ES2914284T3 - Derivados de piperidina como inhibidores de la proteasa específica de la ubiquitina 7 - Google Patents
Derivados de piperidina como inhibidores de la proteasa específica de la ubiquitina 7 Download PDFInfo
- Publication number
- ES2914284T3 ES2914284T3 ES17790829T ES17790829T ES2914284T3 ES 2914284 T3 ES2914284 T3 ES 2914284T3 ES 17790829 T ES17790829 T ES 17790829T ES 17790829 T ES17790829 T ES 17790829T ES 2914284 T3 ES2914284 T3 ES 2914284T3
- Authority
- ES
- Spain
- Prior art keywords
- methyl
- optionally substituted
- femlbutano
- drox
- mmol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 229940042399 direct acting antivirals protease inhibitors Drugs 0.000 title description 2
- 239000000137 peptide hydrolase inhibitor Substances 0.000 title description 2
- 150000003053 piperidines Chemical class 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 336
- -1 CH2NHC(O)OCH2CH3 Chemical group 0.000 claims abstract description 103
- 125000001072 heteroaryl group Chemical group 0.000 claims abstract description 40
- 125000001424 substituent group Chemical group 0.000 claims abstract description 37
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims abstract description 36
- 125000003118 aryl group Chemical group 0.000 claims abstract description 34
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims abstract description 29
- 150000003839 salts Chemical class 0.000 claims abstract description 23
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 21
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims abstract description 17
- 229910052731 fluorine Inorganic materials 0.000 claims abstract description 17
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims abstract description 16
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims abstract description 16
- 150000003973 alkyl amines Chemical class 0.000 claims abstract description 15
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims abstract description 14
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 13
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 13
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 12
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 12
- 125000004104 aryloxy group Chemical group 0.000 claims abstract description 11
- 125000004043 oxo group Chemical group O=* 0.000 claims abstract description 11
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 claims abstract description 10
- 229910052740 iodine Inorganic materials 0.000 claims abstract description 10
- 150000001408 amides Chemical class 0.000 claims abstract description 9
- JNCMHMUGTWEVOZ-UHFFFAOYSA-N F[CH]F Chemical compound F[CH]F JNCMHMUGTWEVOZ-UHFFFAOYSA-N 0.000 claims abstract description 7
- 108010081348 HRT1 protein Hairy Proteins 0.000 claims abstract description 7
- 102100021881 Hairy/enhancer-of-split related with YRPW motif protein 1 Human genes 0.000 claims abstract description 7
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims abstract description 7
- 150000001204 N-oxides Chemical class 0.000 claims abstract description 6
- 125000000524 functional group Chemical group 0.000 claims abstract description 6
- 125000000547 substituted alkyl group Chemical group 0.000 claims abstract description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 6
- 125000006549 C4-C10 aryl group Chemical group 0.000 claims abstract description 5
- 125000002877 alkyl aryl group Chemical group 0.000 claims abstract description 5
- 125000005213 alkyl heteroaryl group Chemical group 0.000 claims abstract description 5
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims abstract 2
- 239000000203 mixture Substances 0.000 claims description 181
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 91
- 206010028980 Neoplasm Diseases 0.000 claims description 28
- 201000011510 cancer Diseases 0.000 claims description 22
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 21
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 19
- 239000008194 pharmaceutical composition Substances 0.000 claims description 15
- 239000003795 chemical substances by application Substances 0.000 claims description 14
- 125000005843 halogen group Chemical group 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 12
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical group CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 claims description 11
- 238000011282 treatment Methods 0.000 claims description 11
- 208000002250 Hematologic Neoplasms Diseases 0.000 claims description 10
- 206010029260 Neuroblastoma Diseases 0.000 claims description 10
- 206010060862 Prostate cancer Diseases 0.000 claims description 10
- 208000000236 Prostatic Neoplasms Diseases 0.000 claims description 10
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 10
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 7
- BAVYZALUXZFZLV-UHFFFAOYSA-N mono-methylamine Natural products NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims description 6
- 239000003472 antidiabetic agent Substances 0.000 claims description 5
- 229940125708 antidiabetic agent Drugs 0.000 claims description 5
- 125000002971 oxazolyl group Chemical group 0.000 claims description 5
- 239000002246 antineoplastic agent Substances 0.000 claims description 4
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 claims description 4
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 4
- 125000001153 fluoro group Chemical group F* 0.000 claims description 4
- 125000001207 fluorophenyl group Chemical group 0.000 claims description 4
- 201000005787 hematologic cancer Diseases 0.000 claims description 4
- 208000024200 hematopoietic and lymphoid system neoplasm Diseases 0.000 claims description 4
- ONQBOTKLCMXPOF-UHFFFAOYSA-N 1-ethylpyrrolidine Chemical group CCN1CCCC1 ONQBOTKLCMXPOF-UHFFFAOYSA-N 0.000 claims description 3
- 239000003242 anti bacterial agent Substances 0.000 claims description 3
- 239000002260 anti-inflammatory agent Substances 0.000 claims description 3
- 229940121363 anti-inflammatory agent Drugs 0.000 claims description 3
- 239000003443 antiviral agent Substances 0.000 claims description 3
- 230000008482 dysregulation Effects 0.000 claims description 3
- 230000002519 immonomodulatory effect Effects 0.000 claims description 3
- 239000003018 immunosuppressive agent Substances 0.000 claims description 3
- 229940125721 immunosuppressive agent Drugs 0.000 claims description 3
- 230000000926 neurological effect Effects 0.000 claims description 3
- 238000001959 radiotherapy Methods 0.000 claims description 3
- 238000002560 therapeutic procedure Methods 0.000 claims description 3
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 2
- 125000006645 (C3-C4) cycloalkyl group Chemical group 0.000 claims description 2
- JOTSUKXEWYWHQQ-LSCLNCKRSA-N 6-(11-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-4-ylamino)-3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]pyrimidin-4-one Chemical compound C(=O)(N1CCC(CC1)(CN1C(=O)C=C(NC2=CC3=C(C=C2)C2CCC3N2)N=C1)O)C[C@H](C1=CC=CC=C1)C JOTSUKXEWYWHQQ-LSCLNCKRSA-N 0.000 claims description 2
- QEYOTKDZXAIFQC-LJQANCHMSA-N 6-(4-aminopiperidin-1-yl)-3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(cc2=O)N2CCC(N)CC2)CC1)c1ccccc1 QEYOTKDZXAIFQC-LJQANCHMSA-N 0.000 claims description 2
- KHOFXUMHKCDBAP-CTNGQTDRSA-N 6-[(3S)-3-aminopiperidin-1-yl]-3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(cc2=O)N2CCC[C@H](N)C2)CC1)c1ccccc1 KHOFXUMHKCDBAP-CTNGQTDRSA-N 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 2
- CUNQWGGNPNLAAD-GOSISDBHSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-(1-methylpyrazol-4-yl)pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(cc2=O)-c2cnn(C)c2)CC1)c1ccccc1 CUNQWGGNPNLAAD-GOSISDBHSA-N 0.000 claims 1
- TUPLDYIKGXBXBQ-OAQYLSRUSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-[1-(2-methylpropyl)pyrazol-4-yl]pyrimidin-4-one Chemical compound CC(C)Cn1cc(cn1)-c1cc(=O)n(CC2(O)CCN(CC2)C(=O)C[C@@H](C)c2ccccc2)cn1 TUPLDYIKGXBXBQ-OAQYLSRUSA-N 0.000 claims 1
- AVWDHNLLZONPJR-HXUWFJFHSA-N 5-bromo-3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-(2-pyrrolidin-1-ylethylamino)pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(NCCN3CCCC3)c(Br)c2=O)CC1)c1ccccc1 AVWDHNLLZONPJR-HXUWFJFHSA-N 0.000 claims 1
- 101100107064 Drosophila melanogaster Zasp52 gene Proteins 0.000 claims 1
- YUCFVHQCAFKDQG-UHFFFAOYSA-N fluoromethane Chemical compound F[CH] YUCFVHQCAFKDQG-UHFFFAOYSA-N 0.000 claims 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 abstract description 6
- VUWZPRWSIVNGKG-UHFFFAOYSA-N fluoromethane Chemical compound F[CH2] VUWZPRWSIVNGKG-UHFFFAOYSA-N 0.000 abstract description 2
- 125000001475 halogen functional group Chemical group 0.000 abstract 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 387
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 382
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 371
- 238000000034 method Methods 0.000 description 369
- XFGLBBQXQQOWGO-UHFFFAOYSA-N 2,2-dimethyl-5-phenyl-1h-1,4-benzodiazepin-3-one Chemical compound N=1C(=O)C(C)(C)NC2=CC=CC=C2C=1C1=CC=CC=C1 XFGLBBQXQQOWGO-UHFFFAOYSA-N 0.000 description 228
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 213
- 239000007787 solid Substances 0.000 description 207
- 235000019439 ethyl acetate Nutrition 0.000 description 177
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 137
- 239000000243 solution Substances 0.000 description 127
- 238000005160 1H NMR spectroscopy Methods 0.000 description 125
- 239000011541 reaction mixture Substances 0.000 description 91
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 83
- 238000003818 flash chromatography Methods 0.000 description 83
- 238000006243 chemical reaction Methods 0.000 description 78
- 238000005481 NMR spectroscopy Methods 0.000 description 76
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 76
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 72
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 70
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 69
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 63
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 51
- 239000012071 phase Substances 0.000 description 51
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 48
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 46
- 239000012074 organic phase Substances 0.000 description 43
- 239000011734 sodium Substances 0.000 description 42
- 239000000725 suspension Substances 0.000 description 42
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 41
- 108700011958 Ubiquitin-Specific Peptidase 7 Proteins 0.000 description 38
- 235000019253 formic acid Nutrition 0.000 description 38
- 125000004432 carbon atom Chemical group C* 0.000 description 37
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 36
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 34
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical compound O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 description 33
- 101150020913 USP7 gene Proteins 0.000 description 33
- 102100021013 Ubiquitin carboxyl-terminal hydrolase 7 Human genes 0.000 description 33
- 229940126752 Ubiquitin-specific protease 7 inhibitor Drugs 0.000 description 33
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 32
- 125000005842 heteroatom Chemical group 0.000 description 32
- 150000002924 oxiranes Chemical class 0.000 description 32
- 239000000047 product Substances 0.000 description 32
- 239000002904 solvent Substances 0.000 description 32
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 31
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 28
- 239000000460 chlorine Substances 0.000 description 28
- 125000000623 heterocyclic group Chemical group 0.000 description 28
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- 239000012267 brine Substances 0.000 description 27
- QSRRZKPKHJHIRB-UHFFFAOYSA-N methyl 4-[(2,5-dichloro-4-methylthiophen-3-yl)sulfonylamino]-2-hydroxybenzoate Chemical compound C1=C(O)C(C(=O)OC)=CC=C1NS(=O)(=O)C1=C(Cl)SC(Cl)=C1C QSRRZKPKHJHIRB-UHFFFAOYSA-N 0.000 description 27
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 27
- 229920006395 saturated elastomer Polymers 0.000 description 27
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 27
- 239000007821 HATU Substances 0.000 description 26
- 229910052757 nitrogen Inorganic materials 0.000 description 26
- 238000002953 preparative HPLC Methods 0.000 description 26
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 24
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 24
- 239000000284 extract Substances 0.000 description 24
- 230000002378 acidificating effect Effects 0.000 description 23
- 238000000746 purification Methods 0.000 description 23
- 125000000217 alkyl group Chemical group 0.000 description 22
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 21
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- 229910052799 carbon Inorganic materials 0.000 description 21
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 21
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 20
- 239000010410 layer Substances 0.000 description 20
- 230000002829 reductive effect Effects 0.000 description 20
- 239000000377 silicon dioxide Substances 0.000 description 20
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 19
- 210000004027 cell Anatomy 0.000 description 19
- 235000002639 sodium chloride Nutrition 0.000 description 19
- 125000004429 atom Chemical group 0.000 description 18
- 239000003921 oil Substances 0.000 description 18
- 235000019198 oils Nutrition 0.000 description 18
- 239000012044 organic layer Substances 0.000 description 18
- 238000003756 stirring Methods 0.000 description 18
- 150000001721 carbon Chemical group 0.000 description 17
- 239000012230 colorless oil Substances 0.000 description 17
- 239000008346 aqueous phase Substances 0.000 description 16
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 16
- 125000006413 ring segment Chemical group 0.000 description 16
- 239000002253 acid Substances 0.000 description 15
- 125000004452 carbocyclyl group Chemical group 0.000 description 15
- 239000003112 inhibitor Substances 0.000 description 15
- 125000003367 polycyclic group Chemical group 0.000 description 15
- 125000000753 cycloalkyl group Chemical group 0.000 description 14
- ZZEWMYILWXCRHZ-MRVPVSSYSA-N (3r)-3-phenylbutanoic acid Chemical compound OC(=O)C[C@@H](C)C1=CC=CC=C1 ZZEWMYILWXCRHZ-MRVPVSSYSA-N 0.000 description 13
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 13
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical class N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 13
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 13
- 125000003277 amino group Chemical group 0.000 description 13
- 201000010099 disease Diseases 0.000 description 13
- 235000011167 hydrochloric acid Nutrition 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 12
- 230000005587 bubbling Effects 0.000 description 12
- 238000002474 experimental method Methods 0.000 description 12
- 102100025064 Cellular tumor antigen p53 Human genes 0.000 description 11
- 206010035226 Plasma cell myeloma Diseases 0.000 description 11
- 230000000694 effects Effects 0.000 description 11
- 238000001914 filtration Methods 0.000 description 11
- 239000011521 glass Substances 0.000 description 11
- 238000004128 high performance liquid chromatography Methods 0.000 description 11
- 239000002244 precipitate Substances 0.000 description 11
- 101000721661 Homo sapiens Cellular tumor antigen p53 Proteins 0.000 description 10
- 208000034578 Multiple myelomas Diseases 0.000 description 10
- 238000010828 elution Methods 0.000 description 10
- 239000006228 supernatant Substances 0.000 description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 9
- 208000025205 Mantle-Cell Lymphoma Diseases 0.000 description 9
- 235000019441 ethanol Nutrition 0.000 description 9
- 208000005017 glioblastoma Diseases 0.000 description 9
- 125000004404 heteroalkyl group Chemical group 0.000 description 9
- 150000002500 ions Chemical class 0.000 description 9
- 239000000463 material Substances 0.000 description 9
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 9
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 8
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 8
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 8
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 8
- 125000003342 alkenyl group Chemical group 0.000 description 8
- 125000004103 aminoalkyl group Chemical group 0.000 description 8
- 125000004122 cyclic group Chemical group 0.000 description 8
- 208000035475 disorder Diseases 0.000 description 8
- 239000003814 drug Substances 0.000 description 8
- 238000000132 electrospray ionisation Methods 0.000 description 8
- 238000005516 engineering process Methods 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- 239000006260 foam Substances 0.000 description 8
- 238000010438 heat treatment Methods 0.000 description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 8
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 8
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 7
- 102000001477 Deubiquitinating Enzymes Human genes 0.000 description 7
- 108010093668 Deubiquitinating Enzymes Proteins 0.000 description 7
- 108050002772 E3 ubiquitin-protein ligase Mdm2 Proteins 0.000 description 7
- 102000012199 E3 ubiquitin-protein ligase Mdm2 Human genes 0.000 description 7
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 7
- 125000003545 alkoxy group Chemical group 0.000 description 7
- 229910052796 boron Inorganic materials 0.000 description 7
- 238000004587 chromatography analysis Methods 0.000 description 7
- 125000000392 cycloalkenyl group Chemical group 0.000 description 7
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 7
- 125000002950 monocyclic group Chemical group 0.000 description 7
- RYLOHTVBYHZHMN-MRVPVSSYSA-N (3r)-4,4,4-trifluoro-3-phenylbutanoic acid Chemical compound OC(=O)C[C@@H](C(F)(F)F)C1=CC=CC=C1 RYLOHTVBYHZHMN-MRVPVSSYSA-N 0.000 description 6
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical group C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- 102000018390 Ubiquitin-Specific Proteases Human genes 0.000 description 6
- 108010066496 Ubiquitin-Specific Proteases Proteins 0.000 description 6
- 125000003368 amide group Chemical group 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 229910021529 ammonia Inorganic materials 0.000 description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 6
- 150000002430 hydrocarbons Chemical group 0.000 description 6
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 6
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 6
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- LFILDSDQMSCNBV-LURJTMIESA-N propane-2-sulfinamide Chemical compound CC(C)[S@@](N)=O LFILDSDQMSCNBV-LURJTMIESA-N 0.000 description 6
- 239000000523 sample Substances 0.000 description 6
- BCWANYYNBPPTKM-UHFFFAOYSA-N tert-butyl N-[[4-[6-[(4-hydroxypiperidin-4-yl)methyl]-2-methyl-7-oxopyrazolo[4,3-d]pyrimidin-3-yl]phenyl]methyl]carbamate Chemical compound OC1(CCNCC1)CN1C=NC=2C(C1=O)=NN(C=2C1=CC=C(CNC(OC(C)(C)C)=O)C=C1)C BCWANYYNBPPTKM-UHFFFAOYSA-N 0.000 description 6
- 238000012056 up-stream process Methods 0.000 description 6
- 239000003039 volatile agent Substances 0.000 description 6
- 239000003643 water by type Substances 0.000 description 6
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 5
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 5
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 5
- 125000001931 aliphatic group Chemical group 0.000 description 5
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 5
- 235000011114 ammonium hydroxide Nutrition 0.000 description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 230000001613 neoplastic effect Effects 0.000 description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- 229920005862 polyol Polymers 0.000 description 5
- 150000003077 polyols Chemical class 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 229910052717 sulfur Inorganic materials 0.000 description 5
- 239000003826 tablet Substances 0.000 description 5
- CJTGQEWIMKXPBM-UHFFFAOYSA-N tert-butyl 4-[(4-chloro-6-oxopyrimidin-1-yl)methyl]-4-hydroxypiperidine-1-carboxylate Chemical compound ClC=1N=CN(C(C=1)=O)CC1(CCN(CC1)C(=O)OC(C)(C)C)O CJTGQEWIMKXPBM-UHFFFAOYSA-N 0.000 description 5
- 230000001225 therapeutic effect Effects 0.000 description 5
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 5
- 108700004313 ubiquitin vinyl sulfone Proteins 0.000 description 5
- QQDCXQURAAVVHQ-UHFFFAOYSA-N 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl methanesulfonate Chemical compound CC(C)(C)OC(=O)NCCOS(C)(=O)=O QQDCXQURAAVVHQ-UHFFFAOYSA-N 0.000 description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 4
- ZWIANYIFPLJVMF-UHFFFAOYSA-N 3-bromo-2-methyl-6H-pyrazolo[4,3-d]pyrimidin-7-one Chemical compound BrC=1N(N=C2C=1N=CNC2=O)C ZWIANYIFPLJVMF-UHFFFAOYSA-N 0.000 description 4
- XMIIGOLPHOKFCH-UHFFFAOYSA-N 3-phenylpropionic acid Chemical compound OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 4
- GMXANMXNFQWAJY-OAHLLOKOSA-N 6-chloro-3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(Cl)cc2=O)CC1)c1ccccc1 GMXANMXNFQWAJY-OAHLLOKOSA-N 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical group CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 4
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 4
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 4
- 102000004245 Proteasome Endopeptidase Complex Human genes 0.000 description 4
- 108090000708 Proteasome Endopeptidase Complex Proteins 0.000 description 4
- 229940079156 Proteasome inhibitor Drugs 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- NKANXQFJJICGDU-QPLCGJKRSA-N Tamoxifen Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=CC=C1 NKANXQFJJICGDU-QPLCGJKRSA-N 0.000 description 4
- 125000000304 alkynyl group Chemical group 0.000 description 4
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 description 4
- 239000000908 ammonium hydroxide Substances 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 4
- IPWKHHSGDUIRAH-UHFFFAOYSA-N bis(pinacolato)diboron Chemical compound O1C(C)(C)C(C)(C)OB1B1OC(C)(C)C(C)(C)O1 IPWKHHSGDUIRAH-UHFFFAOYSA-N 0.000 description 4
- GXJABQQUPOEUTA-RDJZCZTQSA-N bortezomib Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)B(O)O)NC(=O)C=1N=CC=NC=1)C1=CC=CC=C1 GXJABQQUPOEUTA-RDJZCZTQSA-N 0.000 description 4
- VSJKWCGYPAHWDS-FQEVSTJZSA-N camptothecin Chemical compound C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-FQEVSTJZSA-N 0.000 description 4
- 230000008878 coupling Effects 0.000 description 4
- 238000010168 coupling process Methods 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 238000000605 extraction Methods 0.000 description 4
- 239000008103 glucose Substances 0.000 description 4
- 238000001727 in vivo Methods 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- GLVAUDGFNGKCSF-UHFFFAOYSA-N mercaptopurine Chemical compound S=C1NC=NC2=C1NC=N2 GLVAUDGFNGKCSF-UHFFFAOYSA-N 0.000 description 4
- 201000008968 osteosarcoma Diseases 0.000 description 4
- 235000011056 potassium acetate Nutrition 0.000 description 4
- 239000003207 proteasome inhibitor Substances 0.000 description 4
- 235000018102 proteins Nutrition 0.000 description 4
- 108090000623 proteins and genes Proteins 0.000 description 4
- 102000004169 proteins and genes Human genes 0.000 description 4
- 125000004076 pyridyl group Chemical group 0.000 description 4
- 238000010791 quenching Methods 0.000 description 4
- 230000000171 quenching effect Effects 0.000 description 4
- 230000005855 radiation Effects 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical class [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000011593 sulfur Substances 0.000 description 4
- 238000004808 supercritical fluid chromatography Methods 0.000 description 4
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 4
- WYWHKKSPHMUBEB-UHFFFAOYSA-N tioguanine Chemical compound N1C(N)=NC(=S)C2=C1N=CN2 WYWHKKSPHMUBEB-UHFFFAOYSA-N 0.000 description 4
- 238000001262 western blot Methods 0.000 description 4
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 3
- IZXIZTKNFFYFOF-UHFFFAOYSA-N 2-Oxazolidone Chemical compound O=C1NCCO1 IZXIZTKNFFYFOF-UHFFFAOYSA-N 0.000 description 3
- NCNHKGZVJKQTMB-UHFFFAOYSA-N 2-methyl-4h-pyrazolo[4,3-d]pyrimidin-7-one Chemical compound N1=CNC(=O)C2=NN(C)C=C21 NCNHKGZVJKQTMB-UHFFFAOYSA-N 0.000 description 3
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 3
- ZNJRONVKWRHYBF-VOTSOKGWSA-N 4-(dicyanomethylene)-2-methyl-6-julolidyl-9-enyl-4h-pyran Chemical compound O1C(C)=CC(=C(C#N)C#N)C=C1\C=C\C1=CC(CCCN2CCC3)=C2C3=C1 ZNJRONVKWRHYBF-VOTSOKGWSA-N 0.000 description 3
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 3
- PESGUQRDJASXOR-UHFFFAOYSA-N 9-methylhypoxanthine Chemical compound N1C=NC(=O)C2=C1N(C)C=N2 PESGUQRDJASXOR-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- 206010006187 Breast cancer Diseases 0.000 description 3
- 208000026310 Breast neoplasm Diseases 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- PCBZRNYXXCIELG-WYFCWLEVSA-N COC1=CC=C(C[C@H](NC(=O)OC2CCCC3(C2)OOC2(O3)C3CC4CC(C3)CC2C4)C(=O)N[C@@H]2[C@@H](CO)O[C@H]([C@@H]2O)N2C=NC3=C2N=CN=C3N(C)C)C=C1 Chemical compound COC1=CC=C(C[C@H](NC(=O)OC2CCCC3(C2)OOC2(O3)C3CC4CC(C3)CC2C4)C(=O)N[C@@H]2[C@@H](CO)O[C@H]([C@@H]2O)N2C=NC3=C2N=CN=C3N(C)C)C=C1 PCBZRNYXXCIELG-WYFCWLEVSA-N 0.000 description 3
- 206010009944 Colon cancer Diseases 0.000 description 3
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 3
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 3
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 3
- 101000891649 Homo sapiens Transcription elongation factor A protein-like 1 Proteins 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 208000008839 Kidney Neoplasms Diseases 0.000 description 3
- 206010058467 Lung neoplasm malignant Diseases 0.000 description 3
- 101000596402 Mus musculus Neuronal vesicle trafficking-associated protein 1 Proteins 0.000 description 3
- 101000800539 Mus musculus Translationally-controlled tumor protein Proteins 0.000 description 3
- 235000019502 Orange oil Nutrition 0.000 description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 3
- 206010038389 Renal cancer Diseases 0.000 description 3
- 101000781972 Schizosaccharomyces pombe (strain 972 / ATCC 24843) Protein wos2 Proteins 0.000 description 3
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 3
- 101001009610 Toxoplasma gondii Dense granule protein 5 Proteins 0.000 description 3
- 102100040250 Transcription elongation factor A protein-like 1 Human genes 0.000 description 3
- 208000036142 Viral infection Diseases 0.000 description 3
- 125000005021 aminoalkenyl group Chemical group 0.000 description 3
- 238000000065 atmospheric pressure chemical ionisation Methods 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- PUJDIJCNWFYVJX-UHFFFAOYSA-N benzyl carbamate Chemical compound NC(=O)OCC1=CC=CC=C1 PUJDIJCNWFYVJX-UHFFFAOYSA-N 0.000 description 3
- BEFBXRPJLRZLJE-KHZPMNTOSA-N bis[3,5-bis(trifluoromethyl)phenyl]-[(1r)-1-[2-(2-dicyclohexylphosphanylphenyl)cyclopenta-2,4-dien-1-yl]ethyl]phosphane;cyclopenta-1,3-diene;iron(2+) Chemical compound [Fe+2].C=1C=C[CH-]C=1.C=1C(C(F)(F)F)=CC(C(F)(F)F)=CC=1P([C@H](C)[C-]1C(=CC=C1)C=1C(=CC=CC=1)P(C1CCCCC1)C1CCCCC1)C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 BEFBXRPJLRZLJE-KHZPMNTOSA-N 0.000 description 3
- 229960001467 bortezomib Drugs 0.000 description 3
- 125000001589 carboacyl group Chemical group 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 230000001413 cellular effect Effects 0.000 description 3
- 201000007455 central nervous system cancer Diseases 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 208000029742 colonic neoplasm Diseases 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 239000003925 fat Substances 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 238000004108 freeze drying Methods 0.000 description 3
- 125000004366 heterocycloalkenyl group Chemical group 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 125000002883 imidazolyl group Chemical group 0.000 description 3
- 238000000338 in vitro Methods 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 125000001786 isothiazolyl group Chemical group 0.000 description 3
- 125000000842 isoxazolyl group Chemical group 0.000 description 3
- 201000010982 kidney cancer Diseases 0.000 description 3
- 208000032839 leukemia Diseases 0.000 description 3
- 201000005202 lung cancer Diseases 0.000 description 3
- 208000020816 lung neoplasm Diseases 0.000 description 3
- 230000014759 maintenance of location Effects 0.000 description 3
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 3
- 239000010502 orange oil Substances 0.000 description 3
- 230000002018 overexpression Effects 0.000 description 3
- 230000037361 pathway Effects 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 238000009097 single-agent therapy Methods 0.000 description 3
- 150000003384 small molecules Chemical class 0.000 description 3
- KAVUKAXLXGRUCD-UHFFFAOYSA-M sodium trifluoromethanesulfinate Chemical compound [Na+].[O-]S(=O)C(F)(F)F KAVUKAXLXGRUCD-UHFFFAOYSA-M 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000829 suppository Substances 0.000 description 3
- 125000000335 thiazolyl group Chemical group 0.000 description 3
- GGUBFICZYGKNTD-UHFFFAOYSA-N triethyl phosphonoacetate Chemical compound CCOC(=O)CP(=O)(OCC)OCC GGUBFICZYGKNTD-UHFFFAOYSA-N 0.000 description 3
- 235000015112 vegetable and seed oil Nutrition 0.000 description 3
- 239000008158 vegetable oil Substances 0.000 description 3
- 239000003981 vehicle Substances 0.000 description 3
- 230000009385 viral infection Effects 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- OSFFQDBQZLXWDI-IAGOWNOFSA-N (4R)-4-benzyl-3-[(3R)-3-(3,5-difluorophenyl)-4,4,4-trifluorobutanoyl]-1,3-oxazolidin-2-one Chemical compound C(C1=CC=CC=C1)[C@H]1N(C(OC1)=O)C(C[C@@H](C(F)(F)F)C1=CC(=CC(=C1)F)F)=O OSFFQDBQZLXWDI-IAGOWNOFSA-N 0.000 description 2
- FHGHJJFTJFTUIB-VQCYPWCPSA-N (4S)-4-phenyl-3-[(E)-4,4,4-trifluorobut-2-enoyl]-1,3-oxazolidin-2-one Chemical compound FC(/C=C/C(=O)N1C(OC[C@@H]1C1=CC=CC=C1)=O)(F)F FHGHJJFTJFTUIB-VQCYPWCPSA-N 0.000 description 2
- OJOFMLDBXPDXLQ-SECBINFHSA-N (4r)-4-benzyl-1,3-oxazolidin-2-one Chemical compound C1OC(=O)N[C@@H]1CC1=CC=CC=C1 OJOFMLDBXPDXLQ-SECBINFHSA-N 0.000 description 2
- LDRVYZUIUHRGAW-ODDCISTRSA-N (NZ,S)-N-[(4-bromophenyl)methylidene]-2-methylpropane-2-sulfinamide Chemical compound BrC1=CC=C(\C=N/[S@@](=O)C(C)(C)C)C=C1 LDRVYZUIUHRGAW-ODDCISTRSA-N 0.000 description 2
- PGYTXFBZMFYHQL-XBXARRHUSA-N (e)-3-(3,5-difluorophenyl)-4,4,4-trifluorobut-2-enoic acid Chemical compound OC(=O)\C=C(C(F)(F)F)/C1=CC(F)=CC(F)=C1 PGYTXFBZMFYHQL-XBXARRHUSA-N 0.000 description 2
- RJSPAUJQXOKJMG-VMPITWQZSA-N (e)-4,4,4-trifluoro-3-(4-fluorophenyl)but-2-enoic acid Chemical compound OC(=O)\C=C(C(F)(F)F)/C1=CC=C(F)C=C1 RJSPAUJQXOKJMG-VMPITWQZSA-N 0.000 description 2
- IZLDRXUDBMVNKB-SOFGYWHQSA-N (e)-4,4,4-trifluoro-3-phenylbut-2-enoic acid Chemical compound OC(=O)\C=C(C(F)(F)F)/C1=CC=CC=C1 IZLDRXUDBMVNKB-SOFGYWHQSA-N 0.000 description 2
- HDPNBNXLBDFELL-UHFFFAOYSA-N 1,1,1-trimethoxyethane Chemical compound COC(C)(OC)OC HDPNBNXLBDFELL-UHFFFAOYSA-N 0.000 description 2
- 125000004529 1,2,3-triazinyl group Chemical group N1=NN=C(C=C1)* 0.000 description 2
- 125000004530 1,2,4-triazinyl group Chemical group N1=NC(=NC=C1)* 0.000 description 2
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 2
- 125000003363 1,3,5-triazinyl group Chemical group N1=C(N=CN=C1)* 0.000 description 2
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 2
- SCRABXQIJNGZRG-UHFFFAOYSA-N 1-(1-oxa-6-azaspiro[2.5]octan-6-yl)-3-phenylpropan-1-one Chemical compound C1(=CC=CC=C1)CCC(=O)N1CCC2(CO2)CC1 SCRABXQIJNGZRG-UHFFFAOYSA-N 0.000 description 2
- NVKGVBZZSJFQLM-UHFFFAOYSA-N 1-(2-chloroethyl)-1-nitrosourea Chemical compound NC(=O)N(N=O)CCCl NVKGVBZZSJFQLM-UHFFFAOYSA-N 0.000 description 2
- ZSVVFDHOQJEHJQ-UHFFFAOYSA-N 1-(3-phenylpropanoyl)piperidin-4-one Chemical compound C1CC(=O)CCN1C(=O)CCC1=CC=CC=C1 ZSVVFDHOQJEHJQ-UHFFFAOYSA-N 0.000 description 2
- ZZVDPQONIJQHTC-GFCCVEGCSA-N 1-[(3R)-3-phenylbutanoyl]piperidin-4-one Chemical compound C1(=CC=CC=C1)[C@@H](CC(=O)N1CCC(CC1)=O)C ZZVDPQONIJQHTC-GFCCVEGCSA-N 0.000 description 2
- XXJGBENTLXFVFI-UHFFFAOYSA-N 1-amino-methylene Chemical group N[CH2] XXJGBENTLXFVFI-UHFFFAOYSA-N 0.000 description 2
- MLRVZFYXUZQSRU-UHFFFAOYSA-N 1-chlorohexane Chemical compound CCCCCCCl MLRVZFYXUZQSRU-UHFFFAOYSA-N 0.000 description 2
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 2
- NEUWPDLMDVINSN-UHFFFAOYSA-N 1h-pyrazol-5-ylboronic acid Chemical compound OB(O)C=1C=CNN=1 NEUWPDLMDVINSN-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- DXDQFNSYQQZGCG-ZETCQYMHSA-N 2-[(3S)-3-methylpyrrolidin-1-yl]ethanamine Chemical compound C[C@@H]1CN(CC1)CCN DXDQFNSYQQZGCG-ZETCQYMHSA-N 0.000 description 2
- HLBDNUSUVDDICF-AATRIKPKSA-N 2-[(e)-3-chloroprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical compound CC1(C)OB(\C=C\CCl)OC1(C)C HLBDNUSUVDDICF-AATRIKPKSA-N 0.000 description 2
- RTQWWZBSTRGEAV-PKHIMPSTSA-N 2-[[(2s)-2-[bis(carboxymethyl)amino]-3-[4-(methylcarbamoylamino)phenyl]propyl]-[2-[bis(carboxymethyl)amino]propyl]amino]acetic acid Chemical compound CNC(=O)NC1=CC=C(C[C@@H](CN(CC(C)N(CC(O)=O)CC(O)=O)CC(O)=O)N(CC(O)=O)CC(O)=O)C=C1 RTQWWZBSTRGEAV-PKHIMPSTSA-N 0.000 description 2
- FYIPVOFJSHLFFL-UHFFFAOYSA-N 2-methyl-3-(trifluoromethyl)-6H-pyrazolo[4,3-d]pyrimidin-7-one Chemical compound CN1N=C2C(N=CNC2=O)=C1C(F)(F)F FYIPVOFJSHLFFL-UHFFFAOYSA-N 0.000 description 2
- CEBKHWWANWSNTI-UHFFFAOYSA-N 2-methylbut-3-yn-2-ol Chemical compound CC(C)(O)C#C CEBKHWWANWSNTI-UHFFFAOYSA-N 0.000 description 2
- WRXNJTBODVGDRY-UHFFFAOYSA-N 2-pyrrolidin-1-ylethanamine Chemical compound NCCN1CCCC1 WRXNJTBODVGDRY-UHFFFAOYSA-N 0.000 description 2
- BVJHYSSQNCJGPA-UHFFFAOYSA-N 3-(3,5-difluorophenyl)-4,4,4-trifluorobutanoic acid Chemical compound OC(=O)CC(C(F)(F)F)C1=CC(F)=CC(F)=C1 BVJHYSSQNCJGPA-UHFFFAOYSA-N 0.000 description 2
- YMXIIVIQLHYKOT-UHFFFAOYSA-N 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline Chemical group O1C(C)(C)C(C)(C)OB1C1=CC=CC(N)=C1 YMXIIVIQLHYKOT-UHFFFAOYSA-N 0.000 description 2
- GKTPIJFVFBDUQE-UHFFFAOYSA-N 3-[(4-hydroxypiperidin-4-yl)methyl]-9-phenylpyrido[1,2-a]pyrimidin-4-one Chemical compound OC1(CCNCC1)CC1=CN=C2N(C1=O)C=CC=C2C1=CC=CC=C1 GKTPIJFVFBDUQE-UHFFFAOYSA-N 0.000 description 2
- RLPQYKGBXQQARM-JOCHJYFZSA-N 3-[4-(aminomethyl)phenyl]-6-[[4-hydroxy-1-[(3R)-4,4,4-trifluoro-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-methylpyrazolo[4,3-d]pyrimidin-7-one Chemical compound Cn1nc2c(ncn(CC3(O)CCN(CC3)C(=O)C[C@H](c3ccccc3)C(F)(F)F)c2=O)c1-c1ccc(CN)cc1 RLPQYKGBXQQARM-JOCHJYFZSA-N 0.000 description 2
- VJDZJAUBPMXVAF-OAQYLSRUSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-(2-pyrrolidin-1-ylethylamino)pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(NCCN3CCCC3)cc2=O)CC1)c1ccccc1 VJDZJAUBPMXVAF-OAQYLSRUSA-N 0.000 description 2
- YYZQEEQWZOVQSA-YADHBBJMSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-[2-[(2S)-2-methylpyrrolidin-1-yl]ethylamino]pyrimidin-4-one Chemical compound OC1(CCN(CC1)C(C[C@@H](C)C1=CC=CC=C1)=O)CN1C=NC(=CC1=O)NCCN1[C@H](CCC1)C YYZQEEQWZOVQSA-YADHBBJMSA-N 0.000 description 2
- KMVPEEVYWDTFKH-UHFFFAOYSA-N 3-[hydroxy-(4-hydroxypiperidin-4-yl)methyl]-9-phenylpyrido[1,2-a]pyrimidin-4-one Chemical compound OC(C1=CN=C2N(C1=O)C=CC=C2C1=CC=CC=C1)C1(CCNCC1)O KMVPEEVYWDTFKH-UHFFFAOYSA-N 0.000 description 2
- YQQWQDIFFQTIHI-OAHLLOKOSA-N 3-bromo-6-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-methylpyrazolo[4,3-d]pyrimidin-7-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc3c(Br)n(C)nc3c2=O)CC1)c1ccccc1 YQQWQDIFFQTIHI-OAHLLOKOSA-N 0.000 description 2
- LAFGGKPAJCNPTG-UHFFFAOYSA-N 3-bromo-9-phenylpyrido[1,2-a]pyrimidin-4-one Chemical compound BrC1=CN=C2N(C1=O)C=CC=C2C1=CC=CC=C1 LAFGGKPAJCNPTG-UHFFFAOYSA-N 0.000 description 2
- GBRNPUKAAYSNOS-UHFFFAOYSA-N 3h-furo[2,3-d]pyrimidin-4-one Chemical compound O=C1NC=NC2=C1C=CO2 GBRNPUKAAYSNOS-UHFFFAOYSA-N 0.000 description 2
- DWYJYVHKCCWFME-UHFFFAOYSA-N 4,4,4-trifluoro-3-(4-fluorophenyl)butanoic acid Chemical compound OC(=O)CC(C(F)(F)F)C1=CC=C(F)C=C1 DWYJYVHKCCWFME-UHFFFAOYSA-N 0.000 description 2
- ATTSUIJPZMICFB-UHFFFAOYSA-N 4,4-difluoro-3-phenylbutanoic acid Chemical compound OC(=O)CC(C(F)F)C1=CC=CC=C1 ATTSUIJPZMICFB-UHFFFAOYSA-N 0.000 description 2
- ZRYZBQLXDKPBDU-UHFFFAOYSA-N 4-bromobenzaldehyde Chemical compound BrC1=CC=C(C=O)C=C1 ZRYZBQLXDKPBDU-UHFFFAOYSA-N 0.000 description 2
- GUDJFFQZIISQJB-UHFFFAOYSA-N 4-cyano-5-(3,5-dichloropyridin-4-yl)sulfanyl-n-(4-methylsulfonylphenyl)thiophene-2-carboxamide Chemical compound C1=CC(S(=O)(=O)C)=CC=C1NC(=O)C(S1)=CC(C#N)=C1SC1=C(Cl)C=NC=C1Cl GUDJFFQZIISQJB-UHFFFAOYSA-N 0.000 description 2
- LTKDRJJLXAHVPM-UHFFFAOYSA-N 4-methoxy-3-phenylbutanoic acid Chemical compound COCC(CC(O)=O)C1=CC=CC=C1 LTKDRJJLXAHVPM-UHFFFAOYSA-N 0.000 description 2
- XKVUYEYANWFIJX-UHFFFAOYSA-N 5-methyl-1h-pyrazole Chemical compound CC1=CC=NN1 XKVUYEYANWFIJX-UHFFFAOYSA-N 0.000 description 2
- AXFABVAPHSWFMD-UHFFFAOYSA-N 6-chloro-1h-pyrimidin-4-one Chemical compound OC1=CC(Cl)=NC=N1 AXFABVAPHSWFMD-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- YCIPQJTZJGUXND-UHFFFAOYSA-N Aglaia odorata Alkaloid Natural products C1=CC(OC)=CC=C1C1(C(C=2C(=O)N3CCCC3=NC=22)C=3C=CC=CC=3)C2(O)C2=C(OC)C=C(OC)C=C2O1 YCIPQJTZJGUXND-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 2
- 108090000433 Aurora kinases Proteins 0.000 description 2
- MLDQJTXFUGDVEO-UHFFFAOYSA-N BAY-43-9006 Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=CC(NC(=O)NC=3C=C(C(Cl)=CC=3)C(F)(F)F)=CC=2)=C1 MLDQJTXFUGDVEO-UHFFFAOYSA-N 0.000 description 2
- KLWPJMFMVPTNCC-UHFFFAOYSA-N Camptothecin Natural products CCC1(O)C(=O)OCC2=C1C=C3C4Nc5ccccc5C=C4CN3C2=O KLWPJMFMVPTNCC-UHFFFAOYSA-N 0.000 description 2
- GAGWJHPBXLXJQN-UORFTKCHSA-N Capecitabine Chemical compound C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](C)O1 GAGWJHPBXLXJQN-UORFTKCHSA-N 0.000 description 2
- GAGWJHPBXLXJQN-UHFFFAOYSA-N Capecitabine Natural products C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1C1C(O)C(O)C(C)O1 GAGWJHPBXLXJQN-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 2
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 description 2
- UHDGCWIWMRVCDJ-CCXZUQQUSA-N Cytarabine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1 UHDGCWIWMRVCDJ-CCXZUQQUSA-N 0.000 description 2
- ZBNZXTGUTAYRHI-UHFFFAOYSA-N Dasatinib Chemical compound C=1C(N2CCN(CCO)CC2)=NC(C)=NC=1NC(S1)=NC=C1C(=O)NC1=C(C)C=CC=C1Cl ZBNZXTGUTAYRHI-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- 102100021977 Ectonucleotide pyrophosphatase/phosphodiesterase family member 2 Human genes 0.000 description 2
- 108050004000 Ectonucleotide pyrophosphatase/phosphodiesterase family member 2 Proteins 0.000 description 2
- 239000004593 Epoxy Substances 0.000 description 2
- UEXCJVNBTNXOEH-UHFFFAOYSA-N Ethynylbenzene Chemical group C#CC1=CC=CC=C1 UEXCJVNBTNXOEH-UHFFFAOYSA-N 0.000 description 2
- ATTSUIJPZMICFB-MRVPVSSYSA-N FC([C@H](CC(=O)O)C1=CC=CC=C1)F Chemical compound FC([C@H](CC(=O)O)C1=CC=CC=C1)F ATTSUIJPZMICFB-MRVPVSSYSA-N 0.000 description 2
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- 101000809261 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 11 Proteins 0.000 description 2
- 101000644843 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 19 Proteins 0.000 description 2
- 101000748132 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 30 Proteins 0.000 description 2
- 101000809257 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 4 Proteins 0.000 description 2
- 101000759994 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 47 Proteins 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 description 2
- 239000005517 L01XE01 - Imatinib Substances 0.000 description 2
- 239000005411 L01XE02 - Gefitinib Substances 0.000 description 2
- 239000005551 L01XE03 - Erlotinib Substances 0.000 description 2
- 239000002147 L01XE04 - Sunitinib Substances 0.000 description 2
- 239000005511 L01XE05 - Sorafenib Substances 0.000 description 2
- 239000002067 L01XE06 - Dasatinib Substances 0.000 description 2
- 239000002136 L01XE07 - Lapatinib Substances 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- XNRVGTHNYCNCFF-UHFFFAOYSA-N Lapatinib ditosylate monohydrate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1.CC1=CC=C(S(O)(=O)=O)C=C1.O1C(CNCCS(=O)(=O)C)=CC=C1C1=CC=C(N=CN=C2NC=3C=C(Cl)C(OCC=4C=C(F)C=CC=4)=CC=3)C2=C1 XNRVGTHNYCNCFF-UHFFFAOYSA-N 0.000 description 2
- 229910010082 LiAlH Inorganic materials 0.000 description 2
- 102000009151 Luteinizing Hormone Human genes 0.000 description 2
- 108010073521 Luteinizing Hormone Proteins 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- ZDZOTLJHXYCWBA-VCVYQWHSSA-N N-debenzoyl-N-(tert-butoxycarbonyl)-10-deacetyltaxol Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C=CC=CC=4)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 ZDZOTLJHXYCWBA-VCVYQWHSSA-N 0.000 description 2
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 2
- ANRDMRYFOBWAGJ-UHFFFAOYSA-N OC1(CCN(CC1)C(=O)OC(C)(C)C)CN1C=NC=2C(C1=O)=NN(C=2C#C[Si](C)(C)C)C Chemical compound OC1(CCN(CC1)C(=O)OC(C)(C)C)CN1C=NC=2C(C1=O)=NN(C=2C#C[Si](C)(C)C)C ANRDMRYFOBWAGJ-UHFFFAOYSA-N 0.000 description 2
- 229930012538 Paclitaxel Natural products 0.000 description 2
- 101150003085 Pdcl gene Proteins 0.000 description 2
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 2
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 108030005449 Polo kinases Proteins 0.000 description 2
- 102000001253 Protein Kinase Human genes 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- 229940123237 Taxane Drugs 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- FOCVUCIESVLUNU-UHFFFAOYSA-N Thiotepa Chemical compound C1CN1P(N1CC1)(=S)N1CC1 FOCVUCIESVLUNU-UHFFFAOYSA-N 0.000 description 2
- 108090000848 Ubiquitin Proteins 0.000 description 2
- 102000044159 Ubiquitin Human genes 0.000 description 2
- 102100038462 Ubiquitin carboxyl-terminal hydrolase 11 Human genes 0.000 description 2
- 102100020728 Ubiquitin carboxyl-terminal hydrolase 19 Human genes 0.000 description 2
- 102100040052 Ubiquitin carboxyl-terminal hydrolase 30 Human genes 0.000 description 2
- 102100038463 Ubiquitin carboxyl-terminal hydrolase 4 Human genes 0.000 description 2
- 102100025029 Ubiquitin carboxyl-terminal hydrolase 47 Human genes 0.000 description 2
- JXLYSJRDGCGARV-WWYNWVTFSA-N Vinblastine Natural products O=C(O[C@H]1[C@](O)(C(=O)OC)[C@@H]2N(C)c3c(cc(c(OC)c3)[C@]3(C(=O)OC)c4[nH]c5c(c4CCN4C[C@](O)(CC)C[C@H](C3)C4)cccc5)[C@@]32[C@H]2[C@@]1(CC)C=CCN2CC3)C JXLYSJRDGCGARV-WWYNWVTFSA-N 0.000 description 2
- 229940122803 Vinca alkaloid Drugs 0.000 description 2
- NLKBUJQLMRHSKP-SSDOTTSWSA-N [(2r)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate Chemical compound CS(=O)(=O)OC[C@@H](C)NC(=O)OC(C)(C)C NLKBUJQLMRHSKP-SSDOTTSWSA-N 0.000 description 2
- WKRPDGJTXDSBTB-ZETCQYMHSA-N [(3S)-3-methyl-4-methylsulfonyloxybutyl] methanesulfonate Chemical compound CS(=O)(=O)OC[C@H](CCOS(=O)(=O)C)C WKRPDGJTXDSBTB-ZETCQYMHSA-N 0.000 description 2
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 2
- 230000003213 activating effect Effects 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229960000548 alemtuzumab Drugs 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001345 alkine derivatives Chemical class 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
- YBBLVLTVTVSKRW-UHFFFAOYSA-N anastrozole Chemical compound N#CC(C)(C)C1=CC(C(C)(C#N)C)=CC(CN2N=CN=C2)=C1 YBBLVLTVTVSKRW-UHFFFAOYSA-N 0.000 description 2
- 229960002932 anastrozole Drugs 0.000 description 2
- 239000004037 angiogenesis inhibitor Substances 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- 229940045799 anthracyclines and related substance Drugs 0.000 description 2
- 230000002280 anti-androgenic effect Effects 0.000 description 2
- 229940046836 anti-estrogen Drugs 0.000 description 2
- 230000001833 anti-estrogenic effect Effects 0.000 description 2
- 230000000340 anti-metabolite Effects 0.000 description 2
- 230000001028 anti-proliverative effect Effects 0.000 description 2
- 239000000051 antiandrogen Substances 0.000 description 2
- 229940030495 antiandrogen sex hormone and modulator of the genital system Drugs 0.000 description 2
- 229940100197 antimetabolite Drugs 0.000 description 2
- 239000002256 antimetabolite Substances 0.000 description 2
- 239000003080 antimitotic agent Substances 0.000 description 2
- 229940045988 antineoplastic drug protein kinase inhibitors Drugs 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 125000004659 aryl alkyl thio group Chemical group 0.000 description 2
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 2
- 125000001769 aryl amino group Chemical group 0.000 description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 2
- 125000005110 aryl thio group Chemical group 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- 239000005441 aurora Substances 0.000 description 2
- VSRXQHXAPYXROS-UHFFFAOYSA-N azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OC(=O)C1(C(O)=O)CCC1 VSRXQHXAPYXROS-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- YTKUWDBFDASYHO-UHFFFAOYSA-N bendamustine Chemical compound ClCCN(CCCl)C1=CC=C2N(C)C(CCCC(O)=O)=NC2=C1 YTKUWDBFDASYHO-UHFFFAOYSA-N 0.000 description 2
- 229960002707 bendamustine Drugs 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 125000004603 benzisoxazolyl group Chemical group O1N=C(C2=C1C=CC=C2)* 0.000 description 2
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 2
- FDDADAAYFIUZLX-UHFFFAOYSA-N benzyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate Chemical compound C1CC2(OC2)CCN1C(=O)OCC1=CC=CC=C1 FDDADAAYFIUZLX-UHFFFAOYSA-N 0.000 description 2
- WMESVVYMYGDJPF-UHFFFAOYSA-N benzyl 4-[(3-bromo-2-methyl-7-oxopyrazolo[4,3-d]pyrimidin-6-yl)methyl]-4-hydroxypiperidine-1-carboxylate Chemical compound BrC=1N(N=C2C=1N=CN(C2=O)CC1(CCN(CC1)C(=O)OCC1=CC=CC=C1)O)C WMESVVYMYGDJPF-UHFFFAOYSA-N 0.000 description 2
- FGEPDMIZJWLTNE-UHFFFAOYSA-N benzyl 4-hydroxy-4-[[2-methyl-3-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]-7-oxopyrazolo[4,3-d]pyrimidin-6-yl]methyl]piperidine-1-carboxylate Chemical compound C(C)(C)(C)OC(=O)NCC1=CC=C(C=C1)C=1N(N=C2C=1N=CN(C2=O)CC1(CCN(CC1)C(=O)OCC1=CC=CC=C1)O)C FGEPDMIZJWLTNE-UHFFFAOYSA-N 0.000 description 2
- UEVFFFJXASOHNU-UHFFFAOYSA-N benzyl 4-hydroxy-4-[[9-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]-6-oxopurin-1-yl]methyl]piperidine-1-carboxylate Chemical compound C(C)(C)(C)OC(=O)NCC1=CC=C(C=C1)N1C=2N=CN(C(C=2N=C1)=O)CC1(CCN(CC1)C(=O)OCC1=CC=CC=C1)O UEVFFFJXASOHNU-UHFFFAOYSA-N 0.000 description 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 2
- 229960000397 bevacizumab Drugs 0.000 description 2
- 125000002618 bicyclic heterocycle group Chemical group 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 238000010256 biochemical assay Methods 0.000 description 2
- 230000008236 biological pathway Effects 0.000 description 2
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 2
- BRTALTYTFFNPAC-UHFFFAOYSA-N boroxin Chemical group B1OBOBO1 BRTALTYTFFNPAC-UHFFFAOYSA-N 0.000 description 2
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229940127093 camptothecin Drugs 0.000 description 2
- 229960004117 capecitabine Drugs 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 229960004562 carboplatin Drugs 0.000 description 2
- 230000030833 cell death Effects 0.000 description 2
- 239000013592 cell lysate Substances 0.000 description 2
- 229960005395 cetuximab Drugs 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 229960004316 cisplatin Drugs 0.000 description 2
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 238000002648 combination therapy Methods 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 229960004397 cyclophosphamide Drugs 0.000 description 2
- 229960000684 cytarabine Drugs 0.000 description 2
- 229960002448 dasatinib Drugs 0.000 description 2
- 238000010511 deprotection reaction Methods 0.000 description 2
- 230000003831 deregulation Effects 0.000 description 2
- 238000001514 detection method Methods 0.000 description 2
- 206010012601 diabetes mellitus Diseases 0.000 description 2
- MXFYYFVVIIWKFE-UHFFFAOYSA-N dicyclohexyl-[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane Chemical compound CC(C)OC1=CC=CC(OC(C)C)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 MXFYYFVVIIWKFE-UHFFFAOYSA-N 0.000 description 2
- VSJKWCGYPAHWDS-UHFFFAOYSA-N dl-camptothecin Natural products C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)C5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-UHFFFAOYSA-N 0.000 description 2
- 239000003534 dna topoisomerase inhibitor Substances 0.000 description 2
- 229960003668 docetaxel Drugs 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 229930013356 epothilone Natural products 0.000 description 2
- HESCAJZNRMSMJG-KKQRBIROSA-N epothilone A Chemical class C/C([C@@H]1C[C@@H]2O[C@@H]2CCC[C@@H]([C@@H]([C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1)O)C)=C\C1=CSC(C)=N1 HESCAJZNRMSMJG-KKQRBIROSA-N 0.000 description 2
- 229960001433 erlotinib Drugs 0.000 description 2
- AAKJLRGGTJKAMG-UHFFFAOYSA-N erlotinib Chemical compound C=12C=C(OCCOC)C(OCCOC)=CC2=NC=NC=1NC1=CC=CC(C#C)=C1 AAKJLRGGTJKAMG-UHFFFAOYSA-N 0.000 description 2
- 239000000328 estrogen antagonist Substances 0.000 description 2
- DTKPGWDFGMRCBN-UHFFFAOYSA-N ethyl 4,4-difluoro-3-phenylbut-2-enoate Chemical compound CCOC(=O)C=C(C(F)F)C1=CC=CC=C1 DTKPGWDFGMRCBN-UHFFFAOYSA-N 0.000 description 2
- MSOANFBTJKRJOT-UHFFFAOYSA-N ethyl 4-methoxy-3-phenylbutanoate Chemical compound COCC(CC(=O)OCC)C1=CC=CC=C1 MSOANFBTJKRJOT-UHFFFAOYSA-N 0.000 description 2
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethylcyclohexane Chemical compound CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 2
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 2
- 229960000390 fludarabine Drugs 0.000 description 2
- GIUYCYHIANZCFB-FJFJXFQQSA-N fludarabine phosphate Chemical compound C1=NC=2C(N)=NC(F)=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@@H]1O GIUYCYHIANZCFB-FJFJXFQQSA-N 0.000 description 2
- 229960002949 fluorouracil Drugs 0.000 description 2
- 229960002074 flutamide Drugs 0.000 description 2
- MKXKFYHWDHIYRV-UHFFFAOYSA-N flutamide Chemical compound CC(C)C(=O)NC1=CC=C([N+]([O-])=O)C(C(F)(F)F)=C1 MKXKFYHWDHIYRV-UHFFFAOYSA-N 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 229960002584 gefitinib Drugs 0.000 description 2
- XGALLCVXEZPNRQ-UHFFFAOYSA-N gefitinib Chemical compound C=12C=C(OCCCN3CCOCC3)C(OC)=CC2=NC=NC=1NC1=CC=C(F)C(Cl)=C1 XGALLCVXEZPNRQ-UHFFFAOYSA-N 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- SDUQYLNIPVEERB-QPPQHZFASA-N gemcitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 SDUQYLNIPVEERB-QPPQHZFASA-N 0.000 description 2
- 229960005277 gemcitabine Drugs 0.000 description 2
- 229960003297 gemtuzumab ozogamicin Drugs 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- 230000036541 health Effects 0.000 description 2
- 229940121372 histone deacetylase inhibitor Drugs 0.000 description 2
- 239000003276 histone deacetylase inhibitor Substances 0.000 description 2
- 238000001794 hormone therapy Methods 0.000 description 2
- 239000003906 humectant Substances 0.000 description 2
- 229960001001 ibritumomab tiuxetan Drugs 0.000 description 2
- HOMGKSMUEGBAAB-UHFFFAOYSA-N ifosfamide Chemical compound ClCCNP1(=O)OCCCN1CCCl HOMGKSMUEGBAAB-UHFFFAOYSA-N 0.000 description 2
- 229960001101 ifosfamide Drugs 0.000 description 2
- KTUFNOKKBVMGRW-UHFFFAOYSA-N imatinib Chemical compound C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 KTUFNOKKBVMGRW-UHFFFAOYSA-N 0.000 description 2
- 229960002411 imatinib Drugs 0.000 description 2
- 230000028993 immune response Effects 0.000 description 2
- 230000036039 immunity Effects 0.000 description 2
- 229940127121 immunoconjugate Drugs 0.000 description 2
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 2
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 2
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 2
- 125000001041 indolyl group Chemical group 0.000 description 2
- 230000006698 induction Effects 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 238000010829 isocratic elution Methods 0.000 description 2
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 2
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 229960004891 lapatinib Drugs 0.000 description 2
- HPJKCIUCZWXJDR-UHFFFAOYSA-N letrozole Chemical compound C1=CC(C#N)=CC=C1C(N1N=CN=C1)C1=CC=C(C#N)C=C1 HPJKCIUCZWXJDR-UHFFFAOYSA-N 0.000 description 2
- 229960003881 letrozole Drugs 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 229940040129 luteinizing hormone Drugs 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000004949 mass spectrometry Methods 0.000 description 2
- SGDBTWWWUNNDEQ-LBPRGKRZSA-N melphalan Chemical compound OC(=O)[C@@H](N)CC1=CC=C(N(CCCl)CCCl)C=C1 SGDBTWWWUNNDEQ-LBPRGKRZSA-N 0.000 description 2
- 229960001924 melphalan Drugs 0.000 description 2
- 229960001428 mercaptopurine Drugs 0.000 description 2
- 230000002503 metabolic effect Effects 0.000 description 2
- 229960000485 methotrexate Drugs 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- HCXMLRVXGCCXIP-UHFFFAOYSA-N methyl 1-ethyl-4-nitropyrazole-3-carboxylate Chemical compound CCN1C=C([N+]([O-])=O)C(C(=O)OC)=N1 HCXMLRVXGCCXIP-UHFFFAOYSA-N 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 230000000394 mitotic effect Effects 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 125000002757 morpholinyl group Chemical group 0.000 description 2
- KQOQBZWWJPKONC-UHFFFAOYSA-N n,n-dimethyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethanamine Chemical compound C1=NN(CCN(C)C)C=C1B1OC(C)(C)C(C)(C)O1 KQOQBZWWJPKONC-UHFFFAOYSA-N 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- YUXQSZNZGIKWCP-APBUJDDRSA-N n-[(1s)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide Chemical compound CC(C)(C)[S@@](=O)N[C@H](C(F)(F)F)C1=CC=C(Br)C=C1 YUXQSZNZGIKWCP-APBUJDDRSA-N 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 2
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 125000001715 oxadiazolyl group Chemical group 0.000 description 2
- DWAFYCQODLXJNR-BNTLRKBRSA-L oxaliplatin Chemical compound O1C(=O)C(=O)O[Pt]11N[C@@H]2CCCC[C@H]2N1 DWAFYCQODLXJNR-BNTLRKBRSA-L 0.000 description 2
- 229960001756 oxaliplatin Drugs 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 229960001592 paclitaxel Drugs 0.000 description 2
- 229960001972 panitumumab Drugs 0.000 description 2
- 230000008506 pathogenesis Effects 0.000 description 2
- WBXPDJSOTKVWSJ-ZDUSSCGKSA-N pemetrexed Chemical compound C=1NC=2NC(N)=NC(=O)C=2C=1CCC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 WBXPDJSOTKVWSJ-ZDUSSCGKSA-N 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- 125000004193 piperazinyl group Chemical group 0.000 description 2
- DNUTZBZXLPWRJG-UHFFFAOYSA-M piperidine-1-carboxylate Chemical compound [O-]C(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-M 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- 150000003057 platinum Chemical class 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- 229940002612 prodrug Drugs 0.000 description 2
- 239000000651 prodrug Substances 0.000 description 2
- 108060006633 protein kinase Proteins 0.000 description 2
- 239000003909 protein kinase inhibitor Substances 0.000 description 2
- 230000017854 proteolysis Effects 0.000 description 2
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- 125000002098 pyridazinyl group Chemical group 0.000 description 2
- QLULGIRFKAWHOJ-UHFFFAOYSA-N pyridin-4-ylboronic acid Chemical compound OB(O)C1=CC=NC=C1 QLULGIRFKAWHOJ-UHFFFAOYSA-N 0.000 description 2
- VTGOHKSTWXHQJK-UHFFFAOYSA-N pyrimidin-2-ol Chemical compound OC1=NC=CC=N1 VTGOHKSTWXHQJK-UHFFFAOYSA-N 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 2
- 125000000168 pyrrolyl group Chemical group 0.000 description 2
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 2
- GZUITABIAKMVPG-UHFFFAOYSA-N raloxifene Chemical compound C1=CC(O)=CC=C1C1=C(C(=O)C=2C=CC(OCCN3CCCCC3)=CC=2)C2=CC=C(O)C=C2S1 GZUITABIAKMVPG-UHFFFAOYSA-N 0.000 description 2
- 229960004622 raloxifene Drugs 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- 229960004641 rituximab Drugs 0.000 description 2
- 190014017285 satraplatin Chemical compound 0.000 description 2
- 229960005399 satraplatin Drugs 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 2
- AEQFSUDEHCCHBT-UHFFFAOYSA-M sodium valproate Chemical compound [Na+].CCCC(C([O-])=O)CCC AEQFSUDEHCCHBT-UHFFFAOYSA-M 0.000 description 2
- 229960003787 sorafenib Drugs 0.000 description 2
- 230000006641 stabilisation Effects 0.000 description 2
- 238000011105 stabilization Methods 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 125000005017 substituted alkenyl group Chemical group 0.000 description 2
- 125000004426 substituted alkynyl group Chemical group 0.000 description 2
- 125000003107 substituted aryl group Chemical group 0.000 description 2
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 2
- WINHZLLDWRZWRT-ATVHPVEESA-N sunitinib Chemical compound CCN(CC)CCNC(=O)C1=C(C)NC(\C=C/2C3=CC(F)=CC=C3NC\2=O)=C1C WINHZLLDWRZWRT-ATVHPVEESA-N 0.000 description 2
- 229960001796 sunitinib Drugs 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 235000012222 talc Nutrition 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 229960001603 tamoxifen Drugs 0.000 description 2
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 description 2
- NULGHBSNBAMUAH-UHFFFAOYSA-N tert-butyl 2-(4-oxo-9-phenylpyrido[1,2-a]pyrimidin-3-yl)-1-oxa-6-azaspiro[2.5]octane-6-carboxylate Chemical compound O=C1C(=CN=C2N1C=CC=C2C1=CC=CC=C1)C1OC11CCN(CC1)C(=O)OC(C)(C)C NULGHBSNBAMUAH-UHFFFAOYSA-N 0.000 description 2
- SSMSSJBJDMFZFT-UHFFFAOYSA-N tert-butyl 4-[(4-oxo-9-phenylpyrido[1,2-a]pyrimidin-3-yl)methylidene]piperidine-1-carboxylate Chemical compound O=C1C(=CN=C2N1C=CC=C2C1=CC=CC=C1)C=C1CCN(CC1)C(=O)OC(C)(C)C SSMSSJBJDMFZFT-UHFFFAOYSA-N 0.000 description 2
- MQEUZXZUQMUGQL-UHFFFAOYSA-N tert-butyl 4-hydroxy-4-[(2-methyl-7-oxo-3-phenylpyrazolo[4,3-d]pyrimidin-6-yl)methyl]piperidine-1-carboxylate Chemical compound OC1(CCN(CC1)C(=O)OC(C)(C)C)CN1C=NC=2C(C1=O)=NN(C=2C1=CC=CC=C1)C MQEUZXZUQMUGQL-UHFFFAOYSA-N 0.000 description 2
- RZYBLPCKGSAQHS-UHFFFAOYSA-N tert-butyl 4-hydroxy-4-[(2-methyl-7-oxopyrazolo[4,3-d]pyrimidin-6-yl)methyl]piperidine-1-carboxylate Chemical compound OC1(CCN(CC1)C(=O)OC(C)(C)C)CN1C=NC=2C(C1=O)=NN(C=2)C RZYBLPCKGSAQHS-UHFFFAOYSA-N 0.000 description 2
- OLFIYSQRMDUCAI-UHFFFAOYSA-N tert-butyl 4-hydroxy-4-[(4-oxo-9-phenylpyrido[1,2-a]pyrimidin-3-yl)methyl]piperidine-1-carboxylate Chemical compound OC1(CCN(CC1)C(=O)OC(C)(C)C)CC1=CN=C2N(C1=O)C=CC=C2C1=CC=CC=C1 OLFIYSQRMDUCAI-UHFFFAOYSA-N 0.000 description 2
- LTVKPKHEKBOBBQ-UHFFFAOYSA-N tert-butyl 4-hydroxy-4-[[2-methyl-7-oxo-3-(trifluoromethyl)pyrazolo[4,3-d]pyrimidin-6-yl]methyl]piperidine-1-carboxylate Chemical compound OC1(CCN(CC1)C(=O)OC(C)(C)C)CN1C=NC=2C(C1=O)=NN(C=2C(F)(F)F)C LTVKPKHEKBOBBQ-UHFFFAOYSA-N 0.000 description 2
- MMHSWNQSKPCVJD-UHFFFAOYSA-N tert-butyl 4-hydroxy-4-[hydroxy-(4-oxo-9-phenylpyrido[1,2-a]pyrimidin-3-yl)methyl]piperidine-1-carboxylate Chemical compound OC1(CCN(CC1)C(=O)OC(C)(C)C)C(C1=CN=C2N(C1=O)C=CC=C2C1=CC=CC=C1)O MMHSWNQSKPCVJD-UHFFFAOYSA-N 0.000 description 2
- BYSSXGFNZCYFST-UHFFFAOYSA-N tert-butyl N-[2-(4-fluoro-1,3-dihydroisoindol-2-yl)ethyl]carbamate Chemical compound FC1=C2CN(CC2=CC=C1)CCNC(OC(C)(C)C)=O BYSSXGFNZCYFST-UHFFFAOYSA-N 0.000 description 2
- UUDLKFPMCFRXSL-JTQLQIEISA-N tert-butyl N-[2-[(2S)-2-methylpyrrolidin-1-yl]ethyl]carbamate Chemical compound C[C@@H]1N(CCC1)CCNC(OC(C)(C)C)=O UUDLKFPMCFRXSL-JTQLQIEISA-N 0.000 description 2
- XQXBWEPBMNLTKM-UHFFFAOYSA-N tert-butyl N-[[4-(6-chloro-8-methylpurin-9-yl)phenyl]methyl]carbamate Chemical compound ClC1=C2N=C(N(C2=NC=N1)C1=CC=C(CNC(OC(C)(C)C)=O)C=C1)C XQXBWEPBMNLTKM-UHFFFAOYSA-N 0.000 description 2
- ZZJODAMZGGUBTQ-UHFFFAOYSA-N tert-butyl N-[[4-(6-oxo-1H-purin-9-yl)phenyl]methyl]carbamate Chemical compound O=C1C=2N=CN(C=2N=CN1)C1=CC=C(CNC(OC(C)(C)C)=O)C=C1 ZZJODAMZGGUBTQ-UHFFFAOYSA-N 0.000 description 2
- XGLJDYNWDGFIQO-UHFFFAOYSA-N tert-butyl N-[[4-[(5-amino-6-chloropyrimidin-4-yl)amino]phenyl]methyl]carbamate Chemical compound NC=1C(=NC=NC=1Cl)NC1=CC=C(CNC(OC(C)(C)C)=O)C=C1 XGLJDYNWDGFIQO-UHFFFAOYSA-N 0.000 description 2
- VPLLZOVYYBVYCX-UHFFFAOYSA-N tert-butyl N-[[4-[1-[(4-hydroxypiperidin-4-yl)methyl]-6-oxopurin-9-yl]phenyl]methyl]carbamate Chemical compound OC1(CCNCC1)CN1C=NC=2N(C=NC=2C1=O)C1=CC=C(CNC(OC(C)(C)C)=O)C=C1 VPLLZOVYYBVYCX-UHFFFAOYSA-N 0.000 description 2
- MNWYSBTZNZUGKK-UHFFFAOYSA-N tert-butyl N-[[4-[1-[(4-hydroxypiperidin-4-yl)methyl]-8-methyl-6-oxopurin-9-yl]phenyl]methyl]carbamate Chemical compound OC1(CCNCC1)CN1C=NC=2N(C(=NC=2C1=O)C)C1=CC=C(CNC(OC(C)(C)C)=O)C=C1 MNWYSBTZNZUGKK-UHFFFAOYSA-N 0.000 description 2
- PDAFIZPRSXHMCO-ZCFIWIBFSA-N tert-butyl n-[(2r)-1-hydroxypropan-2-yl]carbamate Chemical compound OC[C@@H](C)NC(=O)OC(C)(C)C PDAFIZPRSXHMCO-ZCFIWIBFSA-N 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- MCZDHTKJGDCTAE-UHFFFAOYSA-M tetrabutylazanium;acetate Chemical compound CC([O-])=O.CCCC[N+](CCCC)(CCCC)CCCC MCZDHTKJGDCTAE-UHFFFAOYSA-M 0.000 description 2
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 2
- 125000003831 tetrazolyl group Chemical group 0.000 description 2
- 229940124597 therapeutic agent Drugs 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- 229960001196 thiotepa Drugs 0.000 description 2
- 229960003087 tioguanine Drugs 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 229940044693 topoisomerase inhibitor Drugs 0.000 description 2
- 229960005267 tositumomab Drugs 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 229960000575 trastuzumab Drugs 0.000 description 2
- 125000001425 triazolyl group Chemical group 0.000 description 2
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 2
- MWKJTNBSKNUMFN-UHFFFAOYSA-N trifluoromethyltrimethylsilane Chemical compound C[Si](C)(C)C(F)(F)F MWKJTNBSKNUMFN-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- BPLKQGGAXWRFOE-UHFFFAOYSA-M trimethylsulfoxonium iodide Chemical compound [I-].C[S+](C)(C)=O BPLKQGGAXWRFOE-UHFFFAOYSA-M 0.000 description 2
- 229910000404 tripotassium phosphate Inorganic materials 0.000 description 2
- 235000019798 tripotassium phosphate Nutrition 0.000 description 2
- 230000034512 ubiquitination Effects 0.000 description 2
- 229940102566 valproate Drugs 0.000 description 2
- 229960003048 vinblastine Drugs 0.000 description 2
- JXLYSJRDGCGARV-XQKSVPLYSA-N vincaleukoblastine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 JXLYSJRDGCGARV-XQKSVPLYSA-N 0.000 description 2
- OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 description 2
- 229960004528 vincristine Drugs 0.000 description 2
- OGWKCGZFUXNPDA-UHFFFAOYSA-N vincristine Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(OC(C)=O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-UHFFFAOYSA-N 0.000 description 2
- GBABOYUKABKIAF-GHYRFKGUSA-N vinorelbine Chemical compound C1N(CC=2C3=CC=CC=C3NC=22)CC(CC)=C[C@H]1C[C@]2(C(=O)OC)C1=CC([C@]23[C@H]([C@]([C@H](OC(C)=O)[C@]4(CC)C=CCN([C@H]34)CC2)(O)C(=O)OC)N2C)=C2C=C1OC GBABOYUKABKIAF-GHYRFKGUSA-N 0.000 description 2
- 229960002066 vinorelbine Drugs 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- CXNIUSPIQKWYAI-UHFFFAOYSA-N xantphos Chemical compound C=12OC3=C(P(C=4C=CC=CC=4)C=4C=CC=CC=4)C=CC=C3C(C)(C)C2=CC=CC=1P(C=1C=CC=CC=1)C1=CC=CC=C1 CXNIUSPIQKWYAI-UHFFFAOYSA-N 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- WPDASZCYRKGSTO-UHFFFAOYSA-N (2-aminophenyl)boronic acid;hydrochloride Chemical compound Cl.NC1=CC=CC=C1B(O)O WPDASZCYRKGSTO-UHFFFAOYSA-N 0.000 description 1
- QCSLIRFWJPOENV-UHFFFAOYSA-N (2-fluorophenyl)boronic acid Chemical compound OB(O)C1=CC=CC=C1F QCSLIRFWJPOENV-UHFFFAOYSA-N 0.000 description 1
- ZLGZKMHJXLDWSP-SSDOTTSWSA-N (2r)-1-pyrrolidin-1-ylpropan-2-amine Chemical compound C[C@@H](N)CN1CCCC1 ZLGZKMHJXLDWSP-SSDOTTSWSA-N 0.000 description 1
- CHPRFKYDQRKRRK-ZCFIWIBFSA-N (2r)-2-(methoxymethyl)pyrrolidine Chemical compound COC[C@H]1CCCN1 CHPRFKYDQRKRRK-ZCFIWIBFSA-N 0.000 description 1
- BKMMTJMQCTUHRP-GSVOUGTGSA-N (2r)-2-aminopropan-1-ol Chemical compound C[C@@H](N)CO BKMMTJMQCTUHRP-GSVOUGTGSA-N 0.000 description 1
- GUHQLUWDOMXRGQ-SSDOTTSWSA-N (2r)-2-pyrrolidin-1-ylpropan-1-amine Chemical compound NC[C@@H](C)N1CCCC1 GUHQLUWDOMXRGQ-SSDOTTSWSA-N 0.000 description 1
- CXZRFZVFEBSZLQ-ZCFIWIBFSA-N (2r)-2-pyrrolidin-1-ylpropanamide Chemical compound NC(=O)[C@@H](C)N1CCCC1 CXZRFZVFEBSZLQ-ZCFIWIBFSA-N 0.000 description 1
- YDLCAQYNXGDYTM-ZDUSSCGKSA-N (2s)-1-phenyl-3-pyrrolidin-1-ylpropan-2-amine Chemical compound C([C@@H](N)CC=1C=CC=CC=1)N1CCCC1 YDLCAQYNXGDYTM-ZDUSSCGKSA-N 0.000 description 1
- ZLGZKMHJXLDWSP-ZETCQYMHSA-N (2s)-1-pyrrolidin-1-ylpropan-2-amine Chemical compound C[C@H](N)CN1CCCC1 ZLGZKMHJXLDWSP-ZETCQYMHSA-N 0.000 description 1
- MWCBGWLCXSUTHK-YFKPBYRVSA-N (2s)-2-methylbutane-1,4-diol Chemical compound OC[C@@H](C)CCO MWCBGWLCXSUTHK-YFKPBYRVSA-N 0.000 description 1
- RGHPCLZJAFCTIK-YFKPBYRVSA-N (2s)-2-methylpyrrolidine Chemical compound C[C@H]1CCCN1 RGHPCLZJAFCTIK-YFKPBYRVSA-N 0.000 description 1
- GUHQLUWDOMXRGQ-ZETCQYMHSA-N (2s)-2-pyrrolidin-1-ylpropan-1-amine Chemical compound NC[C@H](C)N1CCCC1 GUHQLUWDOMXRGQ-ZETCQYMHSA-N 0.000 description 1
- WDGWHKRJEBENCE-UHFFFAOYSA-N (3-carbamoylphenyl)boronic acid Chemical compound NC(=O)C1=CC=CC(B(O)O)=C1 WDGWHKRJEBENCE-UHFFFAOYSA-N 0.000 description 1
- XDBHWPLGGBLUHH-UHFFFAOYSA-N (3-cyanophenyl)boronic acid Chemical compound OB(O)C1=CC=CC(C#N)=C1 XDBHWPLGGBLUHH-UHFFFAOYSA-N 0.000 description 1
- WFWQWTPAPNEOFE-UHFFFAOYSA-N (3-hydroxyphenyl)boronic acid Chemical compound OB(O)C1=CC=CC(O)=C1 WFWQWTPAPNEOFE-UHFFFAOYSA-N 0.000 description 1
- DJBYCYRCMFPFKI-CYBMUJFWSA-N (3R)-1-(1-oxa-6-azaspiro[2.5]octan-6-yl)-3-phenylbutan-1-one Chemical compound C1(=CC=CC=C1)[C@@H](CC(=O)N1CCC2(CO2)CC1)C DJBYCYRCMFPFKI-CYBMUJFWSA-N 0.000 description 1
- BVJHYSSQNCJGPA-MRVPVSSYSA-N (3R)-3-(3,5-difluorophenyl)-4,4,4-trifluorobutanoic acid Chemical compound FC=1C=C(C=C(C=1)F)[C@@H](CC(=O)O)C(F)(F)F BVJHYSSQNCJGPA-MRVPVSSYSA-N 0.000 description 1
- LVPZJCLTIBDEAT-ZCFIWIBFSA-N (3r)-3,4-dimethylpent-4-enoic acid Chemical compound CC(=C)[C@H](C)CC(O)=O LVPZJCLTIBDEAT-ZCFIWIBFSA-N 0.000 description 1
- LENYOXXELREKGZ-PGMHMLKASA-N (3r)-3-fluoropyrrolidine;hydrochloride Chemical compound Cl.F[C@@H]1CCNC1 LENYOXXELREKGZ-PGMHMLKASA-N 0.000 description 1
- LENYOXXELREKGZ-WCCKRBBISA-N (3s)-3-fluoropyrrolidin-1-ium;chloride Chemical compound Cl.F[C@H]1CCNC1 LENYOXXELREKGZ-WCCKRBBISA-N 0.000 description 1
- GNRHNKBJNUVWFZ-UHFFFAOYSA-N (4-carbamoylphenyl)boronic acid Chemical compound NC(=O)C1=CC=C(B(O)O)C=C1 GNRHNKBJNUVWFZ-UHFFFAOYSA-N 0.000 description 1
- YBRZMIPKXFTXKM-IAGOWNOFSA-N (4R)-4-benzyl-3-[(3R)-4,4,4-trifluoro-3-(4-fluorophenyl)butanoyl]-1,3-oxazolidin-2-one Chemical compound C(C1=CC=CC=C1)[C@H]1N(C(OC1)=O)C(C[C@@H](C(F)(F)F)C1=CC=C(C=C1)F)=O YBRZMIPKXFTXKM-IAGOWNOFSA-N 0.000 description 1
- AIJLLHXCCKAEQS-TZMCWYRMSA-N (4S)-3-[(3R)-3,4-dimethylpent-4-enoyl]-4-phenyl-1,3-oxazolidin-2-one Chemical compound C[C@H](CC(=O)N1[C@H](COC1=O)c1ccccc1)C(C)=C AIJLLHXCCKAEQS-TZMCWYRMSA-N 0.000 description 1
- XHCQVCQXPWKLFH-DLBZAZTESA-N (4S)-4-benzyl-3-[(3R)-4,4-difluoro-3-phenylbutanoyl]-1,3-oxazolidin-2-one Chemical compound C(C1=CC=CC=C1)[C@@H]1N(C(OC1)=O)C(C[C@@H](C(F)F)C1=CC=CC=C1)=O XHCQVCQXPWKLFH-DLBZAZTESA-N 0.000 description 1
- OJOFMLDBXPDXLQ-VIFPVBQESA-N (4s)-4-benzyl-1,3-oxazolidin-2-one Chemical compound C1OC(=O)N[C@H]1CC1=CC=CC=C1 OJOFMLDBXPDXLQ-VIFPVBQESA-N 0.000 description 1
- OSFFQDBQZLXWDI-IRXDYDNUSA-N (4s)-4-benzyl-3-[(3s)-3-(3,5-difluorophenyl)-4,4,4-trifluorobutanoyl]-1,3-oxazolidin-2-one Chemical compound FC1=CC(F)=CC([C@H](CC(=O)N2C(OC[C@@H]2CC=2C=CC=CC=2)=O)C(F)(F)F)=C1 OSFFQDBQZLXWDI-IRXDYDNUSA-N 0.000 description 1
- QDMNNMIOWVJVLY-MRVPVSSYSA-N (4s)-4-phenyl-1,3-oxazolidin-2-one Chemical compound C1OC(=O)N[C@H]1C1=CC=CC=C1 QDMNNMIOWVJVLY-MRVPVSSYSA-N 0.000 description 1
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 description 1
- GFDIVCKNFWXIFU-RMKBEBRYSA-N (R)-N-[(1S)-2,2-difluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-2-methylpropane-2-sulfinamide Chemical compound FC([C@H](C1=CC=C(C=C1)B1OC(C(O1)(C)C)(C)C)N[S@](=O)C(C)(C)C)F GFDIVCKNFWXIFU-RMKBEBRYSA-N 0.000 description 1
- YUXQSZNZGIKWCP-DGIBIBHMSA-N (S)-N-[(1R)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide Chemical compound BrC1=CC=C(C=C1)[C@H](C(F)(F)F)N[S@@](=O)C(C)(C)C YUXQSZNZGIKWCP-DGIBIBHMSA-N 0.000 description 1
- LDRVYZUIUHRGAW-JEMSNHSXSA-N (nz)-n-[(4-bromophenyl)methylidene]-2-methylpropane-2-sulfinamide Chemical compound CC(C)(C)[S@@](=O)\N=C/C1=CC=C(Br)C=C1 LDRVYZUIUHRGAW-JEMSNHSXSA-N 0.000 description 1
- 125000004502 1,2,3-oxadiazolyl group Chemical group 0.000 description 1
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 1
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 1
- YLPCXVWMHNNQGI-UHFFFAOYSA-N 1,2-diazabicyclo[3.2.1]octane Chemical group C1C2CCN1NCC2 YLPCXVWMHNNQGI-UHFFFAOYSA-N 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- ULTHEAFYOOPTTB-UHFFFAOYSA-N 1,4-dibromobutane Chemical compound BrCCCCBr ULTHEAFYOOPTTB-UHFFFAOYSA-N 0.000 description 1
- 125000000196 1,4-pentadienyl group Chemical group [H]C([*])=C([H])C([H])([H])C([H])=C([H])[H] 0.000 description 1
- YMEBZRNYQBODKB-UHFFFAOYSA-N 1-(2-methylpropyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole Chemical compound C1=NN(CC(C)C)C=C1B1OC(C)(C)C(C)(C)O1 YMEBZRNYQBODKB-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- IGHGWYBXSSYKEF-HXUWFJFHSA-N 1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-9-phenylpurin-6-one Chemical compound OC1(CCN(CC1)C(C[C@@H](C)C1=CC=CC=C1)=O)CN1C=NC=2N(C=NC=2C1=O)C1=CC=CC=C1 IGHGWYBXSSYKEF-HXUWFJFHSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004972 1-butynyl group Chemical group [H]C([H])([H])C([H])([H])C#C* 0.000 description 1
- UCNGGGYMLHAMJG-UHFFFAOYSA-N 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole Chemical compound C1=NN(C)C=C1B1OC(C)(C)C(C)(C)O1 UCNGGGYMLHAMJG-UHFFFAOYSA-N 0.000 description 1
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- AVRPFRMDMNDIDH-UHFFFAOYSA-N 1h-quinazolin-2-one Chemical compound C1=CC=CC2=NC(O)=NC=C21 AVRPFRMDMNDIDH-UHFFFAOYSA-N 0.000 description 1
- LUKLMXJAEKXROG-UHFFFAOYSA-N 2,2,2-trifluoro-1-(4-fluorophenyl)ethanone Chemical compound FC1=CC=C(C(=O)C(F)(F)F)C=C1 LUKLMXJAEKXROG-UHFFFAOYSA-N 0.000 description 1
- OLYKCPDTXVZOQF-UHFFFAOYSA-N 2,2-difluoro-1-phenylethanone Chemical compound FC(F)C(=O)C1=CC=CC=C1 OLYKCPDTXVZOQF-UHFFFAOYSA-N 0.000 description 1
- YNTJKQDWYXUTLZ-UHFFFAOYSA-N 2-(3-chlorophenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=CC(Cl)=C1 YNTJKQDWYXUTLZ-UHFFFAOYSA-N 0.000 description 1
- CWCJURPRDOORGY-ZETCQYMHSA-N 2-[(2s)-2-methylpyrrolidin-1-yl]ethanamine Chemical compound C[C@H]1CCCN1CCN CWCJURPRDOORGY-ZETCQYMHSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- APLNAFMUEHKRLM-UHFFFAOYSA-N 2-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]-1-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NN=C(O1)CC(=O)N1CC2=C(CC1)N=CN2 APLNAFMUEHKRLM-UHFFFAOYSA-N 0.000 description 1
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- GDSGVASFZSYZNU-UHFFFAOYSA-N 2-ethyl-4h-pyrazolo[4,3-d]pyrimidin-7-one Chemical compound N1C=NC(=O)C2=NN(CC)C=C21 GDSGVASFZSYZNU-UHFFFAOYSA-N 0.000 description 1
- NRGGMCIBEHEAIL-UHFFFAOYSA-N 2-ethylpyridine Chemical compound CCC1=CC=CC=N1 NRGGMCIBEHEAIL-UHFFFAOYSA-N 0.000 description 1
- JNHIXEHYXXAQJP-UHFFFAOYSA-N 2-iodofuran-3-carboxylic acid Chemical compound OC(=O)C=1C=COC=1I JNHIXEHYXXAQJP-UHFFFAOYSA-N 0.000 description 1
- YRNDGUSDBCARGC-UHFFFAOYSA-N 2-methoxyacetophenone Chemical compound COCC(=O)C1=CC=CC=C1 YRNDGUSDBCARGC-UHFFFAOYSA-N 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- CESUXLKAADQNTB-SSDOTTSWSA-N 2-methylpropane-2-sulfinamide Chemical compound CC(C)(C)[S@](N)=O CESUXLKAADQNTB-SSDOTTSWSA-N 0.000 description 1
- CESUXLKAADQNTB-ZETCQYMHSA-N 2-methylpropane-2-sulfinamide Chemical compound CC(C)(C)[S@@](N)=O CESUXLKAADQNTB-ZETCQYMHSA-N 0.000 description 1
- SQCCFCWTEILHEB-UHFFFAOYSA-N 2-methylsulfanyl-4h-[1,3]thiazolo[4,5-d]pyrimidin-7-one Chemical compound N1C=NC(=O)C2=C1N=C(SC)S2 SQCCFCWTEILHEB-UHFFFAOYSA-N 0.000 description 1
- CJNRGSHEMCMUOE-UHFFFAOYSA-N 2-piperidin-1-ylethanamine Chemical compound NCCN1CCCCC1 CJNRGSHEMCMUOE-UHFFFAOYSA-N 0.000 description 1
- KEKCQXQAPNKMLX-UHFFFAOYSA-N 2h-1,2,4-benzotriazin-3-one Chemical compound C1=CC=CC2=NC(O)=NN=C21 KEKCQXQAPNKMLX-UHFFFAOYSA-N 0.000 description 1
- ISGOOAZVDIZEMN-UHFFFAOYSA-N 3,6-diazabicyclo[3.2.1]octane Chemical group C1C2CNC1CNC2 ISGOOAZVDIZEMN-UHFFFAOYSA-N 0.000 description 1
- SCLSGOPGWDPMIW-LJQANCHMSA-N 3-(2-aminophenyl)-6-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-methylpyrazolo[4,3-d]pyrimidin-7-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc3c(-c4ccccc4N)n(C)nc3c2=O)CC1)c1ccccc1 SCLSGOPGWDPMIW-LJQANCHMSA-N 0.000 description 1
- PTSGXBFQKPCRMW-LJQANCHMSA-N 3-(2-fluorophenyl)-6-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-methylpyrazolo[4,3-d]pyrimidin-7-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc3c(-c4ccccc4F)n(C)nc3c2=O)CC1)c1ccccc1 PTSGXBFQKPCRMW-LJQANCHMSA-N 0.000 description 1
- MVTJIINPWJPMTH-LJQANCHMSA-N 3-(3-aminophenyl)-6-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-methylpyrazolo[4,3-d]pyrimidin-7-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc3c(-c4cccc(N)c4)n(C)nc3c2=O)CC1)c1ccccc1 MVTJIINPWJPMTH-LJQANCHMSA-N 0.000 description 1
- FXXNIVHGXTWLNC-LJQANCHMSA-N 3-(3-hydroxy-3-methylbut-1-ynyl)-6-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-methylpyrazolo[4,3-d]pyrimidin-7-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc3c(C#CC(C)(C)O)n(C)nc3c2=O)CC1)c1ccccc1 FXXNIVHGXTWLNC-LJQANCHMSA-N 0.000 description 1
- LGEIGCWCSAYZMY-LJQANCHMSA-N 3-(3-hydroxyphenyl)-6-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-methylpyrazolo[4,3-d]pyrimidin-7-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc3c(-c4cccc(O)c4)n(C)nc3c2=O)CC1)c1ccccc1 LGEIGCWCSAYZMY-LJQANCHMSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- CORMGUFRWUTRBY-UHFFFAOYSA-N 3-[(4-hydroxypiperidin-4-yl)methyl]-6-(2-phenylethynyl)pyrimidin-4-one Chemical compound OC1(CCNCC1)CN1C=NC(=CC1=O)C#CC1=CC=CC=C1 CORMGUFRWUTRBY-UHFFFAOYSA-N 0.000 description 1
- JABKKDSAYJYRIV-UHFFFAOYSA-N 3-[(4-hydroxypiperidin-4-yl)methyl]-6-prop-1-en-2-ylpyrimidin-4-one Chemical compound OC1(CCNCC1)CN1C=NC(=CC1=O)C(=C)C JABKKDSAYJYRIV-UHFFFAOYSA-N 0.000 description 1
- CFRKZSWOKVLTIP-UHFFFAOYSA-N 3-[(4-hydroxypiperidin-4-yl)methyl]pyrido[1,2-a]pyrimidin-4-one Chemical compound OC1(CCNCC1)CC1=CN=C2N(C1=O)C=CC=C2 CFRKZSWOKVLTIP-UHFFFAOYSA-N 0.000 description 1
- CZGUAZDZRVLHBT-XMMPIXPASA-N 3-[4-(1-aminocyclobutyl)phenyl]-6-[[4-hydroxy-1-[(3R)-4,4,4-trifluoro-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-methylpyrazolo[4,3-d]pyrimidin-7-one Chemical compound NC1(CCC1)C1=CC=C(C=C1)C=1N(N=C2C=1N=CN(C2=O)CC1(CCN(CC1)C(C[C@@H](C(F)(F)F)C1=CC=CC=C1)=O)O)C CZGUAZDZRVLHBT-XMMPIXPASA-N 0.000 description 1
- YXNMXSSZTNGFEO-OAQYLSRUSA-N 3-[4-(aminomethyl)-3-fluorophenyl]-6-[[4-hydroxy-1-[(3R)-4,4,4-trifluoro-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-methylpyrazolo[4,3-d]pyrimidin-7-one Chemical compound FC1=CC(C=2N(N=C3C=2N=CN(C3=O)CC2(CCN(C(=O)C[C@H](C3=CC=CC=C3)C(F)(F)F)CC2)O)C)=CC=C1CN YXNMXSSZTNGFEO-OAQYLSRUSA-N 0.000 description 1
- DGHAUZFDWIZFRM-HXUWFJFHSA-N 3-[4-(aminomethyl)phenyl]-6-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-methylpyrazolo[4,3-d]pyrimidin-7-one Chemical compound NCC1=CC=C(C=C1)C=1N(N=C2C=1N=CN(C2=O)CC1(CCN(CC1)C(C[C@@H](C)C1=CC=CC=C1)=O)O)C DGHAUZFDWIZFRM-HXUWFJFHSA-N 0.000 description 1
- WXOXRMSONJCXSX-JOCHJYFZSA-N 3-[4-(aminomethyl)phenyl]-6-[[4-hydroxy-1-[(3R)-4,4,4-trifluoro-3-(4-fluorophenyl)butanoyl]piperidin-4-yl]methyl]-2-methylpyrazolo[4,3-d]pyrimidin-7-one Chemical compound NCC1=CC=C(C=C1)C=1N(N=C2C=1N=CN(C2=O)CC1(CCN(CC1)C(C[C@@H](C(F)(F)F)C1=CC=C(C=C1)F)=O)O)C WXOXRMSONJCXSX-JOCHJYFZSA-N 0.000 description 1
- HRHFNXITLYXAQR-HXUWFJFHSA-N 3-[4-(hydroxymethyl)phenyl]-6-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-methylpyrazolo[4,3-d]pyrimidin-7-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc3c(-c4ccc(CO)cc4)n(C)nc3c2=O)CC1)c1ccccc1 HRHFNXITLYXAQR-HXUWFJFHSA-N 0.000 description 1
- WHRDTLMQXVEBPC-RLWLMLJZSA-N 3-[4-[(1S)-1-amino-2,2,2-trifluoroethyl]phenyl]-6-[[4-hydroxy-1-[(3R)-4,4,4-trifluoro-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-methylpyrazolo[4,3-d]pyrimidin-7-one Chemical compound N[C@H](C(F)(F)F)C1=CC=C(C=C1)C=1N(N=C2C=1N=CN(C2=O)CC1(CCN(CC1)C(C[C@@H](C(F)(F)F)C1=CC=CC=C1)=O)O)C WHRDTLMQXVEBPC-RLWLMLJZSA-N 0.000 description 1
- DCRWJOARMKWSNR-GGAORHGYSA-N 3-[4-[(1S)-1-amino-2,2-difluoroethyl]phenyl]-6-[[4-hydroxy-1-[(3R)-4,4,4-trifluoro-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-methylpyrazolo[4,3-d]pyrimidin-7-one Chemical compound N[C@H](C(F)F)C1=CC=C(C=C1)C=1N(N=C2C=1N=CN(C2=O)CC1(CCN(CC1)C(C[C@@H](C(F)(F)F)C1=CC=CC=C1)=O)O)C DCRWJOARMKWSNR-GGAORHGYSA-N 0.000 description 1
- JDLLYACWFFLZNR-LJQANCHMSA-N 3-[6-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-methyl-7-oxopyrazolo[4,3-d]pyrimidin-3-yl]benzamide Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc3c(-c4cccc(c4)C(N)=O)n(C)nc3c2=O)CC1)c1ccccc1 JDLLYACWFFLZNR-LJQANCHMSA-N 0.000 description 1
- GYBVZUILLBUUEW-OAQYLSRUSA-N 3-[[1-[(3R)-4,4-difluoro-3-phenylbutanoyl]-4-hydroxypiperidin-4-yl]methyl]-6-(2-pyrrolidin-1-ylethylamino)pyrimidin-4-one Chemical compound FC([C@H](CC(=O)N1CCC(CC1)(O)CN1C=NC(=CC1=O)NCCN1CCCC1)C1=CC=CC=C1)F GYBVZUILLBUUEW-OAQYLSRUSA-N 0.000 description 1
- PUMARQOGXIAXIE-QGZVFWFLSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-(1H-pyrazol-5-yl)pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(cc2=O)-c2ccn[nH]2)CC1)c1ccccc1 PUMARQOGXIAXIE-QGZVFWFLSA-N 0.000 description 1
- PIPBCHIHVSLXPX-JOCHJYFZSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-(2-phenylethynyl)pyrimidin-4-one Chemical compound OC1(CCN(CC1)C(C[C@@H](C)C1=CC=CC=C1)=O)CN1C=NC(=CC1=O)C#CC1=CC=CC=C1 PIPBCHIHVSLXPX-JOCHJYFZSA-N 0.000 description 1
- CMUDSNLIFZRAOP-JOCHJYFZSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-(2-piperidin-1-ylethylamino)pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(NCCN3CCCCC3)cc2=O)CC1)c1ccccc1 CMUDSNLIFZRAOP-JOCHJYFZSA-N 0.000 description 1
- UEBLWMDAWZAKMN-HXUWFJFHSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-(4-methylpiperazin-1-yl)pyrimidin-4-one Chemical compound OC1(CCN(CC1)C(C[C@@H](C)C1=CC=CC=C1)=O)CN1C=NC(=CC1=O)N1CCN(CC1)C UEBLWMDAWZAKMN-HXUWFJFHSA-N 0.000 description 1
- XNSXEQJMVHYWRR-ISKFKSNPSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-[2-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]ethylamino]pyrimidin-4-one Chemical compound OC1(CCN(CC1)C(C[C@@H](C)C1=CC=CC=C1)=O)CN1C=NC(=CC1=O)NCCN1[C@H](CCC1)COC XNSXEQJMVHYWRR-ISKFKSNPSA-N 0.000 description 1
- GGRRIHVXLZSQRZ-FCHUYYIVSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-[2-[(3S)-3-methylpyrrolidin-1-yl]ethylamino]pyrimidin-4-one Chemical compound OC1(CCN(CC1)C(C[C@@H](C)C1=CC=CC=C1)=O)CN1C=NC(=CC1=O)NCCN1C[C@H](CC1)C GGRRIHVXLZSQRZ-FCHUYYIVSA-N 0.000 description 1
- BUAWYQRRLMBFKJ-AREMUKBSSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-[N-(2-pyrrolidin-1-ylethyl)anilino]pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(cc2=O)N(CCN2CCCC2)c2ccccc2)CC1)c1ccccc1 BUAWYQRRLMBFKJ-AREMUKBSSA-N 0.000 description 1
- CFNWNJAJDWBACV-IFMALSPDSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-[[(2R)-1-methylpyrrolidin-2-yl]methylamino]pyrimidin-4-one Chemical compound C1N([C@H](CC1)CNC1=CC(=O)N(CC2(CCN(C(=O)C[C@H](C3=CC=CC=C3)C)CC2)O)C=N1)C CFNWNJAJDWBACV-IFMALSPDSA-N 0.000 description 1
- CTDCFUHPTZVGLW-FGZHOGPDSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-[[(2R)-1-pyrrolidin-1-ylpropan-2-yl]amino]pyrimidin-4-one Chemical compound OC1(CCN(CC1)C(C[C@@H](C)C1=CC=CC=C1)=O)CN1C=NC(=CC1=O)N[C@@H](CN1CCCC1)C CTDCFUHPTZVGLW-FGZHOGPDSA-N 0.000 description 1
- JUHXHIFDQNDOFU-UHSQPCAPSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-[[(2S)-1-phenyl-3-pyrrolidin-1-ylpropan-2-yl]amino]pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(N[C@H](CN3CCCC3)Cc3ccccc3)cc2=O)CC1)c1ccccc1 JUHXHIFDQNDOFU-UHSQPCAPSA-N 0.000 description 1
- CTDCFUHPTZVGLW-YADHBBJMSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-[[(2S)-1-pyrrolidin-1-ylpropan-2-yl]amino]pyrimidin-4-one Chemical compound C[C@@H](CN1CCCC1)Nc1cc(=O)n(CC2(O)CCN(CC2)C(=O)C[C@@H](C)c2ccccc2)cn1 CTDCFUHPTZVGLW-YADHBBJMSA-N 0.000 description 1
- FWWVSMLHIJRJNB-YADHBBJMSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-[[(2S)-2-pyrrolidin-1-ylpropyl]amino]pyrimidin-4-one Chemical compound OC1(CCN(CC1)C(C[C@@H](C)C1=CC=CC=C1)=O)CN1C=NC(=CC1=O)NC[C@H](C)N1CCCC1 FWWVSMLHIJRJNB-YADHBBJMSA-N 0.000 description 1
- ULIMOUOCKZAUCQ-MRXNPFEDSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-methoxypyrimidin-4-one Chemical compound COc1cc(=O)n(CC2(O)CCN(CC2)C(=O)C[C@@H](C)c2ccccc2)cn1 ULIMOUOCKZAUCQ-MRXNPFEDSA-N 0.000 description 1
- MPDNUHAXCAJRBI-GOSISDBHSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-propan-2-ylpyrimidin-4-one Chemical compound CC(C)c1cc(=O)n(CC2(O)CCN(CC2)C(=O)C[C@@H](C)c2ccccc2)cn1 MPDNUHAXCAJRBI-GOSISDBHSA-N 0.000 description 1
- YGLCIZVWVSDQPW-LJQANCHMSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-pyridin-4-ylpyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(cc2=O)-c2ccncc2)CC1)c1ccccc1 YGLCIZVWVSDQPW-LJQANCHMSA-N 0.000 description 1
- QGUCOZPMFVERAW-JOCHJYFZSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-9-phenylpyrido[1,2-a]pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cc2cnc3c(cccn3c2=O)-c2ccccc2)CC1)c1ccccc1 QGUCOZPMFVERAW-JOCHJYFZSA-N 0.000 description 1
- MIOZSMZEKSKZTL-GOSISDBHSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]pyrido[1,2-a]pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cc2cnc3ccccn3c2=O)CC1)c1ccccc1 MIOZSMZEKSKZTL-GOSISDBHSA-N 0.000 description 1
- JEESYKUJQJRSTN-UHFFFAOYSA-N 3-[hydroxy-(4-hydroxypiperidin-4-yl)methyl]pyrido[1,2-a]pyrimidin-4-one Chemical compound OC(C1=CN=C2N(C1=O)C=CC=C2)C1(CCNCC1)O JEESYKUJQJRSTN-UHFFFAOYSA-N 0.000 description 1
- WPKZJJBSKQHRTK-HXUWFJFHSA-N 3-anilino-6-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-methylpyrazolo[4,3-d]pyrimidin-7-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc3c(Nc4ccccc4)n(C)nc3c2=O)CC1)c1ccccc1 WPKZJJBSKQHRTK-HXUWFJFHSA-N 0.000 description 1
- SJAAWYGXSROTJD-MRXNPFEDSA-N 3-bromo-2-ethyl-6-[[4-hydroxy-1-[(3R)-4,4,4-trifluoro-3-phenylbutanoyl]piperidin-4-yl]methyl]pyrazolo[4,3-d]pyrimidin-7-one Chemical compound BrC=1N(N=C2C=1N=CN(C2=O)CC1(CCN(CC1)C(C[C@@H](C(F)(F)F)C1=CC=CC=C1)=O)O)CC SJAAWYGXSROTJD-MRXNPFEDSA-N 0.000 description 1
- UQBRWIDMDNAWBS-OAHLLOKOSA-N 3-bromo-6-[[4-hydroxy-1-[(3R)-4,4,4-trifluoro-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-methylpyrazolo[4,3-d]pyrimidin-7-one Chemical compound Cn1nc2c(ncn(CC3(O)CCN(CC3)C(=O)C[C@H](c3ccccc3)C(F)(F)F)c2=O)c1Br UQBRWIDMDNAWBS-OAHLLOKOSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- QLNBLPJUUSWLFP-UHFFFAOYSA-N 3-ethynyl-6-[(4-hydroxypiperidin-4-yl)methyl]-2-methylpyrazolo[4,3-d]pyrimidin-7-one Chemical compound C(#C)C=1N(N=C2C=1N=CN(C2=O)CC1(CCNCC1)O)C QLNBLPJUUSWLFP-UHFFFAOYSA-N 0.000 description 1
- ABRGPVVIVBNDCQ-QGZVFWFLSA-N 3-ethynyl-6-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-methylpyrazolo[4,3-d]pyrimidin-7-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc3c(C#C)n(C)nc3c2=O)CC1)c1ccccc1 ABRGPVVIVBNDCQ-QGZVFWFLSA-N 0.000 description 1
- QMYGFTJCQFEDST-UHFFFAOYSA-N 3-methoxybutyl acetate Chemical group COC(C)CCOC(C)=O QMYGFTJCQFEDST-UHFFFAOYSA-N 0.000 description 1
- SVSUYEJKNSMKKW-UHFFFAOYSA-N 4,4,5,5-tetramethyl-2-prop-1-en-2-yl-1,3,2-dioxaborolane Chemical compound CC(=C)B1OC(C)(C)C(C)(C)O1 SVSUYEJKNSMKKW-UHFFFAOYSA-N 0.000 description 1
- TVOJIBGZFYMWDT-UHFFFAOYSA-N 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-pyrazole Chemical compound O1C(C)(C)C(C)(C)OB1C1=CNN=C1 TVOJIBGZFYMWDT-UHFFFAOYSA-N 0.000 description 1
- JLAKCHGEEBPDQI-UHFFFAOYSA-N 4-(4-fluorobenzyl)piperidine Chemical compound C1=CC(F)=CC=C1CC1CCNCC1 JLAKCHGEEBPDQI-UHFFFAOYSA-N 0.000 description 1
- YUZVYQFFIFNVDA-UHFFFAOYSA-N 4-[(5-phenylpyrazin-2-yl)methyl]piperidin-4-ol Chemical compound C1(=CC=CC=C1)C=1N=CC(=NC=1)CC1(CCNCC1)O YUZVYQFFIFNVDA-UHFFFAOYSA-N 0.000 description 1
- APOSIVDVBHFUHO-LJQANCHMSA-N 4-[6-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-methyl-7-oxopyrazolo[4,3-d]pyrimidin-3-yl]benzamide Chemical compound O=C(C1=CC=C(C=2N(N=C3C(=O)N(CC4(CCN(C(=O)C[C@H](C5=CC=CC=C5)C)CC4)O)C=NC=23)C)C=C1)N APOSIVDVBHFUHO-LJQANCHMSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- UDBMWFNXDSVYBR-UHFFFAOYSA-N 4-fluoro-2,3-dihydro-1h-isoindole Chemical compound FC1=CC=CC2=C1CNC2 UDBMWFNXDSVYBR-UHFFFAOYSA-N 0.000 description 1
- OURXRFYZEOUCRM-UHFFFAOYSA-N 4-hydroxymorpholine Chemical compound ON1CCOCC1 OURXRFYZEOUCRM-UHFFFAOYSA-N 0.000 description 1
- BPAVDSCRNUZQHK-UHFFFAOYSA-N 4-phenyl-1H-pyrimidine-4,5-diamine Chemical compound C1(=CC=CC=C1)C1(NC=NC=C1N)N BPAVDSCRNUZQHK-UHFFFAOYSA-N 0.000 description 1
- 125000002471 4H-quinolizinyl group Chemical group C=1(C=CCN2C=CC=CC12)* 0.000 description 1
- LVMZMDMVDWIZAL-UHFFFAOYSA-N 5-amino-6-chloro-1h-pyrimidin-4-one Chemical compound NC1=C(Cl)NC=NC1=O LVMZMDMVDWIZAL-UHFFFAOYSA-N 0.000 description 1
- ZORUQUCYMCNMIB-CQSZACIVSA-N 5-amino-6-chloro-3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(Cl)c(N)c2=O)CC1)c1ccccc1 ZORUQUCYMCNMIB-CQSZACIVSA-N 0.000 description 1
- KDOPAZIWBAHVJB-UHFFFAOYSA-N 5h-pyrrolo[3,2-d]pyrimidine Chemical compound C1=NC=C2NC=CC2=N1 KDOPAZIWBAHVJB-UHFFFAOYSA-N 0.000 description 1
- VVOWOEPVPXDEGB-QGZVFWFLSA-N 6-(2-hydroxyethylamino)-3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]pyrimidin-4-one Chemical compound OC1(CCN(CC1)C(C[C@@H](C)C1=CC=CC=C1)=O)CN1C=NC(=CC1=O)NCCO VVOWOEPVPXDEGB-QGZVFWFLSA-N 0.000 description 1
- VWPGYTLVRPBGSS-IRLDBZIGSA-N 6-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(cc2=O)N2CC[C@@H](C2)N(C)C)CC1)c1ccccc1 VWPGYTLVRPBGSS-IRLDBZIGSA-N 0.000 description 1
- OXVBPJVSTGCVPL-QUCCMNQESA-N 6-[(3S)-3-aminopyrrolidin-1-yl]-3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]pyrimidin-4-one Chemical compound N[C@@H]1CN(CC1)C1=CC(N(C=N1)CC1(CCN(CC1)C(C[C@@H](C)C1=CC=CC=C1)=O)O)=O OXVBPJVSTGCVPL-QUCCMNQESA-N 0.000 description 1
- GPDLJBQXBRZGDN-UHFFFAOYSA-N 6-[(4-hydroxypiperidin-4-yl)methyl]-2-methyl-3-(trifluoromethyl)pyrazolo[4,3-d]pyrimidin-7-one Chemical compound OC1(CCNCC1)CN1C=NC=2C(C1=O)=NN(C=2C(F)(F)F)C GPDLJBQXBRZGDN-UHFFFAOYSA-N 0.000 description 1
- DQIXDLPUJUPZMR-UHFFFAOYSA-N 6-[(4-hydroxypiperidin-4-yl)methyl]-2-methylpyrazolo[4,3-d]pyrimidin-7-one Chemical compound OC1(CCNCC1)CN1C=NC=2C(C1=O)=NN(C=2)C DQIXDLPUJUPZMR-UHFFFAOYSA-N 0.000 description 1
- LLODDDVAUOIGSH-JOCHJYFZSA-N 6-[2-(4-fluoro-1,3-dihydroisoindol-2-yl)ethylamino]-3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]pyrimidin-4-one Chemical compound FC1=C2CN(CC2=CC=C1)CCNC1=CC(N(C=N1)CC1(CCN(CC1)C(C[C@@H](C)C1=CC=CC=C1)=O)O)=O LLODDDVAUOIGSH-JOCHJYFZSA-N 0.000 description 1
- JKYURQGUWCHEMD-HXUWFJFHSA-N 6-[2-(dimethylamino)ethyl-methylamino]-3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(cc2=O)N(C)CCN(C)C)CC1)c1ccccc1 JKYURQGUWCHEMD-HXUWFJFHSA-N 0.000 description 1
- RLZJEGKGIHARPJ-LJQANCHMSA-N 6-[2-(dimethylamino)ethylamino]-3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(NCCN(C)C)cc2=O)CC1)c1ccccc1 RLZJEGKGIHARPJ-LJQANCHMSA-N 0.000 description 1
- UDCUOYWIYORHSS-IFMALSPDSA-N 6-[2-[(3R)-3-fluoropyrrolidin-1-yl]ethylamino]-3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(NCCN3CC[C@@H](F)C3)cc2=O)CC1)c1ccccc1 UDCUOYWIYORHSS-IFMALSPDSA-N 0.000 description 1
- UECQGLAZBLIFRP-UHFFFAOYSA-N 6-[[4-hydroxy-1-(3-phenylpropanoyl)piperidin-4-yl]methyl]-2-methyl-3-(trifluoromethyl)pyrazolo[4,3-d]pyrimidin-7-one Chemical compound Cn1nc2c(ncn(CC3(O)CCN(CC3)C(=O)CCc3ccccc3)c2=O)c1C(F)(F)F UECQGLAZBLIFRP-UHFFFAOYSA-N 0.000 description 1
- FBCJMPWAGHWXHF-QGZVFWFLSA-N 6-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-methyl-3-(1H-pyrazol-5-yl)pyrazolo[4,3-d]pyrimidin-7-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc3c(-c4ccn[nH]4)n(C)nc3c2=O)CC1)c1ccccc1 FBCJMPWAGHWXHF-QGZVFWFLSA-N 0.000 description 1
- XARMGQZVMSMTHK-HXUWFJFHSA-N 6-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-methyl-3-phenylpyrazolo[4,3-d]pyrimidin-7-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc3c(-c4ccccc4)n(C)nc3c2=O)CC1)c1ccccc1 XARMGQZVMSMTHK-HXUWFJFHSA-N 0.000 description 1
- JCAPNVQSBQYYJR-HSZRJFAPSA-N 6-[[4-hydroxy-1-[(3R)-4,4,4-trifluoro-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-methyl-3-[4-(methylaminomethyl)phenyl]pyrazolo[4,3-d]pyrimidin-7-one Chemical compound CNCC1=CC=C(C=2N(N=C3C=2N=CN(C3=O)CC2(CCN(C(=O)C[C@H](C3=CC=CC=C3)C(F)(F)F)CC2)O)C)C=C1 JCAPNVQSBQYYJR-HSZRJFAPSA-N 0.000 description 1
- UTGDWIVPYKAJII-OAHLLOKOSA-N 6-amino-3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(N)cc2=O)CC1)c1ccccc1 UTGDWIVPYKAJII-OAHLLOKOSA-N 0.000 description 1
- WFMXEEPSEBBFMS-HXUWFJFHSA-N 6-anilino-3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(Nc3ccccc3)cc2=O)CC1)c1ccccc1 WFMXEEPSEBBFMS-HXUWFJFHSA-N 0.000 description 1
- PCKVPGSOVLNBJZ-UHFFFAOYSA-N 6-benzyl-3-[(4-hydroxypiperidin-4-yl)methyl]pyrimidin-4-one Chemical compound C(C1=CC=CC=C1)C1=CC(N(C=N1)CC1(CCNCC1)O)=O PCKVPGSOVLNBJZ-UHFFFAOYSA-N 0.000 description 1
- UKCUCPXBHFHGSE-OAQYLSRUSA-N 6-benzyl-3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]pyrimidin-4-one Chemical compound C(C1=CC=CC=C1)C1=CC(N(C=N1)CC1(CCN(CC1)C(C[C@@H](C)C1=CC=CC=C1)=O)O)=O UKCUCPXBHFHGSE-OAQYLSRUSA-N 0.000 description 1
- GBUDFPLVFQWKCX-UHFFFAOYSA-N 6-chloro-3-[(4-hydroxypiperidin-4-yl)methyl]-5-methylpyrimidin-4-one Chemical compound ClC1=C(C(N(C=N1)CC1(CCNCC1)O)=O)C GBUDFPLVFQWKCX-UHFFFAOYSA-N 0.000 description 1
- DCVGQJPXJRNMIW-UHFFFAOYSA-N 6-chloro-3-[(4-hydroxypiperidin-4-yl)methyl]pyrimidin-4-one Chemical compound ClC1=CC(N(C=N1)CC1(CCNCC1)O)=O DCVGQJPXJRNMIW-UHFFFAOYSA-N 0.000 description 1
- OJPBRKCINLGSNN-OAHLLOKOSA-N 6-chloro-3-[[1-[(3R)-4,4-difluoro-3-phenylbutanoyl]-4-hydroxypiperidin-4-yl]methyl]pyrimidin-4-one Chemical compound ClC1=CC(N(C=N1)CC1(CCN(CC1)C(C[C@@H](C(F)F)C1=CC=CC=C1)=O)O)=O OJPBRKCINLGSNN-OAHLLOKOSA-N 0.000 description 1
- GKXWECHRCPLJLT-OAHLLOKOSA-N 6-chloro-3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-5-methylpyrimidin-4-one Chemical compound ClC1=C(C(N(C=N1)CC1(CCN(CC1)C(C[C@@H](C)C1=CC=CC=C1)=O)O)=O)C GKXWECHRCPLJLT-OAHLLOKOSA-N 0.000 description 1
- XZDABTAOUACVLS-UHFFFAOYSA-N 6-chloro-5-methyl-1h-pyrimidin-4-one Chemical compound CC1=C(O)N=CN=C1Cl XZDABTAOUACVLS-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- ALLYIYDACDRUHJ-OAHLLOKOSA-N 8-bromo-1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-9-methylpurin-6-one Chemical compound BrC=1N(C=2N=CN(C(C=2N=1)=O)CC1(CCN(CC1)C(C[C@@H](C)C1=CC=CC=C1)=O)O)C ALLYIYDACDRUHJ-OAHLLOKOSA-N 0.000 description 1
- TWMYCFXOHZLQGI-UHFFFAOYSA-N 8-bromo-9-methyl-3h-purin-6-one Chemical compound N1C=NC(=O)C2=C1N(C)C(Br)=N2 TWMYCFXOHZLQGI-UHFFFAOYSA-N 0.000 description 1
- LXKMWEDUZLADNN-HXUWFJFHSA-N 9-[4-(aminomethyl)phenyl]-1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-8-methylpurin-6-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc3n(c(C)nc3c2=O)-c2ccc(CN)cc2)CC1)c1ccccc1 LXKMWEDUZLADNN-HXUWFJFHSA-N 0.000 description 1
- FRSKFYIUQPOUFY-HSZRJFAPSA-N 9-[4-(aminomethyl)phenyl]-1-[[4-hydroxy-1-[(3R)-4,4,4-trifluoro-3-phenylbutanoyl]piperidin-4-yl]methyl]-8-methylpurin-6-one Chemical compound NCC1=CC=C(C=C1)N1C=2N=CN(C(C=2N=C1C)=O)CC1(CCN(CC1)C(C[C@@H](C(F)(F)F)C1=CC=CC=C1)=O)O FRSKFYIUQPOUFY-HSZRJFAPSA-N 0.000 description 1
- LHYLIAZDZACMAZ-JOCHJYFZSA-N 9-[4-(aminomethyl)phenyl]-1-[[4-hydroxy-1-[(3R)-4,4,4-trifluoro-3-phenylbutanoyl]piperidin-4-yl]methyl]purin-6-one Chemical compound NCc1ccc(cc1)-n1cnc2c1ncn(CC1(O)CCN(CC1)C(=O)C[C@H](c1ccccc1)C(F)(F)F)c2=O LHYLIAZDZACMAZ-JOCHJYFZSA-N 0.000 description 1
- GWESJYMONRJXLB-UHFFFAOYSA-N 9-methyl-8-(trifluoromethyl)-1H-purin-6-one Chemical compound CN1C=2N=CNC(C=2N=C1C(F)(F)F)=O GWESJYMONRJXLB-UHFFFAOYSA-N 0.000 description 1
- HXOKFCNYKJYTEM-UHFFFAOYSA-N 9-phenyl-3h-purin-6-one Chemical compound C1=NC=2C(=O)N=CNC=2N1C1=CC=CC=C1 HXOKFCNYKJYTEM-UHFFFAOYSA-N 0.000 description 1
- WWGSUSNBPCVMNS-UHFFFAOYSA-N 9-phenylpyrido[1,2-a]pyrimidin-4-one Chemical compound C=1C=CN2C(=O)C=CN=C2C=1C1=CC=CC=C1 WWGSUSNBPCVMNS-UHFFFAOYSA-N 0.000 description 1
- RGNQFMYCOUARHV-UHFFFAOYSA-N 942492-11-7 Chemical compound C12=CC(N)=CC=C2C2N(C(=O)OC(C)(C)C)C1CC2 RGNQFMYCOUARHV-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- TUGDOJXXURKPEO-UHFFFAOYSA-N CC(C)(C)OC(=O)NC1(CCC1)C1=CC=C(C=C1)B(O)O Chemical compound CC(C)(C)OC(=O)NC1(CCC1)C1=CC=C(C=C1)B(O)O TUGDOJXXURKPEO-UHFFFAOYSA-N 0.000 description 1
- ARCMTYUUTQWCMC-PGGUUEOZSA-N CC(C)(C)[S@@](=O)N[C@H](C(F)(F)F)C1=CC=C(C=C1)B1OC(C(O1)(C)C)(C)C Chemical compound CC(C)(C)[S@@](=O)N[C@H](C(F)(F)F)C1=CC=C(C=C1)B1OC(C(O1)(C)C)(C)C ARCMTYUUTQWCMC-PGGUUEOZSA-N 0.000 description 1
- ARCMTYUUTQWCMC-ASHKIFAZSA-N CC(C)(C)[S@](=O)N[C@@H](C(F)(F)F)C1=CC=C(C=C1)B1OC(C(O1)(C)C)(C)C Chemical compound CC(C)(C)[S@](=O)N[C@@H](C(F)(F)F)C1=CC=C(C=C1)B1OC(C(O1)(C)C)(C)C ARCMTYUUTQWCMC-ASHKIFAZSA-N 0.000 description 1
- NQBZAJDDLPOLNH-LADRWXRNSA-N CC(CC(N(CCC(CN(C=NC1=C2N=CN1C)C2=O)C1)[C@@H]1O)=O)C1=CC=CC=C1 Chemical compound CC(CC(N(CCC(CN(C=NC1=C2N=CN1C)C2=O)C1)[C@@H]1O)=O)C1=CC=CC=C1 NQBZAJDDLPOLNH-LADRWXRNSA-N 0.000 description 1
- KCBAMQOKOLXLOX-BSZYMOERSA-N CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)NC(=O)[C@@H]3C[C@H](CN3C(=O)[C@H](C(C)(C)C)NC(=O)CCCCCCCCCCNCCCONC(=O)C4=C(C(=C(C=C4)F)F)NC5=C(C=C(C=C5)I)F)O Chemical compound CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)NC(=O)[C@@H]3C[C@H](CN3C(=O)[C@H](C(C)(C)C)NC(=O)CCCCCCCCCCNCCCONC(=O)C4=C(C(=C(C=C4)F)F)NC5=C(C=C(C=C5)I)F)O KCBAMQOKOLXLOX-BSZYMOERSA-N 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- 101100208731 Caenorhabditis elegans math-33 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 101710150820 Cellular tumor antigen p53 Proteins 0.000 description 1
- UDHXJZHVNHGCEC-UHFFFAOYSA-N Chlorophacinone Chemical compound C1=CC(Cl)=CC=C1C(C=1C=CC=CC=1)C(=O)C1C(=O)C2=CC=CC=C2C1=O UDHXJZHVNHGCEC-UHFFFAOYSA-N 0.000 description 1
- 102000020038 Cholesterol 24-Hydroxylase Human genes 0.000 description 1
- 108091022871 Cholesterol 24-Hydroxylase Proteins 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 102100040484 Claspin Human genes 0.000 description 1
- 101710117926 Claspin Proteins 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 1
- 102000005927 Cysteine Proteases Human genes 0.000 description 1
- 108010005843 Cysteine Proteases Proteins 0.000 description 1
- 102000004127 Cytokines Human genes 0.000 description 1
- 108090000695 Cytokines Proteins 0.000 description 1
- HVVNJUAVDAZWCB-RXMQYKEDSA-N D-prolinol Chemical compound OC[C@H]1CCCN1 HVVNJUAVDAZWCB-RXMQYKEDSA-N 0.000 description 1
- GSNUFIFRDBKVIE-UHFFFAOYSA-N DMF Natural products CC1=CC=C(C)O1 GSNUFIFRDBKVIE-UHFFFAOYSA-N 0.000 description 1
- 108010009540 DNA (Cytosine-5-)-Methyltransferase 1 Proteins 0.000 description 1
- 102100036279 DNA (cytosine-5)-methyltransferase 1 Human genes 0.000 description 1
- 230000005778 DNA damage Effects 0.000 description 1
- 231100000277 DNA damage Toxicity 0.000 description 1
- 230000033616 DNA repair Effects 0.000 description 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 241001649081 Dina Species 0.000 description 1
- 102100024739 E3 ubiquitin-protein ligase UHRF1 Human genes 0.000 description 1
- 101150059079 EBNA1 gene Proteins 0.000 description 1
- 241000463291 Elga Species 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- IFTRQJLVEBNKJK-UHFFFAOYSA-N Ethylcyclopentane Chemical compound CCC1CCCC1 IFTRQJLVEBNKJK-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- 108010009306 Forkhead Box Protein O1 Proteins 0.000 description 1
- 102100035427 Forkhead box protein O1 Human genes 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 102100022893 Histone acetyltransferase KAT5 Human genes 0.000 description 1
- 101710116149 Histone acetyltransferase KAT5 Proteins 0.000 description 1
- 101000760417 Homo sapiens E3 ubiquitin-protein ligase UHRF1 Proteins 0.000 description 1
- 101000877683 Homo sapiens Forkhead box protein O4 Proteins 0.000 description 1
- 101000861452 Homo sapiens Forkhead box protein P3 Proteins 0.000 description 1
- 101001091538 Homo sapiens Pyruvate kinase PKM Proteins 0.000 description 1
- 101000658628 Homo sapiens Testis-specific Y-encoded-like protein 5 Proteins 0.000 description 1
- 241000700588 Human alphaherpesvirus 1 Species 0.000 description 1
- 101001042072 Human herpesvirus 1 (strain 17) E3 ubiquitin-protein ligase ICP0 Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- XQFRJNBWHJMXHO-RRKCRQDMSA-N IDUR Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(I)=C1 XQFRJNBWHJMXHO-RRKCRQDMSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 102000017274 MDM4 Human genes 0.000 description 1
- 108050005300 MDM4 Proteins 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- XOBKSJJDNFUZPF-UHFFFAOYSA-N Methoxyethane Chemical compound CCOC XOBKSJJDNFUZPF-UHFFFAOYSA-N 0.000 description 1
- 101100521345 Mus musculus Prop1 gene Proteins 0.000 description 1
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 239000012425 OXONE® Substances 0.000 description 1
- 208000008589 Obesity Diseases 0.000 description 1
- 102000043276 Oncogene Human genes 0.000 description 1
- 108700020796 Oncogene Proteins 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 102000014160 PTEN Phosphohydrolase Human genes 0.000 description 1
- 108010011536 PTEN Phosphohydrolase Proteins 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 108700017836 Prophet of Pit-1 Proteins 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- 102000013009 Pyruvate Kinase Human genes 0.000 description 1
- 108020005115 Pyruvate Kinase Proteins 0.000 description 1
- 102100034911 Pyruvate kinase PKM Human genes 0.000 description 1
- 239000012083 RIPA buffer Substances 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 238000006069 Suzuki reaction reaction Methods 0.000 description 1
- 102100034914 Testis-specific Y-encoded-like protein 5 Human genes 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 1
- 108010040002 Tumor Suppressor Proteins Proteins 0.000 description 1
- 102000001742 Tumor Suppressor Proteins Human genes 0.000 description 1
- 101150012828 UPC2 gene Proteins 0.000 description 1
- 108010067390 Viral Proteins Proteins 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- HGBUQKXHEJWLBC-UHFFFAOYSA-N [1,2]thiazolo[4,3-d]pyrimidine 2-oxide Chemical compound N1=CN=CC2=NS(=O)C=C21 HGBUQKXHEJWLBC-UHFFFAOYSA-N 0.000 description 1
- VBIXPLMVJDKWCU-UHFFFAOYSA-N [2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylcarbamic acid Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC=C(CNC(O)=O)C(F)=C1 VBIXPLMVJDKWCU-UHFFFAOYSA-N 0.000 description 1
- PZRPBPMLSSNFOM-UHFFFAOYSA-N [4-(hydroxymethyl)phenyl]boronic acid Chemical compound OCC1=CC=C(B(O)O)C=C1 PZRPBPMLSSNFOM-UHFFFAOYSA-N 0.000 description 1
- MSAGOVOMQIQREX-VIFPVBQESA-N [4-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]boronic acid Chemical compound C(C)(C)(C)OC(=O)N[C@@H](C)C1=CC=C(C=C1)B(O)O MSAGOVOMQIQREX-VIFPVBQESA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- VDSQVKVQCMPCRJ-UHFFFAOYSA-N acetic acid tert-butyl N-[[4-(8-methyl-6-oxo-1H-purin-9-yl)phenyl]methyl]carbamate Chemical compound CC(O)=O.Cc1nc2c(nc[nH]c2=O)n1-c1ccc(CNC(=O)OC(C)(C)C)cc1 VDSQVKVQCMPCRJ-UHFFFAOYSA-N 0.000 description 1
- XPOLVIIHTDKJRY-UHFFFAOYSA-N acetic acid;methanimidamide Chemical compound NC=N.CC(O)=O XPOLVIIHTDKJRY-UHFFFAOYSA-N 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000001093 anti-cancer Effects 0.000 description 1
- 238000011319 anticancer therapy Methods 0.000 description 1
- 238000011394 anticancer treatment Methods 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- WURBFLDFSFBTLW-UHFFFAOYSA-N benzil Chemical compound C=1C=CC=CC=1C(=O)C(=O)C1=CC=CC=C1 WURBFLDFSFBTLW-UHFFFAOYSA-N 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000004604 benzisothiazolyl group Chemical group S1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 150000008038 benzoazepines Chemical class 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000004619 benzopyranyl group Chemical group O1C(C=CC2=C1C=CC=C2)* 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004622 benzoxazinyl group Chemical group O1NC(=CC2=C1C=CC=C2)* 0.000 description 1
- ORPPHCOMLSWMCA-UHFFFAOYSA-N benzyl 4-hydroxy-4-[[8-methyl-9-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]-6-oxopurin-1-yl]methyl]piperidine-1-carboxylate Chemical compound C(C)(C)(C)OC(=O)NCC1=CC=C(C=C1)N1C=2N=CN(C(C=2N=C1C)=O)CC1(CCN(CC1)C(=O)OCC1=CC=CC=C1)O ORPPHCOMLSWMCA-UHFFFAOYSA-N 0.000 description 1
- VZOVOHRDLOYBJX-UHFFFAOYSA-N benzyl 4-oxopiperidine-1-carboxylate Chemical compound C1CC(=O)CCN1C(=O)OCC1=CC=CC=C1 VZOVOHRDLOYBJX-UHFFFAOYSA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- BVCRERJDOOBZOH-UHFFFAOYSA-N bicyclo[2.2.1]heptanyl Chemical group C1C[C+]2CC[C-]1C2 BVCRERJDOOBZOH-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000012455 biphasic mixture Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- BLMPQMFVWMYDKT-NZTKNTHTSA-N carfilzomib Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC(C)C)C(=O)[C@]1(C)OC1)NC(=O)CN1CCOCC1)CC1=CC=CC=C1 BLMPQMFVWMYDKT-NZTKNTHTSA-N 0.000 description 1
- 229960002438 carfilzomib Drugs 0.000 description 1
- 108010021331 carfilzomib Proteins 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000004113 cell culture Methods 0.000 description 1
- 230000022131 cell cycle Effects 0.000 description 1
- 230000033077 cellular process Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- OGEBRHQLRGFBNV-RZDIXWSQSA-N chembl2036808 Chemical compound C12=NC(NCCCC)=NC=C2C(C=2C=CC(F)=CC=2)=NN1C[C@H]1CC[C@H](N)CC1 OGEBRHQLRGFBNV-RZDIXWSQSA-N 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 238000009643 clonogenic assay Methods 0.000 description 1
- 231100000096 clonogenic assay Toxicity 0.000 description 1
- 229940125833 compound 23 Drugs 0.000 description 1
- 230000021615 conjugation Effects 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- KZZKOVLJUKWSKX-UHFFFAOYSA-N cyclobutanamine Chemical compound NC1CCC1 KZZKOVLJUKWSKX-UHFFFAOYSA-N 0.000 description 1
- 125000003678 cyclohexadienyl group Chemical group C1(=CC=CCC1)* 0.000 description 1
- 150000001934 cyclohexanes Chemical class 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000058 cyclopentadienyl group Chemical group C1(=CC=CC1)* 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000004855 decalinyl group Chemical group C1(CCCC2CCCCC12)* 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 229910052805 deuterium Inorganic materials 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 125000005331 diazinyl group Chemical group N1=NC(=CC=C1)* 0.000 description 1
- WMKGGPCROCCUDY-PHEQNACWSA-N dibenzylideneacetone Chemical compound C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 WMKGGPCROCCUDY-PHEQNACWSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- OOKFLLNDYNWCHK-UHFFFAOYSA-N difluoromethyl(trimethyl)silane Chemical compound C[Si](C)(C)C(F)F OOKFLLNDYNWCHK-UHFFFAOYSA-N 0.000 description 1
- 125000004852 dihydrofuranyl group Chemical group O1C(CC=C1)* 0.000 description 1
- 125000004639 dihydroindenyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000005043 dihydropyranyl group Chemical group O1C(CCC=C1)* 0.000 description 1
- 125000004925 dihydropyridyl group Chemical group N1(CC=CC=C1)* 0.000 description 1
- 125000005057 dihydrothienyl group Chemical group S1C(CC=C1)* 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 208000037765 diseases and disorders Diseases 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- SACNIGZYDTUHKB-UHFFFAOYSA-N ditert-butyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane Chemical group CC(C)C1=CC(C(C)C)=CC(C(C)C)=C1C1=CC=CC=C1P(C(C)(C)C)C(C)(C)C SACNIGZYDTUHKB-UHFFFAOYSA-N 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-M dodecanoate Chemical compound CCCCCCCCCCCC([O-])=O POULHZVOKOAJMA-UHFFFAOYSA-M 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- ZSWFCLXCOIISFI-UHFFFAOYSA-N endo-cyclopentadiene Natural products C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 230000001973 epigenetic effect Effects 0.000 description 1
- 238000011067 equilibration Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- SNOHGJYJJUSAKS-CSKARUKUSA-N ethyl (e)-4,4,4-trifluoro-3-phenylbut-2-enoate Chemical compound CCOC(=O)\C=C(C(F)(F)F)/C1=CC=CC=C1 SNOHGJYJJUSAKS-CSKARUKUSA-N 0.000 description 1
- ZXOUEUVDLLFLIX-UHFFFAOYSA-N ethyl 4,4-difluoro-3-phenylbutanoate Chemical compound CCOC(=O)CC(C(F)F)C1=CC=CC=C1 ZXOUEUVDLLFLIX-UHFFFAOYSA-N 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N ethyl formate Chemical group CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- NEZRFXZYPAIZAD-UHFFFAOYSA-N ethylcyclobutane Chemical compound CCC1CCC1 NEZRFXZYPAIZAD-UHFFFAOYSA-N 0.000 description 1
- ITZHTNFXLDFAPB-UHFFFAOYSA-N ethylcycloheptane Chemical compound CCC1CCCCCC1 ITZHTNFXLDFAPB-UHFFFAOYSA-N 0.000 description 1
- FOTXAJDDGPYIFU-UHFFFAOYSA-N ethylcyclopropane Chemical compound CCC1CC1 FOTXAJDDGPYIFU-UHFFFAOYSA-N 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 230000004110 gluconeogenesis Effects 0.000 description 1
- 230000004153 glucose metabolism Effects 0.000 description 1
- IFPWCRBNZXUWGC-UHFFFAOYSA-M gold(1+);triphenylphosphane;chloride Chemical compound [Cl-].[Au+].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 IFPWCRBNZXUWGC-UHFFFAOYSA-M 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 210000003494 hepatocyte Anatomy 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-M hexadecanoate Chemical compound CCCCCCCCCCCCCCCC([O-])=O IPCSVZSSVZVIGE-UHFFFAOYSA-M 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003395 histamine H3 receptor antagonist Substances 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 238000003119 immunoblot Methods 0.000 description 1
- 230000002779 inactivation Effects 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000008011 inorganic excipient Substances 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- QWXYZCJEXYQNEI-OSZHWHEXSA-N intermediate I Chemical compound COC(=O)[C@@]1(C=O)[C@H]2CC=[N+](C\C2=C\C)CCc2c1[nH]c1ccccc21 QWXYZCJEXYQNEI-OSZHWHEXSA-N 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 229960004903 invert sugar Drugs 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 238000004255 ion exchange chromatography Methods 0.000 description 1
- 150000008040 ionic compounds Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000005438 isoindazolyl group Chemical group 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 229940011051 isopropyl acetate Drugs 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000004628 isothiazolidinyl group Chemical group S1N(CCC1)* 0.000 description 1
- 125000005969 isothiazolinyl group Chemical group 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 125000003965 isoxazolidinyl group Chemical group 0.000 description 1
- 229940000764 kyprolis Drugs 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- JMZFEHDNIAQMNB-UHFFFAOYSA-N m-aminophenylboronic acid Chemical compound NC1=CC=CC(B(O)O)=C1 JMZFEHDNIAQMNB-UHFFFAOYSA-N 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 208000030159 metabolic disease Diseases 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- IWBGCGJFRAUEDE-UHFFFAOYSA-N methanimidamide;hydrate Chemical compound O.NC=N IWBGCGJFRAUEDE-UHFFFAOYSA-N 0.000 description 1
- GBUTXWFQJYQYIK-UHFFFAOYSA-N methyl 4-amino-1-ethylpyrazole-3-carboxylate Chemical compound CCN1C=C(N)C(C(=O)OC)=N1 GBUTXWFQJYQYIK-UHFFFAOYSA-N 0.000 description 1
- 125000006533 methyl amino methyl group Chemical group [H]N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 230000035772 mutation Effects 0.000 description 1
- 201000000050 myeloid neoplasm Diseases 0.000 description 1
- DILRJUIACXKSQE-UHFFFAOYSA-N n',n'-dimethylethane-1,2-diamine Chemical compound CN(C)CCN DILRJUIACXKSQE-UHFFFAOYSA-N 0.000 description 1
- HVOYZOQVDYHUPF-UHFFFAOYSA-N n,n',n'-trimethylethane-1,2-diamine Chemical compound CNCCN(C)C HVOYZOQVDYHUPF-UHFFFAOYSA-N 0.000 description 1
- HXRAMSFGUAOAJR-UHFFFAOYSA-N n,n,n',n'-tetramethyl-1-[(2-methylpropan-2-yl)oxy]methanediamine Chemical compound CN(C)C(N(C)C)OC(C)(C)C HXRAMSFGUAOAJR-UHFFFAOYSA-N 0.000 description 1
- SJYQYOVTHISIKX-UHFFFAOYSA-N n,n-dimethylformamide;n-ethyl-n-propan-2-ylpropan-2-amine Chemical compound CN(C)C=O.CCN(C(C)C)C(C)C SJYQYOVTHISIKX-UHFFFAOYSA-N 0.000 description 1
- MLACQEBQGUBHKX-UHFFFAOYSA-N n,n-dimethylpiperidin-1-amine Chemical group CN(C)N1CCCCC1 MLACQEBQGUBHKX-UHFFFAOYSA-N 0.000 description 1
- NOJMAMCOSWQCTO-UHFFFAOYSA-N n-(2-pyrrolidin-1-ylethyl)aniline Chemical compound C=1C=CC=CC=1NCCN1CCCC1 NOJMAMCOSWQCTO-UHFFFAOYSA-N 0.000 description 1
- NGQUDAHKKSMIIK-XTZNXHDOSA-N n-[(1s)-1-(4-bromophenyl)-2,2-difluoroethyl]-2-methylpropane-2-sulfinamide Chemical compound CC(C)(C)[S@@](=O)N[C@H](C(F)F)C1=CC=C(Br)C=C1 NGQUDAHKKSMIIK-XTZNXHDOSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- GOQYKNQRPGWPLP-UHFFFAOYSA-N n-heptadecyl alcohol Natural products CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 208000015122 neurodegenerative disease Diseases 0.000 description 1
- 231100000344 non-irritating Toxicity 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000007718 nuclear exclusion Effects 0.000 description 1
- 235000020824 obesity Nutrition 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003883 ointment base Substances 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 230000004650 oncogenic pathway Effects 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000001792 phenanthrenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C=CC12)* 0.000 description 1
- 229950009215 phenylbutanoic acid Drugs 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- GJQNVZVOTKFLIU-UHFFFAOYSA-N piperidin-1-ium-4-one;chloride Chemical compound Cl.O=C1CCNCC1 GJQNVZVOTKFLIU-UHFFFAOYSA-N 0.000 description 1
- HDOWRFHMPULYOA-UHFFFAOYSA-N piperidin-4-ol Chemical compound OC1CCNCC1 HDOWRFHMPULYOA-UHFFFAOYSA-N 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 230000004481 post-translational protein modification Effects 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 230000004063 proteosomal degradation Effects 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- DOTPSQVYOBAWPQ-UHFFFAOYSA-N pyrazolo[4,3-d]pyrimidin-3-one Chemical compound N1=CN=C2C(=O)N=NC2=C1 DOTPSQVYOBAWPQ-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- HZFPPBMKGYINDF-UHFFFAOYSA-N pyrimidin-5-ylboronic acid Chemical compound OB(O)C1=CN=CN=C1 HZFPPBMKGYINDF-UHFFFAOYSA-N 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- DXVAQZJPPDWTNY-UHFFFAOYSA-N pyrrolo[3,2-d]pyrimidin-2-one Chemical compound O=C1N=CC2=NC=CC2=N1 DXVAQZJPPDWTNY-UHFFFAOYSA-N 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000022983 regulation of cell cycle Effects 0.000 description 1
- 210000003289 regulatory T cell Anatomy 0.000 description 1
- 239000013557 residual solvent Substances 0.000 description 1
- 229940100486 rice starch Drugs 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 230000019491 signal transduction Effects 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 150000003385 sodium Chemical class 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- XGPOMXSYOKFBHS-UHFFFAOYSA-M sodium;trifluoromethanesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C(F)(F)F XGPOMXSYOKFBHS-UHFFFAOYSA-M 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 238000007921 solubility assay Methods 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 125000003003 spiro group Chemical group 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 230000004960 subcellular localization Effects 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 125000005415 substituted alkoxy group Chemical group 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000007940 sugar coated tablet Substances 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- HXIRQGQBQZUNOU-VAWYXSNFSA-N tert-butyl (3E)-3-(dimethylaminomethylidene)-2-oxo-1-oxa-8-azaspiro[4.5]decane-8-carboxylate Chemical compound CN(C)\C=C/1\C(OC2(C\1)CCN(CC2)C(=O)OC(C)(C)C)=O HXIRQGQBQZUNOU-VAWYXSNFSA-N 0.000 description 1
- ULSBMKGFFFMGOI-UHFFFAOYSA-N tert-butyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC11OC1 ULSBMKGFFFMGOI-UHFFFAOYSA-N 0.000 description 1
- VNRTYICFNIBACK-UHFFFAOYSA-N tert-butyl 4-[(3-bromo-2-ethyl-7-oxopyrazolo[4,3-d]pyrimidin-6-yl)methyl]-4-hydroxypiperidine-1-carboxylate Chemical compound BrC=1N(N=C2C=1N=CN(C2=O)CC1(CCN(CC1)C(=O)OC(C)(C)C)O)CC VNRTYICFNIBACK-UHFFFAOYSA-N 0.000 description 1
- RSYPXJFNLSORHT-UHFFFAOYSA-N tert-butyl 4-[(3-bromo-2-methyl-7-oxopyrazolo[4,3-d]pyrimidin-6-yl)methyl]-4-hydroxypiperidine-1-carboxylate Chemical compound Cn1nc2c(ncn(CC3(O)CCN(CC3)C(=O)OC(C)(C)C)c2=O)c1Br RSYPXJFNLSORHT-UHFFFAOYSA-N 0.000 description 1
- RJANMUJZJKCWID-UHFFFAOYSA-N tert-butyl 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1=CB1OC(C)(C)C(C)(C)O1 RJANMUJZJKCWID-UHFFFAOYSA-N 0.000 description 1
- LNFBZQPOMMTVEK-UHFFFAOYSA-N tert-butyl 4-[(4-chloro-5-methyl-6-oxopyrimidin-1-yl)methyl]-4-hydroxypiperidine-1-carboxylate Chemical compound ClC=1N=CN(C(C=1C)=O)CC1(CCN(CC1)C(=O)OC(C)(C)C)O LNFBZQPOMMTVEK-UHFFFAOYSA-N 0.000 description 1
- LEMQGMHLRVOIHL-UHFFFAOYSA-N tert-butyl 4-hydroxy-4-[(4-oxofuro[2,3-d]pyrimidin-3-yl)methyl]piperidine-1-carboxylate Chemical compound OC1(CCN(CC1)C(=O)OC(C)(C)C)CN1C=NC2=C(C1=O)C=CO2 LEMQGMHLRVOIHL-UHFFFAOYSA-N 0.000 description 1
- AHNLHNKQBPLMPO-UHFFFAOYSA-N tert-butyl 4-hydroxy-4-[hydroxy-(4-oxopyrido[1,2-a]pyrimidin-3-yl)methyl]piperidine-1-carboxylate Chemical compound OC1(CCN(CC1)C(=O)OC(C)(C)C)C(C1=CN=C2N(C1=O)C=CC=C2)O AHNLHNKQBPLMPO-UHFFFAOYSA-N 0.000 description 1
- ROUYFJUVMYHXFJ-UHFFFAOYSA-N tert-butyl 4-oxopiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(=O)CC1 ROUYFJUVMYHXFJ-UHFFFAOYSA-N 0.000 description 1
- JXHYRACBNLSETP-SNVBAGLBSA-N tert-butyl N-[(2R)-1-pyrrolidin-1-ylpropan-2-yl]carbamate Chemical compound N1(CCCC1)C[C@@H](C)NC(OC(C)(C)C)=O JXHYRACBNLSETP-SNVBAGLBSA-N 0.000 description 1
- DWIQLJRRFMPIJC-GGAORHGYSA-N tert-butyl N-[(3S)-1-[1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-oxopyrimidin-4-yl]pyrrolidin-3-yl]carbamate Chemical compound OC1(CCN(CC1)C(C[C@@H](C)C1=CC=CC=C1)=O)CN1C=NC(=CC1=O)N1C[C@H](CC1)NC(OC(C)(C)C)=O DWIQLJRRFMPIJC-GGAORHGYSA-N 0.000 description 1
- JSWBSIRKRBKYAN-HXUWFJFHSA-N tert-butyl N-[1-[1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-oxopyrimidin-4-yl]azetidin-3-yl]carbamate Chemical compound OC1(CCN(CC1)C(C[C@@H](C)C1=CC=CC=C1)=O)CN1C=NC(=CC1=O)N1CC(C1)NC(OC(C)(C)C)=O JSWBSIRKRBKYAN-HXUWFJFHSA-N 0.000 description 1
- UCACBDXIGRSWEN-JTQLQIEISA-N tert-butyl N-[2-[(3S)-3-methylpyrrolidin-1-yl]ethyl]carbamate Chemical compound C[C@@H]1CN(CC1)CCNC(OC(C)(C)C)=O UCACBDXIGRSWEN-JTQLQIEISA-N 0.000 description 1
- UGDQUABGKPINGG-UHFFFAOYSA-N tert-butyl N-[[4-(6-chloropurin-9-yl)phenyl]methyl]carbamate Chemical compound ClC1=C2N=CN(C2=NC=N1)C1=CC=C(CNC(OC(C)(C)C)=O)C=C1 UGDQUABGKPINGG-UHFFFAOYSA-N 0.000 description 1
- SFIQPTXIKHLPIE-UHFFFAOYSA-N tert-butyl N-[[4-[(6-chloro-5-nitropyrimidin-4-yl)amino]phenyl]methyl]carbamate Chemical compound ClC1=C(C(=NC=N1)NC1=CC=C(CNC(OC(C)(C)C)=O)C=C1)[N+](=O)[O-] SFIQPTXIKHLPIE-UHFFFAOYSA-N 0.000 description 1
- XPBVKBOOWCYHHS-XMMPIXPASA-N tert-butyl N-[[4-[2-ethyl-6-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-7-oxopyrazolo[4,3-d]pyrimidin-3-yl]phenyl]methyl]carbamate Chemical compound C(C)N1N=C2C(N=CN(C2=O)CC2(CCN(CC2)C(C[C@@H](C)C2=CC=CC=C2)=O)O)=C1C1=CC=C(CNC(OC(C)(C)C)=O)C=C1 XPBVKBOOWCYHHS-XMMPIXPASA-N 0.000 description 1
- RUPAXCPQAAOIPB-UHFFFAOYSA-N tert-butyl formate Chemical compound CC(C)(C)OC=O RUPAXCPQAAOIPB-UHFFFAOYSA-N 0.000 description 1
- AOCSUUGBCMTKJH-UHFFFAOYSA-N tert-butyl n-(2-aminoethyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCN AOCSUUGBCMTKJH-UHFFFAOYSA-N 0.000 description 1
- GPTXCAZYUMDUMN-UHFFFAOYSA-N tert-butyl n-(2-hydroxyethyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCO GPTXCAZYUMDUMN-UHFFFAOYSA-N 0.000 description 1
- NEMXVXVJGXZDRR-UHFFFAOYSA-N tert-butyl n-(azetidin-3-yl)carbamate Chemical compound CC(C)(C)OC(=O)NC1CNC1 NEMXVXVJGXZDRR-UHFFFAOYSA-N 0.000 description 1
- DQQJBEAXSOOCPG-SSDOTTSWSA-N tert-butyl n-[(3r)-pyrrolidin-3-yl]carbamate Chemical compound CC(C)(C)OC(=O)N[C@@H]1CCNC1 DQQJBEAXSOOCPG-SSDOTTSWSA-N 0.000 description 1
- WUOQXNWMYLFAHT-QMMMGPOBSA-N tert-butyl n-[(3s)-piperidin-3-yl]carbamate Chemical compound CC(C)(C)OC(=O)N[C@H]1CCCNC1 WUOQXNWMYLFAHT-QMMMGPOBSA-N 0.000 description 1
- DQQJBEAXSOOCPG-ZETCQYMHSA-N tert-butyl n-[(3s)-pyrrolidin-3-yl]carbamate Chemical compound CC(C)(C)OC(=O)N[C@H]1CCNC1 DQQJBEAXSOOCPG-ZETCQYMHSA-N 0.000 description 1
- UXWQXBSQQHAGMG-UHFFFAOYSA-N tert-butyl n-[(4-aminophenyl)methyl]carbamate Chemical compound CC(C)(C)OC(=O)NCC1=CC=C(N)C=C1 UXWQXBSQQHAGMG-UHFFFAOYSA-N 0.000 description 1
- IIUCSVYIICFIGA-UHFFFAOYSA-N tert-butyl n-[(4-bromophenyl)methyl]-n-methylcarbamate Chemical compound CC(C)(C)OC(=O)N(C)CC1=CC=C(Br)C=C1 IIUCSVYIICFIGA-UHFFFAOYSA-N 0.000 description 1
- MGDIIQXOACAHIU-UHFFFAOYSA-N tert-butyl n-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamate Chemical compound C1=CC(CCNC(=O)OC(C)(C)C)=CC=C1B1OC(C)(C)C(C)(C)O1 MGDIIQXOACAHIU-UHFFFAOYSA-N 0.000 description 1
- CUDCEJRRWNIPDL-UHFFFAOYSA-N tert-butyl n-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate Chemical compound C1=CC(CNC(=O)OC(C)(C)C)=CC=C1B1OC(C)(C)C(C)(C)O1 CUDCEJRRWNIPDL-UHFFFAOYSA-N 0.000 description 1
- MZFOCJORKNCEMQ-UHFFFAOYSA-N tert-butyl n-methyl-n-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate Chemical compound C1=CC(CN(C)C(=O)OC(C)(C)C)=CC=C1B1OC(C)(C)C(C)(C)O1 MZFOCJORKNCEMQ-UHFFFAOYSA-N 0.000 description 1
- CKXZPVPIDOJLLM-UHFFFAOYSA-N tert-butyl n-piperidin-4-ylcarbamate Chemical compound CC(C)(C)OC(=O)NC1CCNCC1 CKXZPVPIDOJLLM-UHFFFAOYSA-N 0.000 description 1
- RQCNHUCCQJMSRG-UHFFFAOYSA-N tert-butyl piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCCCC1 RQCNHUCCQJMSRG-UHFFFAOYSA-N 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000003507 tetrahydrothiofenyl group Chemical group 0.000 description 1
- 125000004632 tetrahydrothiopyranyl group Chemical group S1C(CCCC1)* 0.000 description 1
- 125000005329 tetralinyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000002769 thiazolinyl group Chemical group 0.000 description 1
- GFZLEUSLQORNJJ-UHFFFAOYSA-N thieno[3,2-d]pyrimidine 5-oxide Chemical compound C1=NC=C2S(=O)C=CC2=N1 GFZLEUSLQORNJJ-UHFFFAOYSA-N 0.000 description 1
- 125000005032 thiofuranyl group Chemical group S1C(=CC=C1)* 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 231100000440 toxicity profile Toxicity 0.000 description 1
- 230000002103 transcriptional effect Effects 0.000 description 1
- 238000011277 treatment modality Methods 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- CWMFRHBXRUITQE-UHFFFAOYSA-N trimethylsilylacetylene Chemical compound C[Si](C)(C)C#C CWMFRHBXRUITQE-UHFFFAOYSA-N 0.000 description 1
- VFJYIHQDILEQNR-UHFFFAOYSA-M trimethylsulfanium;iodide Chemical compound [I-].C[S+](C)C VFJYIHQDILEQNR-UHFFFAOYSA-M 0.000 description 1
- 229910052722 tritium Inorganic materials 0.000 description 1
- 238000010798 ubiquitination Methods 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- 229940099039 velcade Drugs 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 229940100445 wheat starch Drugs 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/10—Spiro-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
- A61K31/506—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim not condensed and containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
- A61K31/519—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim ortho- or peri-condensed with heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
- A61K31/519—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim ortho- or peri-condensed with heterocyclic rings
- A61K31/52—Purines, e.g. adenine
- A61K31/522—Purines, e.g. adenine having oxo groups directly attached to the heterocyclic ring, e.g. hypoxanthine, guanine, acyclovir
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K45/00—Medicinal preparations containing active ingredients not provided for in groups A61K31/00 - A61K41/00
- A61K45/06—Mixtures of active ingredients without chemical characterisation, e.g. antiphlogistics and cardiaca
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/08—Bridged systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/10—Spiro-condensed systems
- C07D491/107—Spiro-condensed systems with only one oxygen atom as ring hetero atom in the oxygen-containing ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D493/00—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system
- C07D493/02—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system in which the condensed system contains two hetero rings
- C07D493/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K2300/00—Mixtures or combinations of active ingredients, wherein at least one active ingredient is fully defined in groups A61K31/00 - A61K41/00
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Hydrogenated Pyridines (AREA)
- Peptides Or Proteins (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GBGB1617758.6A GB201617758D0 (en) | 2016-10-20 | 2016-10-20 | Pharmaceutical compounds |
| PCT/GB2017/053175 WO2018073602A1 (en) | 2016-10-20 | 2017-10-20 | Piperidine derivatives as inhibitors of ubiquitin specific protease 7 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ES2914284T3 true ES2914284T3 (es) | 2022-06-08 |
Family
ID=57738053
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ES17790829T Active ES2914284T3 (es) | 2016-10-20 | 2017-10-20 | Derivados de piperidina como inhibidores de la proteasa específica de la ubiquitina 7 |
Country Status (16)
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB201612938D0 (en) | 2016-07-26 | 2016-09-07 | Almac Discovery Ltd | Pharmaceutical compounds |
| JP7402792B2 (ja) * | 2017-09-26 | 2023-12-21 | デイナ ファーバー キャンサー インスティチュート,インコーポレイテッド | 多発性骨髄腫を治療するための新規なusp7阻害剤 |
| GB201801562D0 (en) | 2018-01-31 | 2018-03-14 | Almac Diagnostics Ltd | Pharmaceutical compounds |
| UY38291A (es) * | 2018-07-05 | 2020-06-30 | Servier Lab | Nuevos derivados de amino-pirimidonilo un proceso para su preparación y composiciones farmacéuticas |
| UY38423A (es) * | 2018-10-19 | 2021-02-26 | Servier Lab | Nuevos derivados amino-pirimidonil-piperidinilo, un proceso para su preparación y composiciones farmacéuticas que los contienen |
| JP7508449B2 (ja) * | 2018-10-22 | 2024-07-01 | デイナ ファーバー キャンサー インスティチュート,インコーポレイテッド | Usp7の阻害 |
| CN109912598B (zh) * | 2019-03-27 | 2022-09-13 | 四川大学华西医院 | 防治炎症反应的核苷类衍生物及其应用 |
| CN117050086A (zh) * | 2019-04-11 | 2023-11-14 | 四川科伦博泰生物医药股份有限公司 | 含有并环基团的嘧啶酮并吡唑类化合物、其制备方法及用途 |
| CN113423709B (zh) * | 2019-04-11 | 2024-02-09 | 四川科伦博泰生物医药股份有限公司 | 三嗪酮并咪唑类化合物及其医药用途 |
| EP3965749A4 (en) * | 2019-05-06 | 2023-06-21 | Valo Health, Inc. | INHIBITION OF USP19 |
| CN118108744A (zh) * | 2020-01-08 | 2024-05-31 | 四川科伦博泰生物医药股份有限公司 | 异噻唑并嘧啶酮类化合物,包含其的药物组合物及其用途 |
| CN112608320B (zh) * | 2020-01-16 | 2023-03-17 | 中国药科大学 | 哌啶类化合物及其制备方法和医药用途 |
| GB202001980D0 (en) | 2020-02-13 | 2020-04-01 | Almac Discovery Ltd | Therapeutic mentods |
| CA3167473A1 (en) | 2020-02-28 | 2021-09-02 | Immunologik Gmbh | Inhibitors of human deubiquitinases for the treatment of coronaviral infections |
| CN113801135B (zh) * | 2020-06-15 | 2025-06-24 | 四川科伦博泰生物医药股份有限公司 | 噻吩并吡唑类化合物,包含其的药物组合物及其用途 |
| CN112047933B (zh) * | 2020-10-15 | 2022-06-14 | 郑州大学 | 喹唑啉酮类usp7抑制剂及其制备方法和应用 |
| CN114478437A (zh) * | 2020-11-11 | 2022-05-13 | 山东特珐曼药业有限公司 | 一种制备n-甲基-2-吡咯烷乙胺或其盐的方法 |
| CN113336714A (zh) * | 2021-06-25 | 2021-09-03 | 山东大学 | 一种化合物及其制备方法和应用 |
| WO2022272133A2 (en) * | 2021-06-25 | 2022-12-29 | Stablix, Inc. | Protein stabilizing compounds containing usp7 ligands |
| CN118401507A (zh) * | 2021-07-20 | 2024-07-26 | 丹娜法伯癌症研究院 | 靶向泛素特异性蛋白酶7(usp7)的抑制剂 |
| GB202200753D0 (en) | 2022-01-21 | 2022-03-09 | Almac Discovery Ltd | Pharmaceutical compounds |
| CN114507278B (zh) * | 2022-01-27 | 2023-04-25 | 苏州大学 | 一种犹素探针UFM1-Lys-TAMRA及其合成方法 |
Family Cites Families (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AUPO111096A0 (en) * | 1996-07-18 | 1996-08-08 | Fujisawa Pharmaceutical Co., Ltd. | New compound |
| ZA986594B (en) | 1997-07-25 | 1999-01-27 | Abbott Lab | Urokinase inhibitors |
| AU2003301095A1 (en) | 2002-12-23 | 2004-07-22 | Merck And Co., Inc. | 4(spiropiperidinyl)methyl substituted pyrrolidines as modulators of chemokine receptor activity |
| US20050090529A1 (en) * | 2003-07-31 | 2005-04-28 | Pfizer Inc | 3,5 Disubstituted indazole compounds with nitrogen-bearing 5-membered heterocycles, pharmaceutical compositions, and methods for mediating or inhibiting cell proliferation |
| JP4787529B2 (ja) * | 2004-04-09 | 2011-10-05 | 大塚製薬株式会社 | 医薬組成物 |
| US7884207B2 (en) * | 2004-06-18 | 2011-02-08 | 3M Innovative Properties Company | Substituted imidazoquinolines, imidazopyridines, and imidazonaphthyridines |
| US7943636B2 (en) * | 2005-04-01 | 2011-05-17 | 3M Innovative Properties Company | 1-substituted pyrazolo (3,4-C) ring compounds as modulators of cytokine biosynthesis for the treatment of viral infections and neoplastic diseases |
| JP2009502801A (ja) | 2005-07-22 | 2009-01-29 | サネシス ファーマシューティカルズ, インコーポレイテッド | Auroraキナーゼインヒビターとして有用なピラゾロピリミジン |
| EP1749822B1 (en) | 2005-08-05 | 2008-10-15 | Hybrigenics S.A. | Novel cysteine protease inhibitors and their therapeutic applications |
| US20100121048A1 (en) * | 2006-02-16 | 2010-05-13 | Takanobu Kuroita | Cyclic Amine Compound and Use Thereof for the Prophylaxis or Treatment of Hypertension |
| CA2666406A1 (en) * | 2006-10-16 | 2008-04-24 | Gruenenthal Gmbh | Substituted sulfonamide derivatives for use as bradykinin 1 receptor modulators |
| US7875613B2 (en) | 2006-10-30 | 2011-01-25 | Hybrigenics Sa | Tetracyclic inhibitors of cysteine proteases, the pharmaceutical compositions thereof and their therapeutic applications |
| FR2911138B1 (fr) * | 2007-01-05 | 2009-02-20 | Sanofi Aventis Sa | Nouveaux derives de n, n'-2,4-dianilinopyrimidines, leur preparation a titre de medicaments, compositions pharmaceutiques et notamment comme inhibiteurs de ikk |
| CN101896473B (zh) | 2007-12-11 | 2012-07-25 | 霍夫曼-拉罗奇有限公司 | 硬脂酰基辅酶a去饱和酶抑制剂 |
| ES2531398T3 (es) * | 2008-02-22 | 2015-03-13 | Msd Kk | Nuevos derivados de aminopiridina que tienen una acción inhibidora selectiva de Aurora A |
| CN102099339A (zh) * | 2008-07-18 | 2011-06-15 | 武田药品工业株式会社 | 苯并氮杂衍生物及其作为组胺h3拮抗剂的用途 |
| CA2732628A1 (en) | 2008-08-01 | 2010-02-04 | Biocryst Pharmaceuticals, Inc. | Therapeutic agents |
| WO2010020556A1 (en) * | 2008-08-22 | 2010-02-25 | Evotec Neurosciences Gmbh | New bradykinin b1 antagonists |
| EP2208725A1 (en) | 2009-01-13 | 2010-07-21 | Hybrigenics S.A. | Novel specific inhibitors of ubiquitin specific protease 7, the pharmaceutical compositions thereof and their therapeutic applications |
| US8680139B2 (en) | 2009-04-01 | 2014-03-25 | Progenra | Anti-neoplastic compounds, compositions and methods |
| EP2515657A4 (en) | 2009-12-21 | 2013-07-03 | Merck Sharp & Dohme | Tyrosine kinase inhibitor |
| EP2357176A1 (en) | 2010-01-15 | 2011-08-17 | Hybrigenics S.A. | Amidoacridine derivatives useful as selective inhibitors of ubiquitin specific protease 7 |
| TWI503323B (zh) | 2010-03-29 | 2015-10-11 | Oncotherapy Science Inc | 三環化合物以及含此化合物之pbk抑制劑 |
| JP5765342B2 (ja) * | 2010-08-10 | 2015-08-19 | アステラス製薬株式会社 | へテロ環化合物 |
| JP2012072067A (ja) * | 2010-09-28 | 2012-04-12 | Astellas Pharma Inc | 含窒素芳香族へテロ環化合物 |
| GB201114448D0 (en) | 2011-08-22 | 2011-10-05 | Takeda Pharmaceutical | Compounds and their use |
| EP2565186A1 (en) | 2011-09-02 | 2013-03-06 | Hybrigenics S.A. | Selective and reversible inhibitors of ubiquitin specific protease 7 |
| UA115133C2 (uk) * | 2011-10-07 | 2017-09-25 | Такеда Фармасьютікал Компані Лімітед | Сполуки 1-арилкарбоніл-4-оксипіперидину, придатні для лікування нейродегенеративних захворювань |
| WO2013080141A1 (en) * | 2011-11-29 | 2013-06-06 | Novartis Ag | Pyrazolopyrrolidine compounds |
| MX347917B (es) | 2012-03-09 | 2017-05-17 | Lexicon Pharmaceuticals Inc | Compuestos a base de imidazo[1,2-b]piridazina, composiciones que los comprenden, y metodos para su uso. |
| WO2014045101A1 (en) * | 2012-09-21 | 2014-03-27 | Cellzome Gmbh | Tetrazolo quinoxaline derivatives as tankyrase inhibitors |
| WO2014139144A1 (en) * | 2013-03-15 | 2014-09-18 | Agios Pharmaceuticals, Inc. | Therapeutic compounds and compositions |
| AP2016009020A0 (en) * | 2013-07-18 | 2016-02-29 | Novartis Ag | Autotaxin inhibitors comprising a heteroaromatic ring-benzyl-amide-cycle core |
| WO2015046193A1 (ja) * | 2013-09-25 | 2015-04-02 | 塩野義製薬株式会社 | Trpv4阻害活性を有する芳香族複素環式アミン誘導体 |
| RU2021102805A (ru) * | 2014-12-05 | 2021-02-12 | Эррэй Биофарма Инк. | 4,6-ЗАМЕЩЕННЫЕ ПИРАЗОЛО[1,5-a]ПИРАЗИНЫ В КАЧЕСТВЕ ИНГИБИТОРОВ ЯНУС-КИНАЗЫ |
| TWI698436B (zh) * | 2014-12-30 | 2020-07-11 | 美商佛瑪治療公司 | 作為泛素特異性蛋白酶7抑制劑之吡咯并及吡唑并嘧啶 |
| MA41291A (fr) | 2014-12-30 | 2017-11-07 | Forma Therapeutics Inc | Dérivés de la pyrrolotriazinone et de l'imidazotriazinone en tant qu'inhibiteurs de la protéase spécifique de l'ubiquitine n° 7 (usp7) pour le traitement d'un cancer |
| US9932351B2 (en) * | 2015-02-05 | 2018-04-03 | Forma Therapeutics, Inc. | Thienopyrimidinones as ubiquitin-specific protease 7 inhibitors |
| JP2018504430A (ja) | 2015-02-05 | 2018-02-15 | フォーマ セラピューティクス,インコーポレイテッド | ユビキチン特異的プロテアーゼ7阻害物質としてのキナゾリノン及びアザキナゾリノン |
| US9938300B2 (en) * | 2015-02-05 | 2018-04-10 | Forma Therapeutics, Inc. | Isothiazolopyrimidinones, pyrazolopyrimidinones, and pyrrolopyrimidinones as ubiquitin-specific protease 7 inhibitors |
| EP3271333B1 (en) | 2015-03-20 | 2022-01-12 | F. Hoffmann-La Roche AG | Usp7 inhibitor compounds and methods of use |
| GB201604638D0 (en) | 2016-03-18 | 2016-05-04 | Mission Therapeutics Ltd | Novel compounds |
| GB201604647D0 (en) | 2016-03-18 | 2016-05-04 | Mission Therapeutics Ltd | Novel compounds |
| GB201612938D0 (en) * | 2016-07-26 | 2016-09-07 | Almac Discovery Ltd | Pharmaceutical compounds |
| ES3033182T3 (en) * | 2016-09-20 | 2025-07-31 | Dana Farber Cancer Inst Inc | Compositions and methods for identification, assessment, prevention, and treatment of aml using usp10 biomarkers and modulators |
-
2016
- 2016-10-20 GB GBGB1617758.6A patent/GB201617758D0/en not_active Ceased
-
2017
- 2017-10-20 WO PCT/GB2017/053175 patent/WO2018073602A1/en not_active Ceased
- 2017-10-20 DK DK17790829.0T patent/DK3529241T3/da active
- 2017-10-20 SG SG11201903456WA patent/SG11201903456WA/en unknown
- 2017-10-20 KR KR1020197014463A patent/KR20190069529A/ko not_active Withdrawn
- 2017-10-20 JP JP2019520996A patent/JP7073359B2/ja active Active
- 2017-10-20 CN CN201780077139.8A patent/CN110088096A/zh not_active Withdrawn
- 2017-10-20 AU AU2017346516A patent/AU2017346516B2/en not_active Revoked
- 2017-10-20 MX MX2019004450A patent/MX2019004450A/es unknown
- 2017-10-20 ES ES17790829T patent/ES2914284T3/es active Active
- 2017-10-20 BR BR112019007977A patent/BR112019007977A2/pt not_active Application Discontinuation
- 2017-10-20 CA CA3040805A patent/CA3040805A1/en not_active Withdrawn
- 2017-10-20 RU RU2019115115A patent/RU2019115115A/ru unknown
- 2017-10-20 EP EP17790829.0A patent/EP3529241B1/en not_active Revoked
- 2017-10-20 US US16/343,917 patent/US10766903B2/en not_active Expired - Fee Related
- 2017-10-20 EP EP22157226.6A patent/EP4026832A1/en not_active Withdrawn
-
2019
- 2019-04-16 MX MX2021012589A patent/MX2021012589A/es unknown
- 2019-04-18 IL IL266146A patent/IL266146A/en unknown
-
2022
- 2022-05-11 JP JP2022077871A patent/JP2022106953A/ja not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| CN110088096A (zh) | 2019-08-02 |
| MX2021012589A (es) | 2021-11-12 |
| EP4026832A1 (en) | 2022-07-13 |
| EP3529241B1 (en) | 2022-04-06 |
| SG11201903456WA (en) | 2019-05-30 |
| GB201617758D0 (en) | 2016-12-07 |
| AU2017346516A1 (en) | 2019-05-02 |
| US20190256518A1 (en) | 2019-08-22 |
| CA3040805A1 (en) | 2018-04-26 |
| IL266146A (en) | 2019-06-30 |
| US10766903B2 (en) | 2020-09-08 |
| DK3529241T3 (da) | 2022-07-11 |
| JP2019535664A (ja) | 2019-12-12 |
| KR20190069529A (ko) | 2019-06-19 |
| JP2022106953A (ja) | 2022-07-20 |
| EP3529241A1 (en) | 2019-08-28 |
| RU2019115115A3 (cg-RX-API-DMAC7.html) | 2020-11-24 |
| RU2019115115A (ru) | 2020-11-24 |
| MX2019004450A (es) | 2019-08-05 |
| WO2018073602A1 (en) | 2018-04-26 |
| JP7073359B2 (ja) | 2022-05-23 |
| AU2017346516B2 (en) | 2021-10-14 |
| BR112019007977A2 (pt) | 2019-07-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES2914284T3 (es) | Derivados de piperidina como inhibidores de la proteasa específica de la ubiquitina 7 | |
| ES2650013T3 (es) | Pirimidopirimidinonas útiles como inhibidores de la quinasa Wee-1 | |
| EP3697784B9 (en) | Imidazo[4,5-b]pyridine compounds and pharmaceutical compositions thereof for the treatment of inflammatory disorders | |
| BR112021002479A2 (pt) | composto, composição farmacêutica, método para inibir a atividade de itk ou jak3 em uma população de células, método para tratar um distúrbio mediado por itk ou jak3 em um indivíduo necessitando do mesmo e uso de um composto | |
| CN112384510A (zh) | Rip1抑制性化合物以及制备和使用其的方法 | |
| ES2934958T3 (es) | Derivados de 4-hidroxipiperidina y su uso como inhibidores de la proteasa 19 específica de ubicuitina (USP19) | |
| KR20150090044A (ko) | 아자퀴나졸린 카복사미드 유도체 | |
| US20220033397A1 (en) | Pharmaceutical compounds and their use as inhibitors of ubiquitin specific protease 19 (usp19) | |
| US20240327382A1 (en) | Pharmaceutical compounds as inhibitors of ubiquitin specific protease 19 | |
| RU2785126C2 (ru) | Новые соединения и их фармацевтические композиции для лечения воспалительных заболеваний |