DEM0026608MA - - Google Patents
Info
- Publication number
- DEM0026608MA DEM0026608MA DEM0026608MA DE M0026608M A DEM0026608M A DE M0026608MA DE M0026608M A DEM0026608M A DE M0026608MA
- Authority
- DE
- Germany
- Prior art keywords
- naphthylamine
- phenyl
- oil
- percent
- weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical group NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 claims description 20
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- KEQFTVQCIQJIQW-UHFFFAOYSA-N N-Phenyl-2-naphthylamine Chemical compound C=1C=C2C=CC=CC2=CC=1NC1=CC=CC=C1 KEQFTVQCIQJIQW-UHFFFAOYSA-N 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 3
- -1 phenyl- Chemical group 0.000 claims description 3
- JBIJLHTVPXGSAM-UHFFFAOYSA-N 2-naphthylamine Chemical compound C1=CC=CC2=CC(N)=CC=C21 JBIJLHTVPXGSAM-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 2
- 150000004982 aromatic amines Chemical class 0.000 claims 3
- 239000003921 oil Substances 0.000 description 42
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 17
- 229910052802 copper Inorganic materials 0.000 description 17
- 239000010949 copper Substances 0.000 description 17
- 230000003647 oxidation Effects 0.000 description 7
- 238000007254 oxidation reaction Methods 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 6
- 239000000654 additive Substances 0.000 description 6
- 239000003963 antioxidant agent Substances 0.000 description 6
- 230000003078 antioxidant effect Effects 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 230000006866 deterioration Effects 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- VAMXMNNIEUEQDV-UHFFFAOYSA-N methyl anthranilate Chemical compound COC(=O)C1=CC=CC=C1N VAMXMNNIEUEQDV-UHFFFAOYSA-N 0.000 description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000004090 dissolution Methods 0.000 description 3
- 239000006078 metal deactivator Substances 0.000 description 3
- 230000000996 additive effect Effects 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 230000002542 deteriorative effect Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229940102398 methyl anthranilate Drugs 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 150000003141 primary amines Chemical class 0.000 description 2
- 239000010802 sludge Substances 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- VEUMANXWQDHAJV-UHFFFAOYSA-N 2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol Chemical compound OC1=CC=CC=C1C=NCCN=CC1=CC=CC=C1O VEUMANXWQDHAJV-UHFFFAOYSA-N 0.000 description 1
- RURPJGZXBHYNEM-UHFFFAOYSA-N 2-[2-[(2-hydroxyphenyl)methylideneamino]propyliminomethyl]phenol Chemical compound C=1C=CC=C(O)C=1C=NC(C)CN=CC1=CC=CC=C1O RURPJGZXBHYNEM-UHFFFAOYSA-N 0.000 description 1
- YONDNWOKCUQRQF-UHFFFAOYSA-N 2-aminobenzoic acid;methyl 2-aminobenzoate Chemical compound NC1=CC=CC=C1C(O)=O.COC(=O)C1=CC=CC=C1N YONDNWOKCUQRQF-UHFFFAOYSA-N 0.000 description 1
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 239000002199 base oil Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000010354 butylated hydroxytoluene Nutrition 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000009849 deactivation Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
- XMFRQHDPDGAVEW-UHFFFAOYSA-L zinc;hexylsulfanyl-dioxido-sulfanylidene-$l^{5}-phosphane Chemical compound [Zn+2].CCCCCCSP([O-])([O-])=S XMFRQHDPDGAVEW-UHFFFAOYSA-L 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3884728T2 (de) | Frostschutzmittel mit korrosionsinhibierender Eigenschaft. | |
| DE938148C (de) | Schmieroel | |
| DE942586C (de) | Zusaetze zu Schmiermitteln und Turbinenoelen auf Mineralschmieroelbasis | |
| DE2429512C2 (de) | Verwendung einer konzentrierten Lösung von Benzotriazol und/oder Tetrahydrobenzotriazol als Korrosionsschutzmittel | |
| DE69300390T2 (de) | Korrosioninhibitoren für Wärmeübertragungsflüssigkeiten. | |
| DE2119629C3 (de) | Korrosionsschutzmittel und Verfahren zum Schutz vor Schwefelwasserstoffspannungsrisskorrosion | |
| DE1906293C3 (de) | Hydraulische Flüssigkeit für Flugzeuge | |
| DE1771548C3 (de) | Metallbearbeitungs- und Korrosionsschutzmittel | |
| DE961917C (de) | Isolieroel | |
| DE1211892B (de) | Nichtwaessriges Phosphatierungsbad | |
| DEM0026608MA (enExample) | ||
| DE2821386A1 (de) | Antioxidationsmittelsystem und durch dieses stabilisierte schmieroele | |
| DE1769651B1 (de) | Antikorrosionsadditiv fuer Schmierfette | |
| DE2530562A1 (de) | Korrosionsinhibierung | |
| DE2355436C3 (de) | Mittel zur Verhinderung eines Angreifens von Säuren auf Metalle auf Grundlage eines eine Thioharnstoffverbindung und ein Sulfoniumsalz enthaltenden Inhibitorengemisches | |
| DE1031919B (de) | Isolier- und Schmieroele | |
| DE1270722C2 (de) | Mineralschmieroel | |
| EP0231524B1 (de) | Verwendung von Alkylbenzoylacrylsäuren als Korrosionsinhibitoren | |
| DE2529807A1 (de) | 3,5-bis-(alkyldithio)-4-substituierte isothiazole und ihre verwendung als korrosionsschutzadditiv in schmieroelen | |
| DE1621450A1 (de) | Verfahren zur Verhuetung von Metallkorrosionen | |
| DE1492522C3 (de) | Gefrierschutzmittel für Kühlflüssigkeiten | |
| DE1082597B (de) | Organische Metalldeaktivatormasse fuer die Stabilisierung von Kohlenwasser-stoffoelen oder Fettsaeureglyceriden | |
| DE3512351A1 (de) | Antikorrodierende schmiermittelzusammensetzungen zur behandlung von metallplatten | |
| DE944623C (de) | Zusatzmittel fuer technische OEle und Fette auf Minerlaoelbasis | |
| DE952999C (de) | Synthetisches Schmiermittelgemisch |