DE69213892T2 - Aromatische Aminoalkoholderivate mit antidiabetischer und Antiobesitäts-Wirkung, ihre Herstellung und therapeutische Verwendung - Google Patents
Aromatische Aminoalkoholderivate mit antidiabetischer und Antiobesitäts-Wirkung, ihre Herstellung und therapeutische VerwendungInfo
- Publication number
- DE69213892T2 DE69213892T2 DE69213892T DE69213892T DE69213892T2 DE 69213892 T2 DE69213892 T2 DE 69213892T2 DE 69213892 T DE69213892 T DE 69213892T DE 69213892 T DE69213892 T DE 69213892T DE 69213892 T2 DE69213892 T2 DE 69213892T2
- Authority
- DE
- Germany
- Prior art keywords
- group
- groups
- carbon atoms
- atom
- hydrogen atom
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- -1 Aromatic amino alcohol Chemical class 0.000 title claims description 285
- 238000002360 preparation method Methods 0.000 title claims description 139
- 230000001225 therapeutic effect Effects 0.000 title claims 2
- 230000000694 effects Effects 0.000 title abstract description 15
- 230000003178 anti-diabetic effect Effects 0.000 title abstract 2
- 230000003579 anti-obesity Effects 0.000 title abstract 2
- 239000003472 antidiabetic agent Substances 0.000 title abstract 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 369
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 141
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 119
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 70
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims abstract description 48
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims abstract description 42
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 41
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 40
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 39
- 125000000547 substituted alkyl group Chemical group 0.000 claims abstract description 37
- 125000004430 oxygen atom Chemical group O* 0.000 claims abstract description 33
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 28
- 150000003839 salts Chemical class 0.000 claims abstract description 19
- 201000001421 hyperglycemia Diseases 0.000 claims abstract description 13
- 238000011282 treatment Methods 0.000 claims abstract description 13
- 125000001188 haloalkyl group Chemical group 0.000 claims abstract description 10
- 206010012601 diabetes mellitus Diseases 0.000 claims abstract description 8
- 201000005577 familial hyperlipidemia Diseases 0.000 claims abstract description 8
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 313
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 157
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 157
- 125000001424 substituent group Chemical group 0.000 claims description 134
- 238000006243 chemical reaction Methods 0.000 claims description 133
- 229910052801 chlorine Inorganic materials 0.000 claims description 84
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 81
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 79
- 229910052731 fluorine Inorganic materials 0.000 claims description 69
- 238000004519 manufacturing process Methods 0.000 claims description 61
- 125000001153 fluoro group Chemical group F* 0.000 claims description 59
- 125000005843 halogen group Chemical group 0.000 claims description 49
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 46
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 43
- 125000004423 acyloxy group Chemical group 0.000 claims description 42
- 125000003118 aryl group Chemical group 0.000 claims description 33
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 32
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 27
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 23
- 208000008589 Obesity Diseases 0.000 claims description 21
- 235000020824 obesity Nutrition 0.000 claims description 21
- 125000006239 protecting group Chemical group 0.000 claims description 20
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 19
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims description 17
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 13
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 13
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 13
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 claims description 11
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 claims description 11
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 11
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 claims description 10
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 claims description 10
- 229910052799 carbon Inorganic materials 0.000 claims description 10
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 claims description 9
- 125000005117 dialkylcarbamoyl group Chemical group 0.000 claims description 9
- 238000011321 prophylaxis Methods 0.000 claims description 9
- 125000003277 amino group Chemical group 0.000 claims description 8
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 7
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 claims description 7
- 208000002249 Diabetes Complications Diseases 0.000 claims description 7
- 206010012655 Diabetic complications Diseases 0.000 claims description 7
- 206010020772 Hypertension Diseases 0.000 claims description 7
- 208000001132 Osteoporosis Diseases 0.000 claims description 7
- 125000005115 alkyl carbamoyl group Chemical group 0.000 claims description 7
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 7
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 claims description 7
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 6
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 claims description 6
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims description 6
- 125000004104 aryloxy group Chemical group 0.000 claims description 6
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 claims description 6
- ZOBPZXTWZATXDG-UHFFFAOYSA-N 1,3-thiazolidine-2,4-dione Chemical compound O=C1CSC(=O)N1 ZOBPZXTWZATXDG-UHFFFAOYSA-N 0.000 claims description 5
- GNWRWOJMBZGNPL-UHFFFAOYSA-N 5-[(4-hydroxyphenyl)methyl]-3-trityl-1,3-thiazolidine-2,4-dione Chemical compound C1=CC(O)=CC=C1CC1C(=O)N(C(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C(=O)S1 GNWRWOJMBZGNPL-UHFFFAOYSA-N 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 238000005984 hydrogenation reaction Methods 0.000 claims description 5
- 125000006678 phenoxycarbonyl group Chemical group 0.000 claims description 5
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 claims description 4
- 125000005809 3,4,5-trimethoxyphenyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 claims description 4
- RGHHSNMVTDWUBI-UHFFFAOYSA-N 4-hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1 RGHHSNMVTDWUBI-UHFFFAOYSA-N 0.000 claims description 4
- ZIKUTZAEHMKJOI-UHFFFAOYSA-N [4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl] acetate Chemical compound C1=CC(OC(=O)C)=CC=C1CC1C(=O)NC(=O)S1 ZIKUTZAEHMKJOI-UHFFFAOYSA-N 0.000 claims description 4
- DHIDEWJAINFJON-UHFFFAOYSA-N [4-[(2,4-dioxo-3-trityl-1,3-thiazolidin-5-yl)methyl]phenyl] acetate Chemical compound C1=CC(OC(=O)C)=CC=C1CC1C(=O)N(C(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C(=O)S1 DHIDEWJAINFJON-UHFFFAOYSA-N 0.000 claims description 4
- PACDRDRFKKJXRO-UHFFFAOYSA-N methyl 2-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC=CC(Cl)=C1 PACDRDRFKKJXRO-UHFFFAOYSA-N 0.000 claims description 4
- QJAMANBJMWMBDU-UHFFFAOYSA-N 3-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propoxy]phenyl]propan-1-ol Chemical compound C=1C=CC(Cl)=CC=1C(O)CNC(C)COC1=CC=C(CCCO)C=C1 QJAMANBJMWMBDU-UHFFFAOYSA-N 0.000 claims description 3
- 239000003814 drug Substances 0.000 claims description 3
- 150000002118 epoxides Chemical class 0.000 claims description 3
- 239000000463 material Substances 0.000 claims description 3
- ICFMZEMFXQDDQI-UHFFFAOYSA-N methyl 2-[4-[2-[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC(Cl)=CC(Cl)=C1 ICFMZEMFXQDDQI-UHFFFAOYSA-N 0.000 claims description 3
- NEEBOFPGNNJYOW-UHFFFAOYSA-N methyl 2-[4-[2-[[2-(3-chloro-4-fluorophenyl)-2-hydroxyethyl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC=C(F)C(Cl)=C1 NEEBOFPGNNJYOW-UHFFFAOYSA-N 0.000 claims description 3
- ITUDZEPMRNXLEQ-UHFFFAOYSA-N methyl 2-[4-[2-[[2-hydroxy-2-(3-methoxyphenyl)ethyl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC=CC(OC)=C1 ITUDZEPMRNXLEQ-UHFFFAOYSA-N 0.000 claims description 3
- NLAQJGVQXAHDEQ-UHFFFAOYSA-N methyl 2-[4-[2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC=CC(C(F)(F)F)=C1 NLAQJGVQXAHDEQ-UHFFFAOYSA-N 0.000 claims description 3
- LIUDOUZSOXRVIM-UHFFFAOYSA-N methyl 3-[4-[2-[(2-hydroxy-2-phenylethyl)amino]propoxy]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC=CC=C1 LIUDOUZSOXRVIM-UHFFFAOYSA-N 0.000 claims description 3
- DBYIIBKSIGVCML-UHFFFAOYSA-N methyl 3-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propoxy]phenyl]-2-hydroxypropanoate Chemical compound C1=CC(CC(O)C(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC=CC(Cl)=C1 DBYIIBKSIGVCML-UHFFFAOYSA-N 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- BGSQSKFQJFGYFP-UHFFFAOYSA-N 1-(3-chlorophenyl)-2-[1-[4-(hydroxymethyl)phenoxy]propan-2-ylamino]ethanol Chemical compound C=1C=CC(Cl)=CC=1C(O)CNC(C)COC1=CC=C(CO)C=C1 BGSQSKFQJFGYFP-UHFFFAOYSA-N 0.000 claims description 2
- HYIRCXYSHYNXIV-UHFFFAOYSA-N 5-[[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione Chemical compound C=1C=CC(Cl)=CC=1C(O)CNC(C)COC(C=C1)=CC=C1CC1SC(=O)NC1=O HYIRCXYSHYNXIV-UHFFFAOYSA-N 0.000 claims description 2
- KBHXCDJEUVNMDI-UHFFFAOYSA-N 5-[[4-[2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]propoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione Chemical compound C=1C=CC(C(F)(F)F)=CC=1C(O)CNC(C)COC(C=C1)=CC=C1CC1SC(=O)NC1=O KBHXCDJEUVNMDI-UHFFFAOYSA-N 0.000 claims description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 2
- 125000002837 carbocyclic group Chemical group 0.000 claims description 2
- 150000001735 carboxylic acids Chemical class 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- WDKGHUODOJUVHL-UHFFFAOYSA-N methyl 2-[4-[2-[(2-hydroxy-2-phenylethyl)amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC=CC=C1 WDKGHUODOJUVHL-UHFFFAOYSA-N 0.000 claims description 2
- 239000008194 pharmaceutical composition Substances 0.000 claims description 2
- JBWKIWSBJXDJDT-UHFFFAOYSA-N triphenylmethyl chloride Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 JBWKIWSBJXDJDT-UHFFFAOYSA-N 0.000 claims description 2
- 230000007062 hydrolysis Effects 0.000 claims 1
- 238000006460 hydrolysis reaction Methods 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract description 9
- 239000001257 hydrogen Substances 0.000 abstract description 9
- 102000016912 Aldehyde Reductase Human genes 0.000 abstract description 7
- 108010053754 Aldehyde reductase Proteins 0.000 abstract description 7
- 230000002265 prevention Effects 0.000 abstract description 4
- 125000001624 naphthyl group Chemical group 0.000 abstract description 3
- 230000002401 inhibitory effect Effects 0.000 abstract description 2
- 150000002431 hydrogen Chemical class 0.000 abstract 2
- 239000005864 Sulphur Chemical group 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 566
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 255
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 207
- 239000000203 mixture Substances 0.000 description 195
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 193
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 119
- 239000000741 silica gel Substances 0.000 description 113
- 229910002027 silica gel Inorganic materials 0.000 description 113
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 111
- 239000002904 solvent Substances 0.000 description 102
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 94
- 239000000243 solution Substances 0.000 description 77
- 230000002829 reductive effect Effects 0.000 description 69
- 238000004440 column chromatography Methods 0.000 description 58
- 239000003795 chemical substances by application Substances 0.000 description 56
- 239000003480 eluent Substances 0.000 description 55
- 238000004809 thin layer chromatography Methods 0.000 description 55
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 55
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 52
- 238000004821 distillation Methods 0.000 description 50
- 239000013078 crystal Substances 0.000 description 49
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 48
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 48
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 48
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 47
- 239000011541 reaction mixture Substances 0.000 description 43
- 238000001816 cooling Methods 0.000 description 40
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 39
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 37
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 32
- UAYWVJHJZHQCIE-UHFFFAOYSA-L zinc iodide Chemical compound I[Zn]I UAYWVJHJZHQCIE-UHFFFAOYSA-L 0.000 description 32
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 28
- VQFAIAKCILWQPZ-UHFFFAOYSA-N bromoacetone Chemical compound CC(=O)CBr VQFAIAKCILWQPZ-UHFFFAOYSA-N 0.000 description 28
- 239000003153 chemical reaction reagent Substances 0.000 description 28
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 27
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 27
- 239000007795 chemical reaction product Substances 0.000 description 27
- 238000000034 method Methods 0.000 description 27
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 22
- 239000012280 lithium aluminium hydride Substances 0.000 description 22
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- STJIXOUDTUPEEL-UHFFFAOYSA-N 2-amino-1-(3-chlorophenyl)ethanol Chemical compound NCC(O)C1=CC=CC(Cl)=C1 STJIXOUDTUPEEL-UHFFFAOYSA-N 0.000 description 19
- BGNFOBIJVRNTGB-UHFFFAOYSA-N methyl 2-[4-(2-oxopropoxy)phenyl]acetate Chemical compound COC(=O)CC1=CC=C(OCC(C)=O)C=C1 BGNFOBIJVRNTGB-UHFFFAOYSA-N 0.000 description 19
- 229910000027 potassium carbonate Inorganic materials 0.000 description 18
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 17
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 16
- 239000003054 catalyst Substances 0.000 description 16
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 16
- 238000001704 evaporation Methods 0.000 description 16
- 230000008020 evaporation Effects 0.000 description 16
- LEIMLDGFXIOXMT-UHFFFAOYSA-N trimethylsilyl cyanide Chemical compound C[Si](C)(C)C#N LEIMLDGFXIOXMT-UHFFFAOYSA-N 0.000 description 16
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 15
- 239000011737 fluorine Substances 0.000 description 15
- 239000012279 sodium borohydride Substances 0.000 description 15
- 229910000033 sodium borohydride Inorganic materials 0.000 description 15
- 230000003197 catalytic effect Effects 0.000 description 14
- 238000010992 reflux Methods 0.000 description 14
- 239000011780 sodium chloride Substances 0.000 description 14
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 13
- 150000001408 amides Chemical class 0.000 description 13
- 239000000706 filtrate Substances 0.000 description 13
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- 150000002170 ethers Chemical class 0.000 description 12
- 238000010438 heat treatment Methods 0.000 description 12
- 229930195733 hydrocarbon Natural products 0.000 description 12
- 150000002430 hydrocarbons Chemical class 0.000 description 12
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 12
- 239000010410 layer Substances 0.000 description 12
- 231100000989 no adverse effect Toxicity 0.000 description 12
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 12
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 11
- 239000000460 chlorine Substances 0.000 description 11
- 239000012141 concentrate Substances 0.000 description 11
- 235000008504 concentrate Nutrition 0.000 description 11
- HZAXFHJVJLSVMW-UHFFFAOYSA-N monoethanolamine hydrochloride Natural products NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 11
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 11
- 239000008096 xylene Substances 0.000 description 11
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 9
- 125000001931 aliphatic group Chemical group 0.000 description 9
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 9
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 9
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 8
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 150000001298 alcohols Chemical class 0.000 description 8
- 238000001953 recrystallisation Methods 0.000 description 8
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 7
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 7
- 239000003638 chemical reducing agent Substances 0.000 description 7
- SIPUZPBQZHNSDW-UHFFFAOYSA-N diisobutylaluminium hydride Substances CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 7
- 239000008103 glucose Substances 0.000 description 7
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 238000003786 synthesis reaction Methods 0.000 description 6
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 6
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 6
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 5
- 125000003542 3-methylbutan-2-yl group Chemical group [H]C([H])([H])C([H])(*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 5
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 5
- 150000008282 halocarbons Chemical class 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 5
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 5
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 5
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 5
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- YDSRFKLJZYYNOP-ZDUSSCGKSA-N (2r)-2-[tert-butyl(dimethyl)silyl]oxy-2-phenylacetaldehyde Chemical compound CC(C)(C)[Si](C)(C)O[C@@H](C=O)C1=CC=CC=C1 YDSRFKLJZYYNOP-ZDUSSCGKSA-N 0.000 description 4
- QXBZKBCUWDMBIQ-UHFFFAOYSA-N 1-[4-(2-hydroxyethyl)phenoxy]propan-2-one Chemical compound CC(=O)COC1=CC=C(CCO)C=C1 QXBZKBCUWDMBIQ-UHFFFAOYSA-N 0.000 description 4
- KYRUCCKXVHVIBR-UHFFFAOYSA-N 5-[[4-(2-oxopropoxy)phenyl]methyl]-1,3-thiazolidine-2,4-dione Chemical compound C1=CC(OCC(=O)C)=CC=C1CC1C(=O)NC(=O)S1 KYRUCCKXVHVIBR-UHFFFAOYSA-N 0.000 description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 230000001476 alcoholic effect Effects 0.000 description 4
- 239000008280 blood Substances 0.000 description 4
- 210000004369 blood Anatomy 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 4
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 4
- 239000002552 dosage form Substances 0.000 description 4
- 238000005886 esterification reaction Methods 0.000 description 4
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 4
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 230000002218 hypoglycaemic effect Effects 0.000 description 4
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 4
- SRNOYAWYVFFNBI-SECBINFHSA-N methyl 2-[4-[(2r)-2-aminopropoxy]phenyl]acetate Chemical compound COC(=O)CC1=CC=C(OC[C@@H](C)N)C=C1 SRNOYAWYVFFNBI-SECBINFHSA-N 0.000 description 4
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 150000003462 sulfoxides Chemical class 0.000 description 4
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 4
- ONDSBJMLAHVLMI-UHFFFAOYSA-N trimethylsilyldiazomethane Chemical compound C[Si](C)(C)[CH-][N+]#N ONDSBJMLAHVLMI-UHFFFAOYSA-N 0.000 description 4
- ULSIYEODSMZIPX-MRVPVSSYSA-N (1s)-2-amino-1-phenylethanol Chemical compound NC[C@@H](O)C1=CC=CC=C1 ULSIYEODSMZIPX-MRVPVSSYSA-N 0.000 description 3
- SAMVPMGKGGLIPF-SSDOTTSWSA-N (2r)-2-(3-chlorophenyl)-2-hydroxyacetic acid Chemical compound OC(=O)[C@H](O)C1=CC=CC(Cl)=C1 SAMVPMGKGGLIPF-SSDOTTSWSA-N 0.000 description 3
- YDSRFKLJZYYNOP-CYBMUJFWSA-N (2s)-2-[tert-butyl(dimethyl)silyl]oxy-2-phenylacetaldehyde Chemical compound CC(C)(C)[Si](C)(C)O[C@H](C=O)C1=CC=CC=C1 YDSRFKLJZYYNOP-CYBMUJFWSA-N 0.000 description 3
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 3
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 3
- RRBRWAPWPGAJMA-UHFFFAOYSA-N 2-amino-1-[3-(trifluoromethyl)phenyl]ethanol Chemical compound NCC(O)C1=CC=CC(C(F)(F)F)=C1 RRBRWAPWPGAJMA-UHFFFAOYSA-N 0.000 description 3
- PGJHAXAIVJIVSM-UHFFFAOYSA-N 2-amino-1-naphthalen-2-ylethanol Chemical compound C1=CC=CC2=CC(C(O)CN)=CC=C21 PGJHAXAIVJIVSM-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- PNEYBMLMFCGWSK-UHFFFAOYSA-N Alumina Chemical compound [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 3
- 239000004215 Carbon black (E152) Substances 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 239000012448 Lithium borohydride Substances 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 3
- 150000008041 alkali metal carbonates Chemical class 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- AZWXAPCAJCYGIA-UHFFFAOYSA-N bis(2-methylpropyl)alumane Chemical compound CC(C)C[AlH]CC(C)C AZWXAPCAJCYGIA-UHFFFAOYSA-N 0.000 description 3
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 3
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 3
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 3
- 230000032050 esterification Effects 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- CQLDEKSLHWBFNL-AWEZNQCLSA-N ethyl (2s)-2-[tert-butyl(dimethyl)silyl]oxy-2-phenylacetate Chemical compound CCOC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)C1=CC=CC=C1 CQLDEKSLHWBFNL-AWEZNQCLSA-N 0.000 description 3
- 239000001530 fumaric acid Substances 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 125000005929 isobutyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])OC(*)=O 0.000 description 3
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 3
- 231100000053 low toxicity Toxicity 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 229910052987 metal hydride Inorganic materials 0.000 description 3
- 150000004681 metal hydrides Chemical class 0.000 description 3
- XGDZEDRBLVIUMX-UHFFFAOYSA-N methyl 2-(4-hydroxyphenyl)acetate Chemical compound COC(=O)CC1=CC=C(O)C=C1 XGDZEDRBLVIUMX-UHFFFAOYSA-N 0.000 description 3
- SCEYENKSNYHRLE-UHFFFAOYSA-N methyl 2-[3-chloro-4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propoxy]phenyl]acetate Chemical compound ClC1=CC(CC(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC=CC(Cl)=C1 SCEYENKSNYHRLE-UHFFFAOYSA-N 0.000 description 3
- GKCSGJUHAQEQCO-UHFFFAOYSA-N methyl 3-[4-(2-oxopropoxy)phenyl]prop-2-enoate Chemical compound COC(=O)C=CC1=CC=C(OCC(C)=O)C=C1 GKCSGJUHAQEQCO-UHFFFAOYSA-N 0.000 description 3
- IOEQUNVTIUILLT-UHFFFAOYSA-N methyl 3-[4-(2-oxopropoxy)phenyl]propanoate Chemical compound COC(=O)CCC1=CC=C(OCC(C)=O)C=C1 IOEQUNVTIUILLT-UHFFFAOYSA-N 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 125000005930 sec-butyloxycarbonyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- PDAFIZPRSXHMCO-ZCFIWIBFSA-N tert-butyl n-[(2r)-1-hydroxypropan-2-yl]carbamate Chemical compound OC[C@@H](C)NC(=O)OC(C)(C)C PDAFIZPRSXHMCO-ZCFIWIBFSA-N 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- LBCVPYBBUCWRLU-ZDUSSCGKSA-N (2r)-2-[tert-butyl(dimethyl)silyl]oxy-2-(3-chlorophenyl)acetaldehyde Chemical compound CC(C)(C)[Si](C)(C)O[C@@H](C=O)C1=CC=CC(Cl)=C1 LBCVPYBBUCWRLU-ZDUSSCGKSA-N 0.000 description 2
- QYCUCEFCXOXNIE-UHFFFAOYSA-N 1-(4-aminophenoxy)propan-2-one;hydrochloride Chemical compound Cl.CC(=O)COC1=CC=C(N)C=C1 QYCUCEFCXOXNIE-UHFFFAOYSA-N 0.000 description 2
- SAMVPMGKGGLIPF-UHFFFAOYSA-N 2-(3-chlorophenyl)-2-hydroxyacetic acid Chemical compound OC(=O)C(O)C1=CC=CC(Cl)=C1 SAMVPMGKGGLIPF-UHFFFAOYSA-N 0.000 description 2
- YCCILVSKPBXVIP-UHFFFAOYSA-N 2-(4-hydroxyphenyl)ethanol Chemical compound OCCC1=CC=C(O)C=C1 YCCILVSKPBXVIP-UHFFFAOYSA-N 0.000 description 2
- NGUIMUINQIMVPV-UHFFFAOYSA-N 2-[4-(2-oxopropoxy)phenyl]ethyl acetate Chemical compound CC(=O)COC1=CC=C(CCOC(C)=O)C=C1 NGUIMUINQIMVPV-UHFFFAOYSA-N 0.000 description 2
- HICFIEHMABUVLC-UHFFFAOYSA-N 2-amino-1-(2-chlorophenyl)ethanol Chemical compound NCC(O)C1=CC=CC=C1Cl HICFIEHMABUVLC-UHFFFAOYSA-N 0.000 description 2
- BHURFCFBOPXSCN-UHFFFAOYSA-N 2-amino-1-(3,4,5-trimethoxyphenyl)ethanol Chemical compound COC1=CC(C(O)CN)=CC(OC)=C1OC BHURFCFBOPXSCN-UHFFFAOYSA-N 0.000 description 2
- SWDAVNPCXAGELD-UHFFFAOYSA-N 2-amino-1-(3,5-dichlorophenyl)ethanol Chemical compound NCC(O)C1=CC(Cl)=CC(Cl)=C1 SWDAVNPCXAGELD-UHFFFAOYSA-N 0.000 description 2
- MKDZOLCWDXTLIF-UHFFFAOYSA-N 2-amino-1-(3-bromophenyl)ethanol Chemical compound NCC(O)C1=CC=CC(Br)=C1 MKDZOLCWDXTLIF-UHFFFAOYSA-N 0.000 description 2
- PPLFENOCMSQLTD-UHFFFAOYSA-N 2-amino-1-(3-chloro-4-fluorophenyl)ethanol Chemical compound NCC(O)C1=CC=C(F)C(Cl)=C1 PPLFENOCMSQLTD-UHFFFAOYSA-N 0.000 description 2
- KLIPUNKCUPNMHM-UHFFFAOYSA-N 2-amino-1-(3-fluorophenyl)ethanol Chemical compound NCC(O)C1=CC=CC(F)=C1 KLIPUNKCUPNMHM-UHFFFAOYSA-N 0.000 description 2
- YQMQTEJARSWZPZ-UHFFFAOYSA-N 2-amino-1-(3-methoxyphenyl)ethanol Chemical compound COC1=CC=CC(C(O)CN)=C1 YQMQTEJARSWZPZ-UHFFFAOYSA-N 0.000 description 2
- RMZOTKNVCPHART-UHFFFAOYSA-N 2-amino-1-(3-methylphenyl)ethanol Chemical compound CC1=CC=CC(C(O)CN)=C1 RMZOTKNVCPHART-UHFFFAOYSA-N 0.000 description 2
- BJTVAYZPBFANDH-UHFFFAOYSA-N 2-amino-1-(3-phenoxyphenyl)ethanol Chemical compound NCC(O)C1=CC=CC(OC=2C=CC=CC=2)=C1 BJTVAYZPBFANDH-UHFFFAOYSA-N 0.000 description 2
- QPHAZZJNYDEVHL-UHFFFAOYSA-N 2-amino-1-(4-chlorophenyl)ethanol Chemical compound NCC(O)C1=CC=C(Cl)C=C1 QPHAZZJNYDEVHL-UHFFFAOYSA-N 0.000 description 2
- FWBOVFYHCSVEKC-UHFFFAOYSA-N 2-amino-1-naphthalen-1-ylethanol Chemical compound C1=CC=C2C(C(O)CN)=CC=CC2=C1 FWBOVFYHCSVEKC-UHFFFAOYSA-N 0.000 description 2
- OPHQOIGEOHXOGX-UHFFFAOYSA-N 3,4,5-trimethoxybenzaldehyde Chemical compound COC1=CC(C=O)=CC(OC)=C1OC OPHQOIGEOHXOGX-UHFFFAOYSA-N 0.000 description 2
- CFFZDZCDUFSOFZ-UHFFFAOYSA-N 3,4-Dihydroxy-phenylacetic acid Chemical compound OC(=O)CC1=CC=C(O)C(O)=C1 CFFZDZCDUFSOFZ-UHFFFAOYSA-N 0.000 description 2
- DOZRDZLFLOODMB-UHFFFAOYSA-N 3,5-di-tert-Butyl-4-hydroxybenzaldehyde Chemical compound CC(C)(C)C1=CC(C=O)=CC(C(C)(C)C)=C1O DOZRDZLFLOODMB-UHFFFAOYSA-N 0.000 description 2
- SRWILAKSARHZPR-UHFFFAOYSA-N 3-chlorobenzaldehyde Chemical compound ClC1=CC=CC(C=O)=C1 SRWILAKSARHZPR-UHFFFAOYSA-N 0.000 description 2
- WMPDAIZRQDCGFH-UHFFFAOYSA-N 3-methoxybenzaldehyde Chemical compound COC1=CC=CC(C=O)=C1 WMPDAIZRQDCGFH-UHFFFAOYSA-N 0.000 description 2
- VNTAONUWHQBAMC-UHFFFAOYSA-N 3-phenothiazin-10-ylpropanoic acid Chemical compound C1=CC=C2N(CCC(=O)O)C3=CC=CC=C3SC2=C1 VNTAONUWHQBAMC-UHFFFAOYSA-N 0.000 description 2
- BNKOODGJLDZCCW-UHFFFAOYSA-N 4-(2-amino-1-hydroxyethyl)-2,6-ditert-butylphenol Chemical compound CC(C)(C)C1=CC(C(O)CN)=CC(C(C)(C)C)=C1O BNKOODGJLDZCCW-UHFFFAOYSA-N 0.000 description 2
- WQVWRWFQMICRIK-VOHHKUJWSA-N 5-[[4-[(2r)-2-aminopropoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C1=CC(OC[C@H](N)C)=CC=C1CC1C(=O)NC(=O)S1 WQVWRWFQMICRIK-VOHHKUJWSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- 229930194542 Keto Natural products 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- BVBSGGBDFJUSIH-UHFFFAOYSA-N Methyl (2-hydroxyphenyl)acetate Chemical compound COC(=O)CC1=CC=CC=C1O BVBSGGBDFJUSIH-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- AYESDWSJUSTNGT-UHFFFAOYSA-N [4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] acetate Chemical compound C1=CC(OC(=O)C)=CC=C1C=C1C(=O)NC(=O)S1 AYESDWSJUSTNGT-UHFFFAOYSA-N 0.000 description 2
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 2
- 238000005903 acid hydrolysis reaction Methods 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N alpha-methyl toluene Natural products CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 150000001414 amino alcohols Chemical class 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 238000010531 catalytic reduction reaction Methods 0.000 description 2
- BERDEBHAJNAUOM-UHFFFAOYSA-N copper(i) oxide Chemical compound [Cu]O[Cu] BERDEBHAJNAUOM-UHFFFAOYSA-N 0.000 description 2
- 208000029078 coronary artery disease Diseases 0.000 description 2
- KWGRBVOPPLSCSI-UHFFFAOYSA-N d-ephedrine Natural products CNC(C)C(O)C1=CC=CC=C1 KWGRBVOPPLSCSI-UHFFFAOYSA-N 0.000 description 2
- ZVRVOPMYTWMIJQ-UHFFFAOYSA-N dimethyl 2-[4-(2-oxopropoxy)phenyl]propanedioate Chemical compound COC(=O)C(C(=O)OC)C1=CC=C(OCC(C)=O)C=C1 ZVRVOPMYTWMIJQ-UHFFFAOYSA-N 0.000 description 2
- FQYPFXLWUHBFAL-UHFFFAOYSA-N dimethyl 4-(2-oxopropoxy)benzene-1,2-dicarboxylate Chemical compound COC(=O)C1=CC=C(OCC(C)=O)C=C1C(=O)OC FQYPFXLWUHBFAL-UHFFFAOYSA-N 0.000 description 2
- TUFSTUGHDNIHAG-UHFFFAOYSA-N dimethyl 4-(2-oxopropoxy)benzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC=C(OCC(C)=O)C(C(=O)OC)=C1 TUFSTUGHDNIHAG-UHFFFAOYSA-N 0.000 description 2
- UTUBLIAZIWFUSD-UHFFFAOYSA-N dimethyl 4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC=CC(Cl)=C1 UTUBLIAZIWFUSD-UHFFFAOYSA-N 0.000 description 2
- JJXVDRYFBGDXOU-UHFFFAOYSA-N dimethyl 4-hydroxybenzene-1,2-dicarboxylate Chemical compound COC(=O)C1=CC=C(O)C=C1C(=O)OC JJXVDRYFBGDXOU-UHFFFAOYSA-N 0.000 description 2
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- SAXHIDRUJXPDOD-VIFPVBQESA-N ethyl (2S)-hydroxy(phenyl)acetate Chemical compound CCOC(=O)[C@@H](O)C1=CC=CC=C1 SAXHIDRUJXPDOD-VIFPVBQESA-N 0.000 description 2
- CQLDEKSLHWBFNL-CQSZACIVSA-N ethyl (2r)-2-[tert-butyl(dimethyl)silyl]oxy-2-phenylacetate Chemical compound CCOC(=O)[C@H](O[Si](C)(C)C(C)(C)C)C1=CC=CC=C1 CQLDEKSLHWBFNL-CQSZACIVSA-N 0.000 description 2
- AVFOTFUTMAFMKE-UHFFFAOYSA-N ethyl 2-chloro-3-[4-(2-oxopropoxy)phenyl]propanoate Chemical compound CCOC(=O)C(Cl)CC1=CC=C(OCC(C)=O)C=C1 AVFOTFUTMAFMKE-UHFFFAOYSA-N 0.000 description 2
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- IGMNYECMUMZDDF-UHFFFAOYSA-N homogentisic acid Chemical compound OC(=O)CC1=CC(O)=CC=C1O IGMNYECMUMZDDF-UHFFFAOYSA-N 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000011068 loading method Methods 0.000 description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 2
- FHZXYKLSQUAWQN-UHFFFAOYSA-N methyl 2-[2-(2-oxopropoxy)phenyl]acetate Chemical compound COC(=O)CC1=CC=CC=C1OCC(C)=O FHZXYKLSQUAWQN-UHFFFAOYSA-N 0.000 description 2
- VYBIFJADGSYMNX-UHFFFAOYSA-N methyl 2-[2-hydroxy-5-(2-oxopropoxy)phenyl]acetate Chemical compound COC(=O)CC1=CC(OCC(C)=O)=CC=C1O VYBIFJADGSYMNX-UHFFFAOYSA-N 0.000 description 2
- TWZOZAJHIJUACJ-UHFFFAOYSA-N methyl 2-[3-(2-oxopropoxy)phenyl]acetate Chemical compound COC(=O)CC1=CC=CC(OCC(C)=O)=C1 TWZOZAJHIJUACJ-UHFFFAOYSA-N 0.000 description 2
- PAJWSTKEOBHHTE-UHFFFAOYSA-N methyl 2-[3-chloro-4-(2-oxopropoxy)phenyl]acetate Chemical compound COC(=O)CC1=CC=C(OCC(C)=O)C(Cl)=C1 PAJWSTKEOBHHTE-UHFFFAOYSA-N 0.000 description 2
- LUMIUWWIVBLXSW-UHFFFAOYSA-N methyl 2-[3-hydroxy-4-(2-oxopropoxy)phenyl]acetate Chemical compound COC(=O)CC1=CC=C(OCC(C)=O)C(O)=C1 LUMIUWWIVBLXSW-UHFFFAOYSA-N 0.000 description 2
- PACDRDRFKKJXRO-KUHUBIRLSA-N methyl 2-[4-[(2r)-2-[[(2r)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OC[C@@H](C)NC[C@H](O)C1=CC=CC(Cl)=C1 PACDRDRFKKJXRO-KUHUBIRLSA-N 0.000 description 2
- MZRTXEJJBJYDPL-DVECYGJZSA-N methyl 2-[4-[(2r)-2-[[(2r)-2-[tert-butyl(dimethyl)silyl]oxy-2-(3-chlorophenyl)ethyl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OC[C@@H](C)NC[C@H](O[Si](C)(C)C(C)(C)C)C1=CC=CC(Cl)=C1 MZRTXEJJBJYDPL-DVECYGJZSA-N 0.000 description 2
- BRCKWTCQPPWYBL-HYBUGGRVSA-N methyl 2-[4-[(2r)-2-[[(2s)-2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OC[C@@H](C)NC[C@@H](O[Si](C)(C)C(C)(C)C)C1=CC=CC=C1 BRCKWTCQPPWYBL-HYBUGGRVSA-N 0.000 description 2
- BRCKWTCQPPWYBL-RDPSFJRHSA-N methyl 2-[4-[(2s)-2-[[(2r)-2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OC[C@H](C)NC[C@H](O[Si](C)(C)C(C)(C)C)C1=CC=CC=C1 BRCKWTCQPPWYBL-RDPSFJRHSA-N 0.000 description 2
- BRCKWTCQPPWYBL-GBXCKJPGSA-N methyl 2-[4-[(2s)-2-[[(2s)-2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OC[C@H](C)NC[C@@H](O[Si](C)(C)C(C)(C)C)C1=CC=CC=C1 BRCKWTCQPPWYBL-GBXCKJPGSA-N 0.000 description 2
- SRNOYAWYVFFNBI-VIFPVBQESA-N methyl 2-[4-[(2s)-2-aminopropoxy]phenyl]acetate Chemical compound COC(=O)CC1=CC=C(OC[C@H](C)N)C=C1 SRNOYAWYVFFNBI-VIFPVBQESA-N 0.000 description 2
- GMSMMKGQFYFZQQ-UHFFFAOYSA-N methyl 2-[4-[2-[[2-(3-bromophenyl)-2-hydroxyethyl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC=CC(Br)=C1 GMSMMKGQFYFZQQ-UHFFFAOYSA-N 0.000 description 2
- XQIOXTPGIXVEEE-UHFFFAOYSA-N methyl 2-hydroxy-2-[4-(2-oxopropoxy)phenyl]acetate Chemical compound COC(=O)C(O)C1=CC=C(OCC(C)=O)C=C1 XQIOXTPGIXVEEE-UHFFFAOYSA-N 0.000 description 2
- BWKNERUQCVZQLL-UHFFFAOYSA-N methyl 2-hydroxy-3-[4-(2-oxopropoxy)phenyl]propanoate Chemical compound COC(=O)C(O)CC1=CC=C(OCC(C)=O)C=C1 BWKNERUQCVZQLL-UHFFFAOYSA-N 0.000 description 2
- VCIHYRFZBPUUGM-UHFFFAOYSA-N methyl 3-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propoxy]phenyl]prop-2-enoate Chemical compound C1=CC(C=CC(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC=CC(Cl)=C1 VCIHYRFZBPUUGM-UHFFFAOYSA-N 0.000 description 2
- QUSXXGLOFQKIBA-UHFFFAOYSA-N methyl 4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propoxy]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC=CC(Cl)=C1 QUSXXGLOFQKIBA-UHFFFAOYSA-N 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 125000001148 pentyloxycarbonyl group Chemical group 0.000 description 2
- RMVRSNDYEFQCLF-UHFFFAOYSA-N phenyl mercaptan Natural products SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 2
- 229940049953 phenylacetate Drugs 0.000 description 2
- ULSIYEODSMZIPX-UHFFFAOYSA-N phenylethanolamine Chemical compound NCC(O)C1=CC=CC=C1 ULSIYEODSMZIPX-UHFFFAOYSA-N 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- 230000003449 preventive effect Effects 0.000 description 2
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 102000005962 receptors Human genes 0.000 description 2
- 108020003175 receptors Proteins 0.000 description 2
- 210000005245 right atrium Anatomy 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 2
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 2
- 239000001117 sulphuric acid Substances 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- LYQSPHYCULDOKO-PSPFREQMSA-N tert-butyl n-[(2r)-1-[4-[(2,4-dioxo-3-trityl-1,3-thiazolidin-5-yl)methyl]phenoxy]propan-2-yl]carbamate Chemical compound C1=CC(OC[C@@H](C)NC(=O)OC(C)(C)C)=CC=C1CC1C(=O)N(C(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C(=O)S1 LYQSPHYCULDOKO-PSPFREQMSA-N 0.000 description 2
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000000037 tert-butyldiphenylsilyl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1[Si]([H])([*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- ZLMLUMYLPTYKHH-UHFFFAOYSA-N tetraethyl 1-[4-(2-oxopropoxy)phenyl]ethane-1,1,2,2-tetracarboxylate Chemical compound CCOC(=O)C(C(=O)OCC)C(C(=O)OCC)(C(=O)OCC)C1=CC=C(OCC(C)=O)C=C1 ZLMLUMYLPTYKHH-UHFFFAOYSA-N 0.000 description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- KWGRBVOPPLSCSI-WPRPVWTQSA-N (-)-ephedrine Chemical compound CN[C@@H](C)[C@H](O)C1=CC=CC=C1 KWGRBVOPPLSCSI-WPRPVWTQSA-N 0.000 description 1
- RQEUFEKYXDPUSK-SSDOTTSWSA-N (1R)-1-phenylethanamine Chemical compound C[C@@H](N)C1=CC=CC=C1 RQEUFEKYXDPUSK-SSDOTTSWSA-N 0.000 description 1
- RQEUFEKYXDPUSK-ZETCQYMHSA-N (1S)-1-phenylethanamine Chemical compound C[C@H](N)C1=CC=CC=C1 RQEUFEKYXDPUSK-ZETCQYMHSA-N 0.000 description 1
- KWGRBVOPPLSCSI-PSASIEDQSA-N (1s,2r)-2-(methylamino)-1-phenylpropan-1-ol Chemical compound CN[C@H](C)[C@@H](O)C1=CC=CC=C1 KWGRBVOPPLSCSI-PSASIEDQSA-N 0.000 description 1
- JUCGVCVPNPBJIG-IUCAKERBSA-N (1s,2s)-2-amino-1-phenylpropane-1,3-diol Chemical compound OC[C@H](N)[C@@H](O)C1=CC=CC=C1 JUCGVCVPNPBJIG-IUCAKERBSA-N 0.000 description 1
- BORQRFQPUZOART-HICAXQOKSA-N (e)-but-2-enedioic acid;methyl 2-[4-[(2r)-2-[[(2r)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propoxy]phenyl]acetate Chemical compound OC(=O)\C=C\C(O)=O.C1=CC(CC(=O)OC)=CC=C1OC[C@@H](C)NC[C@H](O)C1=CC=CC(Cl)=C1 BORQRFQPUZOART-HICAXQOKSA-N 0.000 description 1
- BORQRFQPUZOART-WLHGVMLRSA-N (e)-but-2-enedioic acid;methyl 2-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propoxy]phenyl]acetate Chemical compound OC(=O)\C=C\C(O)=O.C1=CC(CC(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC=CC(Cl)=C1 BORQRFQPUZOART-WLHGVMLRSA-N 0.000 description 1
- 125000005919 1,2,2-trimethylpropyl group Chemical group 0.000 description 1
- 125000005918 1,2-dimethylbutyl group Chemical group 0.000 description 1
- BTPOVNGEGQQHIV-UHFFFAOYSA-N 1-(4-nitrophenoxy)propan-2-one Chemical compound CC(=O)COC1=CC=C([N+]([O-])=O)C=C1 BTPOVNGEGQQHIV-UHFFFAOYSA-N 0.000 description 1
- 125000006219 1-ethylpentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- SQAINHDHICKHLX-UHFFFAOYSA-N 1-naphthaldehyde Chemical compound C1=CC=C2C(C=O)=CC=CC2=C1 SQAINHDHICKHLX-UHFFFAOYSA-N 0.000 description 1
- 125000005978 1-naphthyloxy group Chemical group 0.000 description 1
- WIZIBEDAPVILNL-UHFFFAOYSA-N 1h-pyrrolo[2,3-b]pyridine-2,3-dione Chemical compound C1=CC=C2C(=O)C(=O)NC2=N1 WIZIBEDAPVILNL-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- WRMNZCZEMHIOCP-UHFFFAOYSA-N 2-Phenylethanol Natural products OCCC1=CC=CC=C1 WRMNZCZEMHIOCP-UHFFFAOYSA-N 0.000 description 1
- VPXJOLHSVZGEHA-UHFFFAOYSA-N 2-[3-chloro-4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propoxy]phenyl]acetic acid Chemical compound C=1C=CC(Cl)=CC=1C(O)CNC(C)COC1=CC=C(CC(O)=O)C=C1Cl VPXJOLHSVZGEHA-UHFFFAOYSA-N 0.000 description 1
- QKHURKUJKYCYIC-UHFFFAOYSA-N 2-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propoxy]phenyl]ethyl acetate Chemical compound C=1C=CC(Cl)=CC=1C(O)CNC(C)COC1=CC=C(CCOC(C)=O)C=C1 QKHURKUJKYCYIC-UHFFFAOYSA-N 0.000 description 1
- FPYUJUBAXZAQNL-UHFFFAOYSA-N 2-chlorobenzaldehyde Chemical compound ClC1=CC=CC=C1C=O FPYUJUBAXZAQNL-UHFFFAOYSA-N 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- GXUQMKBQDGPMKZ-UHFFFAOYSA-N 2-hydroxy-2-(3-phenoxyphenyl)acetonitrile Chemical compound N#CC(O)C1=CC=CC(OC=2C=CC=CC=2)=C1 GXUQMKBQDGPMKZ-UHFFFAOYSA-N 0.000 description 1
- 239000001431 2-methylbenzaldehyde Substances 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- PJKVFARRVXDXAD-UHFFFAOYSA-N 2-naphthaldehyde Chemical compound C1=CC=CC2=CC(C=O)=CC=C21 PJKVFARRVXDXAD-UHFFFAOYSA-N 0.000 description 1
- 125000005979 2-naphthyloxy group Chemical group 0.000 description 1
- CASRSOJWLARCRX-UHFFFAOYSA-N 3,5-dichlorobenzaldehyde Chemical compound ClC1=CC(Cl)=CC(C=O)=C1 CASRSOJWLARCRX-UHFFFAOYSA-N 0.000 description 1
- NMTUHPSKJJYGML-UHFFFAOYSA-N 3-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=CC(C=O)=C1 NMTUHPSKJJYGML-UHFFFAOYSA-N 0.000 description 1
- SUISZCALMBHJQX-UHFFFAOYSA-N 3-bromobenzaldehyde Chemical compound BrC1=CC=CC(C=O)=C1 SUISZCALMBHJQX-UHFFFAOYSA-N 0.000 description 1
- GVORVQPNNSASDM-UHFFFAOYSA-N 3-chloro-4-fluorobenzaldehyde Chemical compound FC1=CC=C(C=O)C=C1Cl GVORVQPNNSASDM-UHFFFAOYSA-N 0.000 description 1
- PIKNVEVCWAAOMJ-UHFFFAOYSA-N 3-fluorobenzaldehyde Chemical compound FC1=CC=CC(C=O)=C1 PIKNVEVCWAAOMJ-UHFFFAOYSA-N 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- AVPYQKSLYISFPO-UHFFFAOYSA-N 4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1 AVPYQKSLYISFPO-UHFFFAOYSA-N 0.000 description 1
- NITWSHWHQAQBAW-UHFFFAOYSA-N 4-coumaric acid methyl ester Chemical compound COC(=O)C=CC1=CC=C(O)C=C1 NITWSHWHQAQBAW-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- YHXHKYRQLYQUIH-UHFFFAOYSA-N 4-hydroxymandelic acid Chemical compound OC(=O)C(O)C1=CC=C(O)C=C1 YHXHKYRQLYQUIH-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- HYIRCXYSHYNXIV-OJBAKJFDSA-N 5-[[4-[(2r)-2-[[(2r)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione Chemical compound C([C@@H](C)NC[C@H](O)C=1C=C(Cl)C=CC=1)OC(C=C1)=CC=C1CC1SC(=O)NC1=O HYIRCXYSHYNXIV-OJBAKJFDSA-N 0.000 description 1
- KTSYCLYUBVXQPX-FXHMIMKSSA-N 5-[[4-[(2r)-2-[[(2r)-2-[tert-butyl(dimethyl)silyl]oxy-2-(3-chlorophenyl)ethyl]amino]propoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione Chemical compound C([C@@H](C)NC[C@H](O[Si](C)(C)C(C)(C)C)C=1C=C(Cl)C=CC=1)OC(C=C1)=CC=C1CC1SC(=O)NC1=O KTSYCLYUBVXQPX-FXHMIMKSSA-N 0.000 description 1
- VZHDLRBPRGRUHX-UHFFFAOYSA-N 5-[[4-[2-[(2-hydroxy-2-naphthalen-2-ylethyl)amino]propoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione Chemical compound C=1C=C2C=CC=CC2=CC=1C(O)CNC(C)COC(C=C1)=CC=C1CC1SC(=O)NC1=O VZHDLRBPRGRUHX-UHFFFAOYSA-N 0.000 description 1
- DOVOVWITCHWXJD-UHFFFAOYSA-N 8-methoxy-2-oxo-n-(4-sulfamoylphenyl)chromene-3-carboxamide Chemical compound O=C1OC=2C(OC)=CC=CC=2C=C1C(=O)NC1=CC=C(S(N)(=O)=O)C=C1 DOVOVWITCHWXJD-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 208000002177 Cataract Diseases 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 240000004322 Lens culinaris Species 0.000 description 1
- 235000014647 Lens culinaris subsp culinaris Nutrition 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- NITWSHWHQAQBAW-QPJJXVBHSA-N Methyl 4-hydroxy cinnamate Natural products COC(=O)\C=C\C1=CC=C(O)C=C1 NITWSHWHQAQBAW-QPJJXVBHSA-N 0.000 description 1
- 238000006751 Mitsunobu reaction Methods 0.000 description 1
- HOKKHZGPKSLGJE-GSVOUGTGSA-N N-Methyl-D-aspartic acid Chemical compound CN[C@@H](C(O)=O)CC(O)=O HOKKHZGPKSLGJE-GSVOUGTGSA-N 0.000 description 1
- 208000017442 Retinal disease Diseases 0.000 description 1
- 206010038923 Retinopathy Diseases 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 238000006859 Swern oxidation reaction Methods 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 230000005856 abnormality Effects 0.000 description 1
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000001270 agonistic effect Effects 0.000 description 1
- 125000004450 alkenylene group Chemical group 0.000 description 1
- 125000006307 alkoxy benzyl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 238000009876 asymmetric hydrogenation reaction Methods 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 1
- 102000012740 beta Adrenergic Receptors Human genes 0.000 description 1
- 108010079452 beta Adrenergic Receptors Proteins 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 210000000748 cardiovascular system Anatomy 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 230000002057 chronotropic effect Effects 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- LWIPABRAHRZWNP-UHFFFAOYSA-N dimethyl 2-(4-hydroxyphenyl)propanedioate Chemical compound COC(=O)C(C(=O)OC)C1=CC=C(O)C=C1 LWIPABRAHRZWNP-UHFFFAOYSA-N 0.000 description 1
- NHEWIISWVDLPCP-UHFFFAOYSA-N dimethyl 2-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propoxy]phenyl]propanedioate Chemical compound C1=CC(C(C(=O)OC)C(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC=CC(Cl)=C1 NHEWIISWVDLPCP-UHFFFAOYSA-N 0.000 description 1
- AMZFIOFMMCEMDQ-UHFFFAOYSA-N dimethyl 4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propoxy]benzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC(C(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC=CC(Cl)=C1 AMZFIOFMMCEMDQ-UHFFFAOYSA-N 0.000 description 1
- 208000037765 diseases and disorders Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000004110 gluconeogenesis Effects 0.000 description 1
- 229940093181 glucose injection Drugs 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000003944 halohydrins Chemical class 0.000 description 1
- 230000002440 hepatic effect Effects 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005935 hexyloxycarbonyl group Chemical group 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 125000006289 hydroxybenzyl group Chemical group 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 229940090044 injection Drugs 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 230000000297 inotrophic effect Effects 0.000 description 1
- 230000001678 irradiating effect Effects 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 208000017169 kidney disease Diseases 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- OVWYEQOVUDKZNU-UHFFFAOYSA-N m-tolualdehyde Chemical compound CC1=CC=CC(C=O)=C1 OVWYEQOVUDKZNU-UHFFFAOYSA-N 0.000 description 1
- 238000003328 mesylation reaction Methods 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- CPEZVACFWJSZNE-MRVPVSSYSA-N methyl (2r)-2-(3-chlorophenyl)-2-hydroxyacetate Chemical compound COC(=O)[C@H](O)C1=CC=CC(Cl)=C1 CPEZVACFWJSZNE-MRVPVSSYSA-N 0.000 description 1
- NIQBJRVOVHHHMK-CYBMUJFWSA-N methyl (2r)-2-[tert-butyl(dimethyl)silyl]oxy-2-(3-chlorophenyl)acetate Chemical compound CC(C)(C)[Si](C)(C)O[C@@H](C(=O)OC)C1=CC=CC(Cl)=C1 NIQBJRVOVHHHMK-CYBMUJFWSA-N 0.000 description 1
- ACBFEXJHCINJDS-UHFFFAOYSA-N methyl 2-(3-chloro-4-hydroxyphenyl)acetate Chemical compound COC(=O)CC1=CC=C(O)C(Cl)=C1 ACBFEXJHCINJDS-UHFFFAOYSA-N 0.000 description 1
- AMDDOQIUPAINLH-UHFFFAOYSA-N methyl 2-(3-hydroxyphenyl)acetate Chemical compound COC(=O)CC1=CC=CC(O)=C1 AMDDOQIUPAINLH-UHFFFAOYSA-N 0.000 description 1
- BJUPNJLVYQSMOE-UHFFFAOYSA-N methyl 2-[2-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propoxy]phenyl]acetate Chemical compound COC(=O)CC1=CC=CC=C1OCC(C)NCC(O)C1=CC=CC(Cl)=C1 BJUPNJLVYQSMOE-UHFFFAOYSA-N 0.000 description 1
- QGMWXQITYODEJO-UHFFFAOYSA-N methyl 2-[3-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propoxy]phenyl]acetate Chemical compound COC(=O)CC1=CC=CC(OCC(C)NCC(O)C=2C=C(Cl)C=CC=2)=C1 QGMWXQITYODEJO-UHFFFAOYSA-N 0.000 description 1
- BRCKWTCQPPWYBL-YKSBVNFPSA-N methyl 2-[4-[(2r)-2-[[(2r)-2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OC[C@@H](C)NC[C@H](O[Si](C)(C)C(C)(C)C)C1=CC=CC=C1 BRCKWTCQPPWYBL-YKSBVNFPSA-N 0.000 description 1
- WDKGHUODOJUVHL-BEFAXECRSA-N methyl 2-[4-[(2r)-2-[[(2r)-2-hydroxy-2-phenylethyl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OC[C@@H](C)NC[C@H](O)C1=CC=CC=C1 WDKGHUODOJUVHL-BEFAXECRSA-N 0.000 description 1
- WDKGHUODOJUVHL-DNVCBOLYSA-N methyl 2-[4-[(2r)-2-[[(2s)-2-hydroxy-2-phenylethyl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OC[C@@H](C)NC[C@@H](O)C1=CC=CC=C1 WDKGHUODOJUVHL-DNVCBOLYSA-N 0.000 description 1
- WDKGHUODOJUVHL-KXBFYZLASA-N methyl 2-[4-[(2s)-2-[[(2r)-2-hydroxy-2-phenylethyl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OC[C@H](C)NC[C@H](O)C1=CC=CC=C1 WDKGHUODOJUVHL-KXBFYZLASA-N 0.000 description 1
- WDKGHUODOJUVHL-HNAYVOBHSA-N methyl 2-[4-[(2s)-2-[[(2s)-2-hydroxy-2-phenylethyl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OC[C@H](C)NC[C@@H](O)C1=CC=CC=C1 WDKGHUODOJUVHL-HNAYVOBHSA-N 0.000 description 1
- CYTSQDOAEIWXHH-UHFFFAOYSA-N methyl 2-[4-[2-[(2-hydroxy-2-naphthalen-1-ylethyl)amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC=CC2=CC=CC=C12 CYTSQDOAEIWXHH-UHFFFAOYSA-N 0.000 description 1
- WCRONCXWKQOLDT-VWDLYUFVSA-N methyl 2-[4-[2-[[(1s,2r)-1-hydroxy-1-phenylpropan-2-yl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OCC(C)N[C@H](C)[C@@H](O)C1=CC=CC=C1 WCRONCXWKQOLDT-VWDLYUFVSA-N 0.000 description 1
- SVAVUNRQYFMWFL-XHRKEWCOSA-N methyl 2-[4-[2-[[(1s,2s)-1,3-dihydroxy-1-phenylpropan-2-yl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OCC(C)N[C@@H](CO)[C@@H](O)C1=CC=CC=C1 SVAVUNRQYFMWFL-XHRKEWCOSA-N 0.000 description 1
- OJCFERNWAVOFIV-UHFFFAOYSA-N methyl 2-[4-[2-[[2-(2-chlorophenyl)-2-hydroxyethyl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC=CC=C1Cl OJCFERNWAVOFIV-UHFFFAOYSA-N 0.000 description 1
- PNCYESRWIRQRAL-UHFFFAOYSA-N methyl 2-[4-[2-[[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-hydroxyethyl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 PNCYESRWIRQRAL-UHFFFAOYSA-N 0.000 description 1
- UNQDMEGCCSEREB-UHFFFAOYSA-N methyl 2-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propoxy]-3-hydroxyphenyl]acetate Chemical compound OC1=CC(CC(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC=CC(Cl)=C1 UNQDMEGCCSEREB-UHFFFAOYSA-N 0.000 description 1
- SRIPTXVZQGMSIV-UHFFFAOYSA-N methyl 2-[4-[2-[[2-(3-fluorophenyl)-2-hydroxyethyl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC=CC(F)=C1 SRIPTXVZQGMSIV-UHFFFAOYSA-N 0.000 description 1
- APQXYQPAXVIMCA-UHFFFAOYSA-N methyl 2-[4-[2-[[2-(4-chlorophenyl)-2-hydroxyethyl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC=C(Cl)C=C1 APQXYQPAXVIMCA-UHFFFAOYSA-N 0.000 description 1
- NNEGJZRYTLMESN-UHFFFAOYSA-N methyl 2-[4-[2-[[2-hydroxy-2-(3,4,5-trimethoxyphenyl)ethyl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC(OC)=C(OC)C(OC)=C1 NNEGJZRYTLMESN-UHFFFAOYSA-N 0.000 description 1
- UMHCYEDEMQOXMM-UHFFFAOYSA-N methyl 2-[4-[2-[[2-hydroxy-2-(3-methylphenyl)ethyl]amino]propoxy]phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OCC(C)NCC(O)C1=CC=CC(C)=C1 UMHCYEDEMQOXMM-UHFFFAOYSA-N 0.000 description 1
- OBKXBSQEZIVWQA-UHFFFAOYSA-N methyl 4-(2-oxopropoxy)benzoate Chemical compound COC(=O)C1=CC=C(OCC(C)=O)C=C1 OBKXBSQEZIVWQA-UHFFFAOYSA-N 0.000 description 1
- PDFUCDWETSQSSU-SECBINFHSA-N methyl 4-hydroxyphenyllactate Natural products COC(=O)[C@H](O)CC1=CC=C(O)C=C1 PDFUCDWETSQSSU-SECBINFHSA-N 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 230000003551 muscarinic effect Effects 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 230000018791 negative regulation of catalytic activity Effects 0.000 description 1
- 201000001119 neuropathy Diseases 0.000 description 1
- 230000007823 neuropathy Effects 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 208000033808 peripheral neuropathy Diseases 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 239000013558 reference substance Substances 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229940076279 serotonin Drugs 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 125000005017 substituted alkenyl group Chemical group 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- PDAFIZPRSXHMCO-LURJTMIESA-N tert-butyl n-[(2s)-1-hydroxypropan-2-yl]carbamate Chemical compound OC[C@H](C)NC(=O)OC(C)(C)C PDAFIZPRSXHMCO-LURJTMIESA-N 0.000 description 1
- WESMVDZJZHDGKM-UHFFFAOYSA-N tetraethyl 1-(4-hydroxyphenyl)ethane-1,1,2,2-tetracarboxylate Chemical compound CCOC(=O)C(C(=O)OCC)C(C(=O)OCC)(C(=O)OCC)C1=CC=C(O)C=C1 WESMVDZJZHDGKM-UHFFFAOYSA-N 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 125000005147 toluenesulfonyl group Chemical group C=1(C(=CC=CC1)S(=O)(=O)*)C 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 238000007070 tosylation reaction Methods 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/28—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines
- C07C217/30—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/13—Amines
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/08—Drugs for skeletal disorders for bone diseases, e.g. rachitism, Paget's disease
- A61P19/10—Drugs for skeletal disorders for bone diseases, e.g. rachitism, Paget's disease for osteoporosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/04—Anorexiants; Antiobesity agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/06—Antihyperlipidemics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/08—Drugs for disorders of the metabolism for glucose homeostasis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/08—Drugs for disorders of the metabolism for glucose homeostasis
- A61P3/10—Drugs for disorders of the metabolism for glucose homeostasis for hyperglycaemia, e.g. antidiabetics
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/06—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted
- C07C217/14—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring
- C07C217/18—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/06—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted
- C07C217/14—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring
- C07C217/18—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted
- C07C217/22—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted by carbon atoms having at least two bonds to oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/32—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton containing six-membered aromatic rings
- C07C235/34—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton containing six-membered aromatic rings having the nitrogen atoms of the carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C259/00—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups
- C07C259/04—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups without replacement of the other oxygen atom of the carboxyl group, e.g. hydroxamic acids
- C07C259/06—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups without replacement of the other oxygen atom of the carboxyl group, e.g. hydroxamic acids having carbon atoms of hydroxamic groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/24—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/25—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being acyclic and saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/62—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/34—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Diabetes (AREA)
- Animal Behavior & Ethology (AREA)
- Medicinal Chemistry (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Obesity (AREA)
- Hematology (AREA)
- Physical Education & Sports Medicine (AREA)
- Emergency Medicine (AREA)
- Orthopedic Medicine & Surgery (AREA)
- Endocrinology (AREA)
- Rheumatology (AREA)
- Child & Adolescent Psychology (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Plural Heterocyclic Compounds (AREA)
- Investigating Or Analysing Biological Materials (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP30458191 | 1991-11-20 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69213892D1 DE69213892D1 (de) | 1996-10-24 |
| DE69213892T2 true DE69213892T2 (de) | 1997-04-17 |
Family
ID=17934718
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69213892T Expired - Fee Related DE69213892T2 (de) | 1991-11-20 | 1992-11-20 | Aromatische Aminoalkoholderivate mit antidiabetischer und Antiobesitäts-Wirkung, ihre Herstellung und therapeutische Verwendung |
Country Status (23)
| Country | Link |
|---|---|
| US (3) | US5977374A (enExample) |
| EP (1) | EP0543662B1 (enExample) |
| JP (2) | JP2654323B2 (enExample) |
| KR (1) | KR0149679B1 (enExample) |
| CN (3) | CN1033750C (enExample) |
| AT (1) | ATE143002T1 (enExample) |
| AU (2) | AU655689B2 (enExample) |
| CA (1) | CA2083323A1 (enExample) |
| CZ (2) | CZ34595A3 (enExample) |
| DE (1) | DE69213892T2 (enExample) |
| DK (1) | DK0543662T3 (enExample) |
| ES (1) | ES2094308T3 (enExample) |
| FI (1) | FI925255L (enExample) |
| GR (1) | GR3021245T3 (enExample) |
| HK (1) | HK218496A (enExample) |
| HU (1) | HUT66816A (enExample) |
| IL (3) | IL110804A (enExample) |
| MX (1) | MX9206740A (enExample) |
| NO (1) | NO179246C (enExample) |
| NZ (1) | NZ245188A (enExample) |
| RU (2) | RU2095344C1 (enExample) |
| TW (2) | TW290543B (enExample) |
| ZA (1) | ZA928960B (enExample) |
Families Citing this family (57)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0915090A1 (en) * | 1992-09-10 | 1999-05-12 | Eli Lilly And Company | Compounds useful as hypoglycemic agents and for treating Alzheimer's disease |
| GB9313574D0 (en) * | 1993-07-01 | 1993-08-18 | Glaxo Group Ltd | Medicaments |
| CA2145257A1 (en) * | 1994-03-23 | 1995-09-24 | Takashi Fujita | Thiazolidine and oxazolidine derivatives, their preparation and their medical use |
| CA2146701A1 (en) * | 1994-04-11 | 1995-10-12 | Takashi Fujita | Heterocyclic compounds having anti-diabetic activity, their preparation and their use |
| WO1995033724A1 (en) * | 1994-06-09 | 1995-12-14 | Glaxo Group Limited | Phenethanolamine derivatives and their use as atypical beta-adrenoceptor agonists |
| GB9525121D0 (en) * | 1995-12-08 | 1996-02-07 | Glaxo Group Ltd | Chemical compounds |
| GB9525177D0 (en) * | 1995-12-08 | 1996-02-07 | Glaxo Group Ltd | Chemical compounds |
| EP0783888A1 (en) * | 1995-12-26 | 1997-07-16 | Sankyo Company Limited | Use of troglitazone and related thiazolidinediones in the manufacture of a medicament for the treatment and prophylaxis of osteoporosis |
| DE69625795T2 (de) * | 1996-04-09 | 2003-08-14 | Dr. Reddy's Laboratories Ltd., Hyderabad | Thiazolidinedionderivate mit antidiabetischen, hypolipidämischen und antihypertensiven Eigenschaften, Verfahren zu deren Herstellung und pharmazeutischen Zusammenstellungen, die sie enthalten |
| US5801173A (en) * | 1996-05-06 | 1998-09-01 | Dr. Reddy's Research Foundation | Heterocyclic compounds having antidiabetic, hypolipidaemic, antihypertensive properties, process for their preparation and pharmaceutical compositions containing them |
| US5889032A (en) * | 1996-05-06 | 1999-03-30 | Dr. Reddy's Research Foundation | Heterocyclic compounds having antidiabetic, hypolipidaemic, antihypertensive properties, process for their preparation and pharmaceutical compositions containing them |
| US5919782A (en) * | 1996-05-06 | 1999-07-06 | Dr. Reddy's Research Foundation | Heterocyclic compounds having antidiabetic, hypolipidaemic, antihypertensive properties, process for their preparation and pharmaceutical compositions containing them |
| ZA973850B (en) * | 1996-05-06 | 1997-12-02 | Reddy Research Foundation | Novel antidiabetic compounds having hypolipidaemic, anti-hypertensive properties, process for their preparation and pharmaceutical compositions containing them. |
| US6114526A (en) * | 1996-07-01 | 2000-09-05 | Dr. Reddy's Research Foundation | Heterocyclic compounds, process for their preparation and pharmaceutical compositions containing them and their use in the treatment of diabetes and related diseases |
| US6372750B2 (en) | 1996-07-01 | 2002-04-16 | Dr. Reddy's Research Foundation | Heterocyclic compounds, process for their preparation and pharmaceutical compounds containing them and their use in the treatment of diabetes and related diseases |
| BR9711098B1 (pt) | 1996-07-01 | 2011-10-04 | compostos heterocìclicos, processo para sua preparação e composições farmacêuticas contendo os mesmos e seu uso no tratamento de diabetes e doenças relacionadas. | |
| US5885997A (en) * | 1996-07-01 | 1999-03-23 | Dr. Reddy's Research Foundation | Heterocyclic compounds, process for their preparation and pharmaceutical compositions containing them and their use in the treatment of diabetes and related diseases |
| USRE39266E1 (en) * | 1996-07-01 | 2006-09-05 | Dr. Reddy's Laboratories, Limited | Heterocyclic compounds, process for their preparation and pharmaceutical compositions containing them and their use in the treatment of diabetes and related diseases |
| US5990169A (en) * | 1996-10-23 | 1999-11-23 | Zymogenetics, Inc. | Compositions and methods for treating bone deficit conditions |
| GB9706707D0 (en) * | 1997-04-02 | 1997-05-21 | Glaxo Group Ltd | Chemical compounds |
| JPH10338679A (ja) * | 1997-04-08 | 1998-12-22 | Mitsubishi Rayon Co Ltd | チアゾリジン誘導体の製造方法 |
| HUP9702411A2 (hu) * | 1997-12-11 | 2000-03-28 | Gyógyszerkutató Intézet Kft. | Fenoxi-alkil-amin-származékok és a vegyületeket tartalmazó antiaritmiás hatású gyógyszerkészítmények |
| GB9812709D0 (en) * | 1998-06-13 | 1998-08-12 | Glaxo Group Ltd | Chemical compounds |
| US6006419A (en) * | 1998-09-01 | 1999-12-28 | Millitech Corporation | Synthetic resin transreflector and method of making same |
| US6756360B1 (en) | 1998-12-24 | 2004-06-29 | Metabasis Therapeutics, Inc. | Combination of FBPase inhibitors and insulin sensitizers for the treatment of diabetes |
| GB9929297D0 (en) * | 1999-12-11 | 2000-02-02 | Glaxo Group Ltd | Process |
| PL357719A1 (en) * | 2000-03-17 | 2004-07-26 | Ajinomoto Co, Inc. | Drugs for complications of diabetes and neuropathy and utilization thereof |
| US7563774B2 (en) | 2000-06-29 | 2009-07-21 | Metabasis Therapeutics, Inc. | Combination of FBPase inhibitors and antidiabetic agents useful for the treatment of diabetes |
| CN1267429C (zh) * | 2000-07-13 | 2006-08-02 | 三共株式会社 | 氨基醇衍生物 |
| CN1469876A (zh) | 2000-10-20 | 2004-01-21 | �Ʒ� | α-芳基乙醇胺及其用作β-3肾上腺素能受体激动剂的用途 |
| GB0102407D0 (en) | 2001-01-31 | 2001-03-14 | Glaxo Group Ltd | Process |
| US7709677B2 (en) | 2001-01-31 | 2010-05-04 | Glaxosmithkline Llc | Process of preparing arylethanoldiamines |
| EP1383729A4 (en) * | 2001-04-05 | 2006-04-19 | Smithkline Beecham Corp | DEFORMYLASE PEPTIDE INHIBITORS |
| TWI311133B (en) * | 2001-04-20 | 2009-06-21 | Eisai R&D Man Co Ltd | Carboxylic acid derivativeand the salt thereof |
| WO2003010157A1 (en) * | 2001-07-23 | 2003-02-06 | Dr. Reddy's Research Foundation | Dioxane derivatives and a process for their preparation |
| EP1452521A4 (en) | 2001-08-17 | 2007-03-14 | Eisai R&D Man Co Ltd | CYCLIC COMPOUND AND AGONIST OF PPAR RECEPTOR |
| DOP2003000587A (es) * | 2002-02-27 | 2003-08-30 | Pfizer Prod Inc | AGONISTAS DEL RECEPTOR ß3-ADRENERGICO |
| MXPA04008298A (es) | 2002-02-27 | 2004-11-26 | Pfizer Prod Inc | Procesos e intermedios utiles en la preparacion de agonistas de receptor beta-3 adrenergico. |
| AU2003209527A1 (en) | 2002-02-27 | 2003-09-09 | Pfizer Products Inc. | Crystal forms of (r)-2-(2-(4-oxazol-4-yl-phenoxy)-ethylamino)-1-pyridin-3-yl-ethanol |
| US6864268B2 (en) | 2002-02-27 | 2005-03-08 | Pfizer Inc. | β3 adrenergic receptor agonists |
| WO2005061433A2 (en) * | 2003-12-23 | 2005-07-07 | Astellas Pharma Inc. | Aminoalcohol derivatives |
| TW200531692A (en) * | 2004-01-12 | 2005-10-01 | Theravance Inc | Aryl aniline derivatives as β2 adrenergic receptor agonists |
| EP1891971A4 (en) * | 2005-01-31 | 2010-02-03 | Ajinomoto Kk | MEDICAL COMPOSITION USING HYPERGLY CRAB MEDICAMENT TO TREAT OR TREAT GLUCOSE-INTOLERANCE, BORDERLINE DIABETES, INSULIN RESISTANCE AND HYPERINSULINEMIA |
| ES2265276B1 (es) * | 2005-05-20 | 2008-02-01 | Laboratorios Almirall S.A. | Derivados de 4-(2-amino-1-hidroxietil)fenol como agonistas del receptor beta2 adrenergico. |
| KR20100084604A (ko) | 2007-10-24 | 2010-07-27 | 쮸 시아오잉 | 감아올림 스크린 장치 |
| NZ585073A (en) | 2007-11-01 | 2012-08-31 | Howard Florey Inst | Aryloxy amine compounds and their use as sodium channel modulators |
| US9907767B2 (en) | 2010-08-03 | 2018-03-06 | Velicept Therapeutics, Inc. | Pharmaceutical compositions and the treatment of overactive bladder |
| US9522129B2 (en) | 2010-08-03 | 2016-12-20 | Velicept Therapeutics, Inc. | Pharmaceutical Combination |
| HK1245117A1 (zh) | 2014-12-03 | 2018-08-24 | Velicept Therapeutics, Inc. | 使用调节释放索拉贝隆用於下尿路症状的组合物和方法 |
| US9968531B2 (en) | 2015-08-05 | 2018-05-15 | Dupont Tate & Lyle Bio Products Company, Llc | Deodorants containing 1,3-propanediol |
| IL258856B2 (en) | 2015-10-23 | 2024-07-01 | Velicept Therapeutics Inc | Solabegron zwitterion and uses thereof |
| GB201714736D0 (en) | 2017-09-13 | 2017-10-25 | Atrogi Ab | New compounds and uses |
| GB201714745D0 (en) | 2017-09-13 | 2017-10-25 | Atrogi Ab | New compounds and uses |
| GB201714740D0 (en) | 2017-09-13 | 2017-10-25 | Atrogi Ab | New compounds and uses |
| GB201714734D0 (en) | 2017-09-13 | 2017-10-25 | Atrogi Ab | New compounds and uses |
| WO2019190172A1 (ko) | 2018-03-26 | 2019-10-03 | 주식회사 프로텍바이오 | 신규한 화합물 및 이를 포함하는 비만 또는 대사증후군의 예방 또는 치료용 약학적 조성물 |
| GB201903832D0 (en) | 2019-03-20 | 2019-05-01 | Atrogi Ab | New compounds and methods |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1200886A (en) * | 1966-09-23 | 1970-08-05 | Allen & Hanburys Ltd | Phenylaminoethanol derivatives |
| US3976783A (en) * | 1970-07-18 | 1976-08-24 | Pfizer Inc. | Method of stimulating the heart employing ureido substituted phenyl-alkanolamine, alkylamine and α-aminoalkyl ketone derivatives |
| GB1551260A (en) * | 1976-02-09 | 1979-08-30 | Allen & Hanburys Ltd | Phenylethanolamine derivatives |
| EP0006735B1 (en) * | 1978-06-28 | 1983-06-15 | Beecham Group Plc | Secondary amines, their preparation, pharmaceutical compositions containing them and their use |
| US4338333A (en) * | 1979-06-16 | 1982-07-06 | Beecham Group Limited | Ethanamine derivatives their preparation and use in pharmaceutical compositions |
| DE3061205D1 (en) * | 1979-06-16 | 1983-01-05 | Beecham Group Plc | Secondary amines, their preparation and use in pharmaceutical compositions |
| EP0025331B1 (en) * | 1979-09-06 | 1983-03-02 | Beecham Group Plc | Cinnamic acid derivatives, their preparation, and pharmaceutical compositions containing them |
| EP0099707B1 (en) * | 1982-07-16 | 1986-12-10 | Beecham Group Plc | 2-aminoethyl ether derivatives, processes for their preparation and pharmaceutical compositions containing them |
| GB8528633D0 (en) * | 1985-11-21 | 1985-12-24 | Beecham Group Plc | Compounds |
| GB8620951D0 (en) * | 1986-08-29 | 1986-10-08 | Beecham Group Plc | Compounds |
| US5194443A (en) * | 1987-09-04 | 1993-03-16 | Beecham Group P.L.C. | Compounds |
| EP0842925A1 (en) * | 1987-09-04 | 1998-05-20 | Beecham Group Plc | Substituted thiazolidinedione derivatives |
| GB8910374D0 (en) * | 1989-05-05 | 1989-06-21 | Ici Plc | Chemical compounds |
| US5037842A (en) * | 1990-06-05 | 1991-08-06 | Pfizer Inc. | Oxa- and thiazolidinedione hypoglycemic and hypocholesterolemic agents |
| GB9111426D0 (en) * | 1991-05-28 | 1991-07-17 | Ici Plc | Chemical compounds |
| TW202445B (enExample) * | 1991-07-30 | 1993-03-21 | Yamanouchi Pharma Co Ltd | |
| GB9313574D0 (en) * | 1993-07-01 | 1993-08-18 | Glaxo Group Ltd | Medicaments |
-
1992
- 1992-11-18 NO NO924440A patent/NO179246C/no not_active IP Right Cessation
- 1992-11-19 CA CA002083323A patent/CA2083323A1/en not_active Abandoned
- 1992-11-19 FI FI925255A patent/FI925255L/fi unknown
- 1992-11-19 ZA ZA928960A patent/ZA928960B/xx unknown
- 1992-11-19 NZ NZ24518892A patent/NZ245188A/en unknown
- 1992-11-19 CZ CZ95345A patent/CZ34595A3/cs not_active IP Right Cessation
- 1992-11-19 RU RU92004433/04A patent/RU2095344C1/ru not_active IP Right Cessation
- 1992-11-19 TW TW083108161A patent/TW290543B/zh active
- 1992-11-19 CZ CS923436A patent/CZ280328B6/cs not_active IP Right Cessation
- 1992-11-20 DE DE69213892T patent/DE69213892T2/de not_active Expired - Fee Related
- 1992-11-20 AU AU28493/92A patent/AU655689B2/en not_active Ceased
- 1992-11-20 HU HU9203638A patent/HUT66816A/hu unknown
- 1992-11-20 DK DK92310625.6T patent/DK0543662T3/da active
- 1992-11-20 CN CN94118086A patent/CN1033750C/zh not_active Expired - Fee Related
- 1992-11-20 CN CN92114826A patent/CN1034497C/zh not_active Expired - Fee Related
- 1992-11-20 IL IL110804A patent/IL110804A/xx not_active IP Right Cessation
- 1992-11-20 JP JP4311975A patent/JP2654323B2/ja not_active Expired - Lifetime
- 1992-11-20 KR KR1019920021899A patent/KR0149679B1/ko not_active Expired - Fee Related
- 1992-11-20 ES ES92310625T patent/ES2094308T3/es not_active Expired - Lifetime
- 1992-11-20 IL IL103825A patent/IL103825A/en not_active IP Right Cessation
- 1992-11-20 AT AT92310625T patent/ATE143002T1/de not_active IP Right Cessation
- 1992-11-20 EP EP92310625A patent/EP0543662B1/en not_active Expired - Lifetime
- 1992-11-23 MX MX9206740A patent/MX9206740A/es not_active IP Right Cessation
-
1993
- 1993-11-19 TW TW081109265A patent/TW233294B/zh active
-
1994
- 1994-07-29 US US08/282,579 patent/US5977374A/en not_active Expired - Fee Related
- 1994-08-29 IL IL11080494A patent/IL110804A0/xx unknown
- 1994-09-30 RU RU94036004/04A patent/RU2081113C1/ru not_active IP Right Cessation
- 1994-10-27 AU AU77518/94A patent/AU670007B2/en not_active Ceased
-
1995
- 1995-01-26 US US08/378,879 patent/US5576340A/en not_active Expired - Fee Related
- 1995-06-07 US US08/478,610 patent/US5635534A/en not_active Expired - Fee Related
-
1996
- 1996-06-21 CN CN96107153A patent/CN1054846C/zh not_active Expired - Fee Related
- 1996-10-03 GR GR960402595T patent/GR3021245T3/el unknown
- 1996-12-19 HK HK218496A patent/HK218496A/en not_active IP Right Cessation
-
1997
- 1997-01-16 JP JP9005361A patent/JP2991985B2/ja not_active Expired - Fee Related
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69213892T2 (de) | Aromatische Aminoalkoholderivate mit antidiabetischer und Antiobesitäts-Wirkung, ihre Herstellung und therapeutische Verwendung | |
| DE69326736T2 (de) | Oxazolidin-Derivate mit Antidiabetika und Anti-Fettleibigkeit-Eigenschaften, ihre Herstellung und therapeutische Verwendung | |
| DE3881408T2 (de) | Thiazolidinon-Derivate, ihre Herstellung und ihre Verwendung. | |
| DE69723869T2 (de) | Heterozyklische verbindungen, verfahren zu ihrer herstellung, pharmazeutische zusammensetzungen die diese enthalten und ihre anwendung in der behandlung von diabetis und verwandten krankheiten | |
| DE69616151T2 (de) | Benzimidazolderivate, deren Herstellung und deren therapeutische Anwendung | |
| DE60020381T2 (de) | Substituierte benzylthiazolidin-2,4-dion-derivate | |
| DE3875073T2 (de) | 3-(4(1-substituierte-4-piperazinyl)butyl)-4-thiazolidinone, verfahren zu deren herstellung und ihre anwendung als arzneimittel. | |
| DE69204041T2 (de) | Thiazolidinverbindeungen, deren Herstellung und therapeutische Verwendung. | |
| DE69225123T2 (de) | Thiazolidinederivate, die eine Quinone-Gruppe enthalten, ihre Herstellung und therapeutische Anwendung | |
| DE69032537T2 (de) | Verbindungen zur Behandlung von Bauchentzündungen | |
| DE69419662T2 (de) | Verfahren zur Herstellung von Benzyliden-Derivaten | |
| EP0239815A1 (de) | Substituierte Thiazole und Oxazole, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung | |
| DE69024843T2 (de) | Rhodanin-Derivate und pharmazeutische Zusammensetzungen | |
| DE69102816T2 (de) | Piperdinyloxy- und Chinindidinyloxy- isoxazol- Derivate, ihre Herstellung und ihre therapeutische Verwendung. | |
| DE3613573A1 (de) | Cyclopentylether und ihre herstellung sowie pharmazeutische formulierung | |
| DD283603A5 (de) | Verfahren zur herstellung von substituierten hydroxylaminen | |
| DE69625795T2 (de) | Thiazolidinedionderivate mit antidiabetischen, hypolipidämischen und antihypertensiven Eigenschaften, Verfahren zu deren Herstellung und pharmazeutischen Zusammenstellungen, die sie enthalten | |
| DE69411003T2 (de) | Cycloalkylhydroxyharnstoffe und ihre verwendung als lipoxy-genase-inhibitoren | |
| DE69600329T2 (de) | Benzothiazol-Derivate | |
| WO1994022845A1 (fr) | Compose a base de benzothiazole, procede de production et utilisation | |
| EP0505467A1 (en) | Pharmacologically active amide carboxylate derivatives | |
| DE3888394T2 (de) | Phenolische Thioäther, Sulfoxide und Disulfide als Hemmstoffe der 5-Lipoxigenase. | |
| EP0549600A1 (en) | 5-trifluoroacylamino-2-aryl oxazoles | |
| DE69622415T2 (de) | 12H-Dibenzo[d,g][1,3]dioxocin Derivate | |
| DE69315069T2 (de) | Phenylsubstituierte cycloalkyl-hydroxyharnstoffderivate als lipoxygenase-hemmer |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |