DK142987C - Analogifremgangsmaade til fremstilling af 4-(7-brom-5-methoxy-2-benzofuranyl)-piperidin eller farmaceutisk acceptable syreadditionssalte deraf - Google Patents
Analogifremgangsmaade til fremstilling af 4-(7-brom-5-methoxy-2-benzofuranyl)-piperidin eller farmaceutisk acceptable syreadditionssalte derafInfo
- Publication number
- DK142987C DK142987C DK532176A DK532176A DK142987C DK 142987 C DK142987 C DK 142987C DK 532176 A DK532176 A DK 532176A DK 532176 A DK532176 A DK 532176A DK 142987 C DK142987 C DK 142987C
- Authority
- DK
- Denmark
- Prior art keywords
- benzofuranyl
- piperidine
- analogue
- bromo
- methoxy
- Prior art date
Links
- 239000002253 acid Substances 0.000 title 1
- WZXHSWVDAYOFPE-UHFFFAOYSA-N brofaromine Chemical compound C=1C2=CC(OC)=CC(Br)=C2OC=1C1CCNCC1 WZXHSWVDAYOFPE-UHFFFAOYSA-N 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK264680A DK143848C (da) | 1975-11-26 | 1980-06-20 | Analogifremgangsmaade til fremstilling af 4-(7-brom-5-methoxy-2-benzofuranyl)-piperidinforbindelser eller syreadditionssalte deraf |
| DK264580A DK143901C (da) | 1975-11-26 | 1980-06-20 | Analogifremgangsmaade til fremstilling af 4-(7-brom-5-methoxy-2-benzofuranyl)-1-methyl-1,2,3,6-tetrahydropyridin eller syreadditionssalte deraf |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1530175 | 1975-11-26 | ||
| CH1530175A CH609054A5 (en) | 1975-11-26 | 1975-11-26 | Process for the preparation of a novel piperidine derivative |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK532176A DK532176A (da) | 1977-05-27 |
| DK142987B DK142987B (da) | 1981-03-09 |
| DK142987C true DK142987C (da) | 1981-09-21 |
Family
ID=4407989
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK532176A DK142987C (da) | 1975-11-26 | 1976-11-25 | Analogifremgangsmaade til fremstilling af 4-(7-brom-5-methoxy-2-benzofuranyl)-piperidin eller farmaceutisk acceptable syreadditionssalte deraf |
Country Status (23)
| Country | Link |
|---|---|
| JP (1) | JPS5265277A (enExample) |
| AR (1) | AR214985A1 (enExample) |
| AT (1) | AT352728B (enExample) |
| AU (1) | AU507722B2 (enExample) |
| BE (1) | BE848720R (enExample) |
| CA (1) | CA1088940A (enExample) |
| CH (1) | CH609054A5 (enExample) |
| CS (2) | CS205050B2 (enExample) |
| CY (1) | CY1179A (enExample) |
| DD (1) | DD129328A6 (enExample) |
| DE (1) | DE2653147A1 (enExample) |
| DK (1) | DK142987C (enExample) |
| ES (1) | ES453582A2 (enExample) |
| FR (1) | FR2332754A2 (enExample) |
| GB (1) | GB1565055A (enExample) |
| HK (1) | HK16783A (enExample) |
| IE (1) | IE44084B1 (enExample) |
| MY (1) | MY8400093A (enExample) |
| NL (1) | NL7613050A (enExample) |
| NZ (1) | NZ182716A (enExample) |
| SE (1) | SE426826B (enExample) |
| SU (3) | SU679136A3 (enExample) |
| ZA (1) | ZA777068B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0006524A1 (de) * | 1978-06-22 | 1980-01-09 | Ciba-Geigy Ag | Neue Tetrahydropyridin- und Piperidinderivate und deren Säureadditionssalze, Verfahren zu deren Herstellung und solche enthaltende pharmazeutische Zusammensetzungen |
| US5455254A (en) * | 1991-02-15 | 1995-10-03 | Mondadori; Cesare | Substituted benzofuranylpiperidine as a nootropic agent |
| RU2095339C1 (ru) * | 1991-10-17 | 1997-11-10 | Циба-Гейги АГ | Производные гидрохинона в свободном виде или в виде соли, способы их получения, производные пиперидина и способы их получения |
| US5693807A (en) * | 1992-10-14 | 1997-12-02 | Ciba-Geigy Corporation | Substituted hydroquinone derivatives |
| EP0637586B1 (en) * | 1993-08-05 | 1999-06-02 | HOECHST MARION ROUSSEL, Inc. | 2-(Piperidin-4-yl, pyridin-4-yl and tetrahydropyridin-4-yl)-benzofuran-7-carbamate derivatives, their preparation and their use as acetylcholinesterase inhibitors |
| CN101810606A (zh) * | 2010-03-12 | 2010-08-25 | 南方医科大学 | 2-(6-羟基-2′,3′-二甲氧基苯基)-6-羟基-7-甲氧基苯骈呋喃在制备单胺氧化酶抑制剂中的应用 |
| US8796306B2 (en) * | 2010-06-23 | 2014-08-05 | Sumitomo Chemical Company, Limited | Noxious arthropod controlling composition and heterocyclic compound |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH592656A5 (enExample) * | 1973-03-02 | 1977-10-31 | Ciba Geigy Ag | |
| IE39264B1 (en) * | 1973-05-25 | 1978-08-30 | Ciba Geigy Ag | New pharmaceutical preparations |
-
1975
- 1975-11-26 CH CH1530175A patent/CH609054A5/xx not_active IP Right Cessation
-
1976
- 1976-11-22 AR AR265561A patent/AR214985A1/es active
- 1976-11-23 CY CY1179A patent/CY1179A/xx unknown
- 1976-11-23 GB GB48763/76A patent/GB1565055A/en not_active Expired
- 1976-11-23 NL NL7613050A patent/NL7613050A/xx not_active Application Discontinuation
- 1976-11-23 DE DE19762653147 patent/DE2653147A1/de active Granted
- 1976-11-24 CA CA266,466A patent/CA1088940A/en not_active Expired
- 1976-11-24 DD DD7600195944A patent/DD129328A6/xx unknown
- 1976-11-24 FR FR7635373A patent/FR2332754A2/fr active Granted
- 1976-11-24 ES ES453582A patent/ES453582A2/es not_active Expired
- 1976-11-25 SE SE7613193A patent/SE426826B/xx not_active IP Right Cessation
- 1976-11-25 ZA ZA00777068A patent/ZA777068B/xx unknown
- 1976-11-25 NZ NZ182716A patent/NZ182716A/xx unknown
- 1976-11-25 CS CS767637A patent/CS205050B2/cs unknown
- 1976-11-25 BE BE172674A patent/BE848720R/xx not_active IP Right Cessation
- 1976-11-25 AU AU19995/76A patent/AU507722B2/en not_active Expired
- 1976-11-25 CS CS767637A patent/CS205049B2/cs unknown
- 1976-11-25 DK DK532176A patent/DK142987C/da active
- 1976-11-25 SU SU762422953A patent/SU679136A3/ru active
- 1976-11-25 IE IE2588/76A patent/IE44084B1/en unknown
- 1976-11-25 AT AT874476A patent/AT352728B/de not_active IP Right Cessation
- 1976-11-26 JP JP51141389A patent/JPS5265277A/ja active Granted
-
1978
- 1978-04-17 SU SU782602551A patent/SU682132A3/ru active
- 1978-04-17 SU SU782602552A patent/SU680648A3/ru active
-
1983
- 1983-05-19 HK HK167/83A patent/HK16783A/xx unknown
-
1984
- 1984-12-30 MY MY93/84A patent/MY8400093A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CA1088940A (en) | 1980-11-04 |
| ZA777068B (en) | 1978-07-26 |
| HK16783A (en) | 1983-05-27 |
| FR2332754B2 (enExample) | 1978-12-22 |
| SE426826B (sv) | 1983-02-14 |
| BE848720R (fr) | 1977-05-25 |
| IE44084L (en) | 1977-05-26 |
| DE2653147C2 (enExample) | 1991-09-19 |
| CS205049B2 (en) | 1981-04-30 |
| DK532176A (da) | 1977-05-27 |
| CH609054A5 (en) | 1979-02-15 |
| SU680648A3 (ru) | 1979-08-15 |
| DE2653147A1 (de) | 1977-06-08 |
| SE7613193L (sv) | 1977-05-27 |
| FR2332754A2 (fr) | 1977-06-24 |
| IE44084B1 (en) | 1981-08-12 |
| ATA874476A (de) | 1979-03-15 |
| AT352728B (de) | 1979-10-10 |
| NZ182716A (en) | 1979-06-19 |
| JPS6156234B2 (enExample) | 1986-12-01 |
| JPS5265277A (en) | 1977-05-30 |
| CY1179A (en) | 1983-06-10 |
| CS205050B2 (en) | 1981-04-30 |
| AR214985A1 (es) | 1979-08-31 |
| GB1565055A (en) | 1980-04-16 |
| ES453582A2 (es) | 1978-01-01 |
| DK142987B (da) | 1981-03-09 |
| AU1999576A (en) | 1978-06-01 |
| SU679136A3 (ru) | 1979-08-05 |
| MY8400093A (en) | 1984-12-31 |
| SU682132A3 (ru) | 1979-08-25 |
| NL7613050A (nl) | 1977-05-31 |
| AU507722B2 (en) | 1980-02-28 |
| DD129328A6 (de) | 1978-01-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK145339C (da) | Analogifremgangsmaade til fremstilling af 4-amino-5-hexensyre eller farmaceutisk acceptable salte deraf | |
| DK151884C (da) | Analogifremgangsmaade til fremstilling af 3-(1-imidazolylalkyl)indolderivater eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK151623C (da) | Analogifremgangsmaade til fremstilling af n-substituerede moranolinderivater eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK149843C (da) | Analogifremgangsmaade til fremstilling af 3-substituerede 4-fenylpiperidiner eller salte deraf med farmaceutisk acceptable syrer | |
| DK145119C (da) | Analogifremgangsmaade til fremstilling af phenolethere eller syreadditionssalte deraf | |
| DK153397C (da) | Analogifremgangsmaade til fremstilling af 1,3,4-trisubstituerede 4-arylpiperidiner eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK136714B (da) | Analogifremgangsmåde til fremstilling af substituerede piperidinderivater eller syreadditionssalte deraf. | |
| DK148904C (da) | Analogifremgangsmaade til fremstilling af analgetisk virksomme enkephalin-analoge pentapeptidamider eller farmaceutisk acceptable, ikke-toxiske syreadditionssalte deraf | |
| DK146592C (da) | Analogifremgangsmaade til fremstilling af n-substituerede benzensulfonamider eller syreadditionssalte deraf | |
| DK154950C (da) | Analogifremgangsmaade til fremstilling af 1-(benzazolylalkyl)-piperidinderivater eller de farmaceutisk acceptable syreadditionssalte deraf | |
| DK160045C (da) | Analogifremgangsmaade til fremstilling af 4-oxo-4h-pyridooe1,2-aaapyrimidiner eller farmaceutisk acceptable syreadditionssalte eller kvaternaere ammoniumsalte deraf | |
| DK149063C (da) | Analogifremgangsmaade til fremstilling af trh-analoge derivater af histidylprolinamid eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK153157C (da) | Analogifremgangsmaade til fremstilling af 7-alfa-aminoacyl-3-halogen-cephalosporinderivater eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK149230C (da) | Analogifremgangsmaade til fremstilling af 5-benzoyl-6-hydroxy-indan-1-carboxylsyrederivater eller farmaceutisk acceptable salte deraf | |
| DK142544C (da) | Analogifremgangsmaade til fremstilling af 2-(n-propargyl-n-phenylamino)-imidazolin-(2)-derivater eller fysiologisk acceptable syreadditionssalte heraf | |
| DK149841C (da) | Analogifremgangsmaade til fremstilling af alfa-fluor-methyl-alfa-aminoalkansyrer eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK149077C (da) | Analogifremgangsmaade til fremstilling af encephalin-analoge pentapeptidamidderivater eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK142987C (da) | Analogifremgangsmaade til fremstilling af 4-(7-brom-5-methoxy-2-benzofuranyl)-piperidin eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK143105C (da) | Analogifremgangsmaade til fremstilling af aminobenzocycloheptenderivater eller farmaceutisk acceptable additionssalte deraf | |
| DK152211C (da) | Analogifremgangsmaade til fremstilling af n-phenyl-n-(4-piperidinyl)-amider eller farmaceutisk acceptable syreadditionssalte deraf. | |
| DK148281C (da) | Analogifremgangsmaade til fremstilling af 8a-substituerede 8,8a-desoxy-8,8a-dihydrooleandomycin-forbindelser eller farmaceutiskacceptable syreadditionssalte deraf | |
| DK144793C (da) | Analogifremgangsmaade til fremstilling af dihydro- eller tetrahydroiminothiaziner eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK152208C (da) | Analogifremgangsmaade til fremstilling af 2-phenylamino-phenyleddikesyreamider eller farmaceutisk acceptable salte deraf | |
| DK157021C (da) | Analogifremgangsmaade til fremstilling af 2,3-polymethylen-4-oxo-4h-pyrido- eller -azepinooe1,2-aaapyrimidiner eller farmaceutisk acceptable syreadditionssalte eller kvaternaere salte deraf | |
| DK146851C (da) | Analogifremgangsmaade til fremstilling af benzylaminer eller deres syreadditionssalte af en- eller flerbasiske, fysiologisk acceptable syrer |