DES0039702MA - - Google Patents
Info
- Publication number
- DES0039702MA DES0039702MA DES0039702MA DE S0039702M A DES0039702M A DE S0039702MA DE S0039702M A DES0039702M A DE S0039702MA
- Authority
- DE
- Germany
- Prior art keywords
- iron
- phosphorus
- ores
- substances
- oxygen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 93
- 229910052742 iron Inorganic materials 0.000 claims description 43
- 229910052698 phosphorus Inorganic materials 0.000 claims description 31
- 239000011574 phosphorus Substances 0.000 claims description 26
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 23
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 16
- 229910052760 oxygen Inorganic materials 0.000 claims description 16
- 239000001301 oxygen Substances 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 14
- 229910052799 carbon Inorganic materials 0.000 claims description 10
- 239000000126 substance Substances 0.000 claims description 10
- 239000003638 chemical reducing agent Substances 0.000 claims description 9
- 239000002893 slag Substances 0.000 claims description 9
- 229910000640 Fe alloy Inorganic materials 0.000 claims description 8
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 claims description 8
- 239000000571 coke Substances 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 7
- 239000002184 metal Substances 0.000 claims description 7
- 235000008733 Citrus aurantifolia Nutrition 0.000 claims description 6
- 235000011941 Tilia x europaea Nutrition 0.000 claims description 6
- 239000004571 lime Substances 0.000 claims description 6
- 235000019738 Limestone Nutrition 0.000 claims description 4
- RHZUVFJBSILHOK-UHFFFAOYSA-N anthracen-1-ylmethanolate Chemical compound C1=CC=C2C=C3C(C[O-])=CC=CC3=CC2=C1 RHZUVFJBSILHOK-UHFFFAOYSA-N 0.000 claims description 4
- 239000003830 anthracite Substances 0.000 claims description 4
- 239000000969 carrier Substances 0.000 claims description 4
- 238000006477 desulfuration reaction Methods 0.000 claims description 4
- 230000023556 desulfurization Effects 0.000 claims description 4
- 239000006028 limestone Substances 0.000 claims description 4
- 239000000155 melt Substances 0.000 claims description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 3
- 229910000831 Steel Inorganic materials 0.000 claims description 3
- 238000005275 alloying Methods 0.000 claims description 3
- 229910052804 chromium Inorganic materials 0.000 claims description 3
- 239000011651 chromium Substances 0.000 claims description 3
- 238000002844 melting Methods 0.000 claims description 3
- 230000008018 melting Effects 0.000 claims description 3
- 239000007787 solid Substances 0.000 claims description 3
- 239000010959 steel Substances 0.000 claims description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 2
- 229910045601 alloy Inorganic materials 0.000 claims description 2
- 239000000956 alloy Substances 0.000 claims description 2
- 239000007788 liquid Substances 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims description 2
- 230000004048 modification Effects 0.000 claims 1
- 238000012986 modification Methods 0.000 claims 1
- 229910052717 sulfur Inorganic materials 0.000 description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 6
- 229910052710 silicon Inorganic materials 0.000 description 6
- 239000010703 silicon Substances 0.000 description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000011593 sulfur Substances 0.000 description 5
- 239000007800 oxidant agent Substances 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- 229910000805 Pig iron Inorganic materials 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000011787 zinc oxide Substances 0.000 description 3
- 238000005255 carburizing Methods 0.000 description 2
- 239000002817 coal dust Substances 0.000 description 2
- 238000005261 decarburization Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- -1 scrap Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- SZVJSHCCFOBDDC-UHFFFAOYSA-N iron(II,III) oxide Inorganic materials O=[Fe]O[Fe]O[Fe]=O SZVJSHCCFOBDDC-UHFFFAOYSA-N 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- RNWHGQJWIACOKP-UHFFFAOYSA-N zinc;oxygen(2-) Chemical compound [O-2].[Zn+2] RNWHGQJWIACOKP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0770149B1 (de) | Verfahren zur herstellung von hydraulischen bindemitteln und/oder legierungen wie z.b. eisenchrom oder eisenvanadium | |
| EP1090152B1 (de) | Verfahren zum aufarbeiten von stahlschlacken | |
| DE2155589B2 (de) | Verfahren zur Herstellung von geschmolzenen Eisenlegierungen, die 5,0 bis 30,0 Gw.°/o Chrom und 0 bis 25,0 Gw.o/o Nickel enthalten | |
| DE954606C (de) | Verfahren zur Erzeugung von phosphorarmem Eisen aus phosphorreichen metallischen und oxydischen Rohstoffen | |
| DE660832C (de) | Verfahren zum Herstellen von rostfreiem Eisen | |
| DES0039702MA (cs) | ||
| WO2000015855A1 (de) | Verfahren zum aufarbeiten von stahlschlacken und eisenträgern | |
| DE2656725C2 (de) | Verfahren zum kontinuierlichen Erschmelzen von Ferrochrom | |
| DE589738C (de) | Verfahren zur Gewinnung von Blei, Antimon oder Wismut | |
| DE288644C (cs) | ||
| DE2340174A1 (de) | Verfahren zur herstellung von ferronickel hoher qualitaet unmittelbar aus nickeleisenoxiderzen | |
| DE3240656A1 (de) | Verfahren zur schmelzreduktion von metallerz | |
| WO1997026381A1 (de) | Gewinnung von roheisen, ferro- und/oder buntmetall-legierungen zusammen mit synthetischer hochofenschlacke aus müllverbrennungsrückständen und stahlwerksschlacke | |
| DE750747C (de) | Verfahren zum Herstellen von Ferrolegierungen niedrigen und mittleren Kohlenstoffgehaltes | |
| AT405653B (de) | Verfahren zur herstellung von hydraulischen bindemitteln und rohrstahl oder legierungen aus stahlschlacke | |
| DE900140C (de) | Verfahren zur Herstellung eines fuer die Gewinnung von Chrom geeigneten Ausgangsstoffes | |
| DE621794C (de) | Verfahren zur Herstellung kohlenstoffarmer Eisen-Chrom-Legierungen | |
| DE942329C (de) | Verfahren zur direkten Stahlerzeugung in Konvertern | |
| WO1998011263A1 (de) | Verfahren zum abtrennen von zinn sowie erforderlichenfalls von kupfer aus schrottschmelzen, insbesondere weissblechschmelzen oder metallischen schmelzen | |
| DE908302C (de) | Verfahren zum Herstellen kohlenstoffarmer Ferrolegierungen und Metalle | |
| DE500982C (de) | Verfahren zum Erzeugen von kohlenstoffarmem, mit Chrom oder Mangan legiertem Eisen oder Stahl | |
| DE657665C (de) | Verfahren zur Herstellung kohlenstoffarmer Eisen-Chrom-Legierungen mit verhaeltnismaessig hohem Chromgehalt | |
| DE898449C (de) | Verfahren zur Herstellung von chromlegierten Staehlen im basischen Siemens-Martin-Ofen | |
| AT103062B (de) | Verfahren zur Herstellung einer blankbleibenden Eisenlegierung bzw. eines solchen Stahles. | |
| DE668389C (de) | Verfahren zur Behandlung, insbesondere Raffinierung von Eisen und Stahl sowie zur Herstellung niedriggekohlter Ferrolegierungen |