DEH0020497MA - - Google Patents
Info
- Publication number
- DEH0020497MA DEH0020497MA DEH0020497MA DE H0020497M A DEH0020497M A DE H0020497MA DE H0020497M A DEH0020497M A DE H0020497MA
- Authority
- DE
- Germany
- Prior art keywords
- ether
- trimethylcyclohexen
- aldehyde
- acetal
- parts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 39
- 238000000034 method Methods 0.000 claims description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 10
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 10
- 239000003795 chemical substances by application Substances 0.000 claims description 9
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 claims description 8
- ZKJNETINGMOHJG-GGWOSOGESA-N (e)-1-[(e)-prop-1-enoxy]prop-1-ene Chemical compound C\C=C\O\C=C\C ZKJNETINGMOHJG-GGWOSOGESA-N 0.000 claims description 7
- 238000009833 condensation Methods 0.000 claims description 7
- 230000005494 condensation Effects 0.000 claims description 7
- 239000011541 reaction mixture Substances 0.000 claims description 7
- 230000002378 acidificating effect Effects 0.000 claims description 5
- 238000006359 acetalization reaction Methods 0.000 claims description 4
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- 230000008030 elimination Effects 0.000 claims description 3
- 238000003379 elimination reaction Methods 0.000 claims description 3
- MHNNAWXXUZQSNM-UHFFFAOYSA-N methylethylethylene Natural products CCC(C)=C MHNNAWXXUZQSNM-UHFFFAOYSA-N 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- 229910015900 BF3 Inorganic materials 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 18
- 239000000243 solution Substances 0.000 description 18
- 150000001299 aldehydes Chemical class 0.000 description 13
- -1 ether acetal Chemical class 0.000 description 13
- 239000000203 mixture Substances 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 9
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- FJKIXWOMBXYWOQ-UHFFFAOYSA-N ethenoxyethane Chemical compound CCOC=C FJKIXWOMBXYWOQ-UHFFFAOYSA-N 0.000 description 6
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 6
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- NCYCYZXNIZJOKI-OVSJKPMPSA-N Retinaldehyde Chemical compound O=C\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C NCYCYZXNIZJOKI-OVSJKPMPSA-N 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- 229940072033 potash Drugs 0.000 description 3
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 3
- 235000015320 potassium carbonate Nutrition 0.000 description 3
- 235000020945 retinal Nutrition 0.000 description 3
- 239000011604 retinal Substances 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 238000002211 ultraviolet spectrum Methods 0.000 description 3
- NCYCYZXNIZJOKI-UHFFFAOYSA-N vitamin A aldehyde Natural products O=CC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C NCYCYZXNIZJOKI-UHFFFAOYSA-N 0.000 description 3
- 235000005074 zinc chloride Nutrition 0.000 description 3
- 239000011592 zinc chloride Substances 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000004721 Polyphenylene oxide Substances 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 230000003078 antioxidant effect Effects 0.000 description 2
- 235000006708 antioxidants Nutrition 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 229920000570 polyether Polymers 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 2
- XDHOEHJVXXTEDV-HWKANZROSA-N (e)-1-ethoxyprop-1-ene Chemical compound CCO\C=C\C XDHOEHJVXXTEDV-HWKANZROSA-N 0.000 description 1
- QHMVQKOXILNZQR-ONEGZZNKSA-N (e)-1-methoxyprop-1-ene Chemical compound CO\C=C\C QHMVQKOXILNZQR-ONEGZZNKSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N 1-ethenoxybutane Chemical compound CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- PNKQANLVRCMVPD-UHFFFAOYSA-N 1-prop-1-enoxybutane Chemical compound CCCCOC=CC PNKQANLVRCMVPD-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 150000008043 acidic salts Chemical class 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- SDUJCTKTKOLVFG-UHFFFAOYSA-N butoxymethanediol Chemical compound CCCCOC(O)O SDUJCTKTKOLVFG-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229930002839 ionone Natural products 0.000 description 1
- 150000002499 ionone derivatives Chemical class 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000002266 vitamin A derivatives Chemical class 0.000 description 1
- JYWLZPBBUYOPMI-UHFFFAOYSA-L zinc ethyl acetate dichloride Chemical compound C(C)(=O)OCC.[Cl-].[Zn+2].[Cl-] JYWLZPBBUYOPMI-UHFFFAOYSA-L 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3308922A1 (de) | Verfahren zur herstellung von fettsaeureestern der ascorbinsaeure | |
| EP0045076B1 (de) | Verfahren zur Herstellung von 1,4:3,6-Dianhydro-D-glucit-5-nitrat (Isosorbid-5-nitrat) | |
| EP0018568B1 (de) | Verfahren zur Herstellung von Imidazolen | |
| DE2005959A1 (de) | 7-Nitro-8-hydroxychinolinester, ihre Verwendung und Verfahren zur Herstellung derselben | |
| DE3710805A1 (de) | Verfahren zur herstellung von tetrahydropyran-4-carbonsaeureestern | |
| DEH0020497MA (enrdf_load_stackoverflow) | ||
| DE2627985C3 (de) | 4-Homoisotwistan-3-carbonsäureester und Verfahren zu ihrer Herstellung | |
| DE956682C (de) | Verfahren zur Herstellung des 8-[2, 6, 6-Trimethylcyclohexen- (1)-yl]-2, 6-dimethylokatrien-(2, 4, 6)-aldehyds-(1) | |
| DE953073C (de) | Verfahren zur Herstellung des 6-[2', 6', 6'-Trimethyl- cyclohexen-(1')-yl]-4-methylheadie-(2,4)-aldehyds-(1) | |
| DE1249263B (de) | Verfah ren zur Herstellung vor substituierten 1,3 Dioxocyclopentanderivaten | |
| EP0076379B1 (de) | Verfahren zur Herstellung von 4-Alkoxyacetessigestern | |
| DE2656604C3 (de) | Verfahren zur Herstellung von 1 -(2-Tetrahydrofuryl)-5-fluor-uracil | |
| DE953074C (de) | Verfahren zur Herstellung des 8-[2', 6', 6'-Trimethyl- cyclohexen-(1')-yl]-2, 6-dimetyloktatrien-(2, 4, 6)-aldehyds-(1) | |
| DE962074C (de) | Verfahren zur Herstellung des 4-[2', 6', 6'-Trimethylcyclohexyliden]-2-methylbuten-(2)-als-(1) (Iso-C-aldehyd) bzw. 4-[2', 6', 6'-Trimethylcyclohexen-(2')-yliden]-2-methylbuten-(2)-als-(1) (Retrodehydro-C-aldehyd) | |
| EP0070401A2 (de) | Verfahren zur Herstellung von Isosorbid-2-acylaten | |
| DE3211679A1 (de) | Verfahren zur herstellung von acetalen und enolaethern aus acyloxymethylenverbindungen | |
| DEH0020370MA (enrdf_load_stackoverflow) | ||
| DEH0020478MA (enrdf_load_stackoverflow) | ||
| DE974692C (de) | Verfahren zur Herstellung von 2, 2-disubstituierten 5-Acylamino-4-(p-nitrophenyl)-1,3-dioxanen | |
| DE961165C (de) | Verfahren zur Herstellung des 6-[2', 6', 6'-Trimethylcyclohexyliden]-4-methylhexadien-(2, 4)-als-(1) (Iso-C-aldehyd), des 6-[2', 6', 6',-Trimethylcyclohexen-(2')-yliden]-4-methyl-hexadien-(2', 4)-als-(1) (Retrodehydro-C-aldehyd) bzw. des 6-[2', 6', 6'-Trimethylcyclohexadien-(1', 3')-yl]-4-methyl-hexadien-(2, 4)-als-(1) (ª‰ -Dehydro-C-aldehd) | |
| DE863945C (de) | Verfahren zur Herstellung ungesaettigter cyclischer Acetale | |
| EP0031426A1 (de) | 7-Oxo-PGI2-derivate, Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende pharmazeutische Präparate | |
| DE33497C (de) | Verfahren zur Darstellung substituirter Chinolinderivate aus Imidochloriden und Malonsäure bzgl. Acetessigestern | |
| DE2221123C2 (de) | Reserpsäurederivate, Verfahren zu deren Herstellung und Arzneimittel | |
| DE835738C (de) | Verfahren zur Herstellung ungesaettigter Aldehyde |