DEB0023744MA - - Google Patents
Info
- Publication number
- DEB0023744MA DEB0023744MA DEB0023744MA DE B0023744M A DEB0023744M A DE B0023744MA DE B0023744M A DEB0023744M A DE B0023744MA
- Authority
- DE
- Germany
- Prior art keywords
- polyvinyl chloride
- dispersions
- parts
- coatings
- dispersants
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000006185 dispersion Substances 0.000 claims description 19
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 18
- 239000004800 polyvinyl chloride Substances 0.000 claims description 18
- 239000002270 dispersing agent Substances 0.000 claims description 10
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N Tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 claims description 8
- 230000000694 effects Effects 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 5
- 229920001577 copolymer Polymers 0.000 claims description 4
- 239000007788 liquid Substances 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 3
- 230000002522 swelling Effects 0.000 claims description 3
- BZHJMEDXRYGGRV-UHFFFAOYSA-N vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 claims description 3
- 239000003701 inert diluent Substances 0.000 claims description 2
- 239000003973 paint Substances 0.000 claims description 2
- WVDDGKGOMKODPV-UHFFFAOYSA-N benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 9
- 239000000758 substrate Substances 0.000 description 5
- NIQCNGHVCWTJSM-UHFFFAOYSA-N Dimethyl phthalate Chemical compound COC(=O)C1=CC=CC=C1C(=O)OC NIQCNGHVCWTJSM-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 229960001826 dimethylphthalate Drugs 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 235000019445 benzyl alcohol Nutrition 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 238000007598 dipping method Methods 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- SZVJSHCCFOBDDC-UHFFFAOYSA-N Iron(II,III) oxide Chemical compound O=[Fe]O[Fe]O[Fe]=O SZVJSHCCFOBDDC-UHFFFAOYSA-N 0.000 description 2
- 210000001138 Tears Anatomy 0.000 description 2
- 229920001807 Urea-formaldehyde Polymers 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive Effects 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- 239000011111 cardboard Substances 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000011087 paperboard Substances 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 239000004014 plasticizer Substances 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 2
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 1-butanal Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 1
- BDCFWIDZNLCTMF-UHFFFAOYSA-N 2-phenylpropan-2-ol Chemical compound CC(C)(O)C1=CC=CC=C1 BDCFWIDZNLCTMF-UHFFFAOYSA-N 0.000 description 1
- WBJZTOZJJYAKHQ-UHFFFAOYSA-K Iron(III) phosphate Chemical compound [Fe+3].[O-]P([O-])([O-])=O WBJZTOZJJYAKHQ-UHFFFAOYSA-K 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminum Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- VFGRALUHHHDIQI-UHFFFAOYSA-N butyl 2-hydroxyacetate Chemical compound CCCCOC(=O)CO VFGRALUHHHDIQI-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000000875 corresponding Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000003349 gelling agent Substances 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 1
- 229910000460 iron oxide Inorganic materials 0.000 description 1
- 229910000398 iron phosphate Inorganic materials 0.000 description 1
- MOUPNEIJQCETIW-UHFFFAOYSA-N lead chromate Chemical compound [Pb+2].[O-][Cr]([O-])(=O)=O MOUPNEIJQCETIW-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 1
- 229920001290 polyvinyl ester Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000007788 roughening Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1644703C3 (de) | Wässerige Dispersionen für Anstrichzwecke | |
| DE1494489C3 (de) | Verwendung von Kondensationsprodukten als Filmbildner im Gemisch mit einem Polyvinylharz zur Herstellung von wärmegehärteten Überzügen | |
| DE1669259C3 (de) | überzugsmittel | |
| DE1155554B (de) | Spritzfaehiges Anstrichmittel | |
| DE2262463C2 (de) | Überzugsmittel | |
| DE615219C (de) | Lacke | |
| DE942652C (de) | Verfahren zur Herstellung von Dispersionen, insbesondere Lackdispersionen, aus Vinylchloridpolymerisaten in organischen Dispergiermitteln | |
| EP0154835B1 (de) | Verfahren zur Herstellung wässriger Keton-Harz- oder Keton/Aldehyd-Harz-Dispersionen und deren Verwendung | |
| DEB0023744MA (nl) | ||
| DE1495801A1 (de) | Verfahren zur Herstellung von Pfropfpolymerisaten des Vinylchlorids | |
| DE1293369B (de) | Verfahrenzur Herstellung von in Wasser dispergierbaren Bindemitteln | |
| DE901844C (de) | Verfahren zur Verbesserung der Eigenschaften von filmbildenden Stoffen | |
| EP0001779B1 (de) | Bindemittel für Beschichtungsstoffe und Strassenmarkierungsfarben | |
| DE740903C (de) | Verfahren zur Herstellung von Impraegnierungen und UEberzuegen | |
| DE2626845A1 (de) | Waessrige ueberzugsmasse | |
| DE3428495C1 (de) | Verfahren zur Herstellung sikkativierter waessriger Lacke mit Polybutadien/Maleinsaeureanhydrid-Addukten als Bindemittel | |
| DE560703C (de) | Verfahren zur Erhoehung der Elastizitaet organischer Werkstoffe | |
| DE1546891C3 (de) | Verfahren zum Überziehen von Metallflächen mit Polyvinylfluorid | |
| DE2262006A1 (de) | Ueberzugsmasse fuer metallgegenstaende | |
| DE1228015B (de) | Waessrige UEberzugsmittel und Einbrennlacke | |
| DE2256962C3 (de) | Verwendung von Bisphenol A | |
| DE2604680A1 (de) | Addukt, verfahren zu seiner herstellung und seine verwendung als bindemittel in anstrichmitteln und druckfarben | |
| DE2361671A1 (de) | Epoxidharz-zusammensetzung | |
| DE4423610A1 (de) | Farbstoffe enthaltende wäßrige Dispersionen | |
| DE767634C (de) | Herstellung von gegen alkalisch wirkende Stoffe bestaendigen UEberzuegen |