DE623650C - - Google Patents
Info
- Publication number
- DE623650C DE623650C DENDAT623650D DE623650DA DE623650C DE 623650 C DE623650 C DE 623650C DE NDAT623650 D DENDAT623650 D DE NDAT623650D DE 623650D A DE623650D A DE 623650DA DE 623650 C DE623650 C DE 623650C
- Authority
- DE
- Germany
- Prior art keywords
- weight
- parts
- amino
- sodium
- diazotized
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000000987 azo dye Substances 0.000 claims description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 150000001555 benzenes Chemical class 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 150000002790 naphthalenes Chemical class 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 8
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 8
- 229960004889 salicylic acid Drugs 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000003776 cleavage reaction Methods 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 239000000975 dye Substances 0.000 description 6
- 230000007017 scission Effects 0.000 description 6
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 6
- WFNLHDJJZSJARK-UHFFFAOYSA-N 2-chloro-6-methylaniline Chemical compound CC1=CC=CC(Cl)=C1N WFNLHDJJZSJARK-UHFFFAOYSA-N 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- 239000002253 acid Substances 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 2
- JBCUKQQIWSWEOK-UHFFFAOYSA-N 2-(benzenesulfonyl)aniline Chemical compound NC1=CC=CC=C1S(=O)(=O)C1=CC=CC=C1 JBCUKQQIWSWEOK-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 238000006418 Brown reaction Methods 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 2
- JEHKKBHWRAXMCH-UHFFFAOYSA-N benzenesulfinic acid Chemical compound O[S@@](=O)C1=CC=CC=C1 JEHKKBHWRAXMCH-UHFFFAOYSA-N 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 235000011121 sodium hydroxide Nutrition 0.000 description 2
- KQCMTOWTPBNWDB-UHFFFAOYSA-N 2,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C=C1Cl KQCMTOWTPBNWDB-UHFFFAOYSA-N 0.000 description 1
- SVDAJTZKOJZQFC-UHFFFAOYSA-N 2,4-dichlorobenzenediazonium Chemical compound ClC1=CC=C([N+]#N)C(Cl)=C1 SVDAJTZKOJZQFC-UHFFFAOYSA-N 0.000 description 1
- AVYGCQXNNJPXSS-UHFFFAOYSA-N 2,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC=C1Cl AVYGCQXNNJPXSS-UHFFFAOYSA-N 0.000 description 1
- JDMFXJULNGEPOI-UHFFFAOYSA-N 2,6-dichloroaniline Chemical compound NC1=C(Cl)C=CC=C1Cl JDMFXJULNGEPOI-UHFFFAOYSA-N 0.000 description 1
- WQFIQFARFXHKFG-UHFFFAOYSA-N 2-[(2-aminophenyl)methylsulfonylmethyl]aniline Chemical compound NC1=CC=CC=C1CS(=O)(=O)CC1=CC=CC=C1N WQFIQFARFXHKFG-UHFFFAOYSA-N 0.000 description 1
- VWEINLSNBCFDKI-UHFFFAOYSA-N 2-[[(2-amino-3-methylphenyl)-phenylmethyl]sulfonyl-phenylmethyl]-6-methylaniline Chemical compound CC=1C(=C(C=CC=1)C(C1=CC=CC=C1)S(=O)(=O)C(C1=CC=CC=C1)C1=C(C(=CC=C1)C)N)N VWEINLSNBCFDKI-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- AOPBDRUWRLBSDB-UHFFFAOYSA-N 2-bromoaniline Chemical compound NC1=CC=CC=C1Br AOPBDRUWRLBSDB-UHFFFAOYSA-N 0.000 description 1
- LNEVUNYUJNORRV-UHFFFAOYSA-N 2-chloro-4-methoxyaniline Chemical compound COC1=CC=C(N)C(Cl)=C1 LNEVUNYUJNORRV-UHFFFAOYSA-N 0.000 description 1
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 1
- DILXLMRYFWFBGR-UHFFFAOYSA-N 2-formylbenzene-1,4-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(S(O)(=O)=O)C(C=O)=C1 DILXLMRYFWFBGR-UHFFFAOYSA-N 0.000 description 1
- GJAKRMFICWCSQW-UHFFFAOYSA-N 4-chlorobenzenesulfinic acid;sodium Chemical compound [Na].OS(=O)C1=CC=C(Cl)C=C1 GJAKRMFICWCSQW-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- KZTYYGOKRVBIMI-UHFFFAOYSA-N S-phenyl benzenesulfonothioate Natural products C=1C=CC=CC=1S(=O)(=O)C1=CC=CC=C1 KZTYYGOKRVBIMI-UHFFFAOYSA-N 0.000 description 1
- -1 acetyl compound Chemical class 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- NVSONFIVLCXXDH-UHFFFAOYSA-N benzylsulfinic acid Chemical compound O[S@@](=O)CC1=CC=CC=C1 NVSONFIVLCXXDH-UHFFFAOYSA-N 0.000 description 1
- 239000001049 brown dye Substances 0.000 description 1
- 239000012295 chemical reaction liquid Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- JFXAUUFCZJYLJF-UHFFFAOYSA-M sodium;4-chlorobenzenesulfinate Chemical compound [Na+].[O-]S(=O)C1=CC=C(Cl)C=C1 JFXAUUFCZJYLJF-UHFFFAOYSA-M 0.000 description 1
- CHLCPTJLUJHDBO-UHFFFAOYSA-M sodium;benzenesulfinate Chemical compound [Na+].[O-]S(=O)C1=CC=CC=C1 CHLCPTJLUJHDBO-UHFFFAOYSA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000003457 sulfones Chemical group 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Landscapes
- Color Printing (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
- Coloring (AREA)
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE623650C true DE623650C (cg-RX-API-DMAC10.html) |
Family
ID=576611
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT623650D Active DE623650C (cg-RX-API-DMAC10.html) |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE623650C (cg-RX-API-DMAC10.html) |
-
0
- DE DENDAT623650D patent/DE623650C/de active Active
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE623650C (cg-RX-API-DMAC10.html) | ||
| DE2855427A1 (de) | Kontinuierliches reduktionsverfahren | |
| DE511468C (de) | Verfahren zur Darstellung von 5-Chlor-2-amino-1-methoxybenzol | |
| DE1220952B (de) | Verfahren zur Herstellung von cyclischen Azofarbstoffen | |
| DE848979C (de) | Verfahren zur Herstellung chromhaltiger Monoazofarbstoffe | |
| DE484360C (de) | Verfahren zur Darstellung von organischen Rhodanverbindungen | |
| US1936721A (en) | Manufacture of ortho-nitro-phenyl-sulphones | |
| CH677303B5 (cg-RX-API-DMAC10.html) | ||
| DE870302C (de) | Verfahren zur Herstellung chromhaltiger Monoazofarbstoffe | |
| DE3939966A1 (de) | Azofarbstoffe und verfahren zur herstellung von (5-amino-2-(2-hydroxyethylamino)phenyl)(2-hydroxyethyl)-sulfon | |
| DE74111C (de) | Verfahren zur Darstellung von Amidophenol- und Amidokresolsulfosäure | |
| DE521724C (de) | Verfahren zur Herstellung von Aminoaldehydverbindungen | |
| EP0534314B1 (de) | Verfahren zur Herstellung von Nitrobenzophenonen sowie färbestabile Modifikation eines Benzophenonazopyridonfarbstoffs | |
| DE824493C (de) | Verfahren zur Herstellung von Anthrachinonderivaten | |
| DE924694C (de) | Verfahren zur Herstellung von ª‡-(o-Aminoaryloxy)-fettsaeuren bzw. ihrer Salze | |
| DE832648C (de) | Verfahren zur Herstellung chromhaltiger Monoazofarbstoffe | |
| DE2019427A1 (de) | 1-Arylamino-2-hydroxy-anthrachinone und Verfahren zu ihrer Herstellung | |
| DE708379C (de) | Verfahren zur Herstellung von wasserunloeslichen Azofarbstoffen | |
| DE623651C (cg-RX-API-DMAC10.html) | ||
| DE867856C (de) | Verfahren zur Herstellung von Aminogruppen enthaltenden Diaryldisulfonimiden | |
| DE582844C (de) | Verfahren zur Darstellung von p-Aminodiarylen | |
| DE370854C (de) | Verfahren zur Darstellung von schwefel- und stickstoffhaltigen Kondensationsprodukten der aromatischen Reihe | |
| DE491223C (de) | Verfahren zur Darstellung von schwefelhaltigen Verbindungen der Benzolreihe | |
| DE133686C (cg-RX-API-DMAC10.html) | ||
| US796443A (en) | Red-violet sulfur dye and process of making same. |