DE859660C - Schaltung zur Erzeugung von Saegezahnschwingungen - Google Patents
Schaltung zur Erzeugung von SaegezahnschwingungenInfo
- Publication number
- DE859660C DE859660C DEP26466A DEP0026466A DE859660C DE 859660 C DE859660 C DE 859660C DE P26466 A DEP26466 A DE P26466A DE P0026466 A DEP0026466 A DE P0026466A DE 859660 C DE859660 C DE 859660C
- Authority
- DE
- Germany
- Prior art keywords
- transformer
- circuit
- capacitor
- discharge tube
- winding
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003990 capacitor Substances 0.000 claims description 21
- 238000004804 winding Methods 0.000 claims description 14
- 229910000859 α-Fe Inorganic materials 0.000 claims description 6
- 230000005294 ferromagnetic effect Effects 0.000 claims description 4
- 239000002131 composite material Substances 0.000 claims description 2
- 230000010363 phase shift Effects 0.000 claims 2
- 239000011162 core material Substances 0.000 description 8
- 230000005291 magnetic effect Effects 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 230000010355 oscillation Effects 0.000 description 3
- 230000007423 decrease Effects 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 230000005415 magnetization Effects 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- SYHGEUNFJIGTRX-UHFFFAOYSA-N methylenedioxypyrovalerone Chemical compound C=1C=C2OCOC2=CC=1C(=O)C(CCC)N1CCCC1 SYHGEUNFJIGTRX-UHFFFAOYSA-N 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 230000001360 synchronised effect Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K4/00—Generating pulses having essentially a finite slope or stepped portions
- H03K4/06—Generating pulses having essentially a finite slope or stepped portions having triangular shape
- H03K4/08—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape
- H03K4/10—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements vacuum tubes only
- H03K4/26—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements vacuum tubes only in which a sawtooth current is produced through an inductor
- H03K4/28—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements vacuum tubes only in which a sawtooth current is produced through an inductor using a tube operating as a switching device
- H03K4/32—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements vacuum tubes only in which a sawtooth current is produced through an inductor using a tube operating as a switching device combined with means for generating the driving pulses
- H03K4/34—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements vacuum tubes only in which a sawtooth current is produced through an inductor using a tube operating as a switching device combined with means for generating the driving pulses using a single tube with positive feedback through a transformer
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K4/00—Generating pulses having essentially a finite slope or stepped portions
- H03K4/06—Generating pulses having essentially a finite slope or stepped portions having triangular shape
- H03K4/08—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape
- H03K4/10—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements vacuum tubes only
- H03K4/26—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements vacuum tubes only in which a sawtooth current is produced through an inductor
- H03K4/28—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements vacuum tubes only in which a sawtooth current is produced through an inductor using a tube operating as a switching device
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K4/00—Generating pulses having essentially a finite slope or stepped portions
- H03K4/06—Generating pulses having essentially a finite slope or stepped portions having triangular shape
- H03K4/08—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape
- H03K4/10—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements vacuum tubes only
- H03K4/26—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements vacuum tubes only in which a sawtooth current is produced through an inductor
- H03K4/28—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements vacuum tubes only in which a sawtooth current is produced through an inductor using a tube operating as a switching device
- H03K4/32—Generating pulses having essentially a finite slope or stepped portions having triangular shape having sawtooth shape using as active elements vacuum tubes only in which a sawtooth current is produced through an inductor using a tube operating as a switching device combined with means for generating the driving pulses
Landscapes
- Details Of Television Scanning (AREA)
- Dc-Dc Converters (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL266762X | 1947-08-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE859660C true DE859660C (de) | 1952-12-15 |
Family
ID=19781762
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP26466A Expired DE859660C (de) | 1947-08-15 | 1948-12-24 | Schaltung zur Erzeugung von Saegezahnschwingungen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2611089A (enFirst) |
| BE (1) | BE484369A (enFirst) |
| CH (1) | CH266762A (enFirst) |
| DE (1) | DE859660C (enFirst) |
| FR (1) | FR970343A (enFirst) |
| GB (1) | GB658762A (enFirst) |
| NL (1) | NL70437C (enFirst) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE968070C (de) * | 1955-01-21 | 1958-01-16 | Standard Elek K Ag | Transistor-Oszillatorschaltung |
| US2908870A (en) * | 1957-11-05 | 1959-10-13 | Clyde D Hardin | Generation of very short microwave pulses |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB493142A (en) * | 1938-02-24 | 1938-10-05 | Ferranti Ltd | Improvements in or relating to oscillation generators |
| GB512519A (en) * | 1938-03-02 | 1939-09-19 | Baird Television Ltd | Improvements in or relating to magnetic deflecting arrangements for electron discharge devices |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2059683A (en) * | 1933-04-03 | 1936-11-03 | Farnsworth Television Inc | Scanning oscillator |
| US2169815A (en) * | 1935-11-19 | 1939-08-15 | Edgar W Patterson | Well pump operating mechanism |
| GB470010A (en) * | 1936-02-06 | 1937-08-06 | Erich Kinne | Process of generating saw-tooth electric vibrations or triangular wave-forms |
| US2250686A (en) * | 1937-06-17 | 1941-07-29 | Telefunken Gmbh | Saw-tooth wave oscillator |
| GB516357A (en) * | 1937-06-21 | 1940-01-01 | Telefunken Gmbh | Improvements in generators of electrical oscillations of saw-toothed wave form |
| US2265620A (en) * | 1938-11-30 | 1941-12-09 | Bahring Herbert | Scanning current generator |
-
0
- NL NL70437D patent/NL70437C/xx active
- BE BE484369D patent/BE484369A/xx unknown
-
1948
- 1948-08-02 US US41928A patent/US2611089A/en not_active Expired - Lifetime
- 1948-08-12 GB GB21287/48A patent/GB658762A/en not_active Expired
- 1948-08-13 FR FR970343D patent/FR970343A/fr not_active Expired
- 1948-08-13 CH CH266762D patent/CH266762A/de unknown
- 1948-12-24 DE DEP26466A patent/DE859660C/de not_active Expired
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB493142A (en) * | 1938-02-24 | 1938-10-05 | Ferranti Ltd | Improvements in or relating to oscillation generators |
| GB512519A (en) * | 1938-03-02 | 1939-09-19 | Baird Television Ltd | Improvements in or relating to magnetic deflecting arrangements for electron discharge devices |
Also Published As
| Publication number | Publication date |
|---|---|
| CH266762A (de) | 1950-02-15 |
| US2611089A (en) | 1952-09-16 |
| NL70437C (enFirst) | |
| FR970343A (fr) | 1951-01-03 |
| GB658762A (en) | 1951-10-10 |
| BE484369A (enFirst) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE946557C (de) | Schaltungsanordnung zur Erzeugung saegezahnfoermiger Impulse | |
| DE973547C (de) | Schaltungsanordnung zur Erzeugung saegezahnfoermiger Stroeme | |
| DE859660C (de) | Schaltung zur Erzeugung von Saegezahnschwingungen | |
| DE2437633C3 (de) | Spannungsregelschaltung für eine Ablenkschaltung | |
| DE1269162B (de) | Vorrichtung zur Entmagnetisierung von Metallteilen in einer Fernsehempfaengerroehreoder in deren Naehe | |
| DE976927C (de) | Magnetische Elektronenlinse mit einstellbarer Brennweite | |
| DE1266798B (de) | Schaltungsanordnung zur Korrektur der Elektronenstrahlablenkung einer Fernsehbildroehre mittels eines einzigen Transduktors | |
| DE1514342B2 (de) | Ablenkschaltung zur magnetischen ablenkung des kathoden strahls in fernsehtechnischen geraeten mit linearitaets korrektur | |
| DE729481C (de) | Kippschaltung einer Hochvakuumroehre mit induktiv gekoppeltem Gitter- und Anodenkreis | |
| DE1437846B2 (de) | Schaltungsanordnung zur Entzerrung des durch den Elektronenstrahl einer Fernsehbildröhre auf dem Leuchtschirm geschriebenen Rasters | |
| DE4237704C1 (de) | Verfahren und Vorrichtung zum Entmagnetisieren von magnetischen Werkstoffen | |
| DE756012C (de) | Schaltungsanordnung zur Erzeugung von Zeilensaegezahnstromkurven fuer eine trapezfoermige Ablenkung | |
| DE738937C (de) | Schaltungsanordnung fuer fremdgesteuerte Saegezahngeneratoren, bei denen eine Spannungsrueckkopplung besteht | |
| DE2614299B2 (de) | Schaltungsanordnung zum Erzeugen eines Ablenkstromes | |
| DE2603949B2 (de) | Schaltungsanordnung in einem Fernsehempfänger zum Erzeugen eines horizontalfrequenten Ablenkstromes N.V. Philips' Gloeilampenfabrie- | |
| DE1201867B (de) | Schaltungsanordnung zum Erzeugen eines saegezahnfoermigen Stromes durch eine Spule | |
| DE2325370C3 (de) | Spannungsregler fuer eine fernsehempfaenger-ablenkschaltung mit einem kommutierungsschalter | |
| DE969358C (de) | Schwingungserzeuger zur Erzeugung von im wesentlichen saegezahnfoermigen elektrischen Schwingungen | |
| DE748159C (de) | Schaltungsanordnung zur Erzeugung eines saegezahnfoermig verlaufenden Stromes in der Ablenkspule einer Kathodenstrahlroehre | |
| DE1537150B2 (de) | Ablenkschaltung, insbesondere fur Fern sehgerate zur Trzeugung eines periodischen Stromes in einer Spule | |
| DE886941C (de) | Stromsaegezahngenerator | |
| DE920265C (de) | Schaltung zum Erzeugen eines saegezahnfoermigen Stromes in einer Spule | |
| DE884963C (de) | Schaltungsanordnung zur Erzeugung von Zeilensaegezahnstromkurven fuer eine trapezfoermige Ablenkung von Kathodenstrahlen | |
| DE1190500B (de) | Zeilenablenkschaltung fuer einen Fernsehempfaenger | |
| DE2403331C3 (de) | Schaltungsanordnung zum Erzeugen eines mittels einer Modulationsspannung beeinflußten sägezahniörmlgen Ablenkstromes durch eine Horlzontalablenk-Spule |