DEH0011616MA - - Google Patents
Info
- Publication number
- DEH0011616MA DEH0011616MA DEH0011616MA DE H0011616M A DEH0011616M A DE H0011616MA DE H0011616M A DEH0011616M A DE H0011616MA
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- reaction zone
- catalyst
- gas
- contact
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 238000006243 chemical reaction Methods 0.000 claims description 37
- 238000000034 method Methods 0.000 claims description 22
- 239000003054 catalyst Substances 0.000 claims description 21
- 239000000460 chlorine Substances 0.000 claims description 18
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 15
- 229910052801 chlorine Inorganic materials 0.000 claims description 15
- VUNCWTMEJYMOOR-UHFFFAOYSA-N hexachlorocyclopentadiene Chemical compound ClC1=C(Cl)C(Cl)(Cl)C(Cl)=C1Cl VUNCWTMEJYMOOR-UHFFFAOYSA-N 0.000 claims description 14
- 239000007789 gas Substances 0.000 claims description 9
- 239000012495 reaction gas Substances 0.000 claims description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 8
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 8
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 8
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 7
- 239000008246 gaseous mixture Substances 0.000 claims description 5
- 239000007858 starting material Substances 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 229910052759 nickel Inorganic materials 0.000 claims description 4
- 239000010941 cobalt Substances 0.000 claims description 3
- 229910017052 cobalt Inorganic materials 0.000 claims description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 3
- 239000000463 material Substances 0.000 claims description 3
- 238000013021 overheating Methods 0.000 claims description 3
- 229910001570 bauxite Inorganic materials 0.000 claims description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims 2
- ZSWFCLXCOIISFI-UHFFFAOYSA-N cyclopentadiene Chemical compound C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 claims 2
- 229910052742 iron Inorganic materials 0.000 claims 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 claims 1
- 238000012423 maintenance Methods 0.000 claims 1
- 230000035899 viability Effects 0.000 claims 1
- JLYXXMFPNIAWKQ-UHFFFAOYSA-N γ Benzene hexachloride Chemical compound ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl JLYXXMFPNIAWKQ-UHFFFAOYSA-N 0.000 claims 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 18
- 238000005660 chlorination reaction Methods 0.000 description 7
- CZTQZXZIADLWOZ-UHFFFAOYSA-O 8-oxo-3-(pyridin-1-ium-1-ylmethyl)-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1SC2C(NC(=O)CC=3SC=CC=3)C(=O)N2C(C(=O)O)=C1C[N+]1=CC=CC=C1 CZTQZXZIADLWOZ-UHFFFAOYSA-O 0.000 description 4
- QWTDNUCVQCZILF-UHFFFAOYSA-N isopentane Chemical compound CCC(C)C QWTDNUCVQCZILF-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000033228 biological regulation Effects 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- AFABGHUZZDYHJO-UHFFFAOYSA-N dimethyl butane Natural products CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- FBAFATDZDUQKNH-UHFFFAOYSA-M iron chloride Chemical compound [Cl-].[Fe] FBAFATDZDUQKNH-UHFFFAOYSA-M 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- NKNYZKFBNQUWTM-UHFFFAOYSA-N 1-chloropent-1-ene Chemical compound CCCC=CCl NKNYZKFBNQUWTM-UHFFFAOYSA-N 0.000 description 1
- -1 C n H. Chemical class 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 241000006488 Eutane Species 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 238000003889 chemical engineering Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 210000003127 knee Anatomy 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69812901T2 (de) | Katalytische herstellung von pentafluorpropenen | |
| DE943647C (de) | Verfahren zur Herstellung von Hexachlorcyclopentadien | |
| DE69422812T2 (de) | Verfahren zur herstellung von 1,1,1,3,3-pentafluorpropan und/oder 1,1,3,3,3-pentafluorpropen | |
| DE2306737B2 (de) | Verfahren zur Herstellung von Graphitfluorid | |
| DE1937110A1 (de) | Auf Aluminiumfluorid basierender Katalysator fuer die Fluorierung von Kohlenwasserstoffen in der Gasphase | |
| DE1593063A1 (de) | Verbessertes Verfahren zur Herstellung fluorierter organischer Verbindungen durch Fluorierung aliphatischer Kohlenwasserstoffe in der Dampfphase | |
| DE1468680C3 (de) | Verfahren zur Herstellung chlorfluorierter Derivate des Äthylens oder des Äthans | |
| DE1104496B (de) | Verfahren zur Herstellung von 1-Chlor-2, 2, 2-trifluoraethan | |
| DE69300901T2 (de) | Verfahren zur Reinigung von 1,1,1,2-Tetrafluorethan. | |
| DE1243809B (de) | Verfahren zum Hydrocracken von Kohlenwasserstoffen | |
| DE2722741A1 (de) | Verfahren zur stereoselektiven hydrierung von alpha-pinen | |
| DE69612610T2 (de) | Verfahren zur herstellung von 1,1,1,3,3-pentafluoropropan | |
| DE60010034T2 (de) | Verfahren zum Behandeln von 1,1,1,3,3-Pentafluorpropan | |
| DEH0011616MA (enExample) | ||
| DE69603530T2 (de) | Verfahren zur Herstellung von 1,1-Difluorethan | |
| DE2060041C3 (de) | Verfahren zur Herstellung von fluorierten Kohlenwasserstoffen | |
| DE2156324C3 (de) | Verfahren zum Herstellen eines Hydrocrackkatalysators | |
| DE69715244T2 (de) | Katalytische herstellung von vinylfluorid | |
| DE2257107A1 (de) | Verfahren zur herstellung von vinylidenchlorid | |
| DE69417562T2 (de) | Fluorierungskatalysator auf der grundlage von chrom, verfahren zu dessen herstellung und fluorierungsverfahren. | |
| DE3200783C2 (de) | Verfahren zur Herstellung von gegebenenfalls substituierten cis,cis-1,3-Cyclooctadienen durch Isomerisierung von gegebenenfalls substituierten 1,4- oder 1,5-Cyclooctadienen | |
| DE69907573T2 (de) | Verfahren zur Herstellung von 1,1,1,2,3,3,3-Heptafluoropropane | |
| DE1443696A1 (de) | Verfahren zur Fluorierung von gesaettigten Perhalogenkohlenstoffen | |
| DE943770C (de) | Verfahren zur katalytischen Umformung von benzinartigen Kohlenwasserstoffdestillaten | |
| DE910410C (de) | Verfahren zur Herstellung von Vinylchlorid |