DEG0017237MA - - Google Patents
Info
- Publication number
- DEG0017237MA DEG0017237MA DEG0017237MA DE G0017237M A DEG0017237M A DE G0017237MA DE G0017237M A DEG0017237M A DE G0017237MA
- Authority
- DE
- Germany
- Prior art keywords
- gelatin
- alginyl
- nitrate
- layers
- layer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000010410 layer Substances 0.000 claims description 24
- 108010010803 Gelatin Proteins 0.000 claims description 20
- 239000008273 gelatin Substances 0.000 claims description 20
- 229920000159 gelatin Polymers 0.000 claims description 20
- 235000019322 gelatine Nutrition 0.000 claims description 20
- 235000011852 gelatine desserts Nutrition 0.000 claims description 20
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims description 14
- 229910002651 NO3 Inorganic materials 0.000 claims description 13
- 230000002209 hydrophobic effect Effects 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 7
- 229920002284 Cellulose triacetate Polymers 0.000 claims description 5
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 claims description 5
- 239000000463 material Substances 0.000 claims description 5
- 229920002678 cellulose Polymers 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 239000011241 protective layer Substances 0.000 claims description 3
- 238000000034 method Methods 0.000 claims 3
- 239000002904 solvent Substances 0.000 claims 1
- 239000012790 adhesive layer Substances 0.000 description 9
- 235000010443 alginic acid Nutrition 0.000 description 7
- 229920000615 alginic acid Polymers 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 239000000783 alginic acid Substances 0.000 description 6
- 229960001126 alginic acid Drugs 0.000 description 6
- 150000004781 alginic acids Chemical class 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 3
- AEMOLEFTQBMNLQ-VANFPWTGSA-N D-mannopyranuronic acid Chemical group OC1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@@H]1O AEMOLEFTQBMNLQ-VANFPWTGSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- -1 B. Sodium Alginate Chemical compound 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 230000005660 hydrophilic surface Effects 0.000 description 2
- 230000005661 hydrophobic surface Effects 0.000 description 2
- 150000002823 nitrates Chemical class 0.000 description 2
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- JTXMVXSTHSMVQF-UHFFFAOYSA-N 2-acetyloxyethyl acetate Chemical compound CC(=O)OCCOC(C)=O JTXMVXSTHSMVQF-UHFFFAOYSA-N 0.000 description 1
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical compound O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical class C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 229940072056 alginate Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- OIDPCXKPHYRNKH-UHFFFAOYSA-J chrome alum Chemical compound [K]OS(=O)(=O)O[Cr]1OS(=O)(=O)O1 OIDPCXKPHYRNKH-UHFFFAOYSA-J 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1950121C3 (de) | Fotografisches Aufzeichnungsmaterial | |
| DE720339C (de) | Photographische Schicht mit Bindemittel aus Vinylacetatharz und Verfahren zur Herstellung | |
| DE1957625C2 (de) | Photographisches Material | |
| DE962570C (de) | Verfahren zur Herstellung von fuer lichtempfindliche Schichten geeigneten wasserunloeslichen Traegern mit hydrophiler Oberflaeche | |
| DE1019556B (de) | Photographische Emulsion, die einen gerbenden Entwickler enthaelt | |
| DE1145014B (de) | Aus einer oder mehreren Halogensilber-emulsionsschichten aufgebautes photographisches Material | |
| DE964924C (de) | Verfahren zur Herstellung von Mehrschichtmaterial aus hydrophilen und hydrophoben Schichten | |
| DE561691C (de) | Verfahren zur Herstellung eines lichtempfindlichen Materials, bei dem sich der lichtempfindliche Stoff aus der Dampfphase auf dem Traeger absetzen gelassen wird | |
| DE1104339B (de) | Kopierschicht aus Epoxydharzen fuer Flachdruckplatten | |
| DEG0017237MA (enExample) | ||
| DE740283C (de) | Verfahren zur Herstellung einer Haftschicht auf Cellulosetriacetat-Filmen | |
| DE1745061B2 (de) | Antistatisch beschichteter Kunststoffilm und Verfahren zu seiner Herstellung | |
| DE740796C (de) | Verfahren zur Herstellung von Barytagen auf Papieren fuer photographische Zwecke | |
| DE1966038A1 (de) | Neue Dihydroxy-1,4-dioxane und Verfahren zu deren Herstellung | |
| DE1447024C3 (de) | Verfahren zur Herstellung eines lichtempfindlichen Aufzeichnungsmaterials und dessen Verwendung | |
| DE1104332B (de) | Gelatinehaltige Schichten fuer photographisches Material | |
| DE69101061T2 (de) | Hydrophile kolloidzusammensetzung für photographisches material. | |
| DE69108049T2 (de) | Beschichtungszusammensetzung und diese enthaltende verbundträger und elemente. | |
| DE2163902A1 (de) | Lichtempfindliche Silberhalogenidelemente | |
| DE653716C (de) | Photographischer Abziehfilm mit einem Hilfstraeger und einem staendigen Traeger fuer die photographische Schicht | |
| DE2253398A1 (de) | Cellulosefilm-verbundmaterial | |
| DE936007C (de) | Verfahren zur Herstellung lichtunempfindlicher Hilfsschichten in photographischen Materialien | |
| DE2232185C3 (de) | Lichtempfindliches Gemisch | |
| DE3317883A1 (de) | Phlegmatisierte formen explosionsgefaehrlicher, organischer diazo-bzw. azidoverbindungen f. strahlungsempfindliche zusammensetzungen | |
| DE226982C (enExample) |