DES0026716MA - - Google Patents
Info
- Publication number
- DES0026716MA DES0026716MA DES0026716MA DE S0026716M A DES0026716M A DE S0026716MA DE S0026716M A DES0026716M A DE S0026716MA
- Authority
- DE
- Germany
- Prior art keywords
- parts
- phenol
- cumene
- hydroperoxide
- acetone
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 20
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 claims description 12
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 12
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 7
- 239000011593 sulfur Substances 0.000 claims description 7
- 229910052717 sulfur Inorganic materials 0.000 claims description 7
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 5
- 239000003054 catalyst Substances 0.000 claims description 5
- 229910052785 arsenic Inorganic materials 0.000 claims description 4
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims description 4
- 229910052698 phosphorus Inorganic materials 0.000 claims description 4
- 239000011574 phosphorus Substances 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 2
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 14
- 238000003776 cleavage reaction Methods 0.000 description 8
- 230000007017 scission Effects 0.000 description 8
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 210000004124 hock Anatomy 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- YWBMNCRJFZGXJY-UHFFFAOYSA-N 1-hydroperoxy-1,2,3,4-tetrahydronaphthalene Chemical compound C1=CC=C2C(OO)CCCC2=C1 YWBMNCRJFZGXJY-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- -1 alkyl aromatic hydroperoxides Chemical class 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- CSQAFOOUUOKKPH-UHFFFAOYSA-N benzylbenzene hydrogen peroxide Chemical compound OO.C=1C=CC=CC=1CC1=CC=CC=C1 CSQAFOOUUOKKPH-UHFFFAOYSA-N 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000012262 resinous product Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE913778C (de) | Verfahren zur Herstellung von Phenolen | |
| DE2115551B2 (de) | Verfahren zur Herstellung von aromatischen Hydroxyaldehyden | |
| DE946807C (de) | Verfahren zur gleichzeitigen Herstellung von Phenol und Aceton | |
| DE1793570C3 (de) | Verfahren zur Herstellung von Methylveratrylketon. Ausscheidung aus: 1518037 | |
| DE1543569B1 (de) | Verfahren zur Herstellung von 2,3-Dihydro-2,2-dimethyl-7-benzofuranol | |
| DE574838C (de) | Verfahren zur Darstellung von cyclischen Glykolen und ihren Derivaten bzw. von Ketonen | |
| EP0058326B1 (de) | Verfahren zur Herstellung von araliphatischen Aldehyden und/oder Aminen | |
| DE2640026C2 (de) | Verfahren zur Herstellung von 6,10,14-Trimethylpentadecan-2-on | |
| DE837998C (de) | Verfahren zur Herstellung von aliphatischen Diketonen | |
| DE511092C (de) | Verfahren zur Herstellung von harzartigen Produkten | |
| DE844292C (de) | Verfahren zur Herstellung lactonartiger Erzeugnisse | |
| DE960283C (de) | Verfahren zur Herstellung von Chromanderivaten | |
| DE921624C (de) | Verfahren zur Herstellung von Cyclohexanonoxim durch Oxydation von Cyclohexylhydroxylamin | |
| DE2506801A1 (de) | Verfahren zur herstellung von aethylphenolen | |
| DE629313C (de) | Verfahren zur Herstellung substituierter Phenylaethylamine | |
| DE10055653A1 (de) | Verfahren zur Oxidation von Ketonen und Aldehyden mit Wasserstoffperoxid über eine Baeyer-Villiger-Oxidation | |
| DE2344386A1 (de) | Verfahren zur herstellung von hydrochinon | |
| DE561519C (de) | Verfahren zur Darstellung aromatischer Oxyaldehyde | |
| DE810628C (de) | Verfahren zur Herstellung von 3, 7-Dimethyl-1-(2', 6', 6'-trimethyl-cyclohex-1'-enyl)-nona-3, 5, 7-trien-1-in-9-ol | |
| DE767849C (de) | Verfahren zur Herstellung von Kondensationsprodukten aus Styrol und Formaldehyd | |
| DE909570C (de) | Verfahren zur Herstellung von Aldolen | |
| DE962527C (de) | Verfahren zur Herstellung von Oxyhydroperoxyden | |
| DE2426863A1 (de) | Verfahren zur spaltung von cycloaliphatischen hdroperoxiden | |
| DE960199C (de) | Verfahren zur Herstellung von Cyclohexylhydroxylamin durch katalytische Hydrierung von Nitrocyclohexan | |
| DE1016270B (de) | Verfahren zur gleichzeitigen Herstellung von Phenolen und Ketonen oder Aldehyden |