DEM0021060MA - - Google Patents
Info
- Publication number
- DEM0021060MA DEM0021060MA DEM0021060MA DE M0021060M A DEM0021060M A DE M0021060MA DE M0021060M A DEM0021060M A DE M0021060MA
- Authority
- DE
- Germany
- Prior art keywords
- copper
- catalyst
- chloride
- aniline
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 56
- 239000003054 catalyst Substances 0.000 claims description 50
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 claims description 39
- 238000000034 method Methods 0.000 claims description 29
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 25
- 239000000203 mixture Substances 0.000 claims description 21
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 claims description 20
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 17
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 claims description 17
- 238000010438 heat treatment Methods 0.000 claims description 17
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 claims description 16
- 229910052802 copper Inorganic materials 0.000 claims description 16
- 239000010949 copper Substances 0.000 claims description 16
- 229910021591 Copper(I) chloride Inorganic materials 0.000 claims description 13
- MMCPOSDMTGQNKG-UHFFFAOYSA-N anilinium chloride Chemical compound Cl.NC1=CC=CC=C1 MMCPOSDMTGQNKG-UHFFFAOYSA-N 0.000 claims description 13
- 229910052742 iron Inorganic materials 0.000 claims description 10
- 229910021592 Copper(II) chloride Inorganic materials 0.000 claims description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 9
- 150000001879 copper Chemical class 0.000 claims description 9
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 8
- 235000019270 ammonium chloride Nutrition 0.000 claims description 8
- 229910052751 metal Inorganic materials 0.000 claims description 8
- 239000002184 metal Substances 0.000 claims description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 7
- 239000011701 zinc Substances 0.000 claims description 7
- 229910052725 zinc Inorganic materials 0.000 claims description 7
- 239000007791 liquid phase Substances 0.000 claims description 4
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 claims description 3
- 229910000366 copper(II) sulfate Inorganic materials 0.000 claims description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- -1 amine hydrochloride Chemical class 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims 3
- 150000004677 hydrates Chemical class 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 15
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000009825 accumulation Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- MMCPOSDMTGQNKG-UJZMCJRSSA-N aniline;hydrochloride Chemical compound Cl.N[14C]1=[14CH][14CH]=[14CH][14CH]=[14CH]1 MMCPOSDMTGQNKG-UJZMCJRSSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- IAHBIMWHYUOIOH-UHFFFAOYSA-N vanadium hydrochloride Chemical compound Cl.[V] IAHBIMWHYUOIOH-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2129423A1 (de) | Verfahren zur Hydrolyse von Nitrilen zu Amiden | |
| CH631956A5 (de) | Verfahren zur herstellung von 2,5-dichlorphenol. | |
| DE1667045A1 (de) | Verfahren zur Herstellung eines besonders fuer die NO-Hydrierung zu Hydroxylamin geeigneten Platinkatalysators | |
| DE3007139C2 (de) | Kupferchromit-Katalysator, Verfahren zu seiner Herstellung und seine Verwendung zur Herstellung von Alkoholen aus ungesättigten Aldehyden | |
| EP2291327A1 (de) | Verfahren zur herstellung von reinem ammoniumperrhenat | |
| DEM0021060MA (enrdf_load_stackoverflow) | ||
| DE2506348A1 (de) | Hydrierkatalysator | |
| DE956046C (de) | Verfahren zur Herstellung von Diphenylamin und kernalkylsubstituierten Diphenylaminen | |
| EP0021073B1 (de) | Kobaltkatalysator, seine Herstellung und Verwendung, insbesondere zur Herstellung von Aminen | |
| DE2947825C2 (de) | Verfahren zur Herstellung von 4-Aminobuttersäureamid-hydrochlorid | |
| DE2211231C3 (de) | Verfahren zur Herstellung von Jodwasserstoff und/oder Alkyljodiden | |
| DE2945961A1 (de) | Verfahren zur rueckfuehrung des edelmetallkatalysators zur herstellung aromatischer urethane | |
| DE614801C (de) | Verfahren zur elektrolytischen Niederschlagung von Metallen der Platingruppe | |
| EP0248358B1 (de) | Verfahren zur Verringerung des Kupfersalzgehalts in Oxamid | |
| DE910410C (de) | Verfahren zur Herstellung von Vinylchlorid | |
| DE710746C (de) | Verfahren zur Herstellung hoehermolekularer Aldehyde | |
| DE1916533C3 (de) | Verfahren zur Herstellung von Methyl-2,5-hexadienoat | |
| DE1021341B (de) | Verfahren zur Herstellung von Engelschem Salz | |
| DE60207966T2 (de) | Verfahren für die selektive Zersetzung von Hydrazin/substituiertem Hydrazin/Wasser | |
| DE2060329C3 (de) | Verfahren zur Herstellung von substituierten Benzamiden | |
| DE1926042C3 (de) | Verfahren zur Rückgewinnung von auf Oberflächen abgelagertem Palladium | |
| DE1112727B (de) | Verfahren zur Herstellung von Tetrachlorkohlenstoff durch Erhitzen von Phosgen | |
| EP0029083A1 (de) | Verfahren zur gleichzeitigen Herstellung von Stickstoffmonoxid und Alkalihydroxid aus wässrigen Lösungen von Alkalinitrit durch Elektrolyse | |
| DE929191C (de) | Verfahren zur Herstellung von Aminocarbonsaeuren | |
| DE1768458C3 (enrdf_load_stackoverflow) |