DEB0018752MA - - Google Patents
Info
- Publication number
- DEB0018752MA DEB0018752MA DEB0018752MA DE B0018752M A DEB0018752M A DE B0018752MA DE B0018752M A DEB0018752M A DE B0018752MA
- Authority
- DE
- Germany
- Prior art keywords
- parts
- acid
- brown
- isoxazole
- nitrogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 3
- 239000011707 mineral Substances 0.000 claims description 3
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- -1 hydroxylamino group Chemical group 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 3
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 229940117389 dichlorobenzene Drugs 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 125000000018 nitroso group Chemical group N(=O)* 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- RPAJSBKBKSSMLJ-DFWYDOINSA-N (2s)-2-aminopentanedioic acid;hydrochloride Chemical class Cl.OC(=O)[C@@H](N)CCC(O)=O RPAJSBKBKSSMLJ-DFWYDOINSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- ZXVONLUNISGICL-UHFFFAOYSA-N 4,6-dinitro-o-cresol Chemical group CC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O ZXVONLUNISGICL-UHFFFAOYSA-N 0.000 description 1
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 235000014443 Pyrus communis Nutrition 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- LZDSILRDTDCIQT-UHFFFAOYSA-N dinitrogen trioxide Inorganic materials [O-][N+](=O)N=O LZDSILRDTDCIQT-UHFFFAOYSA-N 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- LBSANEJBGMCTBH-UHFFFAOYSA-N manganate Chemical compound [O-][Mn]([O-])(=O)=O LBSANEJBGMCTBH-UHFFFAOYSA-N 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2355690C2 (de) | Verfahren zur Herstellung von Phenol oder substituierten Phenolen | |
| DE2353987B2 (de) | Verfahren zur isolierung leichtloeslicher basischer oxazin- und phenazinfarbstoffe | |
| DEB0018752MA (Direct) | ||
| DE958024C (de) | Verfahren zur Herstellung eines stickstoffhaltigen Derivats des 2-Acetylanthrachinons | |
| DE1081884B (de) | Verfahren zur Herstellung von Cyclododecanonoxim | |
| DE932369C (de) | Verfahren zur Herstellung von waessrigen Glyoxylsaeureloesungen aus Glyoxal oder seinen Polymerisationsprodukten | |
| DE1912941A1 (de) | Verfahren zur Herstellung von 6-Alkoxy-Pyridaziniumverbindungen | |
| DE2758111A1 (de) | Verfahren zur herstellung von halogenanilinen | |
| DE1670196C3 (de) | Verfahren zur Herstellung von 1,2-Benzisothiazolen | |
| DE1060397B (de) | Verfahren zur Herstellung von metallorganischen Verbindungen des Nickels | |
| DE1140193B (de) | Verfahren zur Herstellung von in 3-Stellung substituierten Thiazolidin-2-on-1, 1-dioxyden | |
| DE1255111B (de) | Verfahren zur Herstellung von Benzophenon-Derivaten | |
| DE969843C (de) | Verfahren zur Herstellung von alicyclischen Ketoximen | |
| DE894994C (de) | Verfahren zur Herstellung von aliphatischen Quecksilberketon-verbindungen | |
| DE1808104A1 (de) | Verfahren zur Herstellung von 2-Alkyl-4-nitroimidazolen | |
| AT239243B (de) | Verfahren zur Herstellung von 2, 3-Dicyan-1, 4-dithia-anthrahydrochinon und -anthrachinon | |
| DE2334918C3 (de) | Verfahren zur Herstellung basischer Farbstoffe durch katalytische Oxidation | |
| AT204552B (de) | Verfahren zur Herstellung von neuen, heterocyclischen Bis-sulfonamiden | |
| DE1793183C (Direct) | ||
| DE1257773B (de) | Verfahren zur Herstellung von Mucochlorsaeure | |
| DE887943C (de) | Verfahren zur Herstellung von Glutarsaeure | |
| DE964324C (de) | Verfahren zur Herstellung von 2-Amino-5-imino-pyrroleninen | |
| AT265286B (de) | Verfahren zur Herstellung von neuen Sulfonamiden | |
| AT266140B (de) | Verfahren zur Herstellung von neuen Pyrazinverbindungen | |
| DE955510C (de) | Verfahren zur Herstellung eines heterocyclischen Chinons |