FI101963B - Menetelmä raseemisen ja optisesti aktiivisen 1,2,3,4-tetrahydroisokino liini-3-karboksyylihapon sekä sen esituotteiden valmistamiseksi - Google Patents
Menetelmä raseemisen ja optisesti aktiivisen 1,2,3,4-tetrahydroisokino liini-3-karboksyylihapon sekä sen esituotteiden valmistamiseksi Download PDFInfo
- Publication number
- FI101963B FI101963B FI920269A FI920269A FI101963B FI 101963 B FI101963 B FI 101963B FI 920269 A FI920269 A FI 920269A FI 920269 A FI920269 A FI 920269A FI 101963 B FI101963 B FI 101963B
- Authority
- FI
- Finland
- Prior art keywords
- formula
- compounds
- compound
- formulas
- acid
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 26
- 238000002360 preparation method Methods 0.000 title claims description 9
- BWKMGYQJPOAASG-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid Chemical compound C1=CC=C2CNC(C(=O)O)CC2=C1 BWKMGYQJPOAASG-UHFFFAOYSA-N 0.000 title description 7
- 239000002243 precursor Substances 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 116
- 239000002253 acid Substances 0.000 claims description 20
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 20
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 claims description 18
- NOOLISFMXDJSKH-KXUCPTDWSA-N (-)-Menthol Chemical compound CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O NOOLISFMXDJSKH-KXUCPTDWSA-N 0.000 claims description 16
- 150000002148 esters Chemical class 0.000 claims description 15
- IWYDHOAUDWTVEP-SSDOTTSWSA-N (R)-mandelic acid Chemical compound OC(=O)[C@H](O)C1=CC=CC=C1 IWYDHOAUDWTVEP-SSDOTTSWSA-N 0.000 claims description 11
- IWYDHOAUDWTVEP-UHFFFAOYSA-N mandelic acid Chemical compound OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 claims description 11
- 230000003287 optical effect Effects 0.000 claims description 10
- NOOLISFMXDJSKH-UHFFFAOYSA-N DL-menthol Natural products CC(C)C1CCC(C)CC1O NOOLISFMXDJSKH-UHFFFAOYSA-N 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 239000003153 chemical reaction reagent Substances 0.000 claims description 7
- 229960004873 levomenthol Drugs 0.000 claims description 7
- 235000019445 benzyl alcohol Nutrition 0.000 claims description 6
- 238000001640 fractional crystallisation Methods 0.000 claims description 6
- 238000007127 saponification reaction Methods 0.000 claims description 6
- 239000012442 inert solvent Substances 0.000 claims description 5
- 230000002378 acidificating effect Effects 0.000 claims description 2
- INRNDFZVAKDYFY-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoline-3-carboxylic acid Chemical class C1=CC=C2CC(C(=O)O)CNC2=C1 INRNDFZVAKDYFY-UHFFFAOYSA-N 0.000 claims 1
- 230000029142 excretion Effects 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 96
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 51
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 35
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 30
- 239000000243 solution Substances 0.000 description 26
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 239000000203 mixture Substances 0.000 description 20
- 238000003756 stirring Methods 0.000 description 19
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 15
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 12
- 238000005160 1H NMR spectroscopy Methods 0.000 description 11
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 11
- 239000012074 organic phase Substances 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 238000009835 boiling Methods 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 9
- 239000008346 aqueous phase Substances 0.000 description 9
- 239000012071 phase Substances 0.000 description 9
- 150000003839 salts Chemical class 0.000 description 9
- 239000007832 Na2SO4 Substances 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 8
- 229910052938 sodium sulfate Inorganic materials 0.000 description 8
- 235000011152 sodium sulphate Nutrition 0.000 description 8
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N DMSO Substances CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 7
- -1 for example Chemical class 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- 238000007363 ring formation reaction Methods 0.000 description 7
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 238000001212 derivatisation Methods 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 238000004128 high performance liquid chromatography Methods 0.000 description 6
- 239000012452 mother liquor Substances 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 239000002002 slurry Substances 0.000 description 6
- 239000002585 base Substances 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 229960005190 phenylalanine Drugs 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 238000000926 separation method Methods 0.000 description 5
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- BWKMGYQJPOAASG-SECBINFHSA-N D-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid Chemical compound C1=CC=C2CN[C@@H](C(=O)O)CC2=C1 BWKMGYQJPOAASG-SECBINFHSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 4
- 230000000711 cancerogenic effect Effects 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 3
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- CAKWIRNQEKMHOR-MRXNPFEDSA-N benzyl (3r)-1,2,3,4-tetrahydroisoquinoline-3-carboxylate Chemical compound O=C([C@@H]1NCC2=CC=CC=C2C1)OCC1=CC=CC=C1 CAKWIRNQEKMHOR-MRXNPFEDSA-N 0.000 description 3
- CAKWIRNQEKMHOR-INIZCTEOSA-N benzyl (3s)-1,2,3,4-tetrahydroisoquinoline-3-carboxylate Chemical compound O=C([C@H]1NCC2=CC=CC=C2C1)OCC1=CC=CC=C1 CAKWIRNQEKMHOR-INIZCTEOSA-N 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 244000309464 bull Species 0.000 description 3
- 231100000315 carcinogenic Toxicity 0.000 description 3
- 229940125890 compound Ia Drugs 0.000 description 3
- HKYGSMOFSFOEIP-UHFFFAOYSA-N dichloro(dichloromethoxy)methane Chemical compound ClC(Cl)OC(Cl)Cl HKYGSMOFSFOEIP-UHFFFAOYSA-N 0.000 description 3
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 3
- 229960002510 mandelic acid Drugs 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 2
- FUVZDXDCPRQZSQ-UHFFFAOYSA-N 1,5,6,7-tetrahydroindazol-4-one Chemical compound O=C1CCCC2=C1C=NN2 FUVZDXDCPRQZSQ-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 238000006418 Brown reaction Methods 0.000 description 2
- 229920000858 Cyclodextrin Polymers 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 238000006929 Pictet-Spengler synthesis reaction Methods 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000006114 decarboxylation reaction Methods 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- 150000005690 diesters Chemical class 0.000 description 2
- ISOLMABRZPQKOV-UHFFFAOYSA-N diethyl 2-acetamidopropanedioate Chemical compound CCOC(=O)C(NC(C)=O)C(=O)OCC ISOLMABRZPQKOV-UHFFFAOYSA-N 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 229940041616 menthol Drugs 0.000 description 2
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 2
- FEMOMIGRRWSMCU-UHFFFAOYSA-N ninhydrin Chemical compound C1=CC=C2C(=O)C(O)(O)C(=O)C2=C1 FEMOMIGRRWSMCU-UHFFFAOYSA-N 0.000 description 2
- 238000005580 one pot reaction Methods 0.000 description 2
- 230000006340 racemization Effects 0.000 description 2
- 229910052703 rhodium Inorganic materials 0.000 description 2
- 239000010948 rhodium Substances 0.000 description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 2
- HFHDHCJBZVLPGP-UHFFFAOYSA-N schardinger α-dextrin Chemical compound O1C(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(O)C2O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC2C(O)C(O)C1OC2CO HFHDHCJBZVLPGP-UHFFFAOYSA-N 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- 238000010186 staining Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- OXFGRWIKQDSSLY-VIFPVBQESA-N (1s)-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid Chemical class C1=CC=C2[C@@H](C(=O)O)NCCC2=C1 OXFGRWIKQDSSLY-VIFPVBQESA-N 0.000 description 1
- BWKMGYQJPOAASG-VIFPVBQESA-N (3s)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid Chemical compound C1=CC=C2CN[C@H](C(=O)O)CC2=C1 BWKMGYQJPOAASG-VIFPVBQESA-N 0.000 description 1
- MRMHRZLMIMLWJN-UQQIVXHISA-N (5-methyl-2-propan-2-ylcyclohexyl) (3R)-1,2,3,4-tetrahydroisoquinoline-3-carboxylate Chemical compound C1N[C@H](CC2=CC=CC=C12)C(=O)OC1CC(CCC1C(C)C)C MRMHRZLMIMLWJN-UQQIVXHISA-N 0.000 description 1
- MRMHRZLMIMLWJN-HFJRUHRISA-N (5-methyl-2-propan-2-ylcyclohexyl) (3S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylate Chemical compound C1N[C@@H](CC2=CC=CC=C12)C(=O)OC1CC(CCC1C(C)C)C MRMHRZLMIMLWJN-HFJRUHRISA-N 0.000 description 1
- KGKAYWMGPDWLQZ-UHFFFAOYSA-N 1,2-bis(bromomethyl)benzene Chemical group BrCC1=CC=CC=C1CBr KGKAYWMGPDWLQZ-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 239000005541 ACE inhibitor Substances 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical compound NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241000699800 Cricetinae Species 0.000 description 1
- 238000003109 Karl Fischer titration Methods 0.000 description 1
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical class [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 238000007171 acid catalysis Methods 0.000 description 1
- 235000004279 alanine Nutrition 0.000 description 1
- 125000005233 alkylalcohol group Chemical group 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 150000001371 alpha-amino acids Chemical class 0.000 description 1
- 235000008206 alpha-amino acids Nutrition 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 229940044094 angiotensin-converting-enzyme inhibitor Drugs 0.000 description 1
- 230000002051 biphasic effect Effects 0.000 description 1
- 239000003152 bradykinin antagonist Substances 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000004581 coalescence Methods 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- WZHCOOQXZCIUNC-UHFFFAOYSA-N cyclandelate Chemical class C1C(C)(C)CC(C)CC1OC(=O)C(O)C1=CC=CC=C1 WZHCOOQXZCIUNC-UHFFFAOYSA-N 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- MJEMIOXXNCZZFK-UHFFFAOYSA-N ethylone Chemical compound CCNC(C)C(=O)C1=CC=C2OCOC2=C1 MJEMIOXXNCZZFK-UHFFFAOYSA-N 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- CRGZYKWWYNQGEC-UHFFFAOYSA-N magnesium;methanolate Chemical compound [Mg+2].[O-]C.[O-]C CRGZYKWWYNQGEC-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-M mandelate Chemical compound [O-]C(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-M 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N methyl acetate Chemical group COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- LBOHISOWGKIIKX-UHFFFAOYSA-M potassium;2-methylpropanoate Chemical compound [K+].CC(C)C([O-])=O LBOHISOWGKIIKX-UHFFFAOYSA-M 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 125000006839 xylylene group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/22—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the nitrogen-containing ring
- C07D217/26—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4102017 | 1991-01-24 | ||
| DE4102017 | 1991-01-24 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI920269A0 FI920269A0 (fi) | 1992-01-22 |
| FI920269A7 FI920269A7 (fi) | 1992-07-25 |
| FI101963B1 FI101963B1 (fi) | 1998-09-30 |
| FI101963B true FI101963B (fi) | 1998-09-30 |
Family
ID=6423604
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI920269A FI101963B (fi) | 1991-01-24 | 1992-01-22 | Menetelmä raseemisen ja optisesti aktiivisen 1,2,3,4-tetrahydroisokino liini-3-karboksyylihapon sekä sen esituotteiden valmistamiseksi |
Country Status (18)
| Country | Link |
|---|---|
| US (2) | US5252738A (Sortimente) |
| EP (1) | EP0496369B1 (Sortimente) |
| JP (1) | JP3187905B2 (Sortimente) |
| KR (1) | KR100225829B1 (Sortimente) |
| AR (1) | AR247554A1 (Sortimente) |
| AT (1) | ATE136299T1 (Sortimente) |
| AU (1) | AU645654B2 (Sortimente) |
| CA (1) | CA2059908C (Sortimente) |
| DE (1) | DE59205884D1 (Sortimente) |
| DK (1) | DK0496369T3 (Sortimente) |
| ES (1) | ES2085497T3 (Sortimente) |
| FI (1) | FI101963B (Sortimente) |
| GR (1) | GR3019556T3 (Sortimente) |
| HU (1) | HU213273B (Sortimente) |
| IE (1) | IE74136B1 (Sortimente) |
| MX (1) | MX9200288A (Sortimente) |
| NO (1) | NO178763C (Sortimente) |
| TW (1) | TW224454B (Sortimente) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TW224454B (Sortimente) * | 1991-01-24 | 1994-06-01 | Hoechst Ag | |
| GB2266529A (en) * | 1992-05-01 | 1993-11-03 | Merck Sharp & Dohme | Tetrahydroisoquinoline derivatives |
| WO1997017050A2 (en) * | 1995-11-09 | 1997-05-15 | Monsanto Company | An improved method for preparation of substituted tetrahydroisoquinolines |
| DE10320197A1 (de) * | 2002-12-20 | 2004-07-08 | Degussa Ag | Umhüllte Persauerstoffverbindungen mit kontrollierter Freisetzung, Verfahren zu ihrer Herstellung und ihrer Verwendung |
| FR3007751A1 (fr) | 2013-06-28 | 2015-01-02 | Solvay | Melanges de sels de sodium et de leur utilisation |
| CN111254180B (zh) * | 2018-11-30 | 2023-04-28 | 浙江大学 | 一种酶法拆分制备(s)-1,2,3,4-四氢异喹啉-3-甲酸的方法 |
| CN111254170B (zh) * | 2018-11-30 | 2023-04-28 | 浙江大学 | 一种多酶耦合制备(s)-1,2,3,4-四氢异喹啉-3-甲酸的方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5187290A (en) * | 1985-03-22 | 1993-02-16 | E. R. Squibb & Sons, Inc. | Acylaminoalkanoyl urethanes or thiourethanes |
| US4912221A (en) * | 1988-10-27 | 1990-03-27 | Occidental Chemical Corporation | Chiral 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid and precursors and preparation thereof |
| TW224454B (Sortimente) * | 1991-01-24 | 1994-06-01 | Hoechst Ag | |
| US5236934A (en) * | 1992-08-26 | 1993-08-17 | E. I. Du Pont De Nemours And Company | 1,2,3,4-tetrahydroisoquinolines useful in the treatment of CNS disorders |
-
1991
- 1991-08-13 TW TW080106363A patent/TW224454B/zh not_active IP Right Cessation
-
1992
- 1992-01-21 US US07/822,930 patent/US5252738A/en not_active Expired - Lifetime
- 1992-01-22 ES ES92100996T patent/ES2085497T3/es not_active Expired - Lifetime
- 1992-01-22 DK DK92100996.5T patent/DK0496369T3/da active
- 1992-01-22 FI FI920269A patent/FI101963B/fi active
- 1992-01-22 DE DE59205884T patent/DE59205884D1/de not_active Expired - Lifetime
- 1992-01-22 AT AT92100996T patent/ATE136299T1/de not_active IP Right Cessation
- 1992-01-22 AR AR92321665A patent/AR247554A1/es active
- 1992-01-22 EP EP92100996A patent/EP0496369B1/de not_active Expired - Lifetime
- 1992-01-23 MX MX9200288A patent/MX9200288A/es unknown
- 1992-01-23 JP JP00982592A patent/JP3187905B2/ja not_active Expired - Lifetime
- 1992-01-23 KR KR1019920000894A patent/KR100225829B1/ko not_active Expired - Lifetime
- 1992-01-23 IE IE920207A patent/IE74136B1/en not_active IP Right Cessation
- 1992-01-23 NO NO920313A patent/NO178763C/no not_active IP Right Cessation
- 1992-01-23 CA CA002059908A patent/CA2059908C/en not_active Expired - Lifetime
- 1992-01-23 AU AU10394/92A patent/AU645654B2/en not_active Expired
- 1992-01-24 HU HU9200231A patent/HU213273B/hu unknown
-
1993
- 1993-06-15 US US08/076,772 patent/US5359074A/en not_active Expired - Lifetime
-
1996
- 1996-04-04 GR GR960400851T patent/GR3019556T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI101963B1 (fi) | 1998-09-30 |
| DK0496369T3 (da) | 1996-07-29 |
| IE920207A1 (en) | 1992-07-29 |
| HU213273B (en) | 1997-04-28 |
| ES2085497T3 (es) | 1996-06-01 |
| AR247554A1 (es) | 1995-01-31 |
| HUT63835A (en) | 1993-10-28 |
| JP3187905B2 (ja) | 2001-07-16 |
| MX9200288A (es) | 1992-07-01 |
| IE74136B1 (en) | 1997-07-02 |
| KR100225829B1 (ko) | 1999-10-15 |
| FI920269A7 (fi) | 1992-07-25 |
| CA2059908C (en) | 2002-09-10 |
| JPH04334370A (ja) | 1992-11-20 |
| NO178763C (no) | 1996-05-29 |
| AU1039492A (en) | 1992-07-30 |
| NO920313L (no) | 1992-07-27 |
| EP0496369A1 (de) | 1992-07-29 |
| FI920269A0 (fi) | 1992-01-22 |
| US5359074A (en) | 1994-10-25 |
| NO920313D0 (no) | 1992-01-23 |
| DE59205884D1 (de) | 1996-05-09 |
| NO178763B (no) | 1996-02-19 |
| CA2059908A1 (en) | 1992-07-25 |
| ATE136299T1 (de) | 1996-04-15 |
| HU9200231D0 (en) | 1992-04-28 |
| TW224454B (Sortimente) | 1994-06-01 |
| EP0496369B1 (de) | 1996-04-03 |
| AU645654B2 (en) | 1994-01-20 |
| US5252738A (en) | 1993-10-12 |
| GR3019556T3 (en) | 1996-07-31 |
| KR920014782A (ko) | 1992-08-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH04352757A (ja) | アミノ酸誘導体 | |
| JP2006516121A5 (Sortimente) | ||
| JP2003531197A (ja) | 2,5−ジケトピペラジンの製造方法、2,5−ジケトピペラジン、ジペプチド及びその使用 | |
| NL7908510A (nl) | Bereidingswijze van threo-3-amino-2-hydroxybutanoyl- aminoazijnzuren, nieuwe uitgangsverbindingen daarvoor en bereidingswijze daarvan. | |
| EP0045161B1 (en) | Amides of 4-oxo-5-amidohexanoic acid derivatives | |
| JPH0471920B2 (Sortimente) | ||
| EP2590943B1 (en) | Process and intermediates for preparation of an active ingredient | |
| FI101963B (fi) | Menetelmä raseemisen ja optisesti aktiivisen 1,2,3,4-tetrahydroisokino liini-3-karboksyylihapon sekä sen esituotteiden valmistamiseksi | |
| EP1333026B1 (en) | Process for the preparation of high purity perindopril and intermediates useful in the synthesis | |
| CA1338572C (en) | Amino acid esters, process for the preparation thereof and use thereof | |
| DK172032B1 (da) | (S)-enantiomere glutaramidderivater og disse forbindelser til anvendelse som lægemidler samt farmaceutiske præparater indeholdende disse forbindelser og (S)-enantiomere glutarsyrederivater, der er anvendelige som mellemprodukter ved fremstilling af disse forbindelser | |
| JP2003523343A (ja) | アミノ酸化合物、ならびにnep、aceおよびece阻害剤としてのその使用 | |
| WO1996030354A1 (en) | Epoxysuccinic acid derivatives | |
| EP0053017A1 (en) | Amide derivatives | |
| KR19990087485A (ko) | 엔도텔린 전환 효소 억제제로서 레트로아미드 결합을 가진 황유도체 | |
| HU228360B1 (en) | Enzymatic process for the preparation of substituted 2-amino-3-(2-amino-phenylsulfanyl)-propionic acid | |
| AU724816B2 (en) | Process for the preparation of chiral, nonracemic(4-aryl-2,5-dioxoimidazolidin-1-yl)acetic acids | |
| RU2298004C2 (ru) | Получение гидрохлорида хинаприла | |
| US20070037845A1 (en) | Peptido-mimetic compounds containing rgd sequence useful as integrin inhibitors, and intermediates thereof | |
| KR100310592B1 (ko) | (s)-1-(2(s)-(1,3-디히드로-1,3-디옥소-이소인도-2-일)-1-옥소-3-페닐프로필)-1,2,3,4-테트라히드로-2-피리딘-카르복실산메틸에스테르및그의중간체의신규제조방법 | |
| US6777550B1 (en) | N-formyl hydroxylamine containing compounds useful as ACE inhibitors and/or NEP inhibitors | |
| EP0225311A2 (fr) | Dérivés d'acide amino-4 butanoîque, leur procédé de préparation et leur utilisation | |
| JPH0920753A (ja) | N−置換4−ケトプロリン−誘導体の製造法及びこの方法で得られる新規誘導体 | |
| CZ568590A3 (cs) | Deriváty kyseliny glutarové, způsob jejich přípravy a meziprodukt tohoto postupu | |
| HUT69721A (en) | Synthesis of intermediates in the preparation of acat inhibitors |