FI56852C - Foerfarande foer framstaellning av jaernoxid- och jaernoxidhydratpigment samt titandioxidkoncentrat - Google Patents
Foerfarande foer framstaellning av jaernoxid- och jaernoxidhydratpigment samt titandioxidkoncentrat Download PDFInfo
- Publication number
- FI56852C FI56852C FI1647/71A FI164771A FI56852C FI 56852 C FI56852 C FI 56852C FI 1647/71 A FI1647/71 A FI 1647/71A FI 164771 A FI164771 A FI 164771A FI 56852 C FI56852 C FI 56852C
- Authority
- FI
- Finland
- Prior art keywords
- iron
- pigment
- suspension
- hours
- preparation
- Prior art date
Links
- 101100148710 Clarkia breweri SAMT gene Proteins 0.000 title 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 113
- 229910052742 iron Inorganic materials 0.000 claims description 50
- 239000000049 pigment Substances 0.000 claims description 48
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 23
- 238000000034 method Methods 0.000 claims description 20
- YDZQQRWRVYGNER-UHFFFAOYSA-N iron;titanium;trihydrate Chemical compound O.O.O.[Ti].[Fe] YDZQQRWRVYGNER-UHFFFAOYSA-N 0.000 claims description 19
- 238000002360 preparation method Methods 0.000 claims description 18
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 claims description 17
- 239000004408 titanium dioxide Substances 0.000 claims description 11
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical class [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 claims description 10
- 238000003756 stirring Methods 0.000 claims description 10
- 239000012141 concentrate Substances 0.000 claims description 5
- 239000012266 salt solution Substances 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- NDLPOXTZKUMGOV-UHFFFAOYSA-N oxo(oxoferriooxy)iron hydrate Chemical compound O.O=[Fe]O[Fe]=O NDLPOXTZKUMGOV-UHFFFAOYSA-N 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 230000002378 acidificating effect Effects 0.000 claims description 3
- 239000007789 gas Substances 0.000 claims description 3
- 239000000725 suspension Substances 0.000 description 32
- 239000013078 crystal Substances 0.000 description 14
- 238000002474 experimental method Methods 0.000 description 12
- 239000001052 yellow pigment Substances 0.000 description 11
- 210000001161 mammalian embryo Anatomy 0.000 description 9
- 239000002245 particle Substances 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 229910006540 α-FeOOH Inorganic materials 0.000 description 9
- 239000000843 powder Substances 0.000 description 7
- 235000013980 iron oxide Nutrition 0.000 description 6
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 6
- 238000002156 mixing Methods 0.000 description 6
- 239000001054 red pigment Substances 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 229910002588 FeOOH Inorganic materials 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 210000002257 embryonic structure Anatomy 0.000 description 4
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000007792 addition Methods 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000011790 ferrous sulphate Substances 0.000 description 3
- 235000003891 ferrous sulphate Nutrition 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 150000002505 iron Chemical class 0.000 description 3
- NIFIFKQPDTWWGU-UHFFFAOYSA-N pyrite Chemical compound [Fe+2].[S-][S-] NIFIFKQPDTWWGU-UHFFFAOYSA-N 0.000 description 3
- 229910052683 pyrite Inorganic materials 0.000 description 3
- 239000011028 pyrite Substances 0.000 description 3
- 239000012429 reaction media Substances 0.000 description 3
- 239000002699 waste material Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- -1 hydrogen ions Chemical class 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 150000002506 iron compounds Chemical class 0.000 description 2
- 239000001034 iron oxide pigment Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- SOQBVABWOPYFQZ-UHFFFAOYSA-N oxygen(2-);titanium(4+) Chemical group [O-2].[O-2].[Ti+4] SOQBVABWOPYFQZ-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 229910006299 γ-FeOOH Inorganic materials 0.000 description 2
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 1
- 239000005569 Iron sulphate Substances 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229910010413 TiO 2 Inorganic materials 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 230000005294 ferromagnetic effect Effects 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- FBAFATDZDUQKNH-UHFFFAOYSA-M iron chloride Chemical compound [Cl-].[Fe] FBAFATDZDUQKNH-UHFFFAOYSA-M 0.000 description 1
- 229910000358 iron sulfate Inorganic materials 0.000 description 1
- VBMVTYDPPZVILR-UHFFFAOYSA-N iron(2+);oxygen(2-) Chemical class [O-2].[Fe+2] VBMVTYDPPZVILR-UHFFFAOYSA-N 0.000 description 1
- UBUHAZKODAUXCP-UHFFFAOYSA-N iron(2+);oxygen(2-);hydrate Chemical class O.[O-2].[Fe+2] UBUHAZKODAUXCP-UHFFFAOYSA-N 0.000 description 1
- RUTXIHLAWFEWGM-UHFFFAOYSA-H iron(3+) sulfate Chemical compound [Fe+3].[Fe+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O RUTXIHLAWFEWGM-UHFFFAOYSA-H 0.000 description 1
- 229910000360 iron(III) sulfate Inorganic materials 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 238000001139 pH measurement Methods 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229910000859 α-Fe Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01G—COMPOUNDS CONTAINING METALS NOT COVERED BY SUBCLASSES C01D OR C01F
- C01G49/00—Compounds of iron
- C01G49/02—Oxides; Hydroxides
- C01G49/06—Ferric oxide [Fe2O3]
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01P—INDEXING SCHEME RELATING TO STRUCTURAL AND PHYSICAL ASPECTS OF SOLID INORGANIC COMPOUNDS
- C01P2004/00—Particle morphology
- C01P2004/60—Particles characterised by their size
- C01P2004/61—Micrometer sized, i.e. from 1-100 micrometer
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01P—INDEXING SCHEME RELATING TO STRUCTURAL AND PHYSICAL ASPECTS OF SOLID INORGANIC COMPOUNDS
- C01P2004/00—Particle morphology
- C01P2004/60—Particles characterised by their size
- C01P2004/62—Submicrometer sized, i.e. from 0.1-1 micrometer
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Compounds Of Iron (AREA)
- Inorganic Compounds Of Heavy Metals (AREA)
- Pigments, Carbon Blacks, Or Wood Stains (AREA)
- Paints Or Removers (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2029300A DE2029300C3 (de) | 1970-06-13 | 1970-06-13 | Verfahren zur Herstellung von Eisenoxid- und Eisenoxidhydratpigmenten |
| DE2029300 | 1970-06-13 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI56852B FI56852B (fi) | 1979-12-31 |
| FI56852C true FI56852C (fi) | 1980-04-10 |
Family
ID=5773922
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI1647/71A FI56852C (fi) | 1970-06-13 | 1971-06-11 | Foerfarande foer framstaellning av jaernoxid- och jaernoxidhydratpigment samt titandioxidkoncentrat |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3755554A (enExample) |
| JP (1) | JPS5146080B1 (enExample) |
| BE (1) | BE768404A (enExample) |
| CA (1) | CA950156A (enExample) |
| DE (1) | DE2029300C3 (enExample) |
| ES (1) | ES392168A1 (enExample) |
| FI (1) | FI56852C (enExample) |
| FR (1) | FR2096266A5 (enExample) |
| GB (1) | GB1356846A (enExample) |
| NL (1) | NL7107788A (enExample) |
| NO (1) | NO131890C (enExample) |
| ZA (1) | ZA713369B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3888575A (en) * | 1971-05-14 | 1975-06-10 | Mitsui Shipbuilding Eng | Prefabrication primer for high tensile steel |
| DE2249274A1 (de) * | 1972-10-07 | 1974-04-18 | Bayer Ag | Herstellung von gefaelltem rotem eisen(iii)-oxid |
| IT1008298B (it) * | 1974-02-25 | 1976-11-10 | Montedison Spa | Metodo per ottenere magnetite a granulometria controllata a partire da soluzioni di solfato ferroso |
| IT1008297B (it) * | 1974-02-25 | 1976-11-10 | Montedison Spa | Procedimento per ottenere magnetite a partire da soluzioni di solfato ferroso |
| JPS5110198A (enExample) * | 1974-07-15 | 1976-01-27 | Toda Kogyo Corp | |
| DE2617569A1 (de) * | 1976-04-22 | 1977-11-03 | Bayer Ag | Herstellung von eisenoxidschwarzpigmenten durch oxydation von metallischem eisen mit sauerstoff-haltigen gasen |
| IT1078361B (it) * | 1977-01-11 | 1985-05-08 | Euteco Spa | Procedimento per la preparazione di ossido di ferro pigmentario giallo |
| IT1074667B (it) * | 1977-01-11 | 1985-04-20 | Euteco Spa | Procedimento per la preparazione di ossido di ferro pigmentario rosso |
| US4432803A (en) * | 1977-05-24 | 1984-02-21 | Bethlehem Steel Corporation | Iron oxide paint pigment precursor |
| JPS53164681U (enExample) * | 1977-06-01 | 1978-12-23 | ||
| NL7906213A (nl) * | 1978-10-04 | 1980-04-09 | Thann & Mulhouse | Rood ijzeroxydepigment en werkwijze voor de bereiding van ijzeroxyde van pigmentkwaliteit uitgaande van afval ijzer (ii) sulfaat. |
| DE3022875A1 (de) * | 1980-06-19 | 1982-01-14 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von eisenoxidpigmenten mit verbesserter reinheit sowie deren verwendung |
| DE19607454C2 (de) * | 1996-02-28 | 1998-04-09 | Bayer Ag | Verwendung von synthetischen, bainitreichen Eisenrohstoffen zur Herstellung von Eisenoxidpigmenten |
| DE19607456A1 (de) * | 1996-02-28 | 1997-09-04 | Bayer Ag | Verwendung von synthetischen Eisenrohstoffen zur Herstellung von Eisenoxidpigmenten |
| RU2131444C1 (ru) * | 1996-09-04 | 1999-06-10 | Акционерное общество "Богословский алюминиевый завод" | Способ производства железоокисных пигментов |
-
1970
- 1970-06-13 DE DE2029300A patent/DE2029300C3/de not_active Expired
-
1971
- 1971-05-25 ZA ZA713369A patent/ZA713369B/xx unknown
- 1971-05-25 US US00146787A patent/US3755554A/en not_active Expired - Lifetime
- 1971-06-03 GB GB1878571*[A patent/GB1356846A/en not_active Expired
- 1971-06-07 NL NL7107788A patent/NL7107788A/xx unknown
- 1971-06-09 NO NO2187/71A patent/NO131890C/no unknown
- 1971-06-10 CA CA115,300,A patent/CA950156A/en not_active Expired
- 1971-06-11 FR FR7121363A patent/FR2096266A5/fr not_active Expired
- 1971-06-11 BE BE768404A patent/BE768404A/xx not_active IP Right Cessation
- 1971-06-11 FI FI1647/71A patent/FI56852C/fi active
- 1971-06-12 JP JP46041440A patent/JPS5146080B1/ja active Pending
- 1971-06-12 ES ES392168A patent/ES392168A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA950156A (en) | 1974-07-02 |
| FR2096266A5 (enExample) | 1972-02-11 |
| NO131890C (enExample) | 1975-08-20 |
| DE2029300C3 (de) | 1979-04-12 |
| NO131890B (enExample) | 1975-05-12 |
| US3755554A (en) | 1973-08-28 |
| DE2029300A1 (de) | 1971-12-23 |
| GB1356846A (en) | 1974-06-19 |
| ZA713369B (en) | 1972-01-26 |
| NL7107788A (enExample) | 1971-12-15 |
| DE2029300B2 (de) | 1978-08-10 |
| FI56852B (fi) | 1979-12-31 |
| JPS5146080B1 (enExample) | 1976-12-07 |
| ES392168A1 (es) | 1974-02-16 |
| BE768404A (fr) | 1971-12-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI56852C (fi) | Foerfarande foer framstaellning av jaernoxid- och jaernoxidhydratpigment samt titandioxidkoncentrat | |
| US9428402B2 (en) | Method for producing finely divided haematite and for producing iron oxide red pigments | |
| CN100475708C (zh) | 氧化铁的制备方法 | |
| JP5619257B2 (ja) | 黄酸化鉄顔料 | |
| US6689206B2 (en) | Process for producing yellow iron oxide pigments | |
| JPH0647470B2 (ja) | 鉄をベ−スとする黒色顔料の製造方法 | |
| US6800260B2 (en) | Processes for treating iron-containing waste streams | |
| CA1053876A (en) | Method and means of growing coarse gypsum and magnetite | |
| CA2421245A1 (en) | Method for producing an iron oxide nucleus containing aluminium | |
| US4137293A (en) | Producing gypsum and magnetite from ferrous sulfate and separating | |
| CN106082354A (zh) | 一种分离四氧化三铁和石膏混合产物的方法 | |
| US4208393A (en) | Purification process | |
| GB2194941A (en) | Process for recovering vanadium values | |
| CA1331675C (en) | Oxidation resistant, heat resistant iron oxide black pigments, a process for their preparation and their use | |
| JPH101315A (ja) | 高純度酸化鉄粉末の製造方法 | |
| JPH06183749A (ja) | 酸化鉄の精製方法 | |
| CS232711B2 (en) | Parting method of ferrous,clayey and manganous impurities from magnesium chloride solution in hydrogen chloride | |
| JP2008285366A (ja) | 塩化鉄溶液および酸化鉄の製造方法 | |
| KR100386380B1 (ko) | 산화제1동의 제조방법 | |
| SU763411A1 (ru) | Способ получени желтого железоокисного пигмента | |
| FI78278C (fi) | Foerfarande foer framstaellning av vanadiumpentoxid. | |
| SU1518400A1 (ru) | Способ переработки марганцевого сырь | |
| SU842026A1 (ru) | Способ получени двуокиси титанаиз жЕлЕзОТиТАНОВОгО СыРь | |
| RU2172358C2 (ru) | Способ переработки марганецсодержащих материалов | |
| RU2209820C2 (ru) | Способ получения железооксидных пигментов |