DEP0009087MA - - Google Patents
Info
- Publication number
- DEP0009087MA DEP0009087MA DEP0009087MA DE P0009087M A DEP0009087M A DE P0009087MA DE P0009087M A DEP0009087M A DE P0009087MA
- Authority
- DE
- Germany
- Prior art keywords
- thread
- aqueous
- dispersion
- bath
- less
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000006185 dispersion Substances 0.000 claims description 20
- 238000001556 precipitation Methods 0.000 claims description 11
- 239000002245 particle Substances 0.000 claims description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- 238000010438 heat treatment Methods 0.000 claims description 9
- -1 polytetrafluoroethylene Polymers 0.000 claims description 7
- 229920001343 polytetrafluoroethylene Polymers 0.000 claims description 6
- 239000004810 polytetrafluoroethylene Substances 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 5
- 238000010494 dissociation reaction Methods 0.000 claims description 3
- 230000005593 dissociations Effects 0.000 claims description 3
- 238000000578 dry spinning Methods 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 150000007522 mineralic acids Chemical class 0.000 claims description 3
- 150000007524 organic acids Chemical class 0.000 claims description 3
- 238000005406 washing Methods 0.000 claims description 3
- 238000002166 wet spinning Methods 0.000 claims description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 229920000642 polymer Polymers 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- 238000002441 X-ray diffraction Methods 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000015271 coagulation Effects 0.000 description 2
- 238000005345 coagulation Methods 0.000 description 2
- 238000000748 compression moulding Methods 0.000 description 2
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 230000001376 precipitating effect Effects 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 229960005215 dichloroacetic acid Drugs 0.000 description 1
- 239000004815 dispersion polymer Substances 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000010327 methods by industry Methods 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000002685 polymerization catalyst Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 1
- 229910052939 potassium sulfate Inorganic materials 0.000 description 1
- 235000011151 potassium sulphates Nutrition 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE931732C (de) | Verfahren zur Herstellung eines fuer die Verarbeitung auf geformte Gegenstaende geeigneten Kopolymeren | |
| DE1494656A1 (de) | Verfahren zur Herstellung von Faeden aus Polypyrrolidon | |
| DD201702A5 (de) | Hochmodul- polyacrylnitrilfaeden und -fasern sowie verfahren zu ihrer herstellung | |
| DE3515461A1 (de) | Kunststoffmischfaser | |
| DE941092C (de) | Verfahren zur Herstellung von kuenstlichen Gebilden, wie Faeden oder Filme, aus einer Dispersion von Polytetrafluoraethylen | |
| DEP0009087MA (enExample) | ||
| DE2942763A1 (de) | Verfahren zur herstellung einer polyacrylnitril-umkehrosmosemembran | |
| DE916470C (de) | Verfahren zur Herstellung waessriger Kolloiddispersionen von Polymeren | |
| DE2736302B2 (de) | Verfahren zur Herstellung von Polypyrrolidonfäden | |
| DE2247615A1 (de) | Verfahren zur herstellung eines carboxylierten polyestermaterials | |
| DE69515531T2 (de) | Elektrisch leitende fasern | |
| DE1494748C3 (de) | Verfahren zum Verbessern der Eigenschaften von Fäden oder Fasern aus einem Fluoräthylenpolymerisat | |
| DE2541482B2 (de) | Verfahren zur herstellung von verstreckten faeden aus poly-phenylen- 1,3,4-oxadiazol | |
| DE2008837A1 (de) | Verfahren zur Herstellung von Polyamidfäden von hoher Festigkeit | |
| DE850213C (de) | Verfahren zur Herstellung von geformten Gebilden aus Polyvinyl- oder Polyacrylverbindungen | |
| DE69612876T2 (de) | Polyphenylenterephthalamid-gegenstände mit hohe flammbeständigkeit | |
| AT332526B (de) | Verfahren zur herstellung von viskosehohlfasern | |
| AT224260B (de) | Verfahren zur Herstellung von geformten Gebilden, wie Fasern, Fäden, Bändern, Stangen oder Röhren aus Acrylnitrilpolymeren und -copolymeren | |
| AT201768B (de) | Verfahren zur Herstellung von länglichen Gebilden, z. B. Fäden, Bändern oder Filmen aus hochpolymerem Polypropylen | |
| DE1817952A1 (de) | Verfahren zur herstellung von faeden und fasern aus aromatischen polyamiden | |
| DE1924736A1 (de) | Polyamidmassen und Verfahren zur Herstellung derselben | |
| DE2357587C3 (de) | Verfahren zur Herstellung von gegebenenfalls mit einem Aldehyd acetalisierten Fäden und Folien aus einer Polyvinylalkohol als Matrix enthaltenden wäßrigen Spinnemulsion eines Vinylchlorid- und/oder Vinylidenchlorid-Polymerisats sowie Polymeremulsion zur Durchführung dieses Verfahrens | |
| DE1469024C (de) | Verfahren zum Herstellen von Faden, Fasern, Folien oder Formgebilden durch Verformen von Viskose oder Celluloseden vaten | |
| DE886951C (de) | Verfahren zur Herstellung von kuenstlichen Gebilden aus Mischpolymeren des Vinylchlorids und Vinylacetats | |
| DE1080262B (de) | Verfahren zur Herstellung von Gebilden, wie Faeden, Fasern oder Folien, aus einem Gemisch von Acrylnitril-polymerisaten oder -mischpolymerisaten und Celluloseaether |