DEC0005750MA - - Google Patents
Info
- Publication number
- DEC0005750MA DEC0005750MA DEC0005750MA DE C0005750M A DEC0005750M A DE C0005750MA DE C0005750M A DEC0005750M A DE C0005750MA
- Authority
- DE
- Germany
- Prior art keywords
- acid
- resin
- amine
- melamine
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000002253 acid Substances 0.000 claims description 25
- 229920005989 resin Polymers 0.000 claims description 20
- 239000011347 resin Substances 0.000 claims description 20
- 239000000203 mixture Substances 0.000 claims description 18
- 150000001412 amines Chemical class 0.000 claims description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 12
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 11
- 229920000877 Melamine resin Polymers 0.000 claims description 11
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 claims description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 claims description 4
- 238000010494 dissociation reaction Methods 0.000 claims description 3
- 230000005593 dissociations Effects 0.000 claims description 3
- AKNUHUCEWALCOI-UHFFFAOYSA-N N-ethyldiethanolamine Chemical compound OCCN(CC)CCO AKNUHUCEWALCOI-UHFFFAOYSA-N 0.000 claims description 2
- CRVGTESFCCXCTH-UHFFFAOYSA-N methyl diethanolamine Chemical compound OCCN(C)CCO CRVGTESFCCXCTH-UHFFFAOYSA-N 0.000 claims description 2
- 238000000465 moulding Methods 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims 1
- 238000001035 drying Methods 0.000 description 9
- 239000007859 condensation product Substances 0.000 description 7
- 239000011342 resin composition Substances 0.000 description 7
- 150000007513 acids Chemical class 0.000 description 6
- IVJISJACKSSFGE-UHFFFAOYSA-N formaldehyde;1,3,5-triazine-2,4,6-triamine Chemical compound O=C.NC1=NC(N)=NC(N)=N1 IVJISJACKSSFGE-UHFFFAOYSA-N 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- -1 diethyl methanolamine Chemical compound 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 150000003512 tertiary amines Chemical class 0.000 description 3
- XOGJBKWFLRETGW-UHFFFAOYSA-N 5-aminotriazine-4-carbaldehyde Chemical compound NC1=CN=NN=C1C=O XOGJBKWFLRETGW-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 150000003973 alkyl amines Chemical class 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000003139 buffering effect Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 229940087646 methanolamine Drugs 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- GAWAYYRQGQZKCR-REOHCLBHSA-N (S)-2-chloropropanoic acid Chemical compound C[C@H](Cl)C(O)=O GAWAYYRQGQZKCR-REOHCLBHSA-N 0.000 description 1
- WKCYFSZDBICRKL-UHFFFAOYSA-N 3-(diethylamino)propan-1-ol Chemical compound CCN(CC)CCCO WKCYFSZDBICRKL-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 239000004640 Melamine resin Substances 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- 238000000748 compression moulding Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 229960002887 deanol Drugs 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000012972 dimethylethanolamine Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 230000005283 ground state Effects 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2504326A1 (de) | Phenol-formaldehyd-resorcin-harzmassen, verfahren zu ihrer herstellung und klebstoffe | |
| DE2235051C3 (de) | Verfahren zur Herstellung von Novolaken | |
| DE3740293A1 (de) | Verfahren zur herstellung von alpha-alkylacroleinen | |
| DE2537656C3 (de) | Verwendung von modifizierten Alkylphenolnovolaken als Klebrigmacher für Kautschukmischungen | |
| DE69422019T2 (de) | Harzartige bindemittelzubereitungen | |
| DE102005058855A1 (de) | Veretherte Melamin-Formaldehydkondensate mit hohem Feststoffgehalt und geringer Viskosität | |
| DE952939C (de) | Melaminformaldehydharz-Pressmassen | |
| DEC0005750MA (enExample) | ||
| DE1569945A1 (de) | Streckmittelhaltige Phenolharzklebstoffe | |
| DE2854440A1 (de) | Beschichtungsmasse | |
| DE852906C (de) | Verfahren zur Herstellung von UEberzug-, Verfugungs-, Moertelmassen od. dgl. | |
| EP0183872B1 (de) | Verfahren zur Herstellung einer Leimmischung, speziell zur Herstellung von Holzkonstruktionen, -Platten und ähnlichen Produkten | |
| EP0805830B1 (de) | Wässerige aminoplastharze mit verbesserter waschbarkeit für die herstellung von holzwerkstoffen | |
| DE727703C (de) | Verfahren zur Herstellung von harzartigen Kondensationsprodukten | |
| DE615525C (de) | Verfahren zur Herstellung von wasserloeslichen, aus reversiblen Gelen bestehenden Kondensationsprodukten aus Harnstoff oder Mischungen von Harnstoff und Thio- harnstoff und Formaldehyd in Trockenform und Loesungen daraus | |
| DE2516898A1 (de) | Verfahren zur herstellung von durch waermeeinwirkung abbindenden phenol/formaldehyd-harzen | |
| DE907697C (de) | Verfahren zur Herstellung eines waerme- und druckhaertenden Harnstoff-Formaldehyd-Kondensationsproduktes | |
| AT163630B (de) | Verfahren zur Herstellung wasserlöslicher methylierter Methylolmelamine | |
| DE2539650A1 (de) | Laminatherstellung | |
| DE688821C (de) | Verfahren zur Darstellung kuenstlicher Harze aus Phenolalkoholen | |
| EP0030310A1 (de) | Internes Trennmittel für hitzehärtbare Aminoplastharze, Verfahren zu seiner Herstellung und seine Verwendung | |
| DE1595111A1 (de) | Verfahren zur Herstellung von Melamin-Formaldehyd-Acrylnitril-Kondensationsprodukten | |
| DE2332046C3 (de) | Verfahren zur Herstellung saurer kolloidaler Lösungen von Melamin-Formaldehyd- Harzen | |
| DE2115197C3 (de) | Verfahren zur Herstellung von wasserlöslichen oder in Wasser dispergierbaren Aminoplastkunstharzen | |
| DE1594203B (de) | Unter Druckanwendung haftendes Klebemittel |