DE841517C - Anordnung zur Steuerung der Brennstoffzufuhr bei dochtlosen Feuerzeugen - Google Patents
Anordnung zur Steuerung der Brennstoffzufuhr bei dochtlosen FeuerzeugenInfo
- Publication number
- DE841517C DE841517C DEP46746A DEP0046746A DE841517C DE 841517 C DE841517 C DE 841517C DE P46746 A DEP46746 A DE P46746A DE P0046746 A DEP0046746 A DE P0046746A DE 841517 C DE841517 C DE 841517C
- Authority
- DE
- Germany
- Prior art keywords
- arrangement according
- fuel channel
- fuel
- lighter
- channel
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000446 fuel Substances 0.000 title claims description 36
- 238000005452 bending Methods 0.000 claims description 5
- 238000007373 indentation Methods 0.000 claims description 5
- 230000005489 elastic deformation Effects 0.000 claims description 4
- 230000001105 regulatory effect Effects 0.000 claims description 4
- 230000006835 compression Effects 0.000 claims description 3
- 238000007906 compression Methods 0.000 claims description 3
- 230000001276 controlling effect Effects 0.000 claims description 2
- 230000004048 modification Effects 0.000 claims 1
- 238000012986 modification Methods 0.000 claims 1
- 239000007788 liquid Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 3
- 210000003813 thumb Anatomy 0.000 description 3
- 239000013013 elastic material Substances 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- WYTGDNHDOZPMIW-RCBQFDQVSA-N alstonine Natural products C1=CC2=C3C=CC=CC3=NC2=C2N1C[C@H]1[C@H](C)OC=C(C(=O)OC)[C@H]1C2 WYTGDNHDOZPMIW-RCBQFDQVSA-N 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000002828 fuel tank Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F23—COMBUSTION APPARATUS; COMBUSTION PROCESSES
- F23Q—IGNITION; EXTINGUISHING-DEVICES
- F23Q2/00—Lighters containing fuel, e.g. for cigarettes
- F23Q2/34—Component parts or accessories
- F23Q2/52—Filling devices
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F23—COMBUSTION APPARATUS; COMBUSTION PROCESSES
- F23Q—IGNITION; EXTINGUISHING-DEVICES
- F23Q2/00—Lighters containing fuel, e.g. for cigarettes
- F23Q2/16—Lighters with gaseous fuel, e.g. the gas being stored in liquid phase
- F23Q2/167—Lighters with gaseous fuel, e.g. the gas being stored in liquid phase with adjustable flame
Landscapes
- Engineering & Computer Science (AREA)
- Chemical & Material Sciences (AREA)
- Combustion & Propulsion (AREA)
- Mechanical Engineering (AREA)
- General Engineering & Computer Science (AREA)
- Lighters Containing Fuel (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH673822X | 1948-02-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE841517C true DE841517C (de) | 1952-06-16 |
Family
ID=4527915
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP46746A Expired DE841517C (de) | 1948-02-12 | 1949-06-24 | Anordnung zur Steuerung der Brennstoffzufuhr bei dochtlosen Feuerzeugen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2565903A (OSRAM) |
| BE (1) | BE485927A (OSRAM) |
| CH (1) | CH270919A (OSRAM) |
| DE (1) | DE841517C (OSRAM) |
| FR (1) | FR1075101A (OSRAM) |
| GB (1) | GB673822A (OSRAM) |
| NL (1) | NL64714C (OSRAM) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1160227B (de) * | 1958-12-20 | 1963-12-27 | Hans Hubert Quandt | Brennstoffbehaelter fuer Gasfeuerzeuge |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2674032A (en) * | 1950-07-17 | 1954-04-06 | Brown & Bigelow | Method of making valves for liquefied petroleum gas lighters |
| US2710533A (en) * | 1950-07-17 | 1955-06-14 | Brown & Bigelow | Lighter with replaceable fuel cartridge |
| US2931387A (en) * | 1957-08-22 | 1960-04-05 | Robertson Co H H | Control apparatus for domestic water distribution system |
| US2985341A (en) * | 1958-05-29 | 1961-05-23 | James H Howard | Reactor catalyst loader |
| US3287939A (en) * | 1962-07-27 | 1966-11-29 | Zellweger Conrad | Fingerpiece controlled gas lighters |
| BE635421A (OSRAM) * | 1962-07-27 | |||
| US4266697A (en) * | 1979-03-12 | 1981-05-12 | Baxter Travenol Laboratories, Inc. | Controlled volume liquid meter defining improved plunger means |
| JPS5682322A (en) * | 1979-12-10 | 1981-07-06 | Tokai:Kk | Valve device for gas lighter |
| US6527546B1 (en) * | 1997-01-22 | 2003-03-04 | Bic Corporation | Utility lighter |
| US6780006B1 (en) * | 2003-08-02 | 2004-08-24 | Chi Lam Wong | Lighter |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE357395C (de) * | 1922-08-24 | Michael Kunstmann | Benzinfeuerzeug mit zusammenpressbarem Saugdocht | |
| US1667835A (en) * | 1927-06-11 | 1928-05-01 | James E Blake Co | Portable lighter |
| AT157429B (de) * | 1932-02-25 | 1939-11-25 | Otto Reich | Feuerzeug, insbesondere Taschenfeuerzeug. |
| US2153432A (en) * | 1934-11-17 | 1939-04-04 | Julius Vignati | Lighter |
| CH204315A (de) * | 1938-05-09 | 1939-04-30 | Altenpohl & Pilgram G M B H | Brenner für Pyrophorfeuerzeuge. |
| US2482794A (en) * | 1944-09-12 | 1949-09-27 | Repeter Products Inc | Portable lighter and the like |
| US2480397A (en) * | 1946-12-28 | 1949-08-30 | Cyril Charles Crockett | Smudge pot igniter |
| US2459042A (en) * | 1947-08-11 | 1949-01-11 | David T Nave | Capillarity control means |
-
0
- NL NL64714D patent/NL64714C/xx active
- BE BE485927D patent/BE485927A/xx unknown
-
1948
- 1948-02-12 CH CH270919D patent/CH270919A/fr unknown
- 1948-11-22 FR FR1075101D patent/FR1075101A/fr not_active Expired
- 1948-12-01 GB GB31101/48A patent/GB673822A/en not_active Expired
- 1948-12-17 US US65777A patent/US2565903A/en not_active Expired - Lifetime
-
1949
- 1949-06-24 DE DEP46746A patent/DE841517C/de not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1160227B (de) * | 1958-12-20 | 1963-12-27 | Hans Hubert Quandt | Brennstoffbehaelter fuer Gasfeuerzeuge |
Also Published As
| Publication number | Publication date |
|---|---|
| CH270919A (fr) | 1950-09-30 |
| GB673822A (en) | 1952-06-11 |
| US2565903A (en) | 1951-08-28 |
| BE485927A (OSRAM) | |
| NL64714C (OSRAM) | |
| FR1075101A (fr) | 1954-10-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE841517C (de) | Anordnung zur Steuerung der Brennstoffzufuhr bei dochtlosen Feuerzeugen | |
| DE69217301T2 (de) | Verfahren und Vorrichtung zum Steuern ein Flüssigkeitsströmung | |
| DE2834341C2 (de) | Kombi-schreibgeraet | |
| DE1160227B (de) | Brennstoffbehaelter fuer Gasfeuerzeuge | |
| DE1959415C3 (de) | Druckminderungsvorrichtung lür ein wegwerfbares Gasfeuerzeug | |
| DE1457512A1 (de) | Gasfeuerzeug | |
| DE2954473A1 (de) | Sicherheitsbrenner zum pulverflammspritzen | |
| DE1807918A1 (de) | Kleinfeuerzeug | |
| DE1156591B (de) | Gasfeuerzeugbrenner | |
| DE4016804C1 (OSRAM) | ||
| DE10324041B4 (de) | Gasströmungswächter | |
| AT58411B (de) | Pyrophores Feuerzeug. | |
| DE367067C (de) | Fuellfederhalter | |
| AT241181B (de) | Reibradfeuerzeug | |
| DE1157423B (de) | Gasfeuerzeug | |
| AT40756B (de) | Füllreißfeder. | |
| DE1605595C3 (de) | Ventileinsatz, insbesondere für Luftreifenventile | |
| DE670877C (de) | Fuellbleistift mit durch eine Druckkappe verschiebbarem Spitzenkoerper und Minenfuehrungsrohr | |
| DE2310110C2 (de) | Schweiß- und/oder Schneidbrenner | |
| DE1457541A1 (de) | Vorrichtung bei zum Zuenden von beispielsweise Zigaretten u.dgl. bestimmten Gasfeuerzeugen | |
| AT82648B (de) | Zereisenfeuerzeug. | |
| EP0053149A1 (de) | Gefässklemme | |
| DE843745C (de) | Gasbrennerduese | |
| DE1457620A1 (de) | Brenner-Einlassventil fuer Gasfeuerzeuge | |
| AT372772B (de) | Fluessiggas-kleinbehaelter aus plastik oder blech zum nachfuellen von feuerzeugen |