DK171352B1 - Metalkomplekser og salte deraf, fremgangsmåde til fremstilling af sådanne forbindelser samt diagnostiske midler og farmaceutiske præparater indeholdende forbindelserne - Google Patents
Metalkomplekser og salte deraf, fremgangsmåde til fremstilling af sådanne forbindelser samt diagnostiske midler og farmaceutiske præparater indeholdende forbindelserne Download PDFInfo
- Publication number
- DK171352B1 DK171352B1 DK320884A DK320884A DK171352B1 DK 171352 B1 DK171352 B1 DK 171352B1 DK 320884 A DK320884 A DK 320884A DK 320884 A DK320884 A DK 320884A DK 171352 B1 DK171352 B1 DK 171352B1
- Authority
- DK
- Denmark
- Prior art keywords
- bis
- group
- carboxymethyl
- acid
- general formula
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 30
- 150000003839 salts Chemical class 0.000 title claims abstract description 18
- 229910052751 metal Inorganic materials 0.000 title claims description 19
- 239000002184 metal Substances 0.000 title claims description 19
- 238000002360 preparation method Methods 0.000 title claims description 14
- 238000000034 method Methods 0.000 title claims description 12
- 239000000032 diagnostic agent Substances 0.000 title claims description 4
- 229940039227 diagnostic agent Drugs 0.000 title claims description 4
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 9
- 229910021645 metal ion Chemical group 0.000 claims abstract description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract 2
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 claims abstract 2
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 claims abstract 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 107
- -1 metal complex salts Chemical class 0.000 claims description 47
- 239000002253 acid Substances 0.000 claims description 38
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 claims description 16
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 claims description 12
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 10
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 9
- 150000002500 ions Chemical class 0.000 claims description 8
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical class CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 claims description 7
- 239000011651 chromium Substances 0.000 claims description 6
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 4
- 229910052797 bismuth Inorganic materials 0.000 claims description 4
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 4
- 150000007530 organic bases Chemical class 0.000 claims description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 3
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052689 Holmium Inorganic materials 0.000 claims description 3
- 229920000305 Nylon 6,10 Polymers 0.000 claims description 3
- 229910052772 Samarium Inorganic materials 0.000 claims description 3
- 229910052771 Terbium Inorganic materials 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 3
- 239000011575 calcium Substances 0.000 claims description 3
- 229910052791 calcium Inorganic materials 0.000 claims description 3
- 229910052804 chromium Inorganic materials 0.000 claims description 3
- KJZYNXUDTRRSPN-UHFFFAOYSA-N holmium atom Chemical compound [Ho] KJZYNXUDTRRSPN-UHFFFAOYSA-N 0.000 claims description 3
- 150000002430 hydrocarbons Chemical group 0.000 claims description 3
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 claims description 3
- KZUNJOHGWZRPMI-UHFFFAOYSA-N samarium atom Chemical compound [Sm] KZUNJOHGWZRPMI-UHFFFAOYSA-N 0.000 claims description 3
- 159000000000 sodium salts Chemical class 0.000 claims description 3
- GZCRRIHWUXGPOV-UHFFFAOYSA-N terbium atom Chemical compound [Tb] GZCRRIHWUXGPOV-UHFFFAOYSA-N 0.000 claims description 3
- 229910052725 zinc Inorganic materials 0.000 claims description 3
- 239000011701 zinc Substances 0.000 claims description 3
- 229910052684 Cerium Inorganic materials 0.000 claims description 2
- 150000000921 Gadolinium Chemical class 0.000 claims description 2
- 229910052746 lanthanum Inorganic materials 0.000 claims description 2
- 150000001414 amino alcohols Chemical class 0.000 claims 3
- 125000001424 substituent group Chemical group 0.000 claims 2
- DDJXXYZGKAHNMH-UHFFFAOYSA-N 2-[2-[2-(carboxymethylamino)ethylamino]ethylamino]acetic acid Chemical compound OC(=O)CNCCNCCNCC(O)=O DDJXXYZGKAHNMH-UHFFFAOYSA-N 0.000 claims 1
- HYFMOMOJNSNYEE-UHFFFAOYSA-N 2-cyclohexyl-n-(2-hydroxyethyl)acetamide Chemical compound OCCNC(=O)CC1CCCCC1 HYFMOMOJNSNYEE-UHFFFAOYSA-N 0.000 claims 1
- 229910052692 Dysprosium Inorganic materials 0.000 claims 1
- 229910001413 alkali metal ion Inorganic materials 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 239000002585 base Substances 0.000 claims 1
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 claims 1
- KBQHZAAAGSGFKK-UHFFFAOYSA-N dysprosium atom Chemical compound [Dy] KBQHZAAAGSGFKK-UHFFFAOYSA-N 0.000 claims 1
- 150000002505 iron Chemical class 0.000 claims 1
- 150000002696 manganese Chemical class 0.000 claims 1
- 150000002739 metals Chemical class 0.000 claims 1
- 125000004430 oxygen atom Chemical group O* 0.000 claims 1
- 125000001183 hydrocarbyl group Chemical group 0.000 abstract 2
- 229910052739 hydrogen Inorganic materials 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- 239000000843 powder Substances 0.000 description 51
- 239000000243 solution Substances 0.000 description 36
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 32
- 238000004458 analytical method Methods 0.000 description 28
- 238000006243 chemical reaction Methods 0.000 description 21
- 239000011572 manganese Substances 0.000 description 21
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 14
- 239000008139 complexing agent Substances 0.000 description 12
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- 229910052748 manganese Inorganic materials 0.000 description 9
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 8
- 229910052688 Gadolinium Inorganic materials 0.000 description 7
- UIWYJDYFSGRHKR-UHFFFAOYSA-N gadolinium atom Chemical compound [Gd] UIWYJDYFSGRHKR-UHFFFAOYSA-N 0.000 description 7
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 6
- 238000005481 NMR spectroscopy Methods 0.000 description 6
- 239000010949 copper Substances 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- KJJPLEZQSCZCKE-UHFFFAOYSA-N 2-aminopropane-1,3-diol Chemical compound OCC(N)CO KJJPLEZQSCZCKE-UHFFFAOYSA-N 0.000 description 5
- 150000008064 anhydrides Chemical class 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 5
- 229960000281 trometamol Drugs 0.000 description 5
- 238000002604 ultrasonography Methods 0.000 description 5
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 239000000729 antidote Substances 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- IJSMDZFKMKEIRX-UHFFFAOYSA-N morpholine-2,6-dione Chemical compound O=C1CNCC(=O)O1 IJSMDZFKMKEIRX-UHFFFAOYSA-N 0.000 description 4
- 230000007935 neutral effect Effects 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- LWBHHRRTOZQPDM-UHFFFAOYSA-N undecanedioic acid Chemical compound OC(=O)CCCCCCCCCC(O)=O LWBHHRRTOZQPDM-UHFFFAOYSA-N 0.000 description 4
- KQIGMPWTAHJUMN-UHFFFAOYSA-N 3-aminopropane-1,2-diol Chemical compound NCC(O)CO KQIGMPWTAHJUMN-UHFFFAOYSA-N 0.000 description 3
- WOMTYMDHLQTCHY-UHFFFAOYSA-N 3-methylamino-1,2-propanediol Chemical compound CNCC(O)CO WOMTYMDHLQTCHY-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 3
- 206010027439 Metal poisoning Diseases 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000002872 contrast media Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 3
- 229910052733 gallium Inorganic materials 0.000 description 3
- 150000007529 inorganic bases Chemical class 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 230000005298 paramagnetic effect Effects 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- LUKQTBHGYFDKQE-UHFFFAOYSA-N 2-[2-[bis(carboxymethyl)amino]ethyl-[2-(1,3-dihydroxypropan-2-ylamino)-2-oxoethyl]amino]acetic acid Chemical compound C(=O)(O)CN(CC(=O)O)CCN(CC(=O)O)CC(NC(CO)CO)=O LUKQTBHGYFDKQE-UHFFFAOYSA-N 0.000 description 2
- RAZLJUXJEOEYAM-UHFFFAOYSA-N 2-[bis[2-(2,6-dioxomorpholin-4-yl)ethyl]azaniumyl]acetate Chemical compound C1C(=O)OC(=O)CN1CCN(CC(=O)O)CCN1CC(=O)OC(=O)C1 RAZLJUXJEOEYAM-UHFFFAOYSA-N 0.000 description 2
- IRIRHXXUSZTSTF-UHFFFAOYSA-N 6-amino-2,2-dimethyl-1,3-dioxepin-5-ol Chemical compound CC1(C)OC=C(N)C(O)=CO1 IRIRHXXUSZTSTF-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- PMMCERFSRFDPSR-UHFFFAOYSA-N CNC(=O)CN(CCNCCNCCNC(CC(CO)O)C(=O)O)CC(=O)O Chemical compound CNC(=O)CN(CCNCCNCCNC(CC(CO)O)C(=O)O)CC(=O)O PMMCERFSRFDPSR-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- IOIFRTZBJMZZFO-UHFFFAOYSA-N dysprosium(3+) Chemical compound [Dy+3] IOIFRTZBJMZZFO-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 239000002502 liposome Substances 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 230000002285 radioactive effect Effects 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000008259 solid foam Substances 0.000 description 2
- 230000001954 sterilising effect Effects 0.000 description 2
- 238000004659 sterilization and disinfection Methods 0.000 description 2
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 229910052713 technetium Inorganic materials 0.000 description 2
- GKLVYJBZJHMRIY-UHFFFAOYSA-N technetium atom Chemical compound [Tc] GKLVYJBZJHMRIY-UHFFFAOYSA-N 0.000 description 2
- HQHCYKULIHKCEB-UHFFFAOYSA-N tetradecanedioic acid Chemical compound OC(=O)CCCCCCCCCCCCC(O)=O HQHCYKULIHKCEB-UHFFFAOYSA-N 0.000 description 2
- 238000009210 therapy by ultrasound Methods 0.000 description 2
- SWNDUEDARACPMW-UHFFFAOYSA-N 1-(methylamino)propane-1,1-diol Chemical compound CCC(O)(O)NC SWNDUEDARACPMW-UHFFFAOYSA-N 0.000 description 1
- RKXUSONQBMRJRB-UHFFFAOYSA-N 2-[2-[2-(carboxymethylamino)ethylamino]ethylamino]-4-[2,3-dihydroxypropyl(methyl)amino]-4-oxobutanoic acid Chemical compound OCC(O)CN(C)C(=O)CC(C(O)=O)NCCNCCNCC(O)=O RKXUSONQBMRJRB-UHFFFAOYSA-N 0.000 description 1
- MKDRHMDHWIBVRH-UHFFFAOYSA-N 2-amino-1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethanol Chemical group CC1(C)OCC(C(O)CN)O1 MKDRHMDHWIBVRH-UHFFFAOYSA-N 0.000 description 1
- RSHPXJWPCWGGSQ-UHFFFAOYSA-N 2-cyclohexyl-n-(1,3-dihydroxypropan-2-yl)acetamide Chemical compound OCC(CO)NC(=O)CC1CCCCC1 RSHPXJWPCWGGSQ-UHFFFAOYSA-N 0.000 description 1
- ZENLEBOJFXPFKO-UHFFFAOYSA-N 3-carbamoyl-2-[2-[2-(carboxymethylamino)ethylamino]ethylamino]-5-hydroxy-3-(2-hydroxyethyl)pentanoic acid Chemical compound OCCC(C(=O)N)(CCO)C(C(O)=O)NCCNCCNCC(O)=O ZENLEBOJFXPFKO-UHFFFAOYSA-N 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- POLIXZIAIMAECK-UHFFFAOYSA-N 4-[2-(2,6-dioxomorpholin-4-yl)ethyl]morpholine-2,6-dione Chemical compound C1C(=O)OC(=O)CN1CCN1CC(=O)OC(=O)C1 POLIXZIAIMAECK-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-UHFFFAOYSA-N 6-(methylamino)hexane-1,2,3,4,5-pentol Chemical compound CNCC(O)C(O)C(O)C(O)CO MBBZMMPHUWSWHV-UHFFFAOYSA-N 0.000 description 1
- QWOJMRHUQHTCJG-UHFFFAOYSA-N CC([CH2-])=O Chemical compound CC([CH2-])=O QWOJMRHUQHTCJG-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N EtOH Substances CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 229920001479 Hydroxyethyl methyl cellulose Polymers 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- QPCDCPDFJACHGM-UHFFFAOYSA-N N,N-bis{2-[bis(carboxymethyl)amino]ethyl}glycine Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(=O)O)CCN(CC(O)=O)CC(O)=O QPCDCPDFJACHGM-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 208000004880 Polyuria Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 1
- GTDPSWPPOUPBNX-UHFFFAOYSA-N ac1mqpva Chemical compound CC12C(=O)OC(=O)C1(C)C1(C)C2(C)C(=O)OC1=O GTDPSWPPOUPBNX-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- RUSUZAGBORAKPY-UHFFFAOYSA-N acetic acid;n'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine Chemical compound CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O.NCCNCCNCCN RUSUZAGBORAKPY-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 229940075522 antidotes Drugs 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- GWXLDORMOJMVQZ-UHFFFAOYSA-N cerium Chemical compound [Ce] GWXLDORMOJMVQZ-UHFFFAOYSA-N 0.000 description 1
- 150000003841 chloride salts Chemical class 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- 230000009918 complex formation Effects 0.000 description 1
- 230000000536 complexating effect Effects 0.000 description 1
- 238000010668 complexation reaction Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000001784 detoxification Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 229940075613 gadolinium oxide Drugs 0.000 description 1
- 229910001938 gadolinium oxide Inorganic materials 0.000 description 1
- CMIHHWBVHJVIGI-UHFFFAOYSA-N gadolinium(iii) oxide Chemical compound [O-2].[O-2].[O-2].[Gd+3].[Gd+3] CMIHHWBVHJVIGI-UHFFFAOYSA-N 0.000 description 1
- 229910052732 germanium Inorganic materials 0.000 description 1
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 239000000819 hypertonic solution Substances 0.000 description 1
- 229940021223 hypertonic solution Drugs 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000003978 infusion fluid Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229910052747 lanthanoid Inorganic materials 0.000 description 1
- 150000002602 lanthanoids Chemical class 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229960003194 meglumine Drugs 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- FYFFGSSZFBZTAH-UHFFFAOYSA-N methylaminomethanetriol Chemical compound CNC(O)(O)O FYFFGSSZFBZTAH-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229910000096 monohydride Inorganic materials 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 238000009206 nuclear medicine Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 229960003330 pentetic acid Drugs 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 238000001959 radiotherapy Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- ANOBYBYXJXCGBS-UHFFFAOYSA-L stannous fluoride Chemical compound F[Sn]F ANOBYBYXJXCGBS-UHFFFAOYSA-L 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 238000003325 tomography Methods 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 231100000816 toxic dose Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 229910001428 transition metal ion Inorganic materials 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K49/00—Preparations for testing in vivo
- A61K49/06—Nuclear magnetic resonance [NMR] contrast preparations; Magnetic resonance imaging [MRI] contrast preparations
- A61K49/18—Nuclear magnetic resonance [NMR] contrast preparations; Magnetic resonance imaging [MRI] contrast preparations characterised by a special physical form, e.g. emulsions, microcapsules, liposomes
- A61K49/1806—Suspensions, emulsions, colloids, dispersions
- A61K49/1812—Suspensions, emulsions, colloids, dispersions liposomes, polymersomes, e.g. immunoliposomes
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K49/00—Preparations for testing in vivo
- A61K49/0002—General or multifunctional contrast agents, e.g. chelated agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K49/00—Preparations for testing in vivo
- A61K49/06—Nuclear magnetic resonance [NMR] contrast preparations; Magnetic resonance imaging [MRI] contrast preparations
- A61K49/18—Nuclear magnetic resonance [NMR] contrast preparations; Magnetic resonance imaging [MRI] contrast preparations characterised by a special physical form, e.g. emulsions, microcapsules, liposomes
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K51/00—Preparations containing radioactive substances for use in therapy or testing in vivo
- A61K51/02—Preparations containing radioactive substances for use in therapy or testing in vivo characterised by the carrier, i.e. characterised by the agent or material covalently linked or complexing the radioactive nucleus
- A61K51/04—Organic compounds
- A61K51/0474—Organic compounds complexes or complex-forming compounds, i.e. wherein a radioactive metal (e.g. 111In3+) is complexed or chelated by, e.g. a N2S2, N3S, NS3, N4 chelating group
- A61K51/0478—Organic compounds complexes or complex-forming compounds, i.e. wherein a radioactive metal (e.g. 111In3+) is complexed or chelated by, e.g. a N2S2, N3S, NS3, N4 chelating group complexes from non-cyclic ligands, e.g. EDTA, MAG3
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K51/00—Preparations containing radioactive substances for use in therapy or testing in vivo
- A61K51/02—Preparations containing radioactive substances for use in therapy or testing in vivo characterised by the carrier, i.e. characterised by the agent or material covalently linked or complexing the radioactive nucleus
- A61K51/04—Organic compounds
- A61K51/0474—Organic compounds complexes or complex-forming compounds, i.e. wherein a radioactive metal (e.g. 111In3+) is complexed or chelated by, e.g. a N2S2, N3S, NS3, N4 chelating group
- A61K51/0478—Organic compounds complexes or complex-forming compounds, i.e. wherein a radioactive metal (e.g. 111In3+) is complexed or chelated by, e.g. a N2S2, N3S, NS3, N4 chelating group complexes from non-cyclic ligands, e.g. EDTA, MAG3
- A61K51/048—DTPA (diethylenetriamine tetraacetic acid)
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P39/00—General protective or antinoxious agents
- A61P39/02—Antidotes
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K2123/00—Preparations for testing in vivo
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10T—TECHNICAL SUBJECTS COVERED BY FORMER US CLASSIFICATION
- Y10T436/00—Chemistry: analytical and immunological testing
- Y10T436/24—Nuclear magnetic resonance, electron spin resonance or other spin effects or mass spectrometry
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Epidemiology (AREA)
- Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Medicinal Chemistry (AREA)
- Radiology & Medical Imaging (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Dispersion Chemistry (AREA)
- Immunology (AREA)
- Toxicology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3324235A DE3324235A1 (de) | 1983-07-01 | 1983-07-01 | Neue komplexbildner, komplexe und komplexsalze |
| DE3324235 | 1983-07-01 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK320884D0 DK320884D0 (da) | 1984-06-29 |
| DK320884A DK320884A (da) | 1985-01-02 |
| DK171352B1 true DK171352B1 (da) | 1996-09-16 |
Family
ID=6203212
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK320884A DK171352B1 (da) | 1983-07-01 | 1984-06-29 | Metalkomplekser og salte deraf, fremgangsmåde til fremstilling af sådanne forbindelser samt diagnostiske midler og farmaceutiske præparater indeholdende forbindelserne |
Country Status (8)
| Country | Link |
|---|---|
| US (2) | US5316756A (https=) |
| EP (1) | EP0130934B1 (https=) |
| JP (1) | JPS6036452A (https=) |
| AT (1) | ATE28745T1 (https=) |
| CA (1) | CA1253514A (https=) |
| DE (2) | DE3324235A1 (https=) |
| DK (1) | DK171352B1 (https=) |
| IE (1) | IE57929B1 (https=) |
Families Citing this family (65)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8413772D0 (en) * | 1984-05-30 | 1984-07-04 | Nyegaard & Co As | Chemical compounds |
| US4687659A (en) * | 1984-11-13 | 1987-08-18 | Salutar, Inc. | Diamide-DTPA-paramagnetic contrast agents for MR imaging |
| DE3508000A1 (de) * | 1985-03-04 | 1986-09-04 | Schering AG, Berlin und Bergkamen, 1000 Berlin | Ferromagnetische partikel fuer die nmr-diagnostik |
| DE3684711D1 (de) * | 1986-04-07 | 1992-05-07 | Francois Dietlin | In der tomo-densitometrie zu verwendende zusammensetzungen. |
| EP0250358A3 (en) * | 1986-06-20 | 1988-10-05 | Schering Aktiengesellschaft | Novel complex compounds |
| AU608759B2 (en) * | 1986-08-04 | 1991-04-18 | Amersham Health Salutar Inc | NMR imaging with paramagnetic polyvalents metal salts of poly-(acid-alkylene-amido)-alkanes |
| IL83966A (en) * | 1986-09-26 | 1992-03-29 | Schering Ag | Amides of aminopolycarboxylic acids and pharmaceutical compositions containing them |
| DE3640708C2 (de) * | 1986-11-28 | 1995-05-18 | Schering Ag | Verbesserte metallhaltige Pharmazeutika |
| US5057302A (en) * | 1987-02-13 | 1991-10-15 | Abbott Laboratories | Bifunctional chelating agents |
| DE3710730A1 (de) * | 1987-03-31 | 1988-10-20 | Schering Ag | Substituierte komplexbildner, komplexe und komplexsalze, verfahren zu deren herstellung und diese enthaltende pharmazeutische mittel |
| US5531978A (en) * | 1987-07-16 | 1996-07-02 | Nycomed Imaging As | Aminopolycarboxylic acids and derivatives thereof |
| US5198208A (en) * | 1987-07-16 | 1993-03-30 | Nycomed Imaging As | Aminopolycarboxylic acids and derivatives thereof |
| GB9007965D0 (en) * | 1990-04-09 | 1990-06-06 | Nycomed As | Compounds |
| DE3724188C2 (de) * | 1987-07-17 | 1995-05-18 | Heinz Dr Gries | Metallhaltige Oligosaccharid-Polysulfate, Verfahren zu deren Herstellung und diese enthaltende pharmazeutische Mittel |
| GB8801646D0 (en) * | 1988-01-26 | 1988-02-24 | Nycomed As | Chemical compounds |
| JPH01240620A (ja) * | 1988-03-16 | 1989-09-26 | Miyamoto Kogyosho:Kk | ビレット調質方法とビレット調質炉 |
| US5137711A (en) * | 1988-07-19 | 1992-08-11 | Mallickrodt Medical, Inc. | Paramagnetic dtpa and edta alkoxyalkylamide complexes as mri agents |
| DE4001655A1 (de) * | 1990-01-18 | 1991-07-25 | Schering Ag | 6-ring enthaltende makrocyclische tetraaza-verbindungen, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische mittel |
| DE3825040A1 (de) * | 1988-07-20 | 1990-01-25 | Schering Ag, 13353 Berlin | 5- oder 6-ring- enthaltende makrocyclische polyaza-verbindungen, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische mittel |
| US5314681A (en) * | 1988-12-23 | 1994-05-24 | Nycomed Innovation Ab | Composition of positive and negative contrast agents for electron spin resonance enhanced magnetic resonance imaging |
| GB8900719D0 (en) * | 1989-01-13 | 1989-03-08 | Nycomed As | Compounds |
| GB8900732D0 (en) * | 1989-01-13 | 1989-03-08 | Nycomed As | Agents |
| US5011925A (en) * | 1989-03-09 | 1991-04-30 | Mallinckrodt, Inc. | Morpholinoamido EDTA derivatives |
| US5384108A (en) * | 1989-04-24 | 1995-01-24 | Mallinckrodt Medical, Inc. | Magnetic resonance imaging agents |
| US5695739A (en) * | 1989-06-30 | 1997-12-09 | Schering Aktiengesellschaft | Derivatized DTPA complexes, pharmaceutical agents containing these compounds, their use, and processes for their production |
| US6039931A (en) * | 1989-06-30 | 2000-03-21 | Schering Aktiengesellschaft | Derivatized DTPA complexes, pharmaceutical agents containing these compounds, their use, and processes for their production |
| GB8916781D0 (en) * | 1989-07-21 | 1989-09-06 | Nycomed As | Compositions |
| JPH04507401A (ja) * | 1989-09-05 | 1992-12-24 | マリンクロッド・インコーポレイテッド | 新規磁気共鳴造影剤 |
| US5494655A (en) * | 1990-03-09 | 1996-02-27 | The Regents Of The University Of California | Methods for detecting blood perfusion variations by magnetic resonance imaging |
| WO1992017215A1 (en) * | 1990-03-28 | 1992-10-15 | Nycomed Salutar, Inc. | Contrast media |
| US5843399A (en) * | 1990-04-06 | 1998-12-01 | Schering Aktiengesellschaft | DTPA monoamides for MRI |
| DE4011684A1 (de) * | 1990-04-06 | 1991-10-10 | Schering Ag | Dtpa-monoamide, diese verbindungen enthaltende pharmazeutische mittel, ihre verwendung und verfahren zu deren herstellung |
| GB9007967D0 (en) * | 1990-04-09 | 1990-06-06 | Nycomed As | Compounds |
| AU636481B2 (en) * | 1990-05-18 | 1993-04-29 | Bracco International B.V. | Polymeric gas or air filled microballoons usable as suspensions in liquid carriers for ultrasonic echography |
| US5077037A (en) * | 1990-08-03 | 1991-12-31 | Mallinckrodt Medical, Inc. | Novel compositions for magnetic resonance imaging |
| US5908931A (en) * | 1990-12-14 | 1999-06-01 | Mallinckrodt Inc. | Preorganized hexadentate ligands useful in radiographic imaging agents |
| GB9027922D0 (en) * | 1990-12-21 | 1991-02-13 | Nycomed As | Compounds |
| EP0577675B1 (en) * | 1991-03-27 | 1999-12-08 | Nycomed Salutar Inc. | Contrast media |
| JPH06507904A (ja) * | 1991-05-23 | 1994-09-08 | イマアーレクス・フアーマシユーチカル・コーポレーシヨン | 磁気共鳴画像形成用の油脂可溶化合物 |
| US5562894A (en) * | 1991-08-09 | 1996-10-08 | Regents Of The University Of California | Amino-acyl-type and catecholamine-type contrast agents for MRI |
| GB9208908D0 (en) * | 1992-04-24 | 1992-06-10 | Nycomed As | Contrast agents |
| US5439913A (en) | 1992-05-12 | 1995-08-08 | Schering Aktiengesellschaft | Contraception method using competitive progesterone antagonists and novel compounds useful therein |
| DE4302287A1 (de) * | 1993-01-25 | 1994-07-28 | Schering Ag | Derivatisierte DTPA-Komplexe, diese Verbindungen enthaltende pharmazeutische Mittel, ihre Verwendung und Verfahren zu deren Herstellung |
| GB9321595D0 (en) * | 1993-10-20 | 1993-12-08 | Nycomed Imaging As | Contrast agents |
| US5571498A (en) * | 1994-06-02 | 1996-11-05 | Hemagen/Pfc | Emulsions of paramagnetic contrast agents for magnetic resonance imaging (MRI). |
| US5672335A (en) * | 1994-11-30 | 1997-09-30 | Schering Aktiengesellschaft | Use of metal complexes as liver and gallbladder X-ray diagnostic agents |
| US5614170A (en) * | 1994-11-30 | 1997-03-25 | Hemagen/Pfc | Paramagnetic complexes of N-alkyl-N-hydroxylamides of organic acids and emulsions containing same for magnetic resonance imaging (MRI) |
| DE19507820A1 (de) * | 1995-02-21 | 1996-08-22 | Schering Ag | Neuartig substituierte DTPA-Derivate, deren Metallkomplexe, diese Komplexe enthaltende pharmazeutische Mittel, deren Verwendung in der Diagnostik, sowie Verfahren zur Herstellung der Komplexe und Mittel |
| DE19507819A1 (de) * | 1995-02-21 | 1996-08-22 | Schering Ag | DTPA-Monoamide der zentralen Carbonsäure und deren Metallkomplexe, diese Komplexe enthaltende pharmazeutische Mittel, deren Verwendung in der Diagnostik und Therapie sowie Verfahren zur Herstellung der Komplexe und Mittel |
| DE19507822B4 (de) * | 1995-02-21 | 2006-07-20 | Schering Ag | Substituierte DTPA-Monoamide der zentralen Carbonsäure und deren Metallkomplexe, diese Komplexe enthaltende pharmazeutische Mittel, deren Verwendung in der Diagnostik und Therapie sowie Verfahren zur Herstellung der Komplexe und Mittel |
| IT1297035B1 (it) | 1997-12-30 | 1999-08-03 | Bracco Spa | Derivati dell'acido 1,4,7,10-tetraazaciclododecan-1,4-diacetico |
| US6767741B1 (en) | 1999-08-27 | 2004-07-27 | Invitrogen Corporation | Metal binding compounds and their use in cell culture medium compositions |
| WO2001016294A2 (en) * | 1999-08-27 | 2001-03-08 | Invitrogen Corporation | Metal binding compounds and their use in cell culture medium compositions |
| US20030203879A1 (en) * | 1999-09-09 | 2003-10-30 | Schering Ag | Calcium complex of [[(4R)-4-[bis[(carboxy-.kappa.O)methyl]amino-.kappa.n]-6,9-bis[(carboxy.kappa.O)methyl]-1-[(4,4-diphenylcyclohexy)oxy]-1-hydroxy-2-oxa-6,9-diaza-1-phosphaundecan-11-ylic-acid-.kappa.N6,.Kappa.N9,.Kappa 011]1-oxidato(6-)]-, hexahydrogen, its salts, pharmaceutical agents that contain these complexes, their use in treatment and as additives in diagnosis, as well as processes for the production of the complexes and agents |
| US6525234B1 (en) * | 2000-11-21 | 2003-02-25 | Exxonmobil Oil Corporation | Process for liquid phase aromatics alkylation comprising in-situ catalyst reactivation with polar compounds |
| US8669236B2 (en) | 2005-05-12 | 2014-03-11 | The General Hospital Corporation | Biotinylated compositions |
| FI20065030A7 (fi) * | 2006-01-17 | 2007-07-18 | Wallac Oy | Neutraaliset leimausreagenssit ja niistä johdetut konjugaatit |
| DE102007058220A1 (de) | 2007-12-03 | 2009-06-04 | Bayer Schering Pharma Aktiengesellschaft | Dimere macrocyclisch substituierte Benzolderivate |
| WO2012136813A2 (en) | 2011-04-07 | 2012-10-11 | Universitetet I Oslo | Agents for medical radar diagnosis |
| EP2890788A1 (en) | 2012-08-31 | 2015-07-08 | The General Hospital Corporation | Biotin complexes for treatment and diagnosis of alzheimer's disease |
| HUP1500076A2 (hu) | 2015-02-25 | 2016-09-28 | Debreceni Egyetem | Új helyettesített etilén-diamin-tetraecetsav-bisz(amid) származékok és alkalmazásuk Mn(II)-alapú MRI kontrasztanyag ligandumként |
| WO2017089849A1 (en) | 2015-11-26 | 2017-06-01 | Debreceni Egyetem | New 6-oxa-3,9, 15-triaza-bicyclo[9.3.1 ]pentadec a- 1 ( 14), 1 1 ( 15), 12-triene derivatives based compounds and their application as ligands of essential metal ion based mri and 52mn based pet contrast agents |
| EP3380472A1 (en) | 2015-11-26 | 2018-10-03 | Debreceni Egyetem | New 3,6,9, 15-tetraaza-bicyclo [9.3.1 ]pentadeca- 1(14), 11(15), 12-triene based compounds and their application as ligands of essential metal ion based mri and 52mn based pet contrast agents |
| WO2017089848A1 (en) | 2015-11-26 | 2017-06-01 | Debreceni Egyetem | New 2, 1 l -diaza-[3.3](2,6)pyridinophane compounds and their application as ligands of essential metal ion based mri contrast agents and 52mn based pet contrast agents |
| DE102023001815A1 (de) * | 2023-05-05 | 2024-11-07 | Siempelkamp Maschinen- Und Anlagenbau Gmbh | Verfahren und Vorrichtung (Anlage) zur Herstellung einer Werkstoffplatte, Werkstoffplatte, sowie Verwendung einer Werkstoffplatte |
Family Cites Families (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2673213A (en) * | 1952-06-03 | 1954-03-23 | Frederick C Bersworth | Polyalkylene polyamino acids |
| US2854458A (en) * | 1954-07-15 | 1958-09-30 | Basf Ag | Complex heavy metal salts |
| US2831885A (en) * | 1954-08-13 | 1958-04-22 | Geigy Chem Corp | Hydroxyethyl polycarboxymethyl polyamines |
| US2954458A (en) * | 1958-07-17 | 1960-09-27 | Mankouski Charles | Holder for welding rods |
| US3024274A (en) * | 1959-03-18 | 1962-03-06 | California Research Corp | Amides of cyclic diaminealkylenecarboxylic acids |
| US3232083A (en) * | 1963-12-09 | 1966-02-01 | Rollins Joseph Ashby | Lock cylinder plug holder |
| CH482647A (de) * | 1966-11-04 | 1969-12-15 | Basf Ag | Verfahren zur Herstellung von B-Carbamyl-B-hydroxyäthylaminen und deren Verwendung |
| GB1374979A (en) * | 1970-12-21 | 1974-11-20 | Nat Res Dev | 3,5-dioxopiperazine derivatives |
| US3859337A (en) * | 1969-06-11 | 1975-01-07 | Stauffer Chemical Co | Ethylenediaminetetraacetic acid anhydride derivatives |
| DE2028219A1 (en) * | 1969-06-11 | 1972-01-20 | Stauffer Chemical Co, New York, N Y (V St A ) | New derivatives of ethylenediamine tetraa - cetic acid |
| US3994966A (en) * | 1972-09-28 | 1976-11-30 | The Board Of Trustees Of The Leland Stanford Junior University | Chelating agents |
| GB1471894A (en) * | 1973-12-12 | 1977-04-27 | Wilkinson Sword Ltd | Compositions for application to or consumption by the body and containing a compound having a physiological cooling effect |
| US4022420A (en) * | 1975-11-06 | 1977-05-10 | Anacleto Pace | Formwork and connecting means apparatus for casting reinforced concrete |
| DE2650966A1 (de) * | 1975-11-14 | 1977-05-26 | Ciba Geigy Ag | Gegebenenfalls veraetherte basische methylolverbindungen und deren salze |
| US4352751A (en) * | 1979-09-10 | 1982-10-05 | Analytical Radiation Corporation | Species-linked diamine triacetic acids and their chelates |
| US4308249A (en) * | 1979-12-13 | 1981-12-29 | G. D. Searle & Co. | Radiopharmaceutical complexes of N-(tri-substituted alkyl)-iminodiacetic acids |
| US4339426A (en) * | 1980-03-18 | 1982-07-13 | Regents Of The University Of California | Bleomycin analog |
| US4647447A (en) * | 1981-07-24 | 1987-03-03 | Schering Aktiengesellschaft | Diagnostic media |
| DE3129906C3 (de) * | 1981-07-24 | 1996-12-19 | Schering Ag | Paramagnetische Komplexsalze, deren Herstellung und Mittel zur Verwendung bei der NMR-Diagnostik |
| US4454106A (en) * | 1982-06-07 | 1984-06-12 | Gansow Otto A | Use of metal chelate conjugated monoclonal antibodies |
| US4472509A (en) * | 1982-06-07 | 1984-09-18 | Gansow Otto A | Metal chelate conjugated monoclonal antibodies |
| NL194579C (nl) * | 1983-01-21 | 2002-08-05 | Schering Ag | Diagnostisch middel. |
| US4652519A (en) * | 1983-02-03 | 1987-03-24 | Yeda Research And Development Company Limited | Bifunctional chelating agents and process for their production |
| US4859451A (en) * | 1984-10-04 | 1989-08-22 | Salutar, Inc. | Paramagnetic contrast agents for MR imaging |
| US4687658A (en) * | 1984-10-04 | 1987-08-18 | Salutar, Inc. | Metal chelates of diethylenetriaminepentaacetic acid partial esters for NMR imaging |
| US4687659A (en) * | 1984-11-13 | 1987-08-18 | Salutar, Inc. | Diamide-DTPA-paramagnetic contrast agents for MR imaging |
| SE465907B (sv) * | 1984-11-01 | 1991-11-18 | Nyegaard & Co As | Diagnosticeringsmedel innehaallande en paramagnetisk metall |
| US4826673A (en) * | 1985-01-09 | 1989-05-02 | Mallinckrodt, Inc. | Methods and compositions for enhancing magnetic resonance imaging |
| US4933441A (en) * | 1987-01-27 | 1990-06-12 | Gibby Wendell A | Contrast enhancing agents for magnetic resonance images |
| US5078986A (en) * | 1989-02-15 | 1992-01-07 | Mallinckrodt Medical, Inc. | Method for enhancing magnetic resonance imaging using an image altering agent containing an excess of chelating agent |
-
1983
- 1983-07-01 DE DE3324235A patent/DE3324235A1/de not_active Withdrawn
-
1984
- 1984-06-28 AT AT84730074T patent/ATE28745T1/de not_active IP Right Cessation
- 1984-06-28 EP EP84730074A patent/EP0130934B1/de not_active Expired
- 1984-06-28 DE DE8484730074T patent/DE3465191D1/de not_active Expired
- 1984-06-29 CA CA000457842A patent/CA1253514A/en not_active Expired
- 1984-06-29 DK DK320884A patent/DK171352B1/da not_active IP Right Cessation
- 1984-07-02 JP JP59135365A patent/JPS6036452A/ja active Granted
- 1984-07-02 IE IE1683/84A patent/IE57929B1/en not_active IP Right Cessation
-
1990
- 1990-04-13 US US07/515,761 patent/US5316756A/en not_active Expired - Lifetime
-
1994
- 1994-03-28 US US08/219,339 patent/US5419894A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DK320884D0 (da) | 1984-06-29 |
| DE3324235A1 (de) | 1985-01-10 |
| ATE28745T1 (de) | 1987-08-15 |
| US5316756A (en) | 1994-05-31 |
| US5419894A (en) | 1995-05-30 |
| EP0130934A1 (de) | 1985-01-09 |
| JPH0380148B2 (https=) | 1991-12-24 |
| JPS6036452A (ja) | 1985-02-25 |
| IE841683L (en) | 1985-01-01 |
| IE57929B1 (en) | 1993-05-19 |
| DE3465191D1 (en) | 1987-09-10 |
| DK320884A (da) | 1985-01-02 |
| EP0130934B1 (de) | 1987-08-05 |
| CA1253514A (en) | 1989-05-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK171352B1 (da) | Metalkomplekser og salte deraf, fremgangsmåde til fremstilling af sådanne forbindelser samt diagnostiske midler og farmaceutiske præparater indeholdende forbindelserne | |
| DK170461B1 (da) | Diagnostisk middel til anvendelse ved in vivo NMR-diagnostik, fremgangsmåde til fremstilling heraf samt komplekse salte velegnede til anvendelse i det diagnostiske middel | |
| JP2833766B2 (ja) | アミノポリカルボン酸およびその誘導体 | |
| DK174771B1 (da) | Fysiologisk tålelig forbindelse, diagnostisk middel indeholdende denne, anvendelse af forbindelsen til fremstilling af det diagnostiske middel samt en fremgangsmåde til fremstilling af forbindelsen | |
| US5885548A (en) | Multiply substituted DTPA derivatives and their metal complexes, and their metal complexes, pharmaceutical agents that contain these complexes, their use in diagnosis and therapy, as well as process for the production of pharmaceutical agents | |
| JP3131219B2 (ja) | キレート化合物 | |
| RU2743167C2 (ru) | Контрастные агенты | |
| JPH05506426A (ja) | キレート化剤 | |
| US5348954A (en) | Heterocyclic chelating agents | |
| IL91046A (en) | Pharmaceutical and diagnostic compositions containing metal complexes of poly(carboxymethyl)-poly [azabicyclo (x,3,1) alkane] derivatives some new such derivatives and their preparation | |
| US5409689A (en) | MRI image enhancement using complexes of paramagnetic cations and amine ligands containing a mixture of phosphonate and non-phosphonate pendant arms | |
| US6117412A (en) | Non-cluster type bismuth compounds | |
| EP0717737B1 (en) | Chelants as contrast enhancing agents | |
| WO2017178301A1 (en) | Contrast agents | |
| JP2020500917A (ja) | 二量体造影剤 | |
| US5695737A (en) | Dimeric DTPA derivatives, their metal complexes and pharmaceutical agents containing these complexes | |
| JP2004506026A (ja) | 極性基を有するペルフルオロアルキル含有錯体、その製造方法およびその使用 | |
| AU687477B2 (en) | Aryl halide substituted metallic complexes, pharmaceuticals containing these complexes, their use for diagnostic purposes, and methods for preparing the complexes and pharmaceuticals | |
| US5972307A (en) | Dichelants | |
| WO1991015467A1 (en) | Aminopolycarboxylic acid chelating agents | |
| CA2177271A1 (en) | 1,4,7,10-tetraazacyclododecane derivatives, their use, pharmaceuticals containing them and process for their production | |
| AU617338B2 (en) | Aminopolycarboxylic acids and derivatives thereof | |
| CN118834263B (zh) | 含短氨基醇链的化合物及其金属络合物和应用 | |
| IE911182A1 (en) | Chelating agents | |
| WO1999045968A1 (en) | Manganese chelates with high relaxivity in serum |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| B1 | Patent granted (law 1993) | ||
| PBP | Patent lapsed |