AU55883/73A patent/AU464025B2/en not_active Expired
- 1973-05-22 NL NL737307127A patent/NL150464B/xx unknown
- 1973-05-24 BE BE131474A patent/BE799977A/xx not_active IP Right Cessation
- 1973-05-25 IN IN1227/CAL/73A patent/IN138686B/en unknown
- 1973-05-29 YU YU1413/73A patent/YU35216B/xx unknown
- 1973-06-01 FR FR7320131A patent/FR2189429B1/fr not_active Expired
- 1973-06-11 JP JP48066243A patent/JPS5137195B2/ja not_active Expired
- 1973-06-12 CA CA173,821A patent/CA1017497A/en not_active Expired
- 1973-06-19 BR BR4545/73A patent/BR7304545D0/pt unknown
- 1973-06-19 DD DD171664A patent/DD106189A5/xx unknown
- 1973-06-20 SE SE7308728A patent/SE411551B/xx unknown
- 1973-06-20 FI FI1987/73A patent/FI58928C/fi active
- 1973-06-20 PL PL1973163480A patent/PL94153B1/pl unknown
- 1973-06-21 GB GB2953073A patent/GB1401708A/en not_active Expired
- 1973-06-21 NO NO2576/73A patent/NO142350C/no unknown
- 1973-06-21 SU SU1932090A patent/SU474993A3/ru active
- 1973-06-21 DK DK344273A patent/DK150148C/da not_active IP Right Cessation
- 1973-06-21 HU HUSO1089A patent/HU166153B/hu unknown
- 1973-06-22 CS CS734511A patent/CS188166B2/cs unknown
- 1973-06-22 AT AT550573A patent/AT327545B/de not_active IP Right Cessation
-
1980
- 1980-10-08 US US06/195,093 patent/US4296223A/en not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI58928C (fi) | Foerfarande och katalysatorsystem foer laogtryckspolymerisering av eten enbart eller tillsammans med en alfa-olefin med 3-6 kolatomer | |
| US4617360A (en) | Process for the polymerization of α-olefins | |
| FI61494B (fi) | Foerfarande foer polymerisation av eten allena eller tillsammans med en annan alfa-olefin vid foerfarandet anvaendbart katalysatorkomplex och dess framstaellning | |
| US3676415A (en) | Process for polymerizing {60 -olefins | |
| KR0142906B1 (ko) | 올레핀 중합용의 지지된 바나듐 촉매, 그의 제조방법 및 그의 사용방법 | |
| DK144274B (da) | Fremgangsmaade til polymerisation eller copolymerisation af alfa-olefiner samt fast katalytisk kompleks til brug ved fremgangsmaaden | |
| EP0036660A1 (en) | Method for producing an olefin polymerization catalyst, catalyst and polymerization process | |
| SU424360A3 (ru) | Способ получения полиолефинов | |
| SI8811759A8 (en) | Process for polymerization of alpha-olefines | |
| KR950007986B1 (ko) | 에틸렌 및 α-올레핀의 (공)중합을 위한 고체 성분의 촉매 | |
| US4292200A (en) | Catalyst composition for polymerization of olefins | |
| EP0104374B1 (en) | Polymerization of olefins | |
| JPS59138206A (ja) | オレフィン重合用触媒成分の製造方法 | |
| US5334568A (en) | Catalytic solid for use in the polymerization of alpha-olefines, process for preparing it and process for the polymerization of alpha-olefines in the presence of a catalyst system containing this solid | |
| JPS6126604A (ja) | ポリオレフインの重合方法及び重合触媒の製造方法 | |
| US4192772A (en) | Solid catalyst and process for the preparation thereof | |
| EP0137971A1 (en) | Polyolefin polymerization process and catalyst | |
| JPH0160044B2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| PL86649B1 (en) | Catalyst compositions and their use in polymerising olefins[gb1433537a] | |
| US4008177A (en) | Process for the manufacture of a catalyst | |
| US4008176A (en) | Process for the manufacture of a catalyst | |
| US4313850A (en) | Catalyst for the polymerization of alpha-olefins | |
| FI57766B (fi) | Foerfarande foer homopolymerisering och sampolymerisering av etylen samt vid foerfarande anvaend katalysator | |
| JPH01213314A (ja) | α−オレフィンの重合法、この重合に使用し得る固体触媒錯体およびその調製法 | |
| US4529715A (en) | Catalyst prepared from organomagnesium compound, carbon dioxide, reducing aluminum source, transition metal compound and zinc compound |