DEU0000790MA - - Google Patents
Info
- Publication number
- DEU0000790MA DEU0000790MA DEU0000790MA DE U0000790M A DEU0000790M A DE U0000790MA DE U0000790M A DEU0000790M A DE U0000790MA
- Authority
- DE
- Germany
- Prior art keywords
- iron
- silicon
- oxide
- mixture according
- exothermic mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 121
- 229910052742 iron Inorganic materials 0.000 claims description 56
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Inorganic materials [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 claims description 56
- 239000000203 mixture Substances 0.000 claims description 41
- 229910052710 silicon Inorganic materials 0.000 claims description 41
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 38
- 239000010703 silicon Substances 0.000 claims description 38
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 claims description 17
- NDLPOXTZKUMGOV-UHFFFAOYSA-N oxo(oxoferriooxy)iron hydrate Chemical compound O.O=[Fe]O[Fe]=O NDLPOXTZKUMGOV-UHFFFAOYSA-N 0.000 claims description 16
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 claims description 15
- 239000000292 calcium oxide Substances 0.000 claims description 13
- 239000002893 slag Substances 0.000 claims description 12
- 229910052799 carbon Inorganic materials 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 6
- 239000007800 oxidant agent Substances 0.000 claims description 5
- 229910000519 Ferrosilicon Inorganic materials 0.000 claims description 4
- 239000003638 chemical reducing agent Substances 0.000 claims description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052804 chromium Inorganic materials 0.000 claims description 3
- 239000011651 chromium Substances 0.000 claims description 3
- 238000002844 melting Methods 0.000 claims description 3
- 230000008018 melting Effects 0.000 claims description 3
- 229910000604 Ferrochrome Inorganic materials 0.000 claims description 2
- 238000005496 tempering Methods 0.000 claims 3
- 229910045601 alloy Inorganic materials 0.000 claims 1
- 239000000956 alloy Substances 0.000 claims 1
- 230000001105 regulatory effect Effects 0.000 claims 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 14
- 235000011941 Tilia x europaea Nutrition 0.000 description 14
- 239000004571 lime Substances 0.000 description 14
- 238000004519 manufacturing process Methods 0.000 description 13
- 239000000126 substance Substances 0.000 description 10
- 238000005266 casting Methods 0.000 description 9
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 8
- SZVJSHCCFOBDDC-UHFFFAOYSA-N iron(II,III) oxide Inorganic materials O=[Fe]O[Fe]O[Fe]=O SZVJSHCCFOBDDC-UHFFFAOYSA-N 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 4
- 150000002739 metals Chemical class 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical group [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 3
- 229910004298 SiO 2 Inorganic materials 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 230000001590 oxidative effect Effects 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 235000010344 sodium nitrate Nutrition 0.000 description 3
- 239000004317 sodium nitrate Substances 0.000 description 3
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 239000000378 calcium silicate Substances 0.000 description 2
- 229910052918 calcium silicate Inorganic materials 0.000 description 2
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 229910052748 manganese Inorganic materials 0.000 description 2
- 239000011572 manganese Substances 0.000 description 2
- 150000002736 metal compounds Chemical class 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 238000005245 sintering Methods 0.000 description 2
- 229910000599 Cr alloy Inorganic materials 0.000 description 1
- 229910000676 Si alloy Inorganic materials 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- ZFXVRMSLJDYJCH-UHFFFAOYSA-N calcium magnesium Chemical compound [Mg].[Ca] ZFXVRMSLJDYJCH-UHFFFAOYSA-N 0.000 description 1
- WETINTNJFLGREW-UHFFFAOYSA-N calcium;iron;tetrahydrate Chemical compound O.O.O.O.[Ca].[Fe].[Fe] WETINTNJFLGREW-UHFFFAOYSA-N 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- 239000000788 chromium alloy Substances 0.000 description 1
- UPHIPHFJVNKLMR-UHFFFAOYSA-N chromium iron Chemical compound [Cr].[Fe] UPHIPHFJVNKLMR-UHFFFAOYSA-N 0.000 description 1
- DYRBFMPPJATHRF-UHFFFAOYSA-N chromium silicon Chemical compound [Si].[Cr] DYRBFMPPJATHRF-UHFFFAOYSA-N 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000011872 intimate mixture Substances 0.000 description 1
- 150000002506 iron compounds Chemical class 0.000 description 1
- 150000002681 magnesium compounds Chemical class 0.000 description 1
- -1 magnetite Chemical compound 0.000 description 1
- 238000010310 metallurgical process Methods 0.000 description 1
- 238000012806 monitoring device Methods 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- NIFIFKQPDTWWGU-UHFFFAOYSA-N pyrite Chemical compound [Fe+2].[S-][S-] NIFIFKQPDTWWGU-UHFFFAOYSA-N 0.000 description 1
- 229910052683 pyrite Inorganic materials 0.000 description 1
- 239000011028 pyrite Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 150000003388 sodium compounds Chemical class 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0770149B1 (de) | Verfahren zur herstellung von hydraulischen bindemitteln und/oder legierungen wie z.b. eisenchrom oder eisenvanadium | |
| EP0235291B1 (de) | Verfahren zur herstellung von vanadiumschlacke | |
| DE3045180C2 (de) | Verfahren und Vorrichtung zur Herstellung einer hochchromhaltigen Roheisenschmelze als Zwischenprodukt für die Herstellung von hochchromhaltigem Stahl | |
| DE2612500C3 (de) | Reduktionsmittel für die Stahlherstellung | |
| DE2427205B2 (de) | Verfahren zur stahlherstellung | |
| DE951089C (de) | Exothermisches Gemisch und Verfahren zum Vergueten von Eisen | |
| DEU0000790MA (enExample) | ||
| DE660832C (de) | Verfahren zum Herstellen von rostfreiem Eisen | |
| DE2358720A1 (de) | Schmieden von metallpulvern | |
| DE2406845A1 (de) | Stahlraffinationsverfahren | |
| DE639497C (de) | Verfahren zur Gewinnung von kohlenstoff- und siliziumarmem Vanadin, Chrom und Mangan oder Legierungen dieser Metalle | |
| DD202895A5 (de) | Zusatzstoffe fuer auf geschmolzenem eisen basierende legierungen | |
| DE401172C (de) | Verfahren zur Herstellung von Eisenchromlegierungen | |
| DE898314C (de) | Verfahren zum Herstellen einer eisen- und chromhaltigen Vorlegierung fuer die Erzeugung von Chromstahl oder Eisen | |
| DE856448C (de) | Verfahren zum Einfuehren von Legierungselementen in geschmolzene Metalle, insbesondere Eisen und Stahl | |
| DE2658315C2 (de) | Reduktionsmittel für die Stahlherstellung | |
| DE432917C (de) | Verfahren zur Erzeugung von kohlenstofffreien oder kohlenstoffarmen Eisenlegierungen, wie Eisenchrom oder rostfreies Eisen | |
| DE2715077C3 (de) | Exothermes Gemisch zum Frischen von Stahlschmelzen | |
| AT165589B (de) | Verfahren zur Herstellung feuerbeständiger, in der Hauptsache austenitischer, bearbeitbarer Legierungen von großer Dauerstandfestigkeit bei hohen Temperaturen | |
| DE415323C (de) | Verfahren zur Herstellung kohlenstoff- und siliciumarmer bzw. siliciumfreier Chrom- und Manganlegierungen | |
| DE2528550B2 (de) | Chromzuschlagstoff und verfahren zu seiner herstellung | |
| DE426123C (de) | Verfahren zur Erzeugung von kohlenstoffarmen Eisen-Chrom-Legierungen | |
| DE908378C (de) | Verfahren zur Behandlung von metallurgischen Schlacken | |
| DE1608186C3 (de) | Verfahren zum Herstellen von Ferromangan oder Ferrochrom mit mittlerem oder niedrigem Kohlenstoffgehalt | |
| DE2638172C2 (de) | Verfahren zur Herstellung von Zusatzmitteln für Stahlschmelzen |