DE6610255U - Verriegelungs- und auswurfvorrichtung fuer tonbandkassetten. - Google Patents
Verriegelungs- und auswurfvorrichtung fuer tonbandkassetten.Info
- Publication number
- DE6610255U DE6610255U DE6610255U DE6610255U DE6610255U DE 6610255 U DE6610255 U DE 6610255U DE 6610255 U DE6610255 U DE 6610255U DE 6610255 U DE6610255 U DE 6610255U DE 6610255 U DE6610255 U DE 6610255U
- Authority
- DE
- Germany
- Prior art keywords
- tape
- spring
- cassette
- tape recorder
- coupling arrangement
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000008878 coupling Effects 0.000 claims description 16
- 238000010168 coupling process Methods 0.000 claims description 16
- 238000005859 coupling reaction Methods 0.000 claims description 16
- 239000004576 sand Substances 0.000 description 2
- 241001633942 Dais Species 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 210000002816 gill Anatomy 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B15/00—Driving, starting or stopping record carriers of filamentary or web form; Driving both such record carriers and heads; Guiding such record carriers or containers therefor; Control thereof; Control of operating function
- G11B15/18—Driving; Starting; Stopping; Arrangements for control or regulation thereof
- G11B15/1808—Driving of both record carrier and head
- G11B15/1875—Driving of both record carrier and head adaptations for special effects or editing
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B15/00—Driving, starting or stopping record carriers of filamentary or web form; Driving both such record carriers and heads; Guiding such record carriers or containers therefor; Control thereof; Control of operating function
- G11B15/02—Control of operating function, e.g. switching from recording to reproducing
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B15/00—Driving, starting or stopping record carriers of filamentary or web form; Driving both such record carriers and heads; Guiding such record carriers or containers therefor; Control thereof; Control of operating function
- G11B15/675—Guiding containers, e.g. loading, ejecting cassettes
Landscapes
- Engineering & Computer Science (AREA)
- Signal Processing (AREA)
- Feeding And Guiding Record Carriers (AREA)
- Automatic Tape Cassette Changers (AREA)
- Fittings On The Vehicle Exterior For Carrying Loads, And Devices For Holding Or Mounting Articles (AREA)
- Mechanical Control Devices (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US62303267A | 1967-03-14 | 1967-03-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE6610255U true DE6610255U (de) | 1973-07-19 |
Family
ID=24496496
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681622965 Granted DE1622965B2 (de) | 1967-03-14 | 1968-03-09 | Verriegelungs- und auswurfvorrichtung fuer tonbandkassetten |
| DE6610255U Expired DE6610255U (de) | 1967-03-14 | 1968-03-09 | Verriegelungs- und auswurfvorrichtung fuer tonbandkassetten. |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681622965 Granted DE1622965B2 (de) | 1967-03-14 | 1968-03-09 | Verriegelungs- und auswurfvorrichtung fuer tonbandkassetten |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3485500A (cg-RX-API-DMAC10.html) |
| DE (2) | DE1622965B2 (cg-RX-API-DMAC10.html) |
| ES (1) | ES351555A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1213192A (cg-RX-API-DMAC10.html) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2020175A1 (cg-RX-API-DMAC10.html) * | 1968-10-09 | 1970-07-10 | Autovox Spa | |
| US3633922A (en) * | 1968-11-11 | 1972-01-11 | Pioneer Electronic Corp | Interlocking mechanism for holding a tape cartridge in inserted position |
| US3617065A (en) * | 1969-01-23 | 1971-11-02 | Iit Res Inst | Cartridge transducer machine and cartridge therefor |
| US3669456A (en) * | 1969-02-21 | 1972-06-13 | Beltek Corp | Cassette mounting and dismounting device |
| US3599985A (en) * | 1969-03-05 | 1971-08-17 | Motorola Inc | Cartridge locking and ejector mechanism |
| US3620429A (en) * | 1969-04-07 | 1971-11-16 | Matsushita Electric Industrial Co Ltd | Device for detecting a tape end in a tape recorder |
| US3572723A (en) * | 1969-10-31 | 1971-03-30 | Sylvania Electric Prod | Tape cartridge system |
| US3603596A (en) * | 1969-11-03 | 1971-09-07 | Kaiser Aluminium Chem Corp | Cartridge-retaining mechanism for tape decks and the like |
| JPS5020664Y1 (cg-RX-API-DMAC10.html) * | 1970-08-01 | 1975-06-23 | ||
| US3817539A (en) * | 1970-12-04 | 1974-06-18 | Matsushita Electric Industrial Co Ltd | Magnetic recording and reproducing apparatus with an automatic cartridge remover |
| US3716243A (en) * | 1971-01-18 | 1973-02-13 | Motorola Inc | Cartridge locking mechanism |
| US3684299A (en) * | 1971-02-08 | 1972-08-15 | Motorola Inc | Cartridge locking and ejector mechanism |
| US3684300A (en) * | 1971-02-11 | 1972-08-15 | Motorola Inc | Cartridge eject and tape head indexing actuator mechanism |
| US3679283A (en) * | 1971-03-10 | 1972-07-25 | Ibm | Cartridge lock actuator |
| US3747940A (en) * | 1971-03-15 | 1973-07-24 | Motorola Inc | Tape cartridge ejection mechanism |
| US3805289A (en) * | 1971-03-30 | 1974-04-16 | Gen Motors Corp | Tape cartridge retaining and ejecting mechanism |
| US3730535A (en) * | 1971-04-23 | 1973-05-01 | Motorola Inc | Cartridge locking mechanism |
| JPS5111961Y2 (cg-RX-API-DMAC10.html) * | 1971-04-30 | 1976-03-31 | ||
| US3869717A (en) * | 1971-06-18 | 1975-03-04 | Matsushita Electric Industrial Co Ltd | Magnetic recording and reproducing apparatus for multi-channel endless tape |
| US3759530A (en) * | 1972-01-20 | 1973-09-18 | Alps Motorola | Record mechanism for cartridge tape player-recorder |
| US3800320A (en) * | 1972-01-20 | 1974-03-26 | Alps Motorola | Temporary stop device for cartridge tape player-recorder |
| US3764147A (en) * | 1972-04-12 | 1973-10-09 | Alps Motorola | Cartridge eject actuating circuitry for multi-track tape cartridge player |
| US3735989A (en) * | 1972-05-12 | 1973-05-29 | Motorola Inc | Cartridge locking mechanism with adjustable tension |
| US3893184A (en) * | 1972-05-25 | 1975-07-01 | Pioneer Electronic Corp | Tape cartridge ejection mechanism |
| US3779561A (en) * | 1972-11-08 | 1973-12-18 | Motorola Inc | Cartridge locking mechanism for a tape player |
| JPS52363B2 (cg-RX-API-DMAC10.html) * | 1972-11-21 | 1977-01-07 | ||
| US3867721A (en) * | 1973-01-30 | 1975-02-18 | Automatic Radio Mfg Co | Cartridge eject mechanism for tape players and the like |
| US3945040A (en) * | 1974-02-15 | 1976-03-16 | Staar Development Company, S.A. | Push-push locking and release mechanism for tape cartridge players |
| US3916442A (en) * | 1974-05-28 | 1975-10-28 | Motorola Inc | Mechanical cartridge eject mechanism |
| US3972073A (en) * | 1974-12-23 | 1976-07-27 | Motorola, Inc. | Automatic tape cartridge ejection mechanism for multitrack cartridge players |
| US3984871A (en) * | 1975-03-14 | 1976-10-05 | Motorola, Inc. | Tape cartridge release assembly |
| JPS5219511A (en) * | 1975-08-05 | 1977-02-14 | Tanashin Denki Co | Auto-eject device for tape recorder |
| US4303955A (en) * | 1980-02-25 | 1981-12-01 | North Atlantic Industries, Inc. | Apparatus for securing and releasing tape cartridges from tape decks |
| JPS5810266U (ja) * | 1981-07-13 | 1983-01-22 | オリンパス光学工業株式会社 | カセツトテ−プレコ−ダのカセツトエジエクト機構 |
| DE3312136C1 (de) * | 1983-04-02 | 1984-09-06 | Philips Patentverwaltung Gmbh, 2000 Hamburg | Vorrichtung zum Einführen und Auswerfen einer Magnetbandkassette in einem Magnetbandkassettengerät |
| US4623945A (en) * | 1983-04-02 | 1986-11-18 | U.S. Philips Corporation | Automatic insertion/ejection linkage for a magnetic-tape-cassette apparatus |
| JPS60229265A (ja) * | 1984-04-26 | 1985-11-14 | Tanashin Denki Co | カセツト式テ−プレコ−ダ |
| JPH04146557A (ja) * | 1990-10-05 | 1992-05-20 | Tanashin Denki Co | テープレコーダのカセット挿脱装置 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3009024A (en) * | 1954-07-19 | 1961-11-14 | Toledo Trust Company | Magnetic recorder |
| US2911215A (en) * | 1955-04-11 | 1959-11-03 | Browning Res Corp | Tape feeding apparatus for magnetic sound recording and reproducing mechanisms |
| US2778880A (en) * | 1955-08-04 | 1957-01-22 | Toledo Trust Company | Endless magnetic tape cartridge and recording play-back instrument mounting same |
| US2864611A (en) * | 1957-10-14 | 1958-12-16 | Packard Bell Electronics Corp | Recording and reproducing assembly |
| US3083269A (en) * | 1961-04-14 | 1963-03-26 | Rene J Gaubert | Programmed tape apparatus |
-
1967
- 1967-03-14 US US623032A patent/US3485500A/en not_active Expired - Lifetime
-
1968
- 1968-02-22 GB GB8572/68A patent/GB1213192A/en not_active Expired
- 1968-03-09 DE DE19681622965 patent/DE1622965B2/de active Granted
- 1968-03-09 DE DE6610255U patent/DE6610255U/de not_active Expired
- 1968-03-13 ES ES351555A patent/ES351555A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES351555A1 (es) | 1969-12-01 |
| DE1622965A1 (de) | 1970-09-10 |
| DE1622965B2 (de) | 1972-09-21 |
| US3485500A (en) | 1969-12-23 |
| GB1213192A (en) | 1970-11-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE6610255U (de) | Verriegelungs- und auswurfvorrichtung fuer tonbandkassetten. | |
| DE1622965C (cg-RX-API-DMAC10.html) | ||
| DE1207653B (de) | Tonbandgeraet | |
| DE1961508C3 (de) | Magnetisches Aufnahme- und Wiedergabegerät | |
| EP0121283B1 (de) | Vorrichtung zum Einführen und Auswerfen einer Magnetbandkassette in einem Magnetbandkassettengerät | |
| DE2658603C3 (de) | Aufnahme- und Wiedergabegerät für Bandkassette mit Mitteln zur Verhinderung unbeabsichtigten Löschens | |
| DE1237353B (de) | Magnettongeraet | |
| DE3012489C2 (de) | Kassettenrekorder | |
| DE2062649C3 (de) | Kassetten Tonbandgerat | |
| DE2604045A1 (de) | Tonbandgeraet | |
| DE69028451T2 (de) | Plattenantriebsgerät | |
| DE1932804A1 (de) | Miniatur-Kasssettentonbandgeraet | |
| DE2206100C3 (de) | Tonkopfeinsteil- und Kassettenauswerfvorrichtung | |
| DE2345055B2 (de) | Sicherheitsschaltvorrichtung fuer ein aufzeichnungs- und wiedergabegeraet | |
| DE4228434C2 (de) | Kassettenladevorrichtung | |
| DE2231930C3 (de) | Kassettenauswerfvorrichtung für Kassettenbandgeräte | |
| DE2040565B2 (de) | Einrichtung zur verhinderung einer unbeabsichtigten loesung von auf einem magnetband aufgezeichneten informationen | |
| DE3107923C2 (cg-RX-API-DMAC10.html) | ||
| DE3011951C2 (de) | Steuervorrichtung für einen Schallplattenspieler | |
| DE2545211C3 (de) | Gerät zum Abspielen- und/oder Bespielen einer Tonbandkassette | |
| DE3347624C2 (cg-RX-API-DMAC10.html) | ||
| AT390336B (de) | Aufzeichnungs- und wiedergabegeraet fuer einen antreibbaren aufzeichnungstraeger | |
| DE2247494C3 (de) | Magnetisches Tonaufzeichnungs- und Wiedergabegerät für Endlos - Bandkassetten | |
| DE1572415A1 (de) | Magnettonbandgeraet | |
| DE2623707B2 (de) | Aufnahme- und Wiedergabe-Magnetbandgerät |