DEC0007898MA - - Google Patents
Info
- Publication number
- DEC0007898MA DEC0007898MA DEC0007898MA DE C0007898M A DEC0007898M A DE C0007898MA DE C0007898M A DEC0007898M A DE C0007898MA
- Authority
- DE
- Germany
- Prior art keywords
- parts
- weight
- acid
- solution
- diazo
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- -1 diazo amino Chemical class 0.000 claims description 18
- 230000036947 Dissociation constant Effects 0.000 claims description 8
- 230000002378 acidificating Effects 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 6
- 150000001555 benzenes Chemical class 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- RWZYAGGXGHYGMB-UHFFFAOYSA-N Anthranilic acid Chemical class NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000004432 carbon atoms Chemical group C* 0.000 claims description 2
- 150000004985 diamines Chemical class 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims 1
- 239000007858 starting material Substances 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 14
- 239000000203 mixture Substances 0.000 description 12
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N HCl Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M Sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 8
- 150000008049 diazo compounds Chemical class 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- 239000001187 sodium carbonate Substances 0.000 description 7
- 229910000029 sodium carbonate Inorganic materials 0.000 description 7
- 239000011780 sodium chloride Substances 0.000 description 6
- CZIRZNRQHFVCDZ-UHFFFAOYSA-L Titan yellow Chemical compound [Na+].[Na+].C1=C(C)C(S([O-])(=O)=O)=C2SC(C3=CC=C(C=C3)/N=N/NC3=CC=C(C=C3)C3=NC4=CC=C(C(=C4S3)S([O-])(=O)=O)C)=NC2=C1 CZIRZNRQHFVCDZ-UHFFFAOYSA-L 0.000 description 5
- 230000001264 neutralization Effects 0.000 description 5
- 239000000047 product Substances 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- 238000010025 steaming Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- JSXMFCCPQQJLCR-UHFFFAOYSA-N 2-(cyclohexylamino)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1NC1CCCCC1 JSXMFCCPQQJLCR-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 125000005055 alkyl alkoxy group Chemical group 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- BDAGIHXWWSANSR-UHFFFAOYSA-N formic acid Chemical compound OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 3
- JGQKORRBYIBYOF-UHFFFAOYSA-N 2-(benzylamino)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1NCC1=CC=CC=C1 JGQKORRBYIBYOF-UHFFFAOYSA-N 0.000 description 2
- DHBHUGJZAZYELM-UHFFFAOYSA-N 2-(butylamino)benzoic acid Chemical compound CCCCNC1=CC=CC=C1C(O)=O DHBHUGJZAZYELM-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- 230000001808 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Substances [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- AVYGCQXNNJPXSS-UHFFFAOYSA-N 2,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC=C1Cl AVYGCQXNNJPXSS-UHFFFAOYSA-N 0.000 description 1
- AUXAEDNEZJCEJL-UHFFFAOYSA-N 2-(2-methylpropylamino)benzoic acid Chemical compound CC(C)CNC1=CC=CC=C1C(O)=O AUXAEDNEZJCEJL-UHFFFAOYSA-N 0.000 description 1
- YZYDFHZMFSHWQG-UHFFFAOYSA-N 2-(3-methylbutylamino)benzoic acid Chemical compound CC(C)CCNC1=CC=CC=C1C(O)=O YZYDFHZMFSHWQG-UHFFFAOYSA-N 0.000 description 1
- OURMOWNIJUVJSE-UHFFFAOYSA-N 2-(propan-2-ylamino)benzoic acid Chemical compound CC(C)NC1=CC=CC=C1C(O)=O OURMOWNIJUVJSE-UHFFFAOYSA-N 0.000 description 1
- VVXHQGJZORQMOC-UHFFFAOYSA-N 2-(propylamino)benzoic acid Chemical compound CCCNC1=CC=CC=C1C(O)=O VVXHQGJZORQMOC-UHFFFAOYSA-N 0.000 description 1
- PZDXDOLQKQBWJV-UHFFFAOYSA-N 4-(nitromethoxy)aniline Chemical class NC1=CC=C(OC[N+]([O-])=O)C=C1 PZDXDOLQKQBWJV-UHFFFAOYSA-N 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- 240000002268 Citrus limon Species 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N Diethylethanolamine Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- DADSZOFTIIETSV-UHFFFAOYSA-N N,N-dichloroaniline Chemical class ClN(Cl)C1=CC=CC=C1 DADSZOFTIIETSV-UHFFFAOYSA-N 0.000 description 1
- QFCSRGLEMDRBMN-UHFFFAOYSA-N N-(2-methylphenyl)nitramide Chemical class CC1=CC=CC=C1N[N+]([O-])=O QFCSRGLEMDRBMN-UHFFFAOYSA-N 0.000 description 1
- VBEGHXKAFSLLGE-UHFFFAOYSA-N N-phenylnitramide Chemical class [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000019646 color tone Nutrition 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000000875 corresponding Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2353149A1 (de) | Saure disazofarbstoffe, verfahren zu ihrer herstellung und ihrer verwendung | |
| DE2363603A1 (de) | Azofarbstoffe | |
| DEC0007898MA (fr) | ||
| DE950291C (de) | Verfahren zur Herstellung von Diazoamino-Derivaten | |
| DE1242775B (fr) | ||
| DE938250C (de) | Verfahren zur Herstellung von Diazoamino-Derivaten | |
| DE915380C (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE1644391B1 (de) | Trisazofarbstoffe | |
| DE2017873C3 (de) | Blaue Diazofarbstoffe | |
| DE2849618C2 (fr) | ||
| DE956127C (de) | Verfahren zur Herstellung von 4-Amino-diarylamin-N-sulfonsaeuren | |
| DE193142C (fr) | ||
| DE959552C (de) | Verfahren zur Isolierung von Diazoamino-Derivaten | |
| DE541474C (de) | Verfahren zur Darstellung von basisch substituierten Derivaten aromatischer Aminooxy-und Polyamino-Verbindungen | |
| DE256999C (fr) | ||
| EP0055380B1 (fr) | Composés disazoiques, procédé pour leur préparation et leur utilisation | |
| DE71160C (de) | Verfahren zur Darstellung von Substantiven Trisazofarbstoffen aus m-Phenylendiaminp-sulfosäure | |
| DE573180C (fr) | ||
| DE2841532C2 (de) | Neue Disazopigmentfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung zur Färbung von Kunststoffen, Lacken und Druckfarben | |
| DE160109C (fr) | ||
| DE895291C (de) | Verfahren zur Herstellung von Diazoamino-Derivaten | |
| DE109424C (fr) | ||
| DE955946C (de) | Verfahren zum Bedrucken von Geweben aus natuerlicher oder regenerierter Cellulose | |
| DE206881C (fr) | ||
| DE1278039B (de) | Verfahren zur Herstellung von Azofarbstoffen |