DK3174852T3 - ARYL HYDRAZIDES CONTAINING A 2-PYRIDON PART AS SELECTIVE ANTIBACTERIALS - Google Patents
ARYL HYDRAZIDES CONTAINING A 2-PYRIDON PART AS SELECTIVE ANTIBACTERIALS Download PDFInfo
- Publication number
- DK3174852T3 DK3174852T3 DK15750274.1T DK15750274T DK3174852T3 DK 3174852 T3 DK3174852 T3 DK 3174852T3 DK 15750274 T DK15750274 T DK 15750274T DK 3174852 T3 DK3174852 T3 DK 3174852T3
- Authority
- DK
- Denmark
- Prior art keywords
- alkyl
- oxo
- 4alkyl
- carboxylic acid
- hydrogen
- Prior art date
Links
- 229940088710 antibiotic agent Drugs 0.000 title abstract description 13
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical group OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 title abstract description 5
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 title 1
- 208000015181 infectious disease Diseases 0.000 claims abstract description 30
- 238000000034 method Methods 0.000 claims abstract description 28
- 239000003242 anti bacterial agent Substances 0.000 claims abstract description 15
- 238000002360 preparation method Methods 0.000 claims abstract description 11
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 9
- 230000008569 process Effects 0.000 claims abstract description 9
- 239000003814 drug Substances 0.000 claims abstract description 7
- 150000001875 compounds Chemical class 0.000 claims description 257
- 229910052739 hydrogen Inorganic materials 0.000 claims description 188
- 239000001257 hydrogen Substances 0.000 claims description 188
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 120
- 229910052736 halogen Inorganic materials 0.000 claims description 116
- -1 -COOR 12 Chemical group 0.000 claims description 115
- 150000002367 halogens Chemical class 0.000 claims description 99
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 72
- 125000000217 alkyl group Chemical group 0.000 claims description 66
- 150000003839 salts Chemical class 0.000 claims description 47
- 239000012453 solvate Substances 0.000 claims description 42
- 125000001424 substituent group Chemical group 0.000 claims description 13
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 11
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- RGZCKPXTNJAWMR-UHFFFAOYSA-N 1,2-dihydro-1-methyl-2-oxopyridine-5-carboxylic acid Natural products CN1C=C(C(O)=O)C=CC1=O RGZCKPXTNJAWMR-UHFFFAOYSA-N 0.000 claims description 5
- 239000003937 drug carrier Substances 0.000 claims description 5
- 125000002950 monocyclic group Chemical group 0.000 claims description 5
- MAZIROXFIAJVQN-UHFFFAOYSA-N 1-benzyl-2-oxo-n'-[2-(trifluoromethyl)phenyl]pyridine-3-carbohydrazide Chemical compound FC(F)(F)C1=CC=CC=C1NNC(=O)C(C1=O)=CC=CN1CC1=CC=CC=C1 MAZIROXFIAJVQN-UHFFFAOYSA-N 0.000 claims description 3
- 229940079593 drug Drugs 0.000 claims description 3
- WSDUAZUBRUEIIL-UHFFFAOYSA-N 1-[(2-chlorophenyl)methyl]-n'-methyl-6-oxo-n'-phenylpyridine-3-carbohydrazide Chemical compound C=1C=CC=CC=1N(C)NC(=O)C(=C1)C=CC(=O)N1CC1=CC=CC=C1Cl WSDUAZUBRUEIIL-UHFFFAOYSA-N 0.000 claims description 2
- UWBIFBXYDQJWOD-UHFFFAOYSA-N 1-[(3-methylphenyl)methyl]-2-oxo-n'-[3-(trifluoromethyl)phenyl]pyridine-3-carbohydrazide Chemical compound CC1=CC=CC(CN2C(C(C(=O)NNC=3C=C(C=CC=3)C(F)(F)F)=CC=C2)=O)=C1 UWBIFBXYDQJWOD-UHFFFAOYSA-N 0.000 claims description 2
- ZXCNQNFWZBDWOM-UHFFFAOYSA-N 1-benzyl-4,6-dimethyl-2-oxo-N'-phenylpyridine-3-carbohydrazide Chemical compound C1(=CC=CC=C1)NNC(=O)C=1C(N(C(=CC=1C)C)CC1=CC=CC=C1)=O ZXCNQNFWZBDWOM-UHFFFAOYSA-N 0.000 claims description 2
- WXNLKTSGVAMFOB-UHFFFAOYSA-N 1-methyl-2-oxo-n'-(2,4,6-trichlorophenyl)pyridine-4-carbohydrazide Chemical compound O=C1N(C)C=CC(C(=O)NNC=2C(=CC(Cl)=CC=2Cl)Cl)=C1 WXNLKTSGVAMFOB-UHFFFAOYSA-N 0.000 claims description 2
- IQRMMSOCEVXJTF-UHFFFAOYSA-N 1-methyl-6-oxo-N'-phenylpyridine-2-carbohydrazide Chemical compound C1(=CC=CC=C1)NNC(=O)C=1N(C(C=CC=1)=O)C IQRMMSOCEVXJTF-UHFFFAOYSA-N 0.000 claims description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims 18
- 125000003545 alkoxy group Chemical group 0.000 claims 12
- 150000002431 hydrogen Chemical class 0.000 claims 9
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 6
- 125000003118 aryl group Chemical group 0.000 claims 4
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 2
- 125000004215 2,4-difluorophenyl group Chemical group [H]C1=C([H])C(*)=C(F)C([H])=C1F 0.000 claims 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims 1
- 125000000304 alkynyl group Chemical group 0.000 claims 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims 1
- 241000588626 Acinetobacter baumannii Species 0.000 abstract description 37
- 230000000844 anti-bacterial effect Effects 0.000 abstract description 11
- 238000011282 treatment Methods 0.000 abstract description 11
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 95
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 64
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 57
- 239000011541 reaction mixture Substances 0.000 description 56
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 54
- 239000000243 solution Substances 0.000 description 48
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 46
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-diisopropylethylamine Substances CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 45
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 44
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 37
- 239000007787 solid Substances 0.000 description 35
- 230000002829 reductive effect Effects 0.000 description 34
- 238000005160 1H NMR spectroscopy Methods 0.000 description 32
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 32
- 235000019439 ethyl acetate Nutrition 0.000 description 32
- 229940093499 ethyl acetate Drugs 0.000 description 31
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 31
- 239000012044 organic layer Substances 0.000 description 28
- NQIGVOXZWAROOG-UHFFFAOYSA-N 1-methyl-6-oxopyridine-2-carboxylic acid Chemical compound CN1C(C(O)=O)=CC=CC1=O NQIGVOXZWAROOG-UHFFFAOYSA-N 0.000 description 27
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 25
- 239000007832 Na2SO4 Substances 0.000 description 24
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 24
- 229910052938 sodium sulfate Inorganic materials 0.000 description 24
- 235000011152 sodium sulphate Nutrition 0.000 description 24
- 239000002904 solvent Substances 0.000 description 24
- 238000006243 chemical reaction Methods 0.000 description 23
- 239000012267 brine Substances 0.000 description 22
- 238000004440 column chromatography Methods 0.000 description 22
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 22
- 239000007821 HATU Substances 0.000 description 21
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 21
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 20
- 125000005843 halogen group Chemical group 0.000 description 20
- 229910052731 fluorine Inorganic materials 0.000 description 19
- 239000011737 fluorine Substances 0.000 description 19
- 239000000741 silica gel Substances 0.000 description 18
- 229910002027 silica gel Inorganic materials 0.000 description 18
- XMIIGOLPHOKFCH-UHFFFAOYSA-N 3-phenylpropionic acid Chemical compound OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 17
- 125000001153 fluoro group Chemical group F* 0.000 description 17
- 229910052757 nitrogen Inorganic materials 0.000 description 16
- FEKUXLUOKFSMRO-UHFFFAOYSA-N (4-fluorophenyl)hydrazine;hydron;chloride Chemical compound Cl.NNC1=CC=C(F)C=C1 FEKUXLUOKFSMRO-UHFFFAOYSA-N 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 239000000203 mixture Substances 0.000 description 13
- 238000003756 stirring Methods 0.000 description 13
- 241000894006 Bacteria Species 0.000 description 12
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000005457 ice water Substances 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 10
- 239000012299 nitrogen atmosphere Substances 0.000 description 10
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000005859 coupling reaction Methods 0.000 description 9
- 238000004128 high performance liquid chromatography Methods 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- 239000002253 acid Substances 0.000 description 8
- GJLWQAUHCDNAEK-UHFFFAOYSA-N methyl 6-oxo-1h-pyridine-2-carboxylate Chemical compound COC(=O)C1=CC=CC(O)=N1 GJLWQAUHCDNAEK-UHFFFAOYSA-N 0.000 description 8
- 206010035664 Pneumonia Diseases 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 6
- XUKWOJNDLIOXSC-UHFFFAOYSA-N 1-methyl-2-oxopyridine-4-carboxylic acid Chemical compound CN1C=CC(C(O)=O)=CC1=O XUKWOJNDLIOXSC-UHFFFAOYSA-N 0.000 description 6
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 6
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 6
- 239000007822 coupling agent Substances 0.000 description 6
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 238000007254 oxidation reaction Methods 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 208000019206 urinary tract infection Diseases 0.000 description 6
- FXKINDGWHBDPDY-UHFFFAOYSA-N 1-(2-amino-2-oxoethyl)-6-oxopyridine-2-carboxylic acid Chemical compound NC(CN1C(=CC=CC1=O)C(=O)O)=O FXKINDGWHBDPDY-UHFFFAOYSA-N 0.000 description 5
- UXQGAMVICZDTEV-UHFFFAOYSA-N 1-[2-(dimethylamino)-2-oxoethyl]-6-oxopyridine-2-carboxylic acid Chemical compound CN(C(CN1C(=CC=CC1=O)C(=O)O)=O)C UXQGAMVICZDTEV-UHFFFAOYSA-N 0.000 description 5
- UENKXQVSDZHOQI-UHFFFAOYSA-N 1-ethyl-2-oxopyridine-3-carboxylic acid Chemical compound CCN1C=CC=C(C(O)=O)C1=O UENKXQVSDZHOQI-UHFFFAOYSA-N 0.000 description 5
- GWCRVVADHPQNNB-UHFFFAOYSA-N 1-ethyl-6-oxopyridine-2-carboxylic acid Chemical compound CCN1C(C(O)=O)=CC=CC1=O GWCRVVADHPQNNB-UHFFFAOYSA-N 0.000 description 5
- DFAQSHLYVFQOJM-UHFFFAOYSA-N 1-methyl-2-oxopyridine-3-carboxylic acid Chemical compound CN1C=CC=C(C(O)=O)C1=O DFAQSHLYVFQOJM-UHFFFAOYSA-N 0.000 description 5
- RYFABALCQHPBIM-UHFFFAOYSA-N 4-methoxy-1-methyl-6-oxopyridine-2-carboxylic acid Chemical compound COC1=CC(=O)N(C)C(=C1)C(O)=O RYFABALCQHPBIM-UHFFFAOYSA-N 0.000 description 5
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 description 5
- 241000194031 Enterococcus faecium Species 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 5
- 206010040047 Sepsis Diseases 0.000 description 5
- 208000009470 Ventilator-Associated Pneumonia Diseases 0.000 description 5
- 208000037815 bloodstream infection Diseases 0.000 description 5
- 230000008878 coupling Effects 0.000 description 5
- 238000010168 coupling process Methods 0.000 description 5
- 230000002401 inhibitory effect Effects 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 230000001225 therapeutic effect Effects 0.000 description 5
- DAUBRVMDSQBYFO-UHFFFAOYSA-N 1-(2-methoxyethyl)-6-oxopyridine-2-carboxylic acid Chemical compound COCCN1C(C(O)=O)=CC=CC1=O DAUBRVMDSQBYFO-UHFFFAOYSA-N 0.000 description 4
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 4
- 241000589291 Acinetobacter Species 0.000 description 4
- 241000588724 Escherichia coli Species 0.000 description 4
- 241000282414 Homo sapiens Species 0.000 description 4
- 241000588915 Klebsiella aerogenes Species 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 208000031650 Surgical Wound Infection Diseases 0.000 description 4
- 230000000845 anti-microbial effect Effects 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 238000011161 development Methods 0.000 description 4
- 238000010790 dilution Methods 0.000 description 4
- 239000012895 dilution Substances 0.000 description 4
- BHTPNYOMVLJREU-UHFFFAOYSA-N ethyl 6-oxo-1h-pyridine-2-carboxylate Chemical compound CCOC(=O)C1=CC=CC(=O)N1 BHTPNYOMVLJREU-UHFFFAOYSA-N 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 150000002430 hydrocarbons Chemical group 0.000 description 4
- 208000002551 irritable bowel syndrome Diseases 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 238000012746 preparative thin layer chromatography Methods 0.000 description 4
- 125000006239 protecting group Chemical group 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- SAXVYJMTJVYCCT-UHFFFAOYSA-N 1-(difluoromethyl)-6-oxopyridine-2-carboxylic acid Chemical compound FC(N1C(=CC=CC1=O)C(=O)O)F SAXVYJMTJVYCCT-UHFFFAOYSA-N 0.000 description 3
- UTHKVSFOOCIQAL-UHFFFAOYSA-N 1-[(2-chlorophenyl)methyl]-6-oxopyridine-3-carboxylic acid Chemical compound C1=C(C(=O)O)C=CC(=O)N1CC1=CC=CC=C1Cl UTHKVSFOOCIQAL-UHFFFAOYSA-N 0.000 description 3
- UUOJFUONBLNEEP-UHFFFAOYSA-N 1-[(3-methylphenyl)methyl]-2-oxopyridine-3-carboxylic acid Chemical compound CC1=CC=CC(CN2C(C(C(O)=O)=CC=C2)=O)=C1 UUOJFUONBLNEEP-UHFFFAOYSA-N 0.000 description 3
- WWQITSXZESSTGW-UHFFFAOYSA-N 1-benzyl-4,6-dimethyl-2-oxopyridine-3-carboxylic acid Chemical compound O=C1C(C(O)=O)=C(C)C=C(C)N1CC1=CC=CC=C1 WWQITSXZESSTGW-UHFFFAOYSA-N 0.000 description 3
- HZEFWASVLRGDDY-UHFFFAOYSA-N 1-benzyl-6-oxopyridine-2-carboxylic acid Chemical compound OC(=O)C1=CC=CC(=O)N1CC1=CC=CC=C1 HZEFWASVLRGDDY-UHFFFAOYSA-N 0.000 description 3
- SPWLGKANDBJTLJ-UHFFFAOYSA-N 1-ethyl-N'-(4-fluorophenyl)-2-oxopyridine-3-carbohydrazide Chemical compound FC1=CC=C(C=C1)NNC(=O)C=1C(N(C=CC=1)CC)=O SPWLGKANDBJTLJ-UHFFFAOYSA-N 0.000 description 3
- QMBPRTHEIXQSEI-UHFFFAOYSA-N 1-ethyl-N'-(4-fluorophenyl)-6-oxopyridine-2-carbohydrazide Chemical compound FC1=CC=C(C=C1)NNC(=O)C=1N(C(C=CC=1)=O)CC QMBPRTHEIXQSEI-UHFFFAOYSA-N 0.000 description 3
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- ORRDAPKKXQZMDX-UHFFFAOYSA-N 2-[2-[(4-fluoroanilino)carbamoyl]-6-oxopyridin-1-yl]acetamide Chemical compound FC1=CC=C(C=C1)NNC(=O)C=1N(C(C=CC=1)=O)CC(=O)N ORRDAPKKXQZMDX-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- ICBDLOCCWXMMTM-UHFFFAOYSA-N N'-(4-fluorophenyl)-1-(2-methoxyethyl)-6-oxopyridine-2-carbohydrazide Chemical compound FC1=CC=C(C=C1)NNC(=O)C=1N(C(C=CC=1)=O)CCOC ICBDLOCCWXMMTM-UHFFFAOYSA-N 0.000 description 3
- RVZCRYZPKJKJKX-UHFFFAOYSA-N N'-(4-fluorophenyl)-1-methyl-2-oxopyridine-3-carbohydrazide Chemical compound FC1=CC=C(C=C1)NNC(=O)C=1C(N(C=CC=1)C)=O RVZCRYZPKJKJKX-UHFFFAOYSA-N 0.000 description 3
- ZUHAJBXAXKAMMT-UHFFFAOYSA-N N'-(4-fluorophenyl)-6-oxo-1-prop-2-ynylpyridine-2-carbohydrazide Chemical compound FC1=CC=C(C=C1)NNC(=O)C=1N(C(C=CC=1)=O)CC#C ZUHAJBXAXKAMMT-UHFFFAOYSA-N 0.000 description 3
- XCWXXSNDTLOKOO-UHFFFAOYSA-N O=C1C=CC=C(N1CC#C)C(=O)OC Chemical compound O=C1C=CC=C(N1CC#C)C(=O)OC XCWXXSNDTLOKOO-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 125000001246 bromo group Chemical group Br* 0.000 description 3
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- HDZGZJOAFYSQFH-UHFFFAOYSA-N ethyl 1-(2-methoxyethyl)-6-oxopyridine-2-carboxylate Chemical compound C(C)OC(=O)C=1N(C(C=CC=1)=O)CCOC HDZGZJOAFYSQFH-UHFFFAOYSA-N 0.000 description 3
- RNSNJQKLQAEJKH-UHFFFAOYSA-N ethyl 1-ethyl-6-oxopyridine-2-carboxylate Chemical compound CCOC(=O)C1=CC=CC(=O)N1CC RNSNJQKLQAEJKH-UHFFFAOYSA-N 0.000 description 3
- PQVSTLUFSYVLTO-UHFFFAOYSA-N ethyl n-ethoxycarbonylcarbamate Chemical compound CCOC(=O)NC(=O)OCC PQVSTLUFSYVLTO-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 125000002346 iodo group Chemical group I* 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium hydroxide monohydrate Substances [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 3
- 229940040692 lithium hydroxide monohydrate Drugs 0.000 description 3
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 3
- JGJBLIZJHMBSKF-UHFFFAOYSA-N methyl 1-(2-amino-2-oxoethyl)-6-oxopyridine-2-carboxylate Chemical compound NC(CN1C(=CC=CC1=O)C(=O)OC)=O JGJBLIZJHMBSKF-UHFFFAOYSA-N 0.000 description 3
- AKTIQPZXMOXNTR-UHFFFAOYSA-N methyl 1-[2-(dimethylamino)-2-oxoethyl]-6-oxopyridine-2-carboxylate Chemical compound CN(C(CN1C(=CC=CC1=O)C(=O)OC)=O)C AKTIQPZXMOXNTR-UHFFFAOYSA-N 0.000 description 3
- NTMIEOOONNCVHU-UHFFFAOYSA-N methyl 4-methoxy-1-methyl-6-oxopyridine-2-carboxylate Chemical compound COC=1C=C(N(C(C=1)=O)C)C(=O)OC NTMIEOOONNCVHU-UHFFFAOYSA-N 0.000 description 3
- QCDPNIZGBUJNPP-UHFFFAOYSA-N methyl 4-methoxy-1-oxidopyridin-1-ium-2-carboxylate Chemical compound COC(=O)C1=CC(OC)=CC=[N+]1[O-] QCDPNIZGBUJNPP-UHFFFAOYSA-N 0.000 description 3
- FKDCVMMHCQVXCN-UHFFFAOYSA-N methyl 4-methoxy-6-oxo-1h-pyridine-2-carboxylate Chemical compound COC(=O)C1=CC(OC)=CC(=O)N1 FKDCVMMHCQVXCN-UHFFFAOYSA-N 0.000 description 3
- 244000052769 pathogen Species 0.000 description 3
- 230000001717 pathogenic effect Effects 0.000 description 3
- 235000015320 potassium carbonate Nutrition 0.000 description 3
- 235000011181 potassium carbonates Nutrition 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 3
- RIDRXGOBXZLKHZ-NZUANIILSA-N (3R,9S,12S,15S,18S,21S,24S,27R,30S,33S,36S,39S,42S,45S)-15,18,24,27,33-pentakis(2-aminoethyl)-30-(3-aminopropyl)-36-[(2S)-butan-2-yl]-42-[(1R)-1-hydroxyethyl]-9-(hydroxymethyl)-21,39-bis(1H-indol-3-ylmethyl)-12-methyl-1,7,10,13,16,19,22,25,28,31,34,37,40,43-tetradecazatricyclo[43.3.0.03,7]octatetracontane-2,8,11,14,17,20,23,26,29,32,35,38,41,44-tetradecone Chemical compound CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H](NC(=O)[C@@H]2CCCN2C(=O)[C@H]2CCCN2C(=O)[C@H](CO)NC(=O)[C@H](C)NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CCN)NC(=O)[C@@H](CCN)NC(=O)[C@H](CCCN)NC(=O)[C@H](CCN)NC1=O)[C@@H](C)O RIDRXGOBXZLKHZ-NZUANIILSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- QSHLSJXLGXSZKT-UHFFFAOYSA-N 1-(cyclopropylmethyl)-6-oxopyridine-2-carboxylic acid Chemical compound OC(=O)C1=CC=CC(=O)N1CC1CC1 QSHLSJXLGXSZKT-UHFFFAOYSA-N 0.000 description 2
- BVNJVNGUIZSNOH-UHFFFAOYSA-N 1-(cyclopropylmethyl)-N'-(4-fluorophenyl)-6-oxopyridine-2-carbohydrazide Chemical compound FC1=CC=C(C=C1)NNC(=O)C=1N(C(C=CC=1)=O)CC1CC1 BVNJVNGUIZSNOH-UHFFFAOYSA-N 0.000 description 2
- MQUDFHCBXPXZEJ-UHFFFAOYSA-N 1-(difluoromethyl)-N'-(4-fluorophenyl)-6-oxopyridine-2-carbohydrazide Chemical compound FC1=CC=C(C=C1)NNC(=O)C=1N(C(C=CC=1)=O)C(F)F MQUDFHCBXPXZEJ-UHFFFAOYSA-N 0.000 description 2
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 2
- JMUXBAQFXTYJBB-UHFFFAOYSA-N 1-benzyl-2-oxopyridine-3-carboxylic acid Chemical compound O=C1C(C(=O)O)=CC=CN1CC1=CC=CC=C1 JMUXBAQFXTYJBB-UHFFFAOYSA-N 0.000 description 2
- AMRRJTGTXAVWAI-UHFFFAOYSA-N 1-benzyl-N'-(4-fluorophenyl)-6-oxopyridine-2-carbohydrazide Chemical compound FC1=CC=C(C=C1)NNC(=O)C=1N(C(C=CC=1)=O)CC1=CC=CC=C1 AMRRJTGTXAVWAI-UHFFFAOYSA-N 0.000 description 2
- HNEGJTWNOOWEMH-UHFFFAOYSA-N 1-fluoropropane Chemical group [CH2]CCF HNEGJTWNOOWEMH-UHFFFAOYSA-N 0.000 description 2
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 2
- JQCSUVJDBHJKNG-UHFFFAOYSA-N 1-methoxy-ethyl Chemical group C[CH]OC JQCSUVJDBHJKNG-UHFFFAOYSA-N 0.000 description 2
- AFAUUJXXNNXDPI-UHFFFAOYSA-N 1-methyl-N'-(4-methylphenyl)-6-oxopyridine-2-carbohydrazide Chemical compound CC1=CC=C(C=C1)NNC(=O)C=1N(C(C=CC=1)=O)C AFAUUJXXNNXDPI-UHFFFAOYSA-N 0.000 description 2
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 2
- UEYQJQVBUVAELZ-UHFFFAOYSA-N 2-Hydroxynicotinic acid Chemical compound OC(=O)C1=CC=CN=C1O UEYQJQVBUVAELZ-UHFFFAOYSA-N 0.000 description 2
- 125000005999 2-bromoethyl group Chemical group 0.000 description 2
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 2
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 2
- KKZUMAMOMRDVKA-UHFFFAOYSA-N 2-chloropropane Chemical group [CH2]C(C)Cl KKZUMAMOMRDVKA-UHFFFAOYSA-N 0.000 description 2
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 2
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 2
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 2
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 2
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 2
- AUQZOHFAPVNKRN-UHFFFAOYSA-N 5-ethyl-1-methyl-6-oxopyridine-2-carboxylic acid Chemical compound CCC1=CC=C(C(O)=O)N(C)C1=O AUQZOHFAPVNKRN-UHFFFAOYSA-N 0.000 description 2
- VRCWSYYXUCKEED-UHFFFAOYSA-N 6-Hydroxypicolinic acid Chemical compound OC(=O)C1=CC=CC(=O)N1 VRCWSYYXUCKEED-UHFFFAOYSA-N 0.000 description 2
- YPTMUSIOZIZXCC-UHFFFAOYSA-N 6-oxo-1-(2,2,2-trifluoroethyl)pyridine-2-carboxylic acid Chemical compound OC(=O)C1=CC=CC(=O)N1CC(F)(F)F YPTMUSIOZIZXCC-UHFFFAOYSA-N 0.000 description 2
- FBJGDKDUIFLGNT-UHFFFAOYSA-N 6-oxo-1-prop-2-ynylpyridine-2-carboxylic acid Chemical compound C(C#C)N1C(=CC=CC1=O)C(=O)O FBJGDKDUIFLGNT-UHFFFAOYSA-N 0.000 description 2
- 208000035143 Bacterial infection Diseases 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- 208000032840 Catheter-Related Infections Diseases 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 108010078777 Colistin Proteins 0.000 description 2
- 206010011409 Cross infection Diseases 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241000588747 Klebsiella pneumoniae Species 0.000 description 2
- 201000009906 Meningitis Diseases 0.000 description 2
- 241000736262 Microbiota Species 0.000 description 2
- RWBKBJKGKXQOGS-UHFFFAOYSA-N N'-(2,4-difluorophenyl)-1-methyl-6-oxopyridine-2-carbohydrazide Chemical compound FC1=C(C=CC(=C1)F)NNC(=O)C=1N(C(C=CC=1)=O)C RWBKBJKGKXQOGS-UHFFFAOYSA-N 0.000 description 2
- LBJBDNVPUGTZLO-UHFFFAOYSA-N N'-(2,6-difluorophenyl)-1-methyl-6-oxopyridine-2-carbohydrazide Chemical compound FC1=C(C(=CC=C1)F)NNC(=O)C=1N(C(C=CC=1)=O)C LBJBDNVPUGTZLO-UHFFFAOYSA-N 0.000 description 2
- ORAZCTDAVHTJME-UHFFFAOYSA-N N'-(4-chlorophenyl)-1-methyl-6-oxopyridine-2-carbohydrazide Chemical compound ClC1=CC=C(C=C1)NNC(=O)C=1N(C(C=CC=1)=O)C ORAZCTDAVHTJME-UHFFFAOYSA-N 0.000 description 2
- FJUJKOSAYPLKRP-UHFFFAOYSA-N N'-(4-fluorophenyl)-1-methyl-2-oxopyridine-4-carbohydrazide Chemical compound FC1=CC=C(C=C1)NNC(=O)C1=CC(N(C=C1)C)=O FJUJKOSAYPLKRP-UHFFFAOYSA-N 0.000 description 2
- RDFAYMWAGUQRNT-UHFFFAOYSA-N N'-(4-fluorophenyl)-1-methyl-6-oxopyridine-2-carbohydrazide Chemical compound FC1=CC=C(C=C1)NNC(=O)C=1N(C(C=CC=1)=O)C RDFAYMWAGUQRNT-UHFFFAOYSA-N 0.000 description 2
- SPVNVUIKTWAGTP-UHFFFAOYSA-N N'-(4-fluorophenyl)-1-methyl-6-oxopyridine-3-carbohydrazide Chemical compound FC1=CC=C(C=C1)NNC(=O)C1=CN(C(C=C1)=O)C SPVNVUIKTWAGTP-UHFFFAOYSA-N 0.000 description 2
- WPUSKXFNPTTXPC-UHFFFAOYSA-N N'-(4-fluorophenyl)-4-methoxy-1-methyl-6-oxopyridine-2-carbohydrazide Chemical compound FC1=CC=C(C=C1)NNC(=O)C=1N(C(C=C(C=1)OC)=O)C WPUSKXFNPTTXPC-UHFFFAOYSA-N 0.000 description 2
- CWGSXZLFXSHZBA-UHFFFAOYSA-N N'-(4-fluorophenyl)-N',1-dimethyl-6-oxopyridine-2-carbohydrazide Chemical compound FC1=CC=C(C=C1)N(NC(=O)C=1N(C(C=CC=1)=O)C)C CWGSXZLFXSHZBA-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 206010029803 Nosocomial infection Diseases 0.000 description 2
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 2
- 206010062255 Soft tissue infection Diseases 0.000 description 2
- 241000191967 Staphylococcus aureus Species 0.000 description 2
- 241000193998 Streptococcus pneumoniae Species 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
- 238000009635 antibiotic susceptibility testing Methods 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 208000022362 bacterial infectious disease Diseases 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 230000003115 biocidal effect Effects 0.000 description 2
- 238000004364 calculation method Methods 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000004775 chlorodifluoromethyl group Chemical group FC(F)(Cl)* 0.000 description 2
- 125000004773 chlorofluoromethyl group Chemical group [H]C(F)(Cl)* 0.000 description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 2
- 125000004774 dichlorofluoromethyl group Chemical group FC(Cl)(Cl)* 0.000 description 2
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 2
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 229940092559 enterobacter aerogenes Drugs 0.000 description 2
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 2
- 238000003818 flash chromatography Methods 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 2
- 235000013355 food flavoring agent Nutrition 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 239000001963 growth medium Substances 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 2
- 230000000968 intestinal effect Effects 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 230000007774 longterm Effects 0.000 description 2
- 238000005399 mechanical ventilation Methods 0.000 description 2
- 230000002503 metabolic effect Effects 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 108010036341 murepavadin Proteins 0.000 description 2
- JORAUNFTUVJTNG-BSTBCYLQSA-N n-[(2s)-4-amino-1-[[(2s,3r)-1-[[(2s)-4-amino-1-oxo-1-[[(3s,6s,9s,12s,15r,18s,21s)-6,9,18-tris(2-aminoethyl)-3-[(1r)-1-hydroxyethyl]-12,15-bis(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptazacyclotricos-21-yl]amino]butan-2-yl]amino]-3-h Chemical compound CC(C)CCCCC(=O)N[C@@H](CCN)C(=O)N[C@H]([C@@H](C)O)CN[C@@H](CCN)C(=O)N[C@H]1CCNC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CCN)NC1=O.CCC(C)CCCCC(=O)N[C@@H](CCN)C(=O)N[C@H]([C@@H](C)O)CN[C@@H](CCN)C(=O)N[C@H]1CCNC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CCN)NC1=O JORAUNFTUVJTNG-BSTBCYLQSA-N 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000005246 nonafluorobutyl group Chemical group FC(F)(F)C(F)(F)C(F)(F)C(F)(F)* 0.000 description 2
- 244000039328 opportunistic pathogen Species 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- XDJYMJULXQKGMM-UHFFFAOYSA-N polymyxin E1 Natural products CCC(C)CCCCC(=O)NC(CCN)C(=O)NC(C(C)O)C(=O)NC(CCN)C(=O)NC1CCNC(=O)C(C(C)O)NC(=O)C(CCN)NC(=O)C(CCN)NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)C(CCN)NC1=O XDJYMJULXQKGMM-UHFFFAOYSA-N 0.000 description 2
- 230000002980 postoperative effect Effects 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 238000011321 prophylaxis Methods 0.000 description 2
- 125000005767 propoxymethyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])[#8]C([H])([H])* 0.000 description 2
- 230000005180 public health Effects 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 206010040872 skin infection Diseases 0.000 description 2
- 229940031000 streptococcus pneumoniae Drugs 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- 238000011200 topical administration Methods 0.000 description 2
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- AAMNNSRHAVREBH-UHFFFAOYSA-N (2,4-difluoroanilino)azanium;chloride Chemical compound Cl.NNC1=CC=C(F)C=C1F AAMNNSRHAVREBH-UHFFFAOYSA-N 0.000 description 1
- IPCPEQXQGSGYCE-UHFFFAOYSA-N (2,6-difluorophenyl)hydrazine Chemical compound NNC1=C(F)C=CC=C1F IPCPEQXQGSGYCE-UHFFFAOYSA-N 0.000 description 1
- FQHCPFMTXFJZJS-UHFFFAOYSA-N (4-methoxyphenyl)hydrazine;hydrochloride Chemical compound Cl.COC1=CC=C(NN)C=C1 FQHCPFMTXFJZJS-UHFFFAOYSA-N 0.000 description 1
- XAMBIJWZVIZZOG-UHFFFAOYSA-N (4-methylphenyl)hydrazine Chemical compound CC1=CC=C(NN)C=C1 XAMBIJWZVIZZOG-UHFFFAOYSA-N 0.000 description 1
- SGKRLCUYIXIAHR-AKNGSSGZSA-N (4s,4ar,5s,5ar,6r,12ar)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4h-tetracene-2-carboxamide Chemical compound C1=CC=C2[C@H](C)[C@@H]([C@H](O)[C@@H]3[C@](C(O)=C(C(N)=O)C(=O)[C@H]3N(C)C)(O)C3=O)C3=C(O)C2=C1O SGKRLCUYIXIAHR-AKNGSSGZSA-N 0.000 description 1
- FFTVPQUHLQBXQZ-KVUCHLLUSA-N (4s,4as,5ar,12ar)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4h-tetracene-2-carboxamide Chemical compound C1C2=C(N(C)C)C=CC(O)=C2C(O)=C2[C@@H]1C[C@H]1[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]1(O)C2=O FFTVPQUHLQBXQZ-KVUCHLLUSA-N 0.000 description 1
- SOVUOXKZCCAWOJ-HJYUBDRYSA-N (4s,4as,5ar,12ar)-9-[[2-(tert-butylamino)acetyl]amino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4h-tetracene-2-carboxamide Chemical compound C1C2=C(N(C)C)C=C(NC(=O)CNC(C)(C)C)C(O)=C2C(O)=C2[C@@H]1C[C@H]1[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]1(O)C2=O SOVUOXKZCCAWOJ-HJYUBDRYSA-N 0.000 description 1
- 125000006650 (C2-C4) alkynyl group Chemical group 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- FMHXXJNNWLWDLN-UHFFFAOYSA-N 1-(4-fluorophenyl)-1-methylhydrazine;hydrochloride Chemical compound Cl.CN(N)C1=CC=C(F)C=C1 FMHXXJNNWLWDLN-UHFFFAOYSA-N 0.000 description 1
- YZUPZGFPHUVJKC-UHFFFAOYSA-N 1-bromo-2-methoxyethane Chemical compound COCCBr YZUPZGFPHUVJKC-UHFFFAOYSA-N 0.000 description 1
- BSIMZHVOQZIAOY-SCSAIBSYSA-N 1-carbapenem-3-carboxylic acid Chemical compound OC(=O)C1=CC[C@@H]2CC(=O)N12 BSIMZHVOQZIAOY-SCSAIBSYSA-N 0.000 description 1
- ZLMJSPGGGYVQOP-UHFFFAOYSA-N 1-cyclopropyl-6-oxopyridine-2-carboxylic acid Chemical compound C1(CC1)N1C(=CC=CC1=O)C(=O)O ZLMJSPGGGYVQOP-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- RTMMSCJWQYWMNK-UHFFFAOYSA-N 2,2,2-trifluoroethyl trifluoromethanesulfonate Chemical compound FC(F)(F)COS(=O)(=O)C(F)(F)F RTMMSCJWQYWMNK-UHFFFAOYSA-N 0.000 description 1
- YZAZYCBKUGONAN-UHFFFAOYSA-N 2-[2-[(4-fluoroanilino)carbamoyl]-6-oxopyridin-1-yl]-N,N-dimethylacetamide Chemical compound FC1=CC=C(C=C1)NNC(=O)C=1N(C(C=CC=1)=O)CC(=O)N(C)C YZAZYCBKUGONAN-UHFFFAOYSA-N 0.000 description 1
- QPIOVNJLOVNTMW-UHFFFAOYSA-N 2-bromo-n,n-dimethylacetamide Chemical compound CN(C)C(=O)CBr QPIOVNJLOVNTMW-UHFFFAOYSA-N 0.000 description 1
- JUIKUQOUMZUFQT-UHFFFAOYSA-N 2-bromoacetamide Chemical compound NC(=O)CBr JUIKUQOUMZUFQT-UHFFFAOYSA-N 0.000 description 1
- 125000006020 2-methyl-1-propenyl group Chemical group 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 1
- XXNOGQJZAOXWAQ-UHFFFAOYSA-N 4-chlorophenylhydrazine Chemical compound NNC1=CC=C(Cl)C=C1 XXNOGQJZAOXWAQ-UHFFFAOYSA-N 0.000 description 1
- 241000193830 Bacillus <bacterium> Species 0.000 description 1
- BRTLKRNVNFIOPJ-UHFFFAOYSA-N Betaine homarine Chemical compound C[N+]1=CC=CC=C1C([O-])=O BRTLKRNVNFIOPJ-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 208000003322 Coinfection Diseases 0.000 description 1
- 108010069514 Cyclic Peptides Proteins 0.000 description 1
- 102000001189 Cyclic Peptides Human genes 0.000 description 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- 206010064687 Device related infection Diseases 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 239000001692 EU approved anti-caking agent Substances 0.000 description 1
- 230000005526 G1 to G0 transition Effects 0.000 description 1
- 208000008745 Healthcare-Associated Pneumonia Diseases 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 206010061598 Immunodeficiency Diseases 0.000 description 1
- 208000019693 Lung disease Diseases 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- WIABETPHZXKDHT-UHFFFAOYSA-N N'-(4-fluorophenyl)-6-oxo-1-(2,2,2-trifluoroethyl)pyridine-2-carbohydrazide Chemical compound FC1=CC=C(C=C1)NNC(=O)C=1N(C(C=CC=1)=O)CC(F)(F)F WIABETPHZXKDHT-UHFFFAOYSA-N 0.000 description 1
- BQSICZBZWLAORW-UHFFFAOYSA-N N'-(4-methoxyphenyl)-1-methyl-6-oxopyridine-2-carbohydrazide Chemical compound COC1=CC=C(C=C1)NNC(=O)C=1N(C(C=CC=1)=O)C BQSICZBZWLAORW-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 108010093965 Polymyxin B Proteins 0.000 description 1
- 108010040201 Polymyxins Proteins 0.000 description 1
- 241000589516 Pseudomonas Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical class [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 239000004098 Tetracycline Substances 0.000 description 1
- WKDDRNSBRWANNC-UHFFFAOYSA-N Thienamycin Natural products C1C(SCCN)=C(C(O)=O)N2C(=O)C(C(O)C)C21 WKDDRNSBRWANNC-UHFFFAOYSA-N 0.000 description 1
- 206010048038 Wound infection Diseases 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 125000005466 alkylenyl group Chemical group 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 229960004821 amikacin Drugs 0.000 description 1
- LKCWBDHBTVXHDL-RMDFUYIESA-N amikacin Chemical compound O([C@@H]1[C@@H](N)C[C@H]([C@@H]([C@H]1O)O[C@@H]1[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O1)O)NC(=O)[C@@H](O)CCN)[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O LKCWBDHBTVXHDL-RMDFUYIESA-N 0.000 description 1
- 229940126575 aminoglycoside Drugs 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 229940041011 carbapenems Drugs 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000001460 carbon-13 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 229960003346 colistin Drugs 0.000 description 1
- 230000001332 colony forming effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- WZHCOOQXZCIUNC-UHFFFAOYSA-N cyclandelate Chemical compound C1C(C)(C)CC(C)CC1OC(=O)C(O)C1=CC=CC=C1 WZHCOOQXZCIUNC-UHFFFAOYSA-N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 229910052805 deuterium Inorganic materials 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- 238000000502 dialysis Methods 0.000 description 1
- 229960004132 diethyl ether Drugs 0.000 description 1
- 238000003113 dilution method Methods 0.000 description 1
- 230000003467 diminishing effect Effects 0.000 description 1
- AASUFOVSZUIILF-UHFFFAOYSA-N diphenylmethanone;sodium Chemical compound [Na].C=1C=CC=CC=1C(=O)C1=CC=CC=C1 AASUFOVSZUIILF-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- AVAACINZEOAHHE-VFZPANTDSA-N doripenem Chemical compound C=1([C@H](C)[C@@H]2[C@H](C(N2C=1C(O)=O)=O)[C@H](O)C)S[C@@H]1CN[C@H](CNS(N)(=O)=O)C1 AVAACINZEOAHHE-VFZPANTDSA-N 0.000 description 1
- 229960000895 doripenem Drugs 0.000 description 1
- 239000012154 double-distilled water Substances 0.000 description 1
- 229960003722 doxycycline Drugs 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229940052303 ethers for general anesthesia Drugs 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 244000005709 gut microbiome Species 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 239000007902 hard capsule Substances 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- ZSKVGTPCRGIANV-ZXFLCMHBSA-N imipenem Chemical compound C1C(SCC\N=C\N)=C(C(O)=O)N2C(=O)[C@H]([C@H](O)C)[C@H]21 ZSKVGTPCRGIANV-ZXFLCMHBSA-N 0.000 description 1
- 229960002182 imipenem Drugs 0.000 description 1
- 230000036737 immune function Effects 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 229910003480 inorganic solid Inorganic materials 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- CRGZYKWWYNQGEC-UHFFFAOYSA-N magnesium;methanolate Chemical compound [Mg+2].[O-]C.[O-]C CRGZYKWWYNQGEC-UHFFFAOYSA-N 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229960002260 meropenem Drugs 0.000 description 1
- DMJNNHOOLUXYBV-PQTSNVLCSA-N meropenem Chemical compound C=1([C@H](C)[C@@H]2[C@H](C(N2C=1C(O)=O)=O)[C@H](O)C)S[C@@H]1CN[C@H](C(=O)N(C)C)C1 DMJNNHOOLUXYBV-PQTSNVLCSA-N 0.000 description 1
- OJDKENGKKYVJLY-UHFFFAOYSA-N methyl 4-methoxypyridine-2-carboxylate Chemical compound COC(=O)C1=CC(OC)=CC=N1 OJDKENGKKYVJLY-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229960004023 minocycline Drugs 0.000 description 1
- ADAMEOZKZQRNKP-UHFFFAOYSA-N n'-propylmethanediimine Chemical compound CCCN=C=N ADAMEOZKZQRNKP-UHFFFAOYSA-N 0.000 description 1
- YKQOSKADJPQZHB-YNWHQGOSSA-N n-[(2s)-4-amino-1-[[(2s,3r)-1-[[(2s)-4-amino-1-oxo-1-[[(3s,6s,9s,12s,15r,18s,21s)-6,9,18-tris(2-aminoethyl)-3-[(1s)-1-hydroxyethyl]-12,15-bis(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptazacyclotricos-21-yl]amino]butan-2-yl]amino]-3-h Polymers CCC(C)CCCC(=O)N[C@@H](CCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCN)C(=O)N[C@H]1CCNC(=O)[C@H]([C@H](C)O)NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CCN)NC1=O YKQOSKADJPQZHB-YNWHQGOSSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 238000012587 nuclear overhauser effect experiment Methods 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 210000004789 organ system Anatomy 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000024 polymyxin B Polymers 0.000 description 1
- KNIWPHSUTGNZST-UHFFFAOYSA-N polymyxin E2 Natural products CC(C)CCCCC(=O)NC(CCN)C(=O)NC(C(C)O)C(=O)NC(CCN)C(=O)NC1CCNC(=O)C(C(C)O)NC(=O)C(CCN)NC(=O)C(CCN)NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)C(CCN)NC1=O KNIWPHSUTGNZST-UHFFFAOYSA-N 0.000 description 1
- 229960005266 polymyxin b Drugs 0.000 description 1
- 229940041153 polymyxins Drugs 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 239000011369 resultant mixture Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 238000000527 sonication Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 235000011044 succinic acid Nutrition 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- NHGXDBSUJJNIRV-UHFFFAOYSA-M tetrabutylammonium chloride Chemical compound [Cl-].CCCC[N+](CCCC)(CCCC)CCCC NHGXDBSUJJNIRV-UHFFFAOYSA-M 0.000 description 1
- 235000019364 tetracycline Nutrition 0.000 description 1
- 150000003522 tetracyclines Chemical class 0.000 description 1
- 229940040944 tetracyclines Drugs 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 229960004089 tigecycline Drugs 0.000 description 1
- 229960000707 tobramycin Drugs 0.000 description 1
- NLVFBUXFDBBNBW-PBSUHMDJSA-N tobramycin Chemical compound N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N NLVFBUXFDBBNBW-PBSUHMDJSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 230000001018 virulence Effects 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/86—Hydrazides; Thio or imino analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/4412—Non condensed pyridines; Hydrogenated derivatives thereof having oxo groups directly attached to the heterocyclic ring
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/86—Hydrazides; Thio or imino analogues thereof
- C07D213/87—Hydrazides; Thio or imino analogues thereof in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Oncology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Communicable Diseases (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP14179089 | 2014-07-30 | ||
| PCT/EP2015/067345 WO2016016291A1 (en) | 2014-07-30 | 2015-07-29 | Arylhydrazides containing a 2-pyridone moiety as selective antibacterial agents |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK3174852T3 true DK3174852T3 (en) | 2018-09-10 |
Family
ID=51260651
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK15750274.1T DK3174852T3 (en) | 2014-07-30 | 2015-07-29 | ARYL HYDRAZIDES CONTAINING A 2-PYRIDON PART AS SELECTIVE ANTIBACTERIALS |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US9840467B2 (enExample) |
| EP (1) | EP3174852B1 (enExample) |
| JP (1) | JP2017523197A (enExample) |
| KR (1) | KR20170038822A (enExample) |
| CN (1) | CN106660962A (enExample) |
| AU (1) | AU2015295380A1 (enExample) |
| BR (1) | BR112017001803A2 (enExample) |
| CA (1) | CA2955559A1 (enExample) |
| CL (1) | CL2017000231A1 (enExample) |
| DK (1) | DK3174852T3 (enExample) |
| ES (1) | ES2687826T3 (enExample) |
| MX (1) | MX2017001280A (enExample) |
| PE (1) | PE20170430A1 (enExample) |
| PH (1) | PH12017500057A1 (enExample) |
| PL (1) | PL3174852T3 (enExample) |
| PT (1) | PT3174852T (enExample) |
| RU (1) | RU2017101154A (enExample) |
| WO (1) | WO2016016291A1 (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CR20180232A (es) | 2015-10-27 | 2018-05-31 | Hoffmann La Roche | Macrociclos peptídicos contra acinetobacter baumannii |
| ES2651943B2 (es) | 2016-07-29 | 2018-08-14 | ABAC Therapeutics, S.L. | Agentes antibacterianos de 2-pirrolidin fenilihidrazidas |
| US11505573B2 (en) | 2018-03-28 | 2022-11-22 | Hoffmann-La Roche Inc. | Peptide macrocycles against Acinetobacter baumannii |
| US11819532B2 (en) | 2018-04-23 | 2023-11-21 | Hoffmann-La Roche Inc. | Peptide macrocycles against Acinetobacter baumannii |
| WO2020169683A1 (en) * | 2019-02-19 | 2020-08-27 | Yncrea Hauts De France | Hydrazonopyrrolidine derivatives for use in preventing and/or treating disorders associated to acinetobacter baumannii |
| WO2020169682A1 (en) * | 2019-02-19 | 2020-08-27 | Yncrea Hauts De France | Hydrazide derivatives and their specific use as antibacterial agents by controlling acinetobacter baumannii bacterium |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH0399058A (ja) * | 1989-09-09 | 1991-04-24 | Kaken Pharmaceut Co Ltd | 複素５員環化合物 |
| DE60330126D1 (de) * | 2002-02-14 | 2009-12-31 | Pharmacia Corp | Substituierte pyridinone als modulatoren für p38 map kinase |
| SE0203348D0 (sv) * | 2002-11-12 | 2002-11-12 | Astrazeneca Ab | Novel compounds |
| TW200500341A (en) * | 2002-11-12 | 2005-01-01 | Astrazeneca Ab | Novel compounds |
| JP2007519735A (ja) * | 2004-01-30 | 2007-07-19 | メルク エンド カムパニー インコーポレーテッド | Ｈｉｖインテグラーゼ阻害剤として有用であるｎ−ベンジル−３，４−ジヒドロキシピリジン−２−カルボキサミド及びｎ−ベンジル−２，３−ジヒドロキシピリジン−４−カルボキサミド化合物 |
| WO2012051708A1 (en) * | 2010-10-21 | 2012-04-26 | The University Of British Columbia | Anti-bacterial pyruvate kinase modulator compounds, compositions, uses, and methods |
| EP2859007B1 (en) * | 2013-07-14 | 2019-04-17 | Olle Svenssons Partiaffär AB | Alkaloid compositions from ribes species to treat conditions associated with mitochondrial function or inhibition of pde4, pde5 and ikk-beta |
| KR102076820B1 (ko) * | 2013-10-21 | 2020-02-13 | 주식회사 대웅테라퓨틱스 | 신규한 항진균성 옥소다이하이드로피리딘카보하이드라자이드 유도체 |
-
2015
- 2015-07-29 CA CA2955559A patent/CA2955559A1/en not_active Abandoned
- 2015-07-29 KR KR1020177003051A patent/KR20170038822A/ko not_active Withdrawn
- 2015-07-29 PE PE2017000133A patent/PE20170430A1/es not_active Application Discontinuation
- 2015-07-29 PL PL15750274T patent/PL3174852T3/pl unknown
- 2015-07-29 RU RU2017101154A patent/RU2017101154A/ru not_active Application Discontinuation
- 2015-07-29 JP JP2017505253A patent/JP2017523197A/ja active Pending
- 2015-07-29 AU AU2015295380A patent/AU2015295380A1/en not_active Abandoned
- 2015-07-29 BR BR112017001803A patent/BR112017001803A2/pt not_active Application Discontinuation
- 2015-07-29 CN CN201580041697.XA patent/CN106660962A/zh active Pending
- 2015-07-29 DK DK15750274.1T patent/DK3174852T3/en active
- 2015-07-29 MX MX2017001280A patent/MX2017001280A/es unknown
- 2015-07-29 US US15/500,333 patent/US9840467B2/en active Active
- 2015-07-29 WO PCT/EP2015/067345 patent/WO2016016291A1/en not_active Ceased
- 2015-07-29 PT PT15750274T patent/PT3174852T/pt unknown
- 2015-07-29 EP EP15750274.1A patent/EP3174852B1/en active Active
- 2015-07-29 ES ES15750274.1T patent/ES2687826T3/es active Active
-
2017
- 2017-01-09 PH PH12017500057A patent/PH12017500057A1/en unknown
- 2017-01-27 CL CL2017000231A patent/CL2017000231A1/es unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BR112017001803A2 (pt) | 2018-02-14 |
| CA2955559A1 (en) | 2016-02-04 |
| MX2017001280A (es) | 2017-06-20 |
| JP2017523197A (ja) | 2017-08-17 |
| ES2687826T3 (es) | 2018-10-29 |
| US9840467B2 (en) | 2017-12-12 |
| US20170217887A1 (en) | 2017-08-03 |
| WO2016016291A1 (en) | 2016-02-04 |
| EP3174852B1 (en) | 2018-07-18 |
| PL3174852T3 (pl) | 2018-11-30 |
| KR20170038822A (ko) | 2017-04-07 |
| PE20170430A1 (es) | 2017-04-13 |
| RU2017101154A3 (enExample) | 2019-01-30 |
| PT3174852T (pt) | 2018-10-23 |
| CL2017000231A1 (es) | 2017-07-28 |
| EP3174852A1 (en) | 2017-06-07 |
| AU2015295380A1 (en) | 2017-02-02 |
| RU2017101154A (ru) | 2018-08-30 |
| PH12017500057A1 (en) | 2017-05-15 |
| CN106660962A (zh) | 2017-05-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK3174852T3 (en) | ARYL HYDRAZIDES CONTAINING A 2-PYRIDON PART AS SELECTIVE ANTIBACTERIALS | |
| EP3065738B1 (en) | Compositions and methods for modulating farnesoid x receptors | |
| US10766863B2 (en) | Monocarboxylate transport modulators and uses thereof | |
| IL305296A (en) | Amino acid compounds and methods of use | |
| CA3124130A1 (en) | Substituted 3-((3-aminophenyl)amino)piperidine-2,6-dione compounds, compositions thereof, and methods of treatment therewith | |
| EP3815689A1 (en) | Arenavirus growth inhibitor comprising polycyclic carbamoyl pyridone derivative | |
| US10150766B2 (en) | P2X7 modulators | |
| JP2018527293A (ja) | ブロモドメイン阻害剤としてのスピロ［シクロブタン−１，３’−インドリン］−２’−オン誘導体 | |
| EP3490984B1 (en) | 2-pyrrolidine phenylhydrazides antibacterial agents | |
| JP5653935B2 (ja) | 抗菌薬として有用なナフチリジン―２（１ｈ）−オン化合物 | |
| JP7746266B2 (ja) | 新規ピロール化合物 | |
| WO2015092118A1 (en) | Spiro[cyclobutane-1,3'-indolin]-2'-one derivatives as bromodomain inhibitors | |
| KR102610545B1 (ko) | Mdm2 억제제, 이의 제조 방법, 이의 약학 조성물 및 이의 용도 | |
| CA3225673A1 (en) | Organic pyridine-pyrazole compounds and their uses | |
| HK1232860A1 (en) | Arylhydrazides containing a 2-pyridone moiety as selective antibacterial agents | |
| CN112239457B (zh) | 一种乙酰基连接的加替沙星-1,2,3-三氮唑-靛红杂合体及其制备方法和应用 | |
| JP4926723B2 (ja) | フルオロアルキルピロリジン誘導体 | |
| WO2023224893A1 (en) | Inhibitors of msba as antibiotics, pharmaceutical compositions, and uses thereof | |
| WO2023224892A1 (en) | Inhibitors of msba as antibiotics, pharmaceutical compositions, and uses thereof | |
| JP4619952B2 (ja) | ８−シアノキノロンカルボン酸誘導体 | |
| EA049627B1 (ru) | Органические соединения пиридин-пиразола и их использование | |
| CN108409729A (zh) | 苯基八氢-1H-吡啶并[1,2-a]吡嗪衍生物及其用途 | |
| HK1224565A1 (en) | Compositions and methods for modulating farnesoid x receptors | |
| HK1224565B (en) | Compositions and methods for modulating farnesoid x receptors |