DE60221866T2 - 2-PHENYL BENZIMIDAZOLE UND IMIDAZO-i4,5ö-PYRIDINE ALS CDS1/CHK2-INHIBITOREN UND ADJUVANTIEN IN DER CHEMOTHERAPIE ODER STRAHLUNGSTHERAPIE ZUR BEHANDLUNG VON KREBS - Google Patents
2-PHENYL BENZIMIDAZOLE UND IMIDAZO-i4,5ö-PYRIDINE ALS CDS1/CHK2-INHIBITOREN UND ADJUVANTIEN IN DER CHEMOTHERAPIE ODER STRAHLUNGSTHERAPIE ZUR BEHANDLUNG VON KREBS Download PDFInfo
- Publication number
- DE60221866T2 DE60221866T2 DE60221866T DE60221866T DE60221866T2 DE 60221866 T2 DE60221866 T2 DE 60221866T2 DE 60221866 T DE60221866 T DE 60221866T DE 60221866 T DE60221866 T DE 60221866T DE 60221866 T2 DE60221866 T2 DE 60221866T2
- Authority
- DE
- Germany
- Prior art keywords
- phenyl
- benzoimidazole
- carboxamide
- chloro
- carboxylic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 206010028980 Neoplasm Diseases 0.000 title claims abstract description 45
- 238000011282 treatment Methods 0.000 title claims abstract description 31
- 201000011510 cancer Diseases 0.000 title claims abstract description 27
- 239000003112 inhibitor Substances 0.000 title abstract description 5
- 238000002512 chemotherapy Methods 0.000 title abstract 2
- 238000001959 radiotherapy Methods 0.000 title abstract 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 title description 13
- 102100031075 Serine/threonine-protein kinase Chk2 Human genes 0.000 title description 3
- 101000777277 Homo sapiens Serine/threonine-protein kinase Chk2 Proteins 0.000 title description 2
- DWYHDSLIWMUSOO-UHFFFAOYSA-N 2-phenyl-1h-benzimidazole Chemical compound C1=CC=CC=C1C1=NC2=CC=CC=C2N1 DWYHDSLIWMUSOO-UHFFFAOYSA-N 0.000 title 1
- 101710178747 Phosphatidate cytidylyltransferase 1 Proteins 0.000 title 1
- -1 -SCF 3 Chemical group 0.000 claims description 279
- 150000001875 compounds Chemical class 0.000 claims description 211
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 51
- 125000000217 alkyl group Chemical group 0.000 claims description 39
- 229910052799 carbon Inorganic materials 0.000 claims description 38
- 125000003118 aryl group Chemical group 0.000 claims description 28
- 229910052757 nitrogen Inorganic materials 0.000 claims description 26
- 150000001721 carbon Chemical group 0.000 claims description 22
- 229910052739 hydrogen Inorganic materials 0.000 claims description 22
- 125000004432 carbon atom Chemical group C* 0.000 claims description 20
- 150000001408 amides Chemical class 0.000 claims description 16
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 16
- 150000003839 salts Chemical class 0.000 claims description 15
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 14
- 229910052727 yttrium Inorganic materials 0.000 claims description 14
- 229910052760 oxygen Inorganic materials 0.000 claims description 13
- 125000004076 pyridyl group Chemical group 0.000 claims description 12
- 229910052717 sulfur Inorganic materials 0.000 claims description 12
- 150000002148 esters Chemical class 0.000 claims description 11
- 125000002950 monocyclic group Chemical group 0.000 claims description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 10
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 claims description 10
- 125000002541 furyl group Chemical group 0.000 claims description 10
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 10
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 9
- 125000001544 thienyl group Chemical group 0.000 claims description 9
- OFXZKDLRVIQUDZ-UHFFFAOYSA-N 2-[4-(4-methoxyphenyl)sulfanylphenyl]-3h-benzimidazole-5-carboxamide Chemical compound C1=CC(OC)=CC=C1SC1=CC=C(C=2NC3=CC=C(C=C3N=2)C(N)=O)C=C1 OFXZKDLRVIQUDZ-UHFFFAOYSA-N 0.000 claims description 8
- 125000002883 imidazolyl group Chemical group 0.000 claims description 8
- JXDYKVIHCLTXOP-UHFFFAOYSA-N isatin Chemical compound C1=CC=C2C(=O)C(=O)NC2=C1 JXDYKVIHCLTXOP-UHFFFAOYSA-N 0.000 claims description 8
- 125000000335 thiazolyl group Chemical group 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- WJJMNDUMQPNECX-UHFFFAOYSA-N dipicolinic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 claims description 7
- 150000002430 hydrocarbons Chemical group 0.000 claims description 7
- 125000001786 isothiazolyl group Chemical group 0.000 claims description 7
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 7
- 125000002971 oxazolyl group Chemical group 0.000 claims description 7
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 7
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 7
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 7
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 7
- 125000001424 substituent group Chemical group 0.000 claims description 7
- UXGJAOIJSROTTN-UHFFFAOYSA-N 2-[4-(4-chlorophenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N1C2=CC(C(=O)N)=CC=C2N=C1C(C=C1)=CC=C1OC1=CC=C(Cl)C=C1 UXGJAOIJSROTTN-UHFFFAOYSA-N 0.000 claims description 6
- IYDLNJYJAXUZOJ-UHFFFAOYSA-N 2-[4-(4-chlorophenoxy)phenyl]-3h-benzimidazole-5-carboxylic acid Chemical compound N=1C2=CC(C(=O)O)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C(Cl)C=C1 IYDLNJYJAXUZOJ-UHFFFAOYSA-N 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 6
- ZVKFEOMYLFFRRO-UHFFFAOYSA-N 2-[4-(4-chlorophenyl)sulfonylphenyl]-3h-benzimidazole-5-carboxylic acid Chemical compound N=1C2=CC(C(=O)O)=CC=C2NC=1C(C=C1)=CC=C1S(=O)(=O)C1=CC=C(Cl)C=C1 ZVKFEOMYLFFRRO-UHFFFAOYSA-N 0.000 claims description 5
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 5
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims description 5
- 239000003814 drug Substances 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- QDKWLJJOYIFEBS-UHFFFAOYSA-N 1-fluoro-4-$l^{1}-oxidanylbenzene Chemical group [O]C1=CC=C(F)C=C1 QDKWLJJOYIFEBS-UHFFFAOYSA-N 0.000 claims description 4
- OCZLENVYJYOFND-UHFFFAOYSA-N 2-[4-(3,4-dichlorophenoxy)phenyl]-1h-imidazo[4,5-b]pyridine-5-carboxamide Chemical compound N=1C2=NC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C(Cl)C(Cl)=C1 OCZLENVYJYOFND-UHFFFAOYSA-N 0.000 claims description 4
- GGGHAUOZPNLVBZ-UHFFFAOYSA-N 2-[4-(4-bromo-3-methoxyphenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound C1=C(Br)C(OC)=CC(OC=2C=CC(=CC=2)C=2NC3=CC=C(C=C3N=2)C(N)=O)=C1 GGGHAUOZPNLVBZ-UHFFFAOYSA-N 0.000 claims description 4
- QVTSHHGQQUXMMU-UHFFFAOYSA-N 2-[4-(4-chlorophenyl)sulfinylphenyl]-3h-benzimidazole-5-carboxylic acid Chemical compound N=1C2=CC(C(=O)O)=CC=C2NC=1C(C=C1)=CC=C1S(=O)C1=CC=C(Cl)C=C1 QVTSHHGQQUXMMU-UHFFFAOYSA-N 0.000 claims description 4
- OEVNSTIIQXLQST-UHFFFAOYSA-N 2-[4-(4-methoxyphenoxy)phenyl]-3h-benzimidazole-5-carboxylic acid Chemical compound C1=CC(OC)=CC=C1OC1=CC=C(C=2NC3=CC=C(C=C3N=2)C(O)=O)C=C1 OEVNSTIIQXLQST-UHFFFAOYSA-N 0.000 claims description 4
- XCICTQGKGKMDPL-UHFFFAOYSA-N 2-[4-(4-phenylpiperazin-1-yl)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1N(CC1)CCN1C1=CC=CC=C1 XCICTQGKGKMDPL-UHFFFAOYSA-N 0.000 claims description 4
- DBXRQSUMLUDDFF-UHFFFAOYSA-N 2-[4-(phenylcarbamoyl)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1C(=O)NC1=CC=CC=C1 DBXRQSUMLUDDFF-UHFFFAOYSA-N 0.000 claims description 4
- DZICGNYWCKQHLC-UHFFFAOYSA-N 2-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1S(=O)(=O)NC1=CC=C(Cl)C(Cl)=C1 DZICGNYWCKQHLC-UHFFFAOYSA-N 0.000 claims description 4
- KQWNAIXXEHWAEW-UHFFFAOYSA-N 2-[4-[(3,4-dichlorophenyl)sulfonylamino]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C(Cl)=C1 KQWNAIXXEHWAEW-UHFFFAOYSA-N 0.000 claims description 4
- KHJVRUYUSFNQOV-UHFFFAOYSA-N 2-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1S(=O)(=O)NC1=CC=C(Cl)C=C1 KHJVRUYUSFNQOV-UHFFFAOYSA-N 0.000 claims description 4
- MXWLUBDXXFDAMW-UHFFFAOYSA-N 2-[4-[4-(4-fluorophenyl)piperazin-1-yl]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1N(CC1)CCN1C1=CC=C(F)C=C1 MXWLUBDXXFDAMW-UHFFFAOYSA-N 0.000 claims description 4
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 4
- YYFLDZZDOUDZQM-UHFFFAOYSA-N 3-[1-[[4-(3-phenylquinolin-2-yl)phenyl]methyl]piperidin-4-yl]-1h-benzimidazol-2-one Chemical compound O=C1NC2=CC=CC=C2N1C(CC1)CCN1CC(C=C1)=CC=C1C1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 YYFLDZZDOUDZQM-UHFFFAOYSA-N 0.000 claims description 4
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 claims description 4
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims description 4
- PQEQTUGNXSXNOM-UHFFFAOYSA-N 6-chloro-2-[4-(3,4-dichlorophenoxy)phenyl]-1h-benzimidazole-5-carboxamide Chemical compound N1C=2C=C(Cl)C(C(=O)N)=CC=2N=C1C(C=C1)=CC=C1OC1=CC=C(Cl)C(Cl)=C1 PQEQTUGNXSXNOM-UHFFFAOYSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 4
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 claims description 4
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 claims description 4
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical compound C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 claims description 3
- PJGNWTVDWTYPDG-UHFFFAOYSA-N 2-(4-naphthalen-2-yloxyphenyl)-3h-benzimidazole-5-carboxamide Chemical compound C1=CC=CC2=CC(OC3=CC=C(C=C3)C=3NC4=CC=C(C=C4N=3)C(=O)N)=CC=C21 PJGNWTVDWTYPDG-UHFFFAOYSA-N 0.000 claims description 3
- FYJXNYHANMMZPJ-UHFFFAOYSA-N 2-(4-naphthalen-2-yloxyphenyl)-3h-benzimidazole-5-sulfonamide Chemical compound C1=CC=CC2=CC(OC3=CC=C(C=C3)C=3NC4=CC=C(C=C4N=3)S(=O)(=O)N)=CC=C21 FYJXNYHANMMZPJ-UHFFFAOYSA-N 0.000 claims description 3
- KHHZVSIVKKGELQ-UHFFFAOYSA-N 2-(4-phenoxyphenyl)-3h-benzimidazole-5-sulfonamide Chemical compound N=1C2=CC(S(=O)(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=CC=C1 KHHZVSIVKKGELQ-UHFFFAOYSA-N 0.000 claims description 3
- YZBXZQMJLCGDHP-UHFFFAOYSA-N 2-(4-pyridin-3-yloxyphenyl)-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=CN=C1 YZBXZQMJLCGDHP-UHFFFAOYSA-N 0.000 claims description 3
- HFODTOJSGSGHID-UHFFFAOYSA-N 2-[2-chloro-4-(4-chlorophenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C(=C1)Cl)=CC=C1OC1=CC=C(Cl)C=C1 HFODTOJSGSGHID-UHFFFAOYSA-N 0.000 claims description 3
- GCKIINJXIXPHKJ-UHFFFAOYSA-N 2-[3-chloro-4-(2-methoxy-4-methylphenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound COC1=CC(C)=CC=C1OC1=CC=C(C=2NC3=CC=C(C=C3N=2)C(N)=O)C=C1Cl GCKIINJXIXPHKJ-UHFFFAOYSA-N 0.000 claims description 3
- XMZUWWYINMWAGW-UHFFFAOYSA-N 2-[3-chloro-4-(3,4-dimethoxyphenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound C1=C(OC)C(OC)=CC=C1OC1=CC=C(C=2NC3=CC=C(C=C3N=2)C(N)=O)C=C1Cl XMZUWWYINMWAGW-UHFFFAOYSA-N 0.000 claims description 3
- BYAONKUTDKSCTA-UHFFFAOYSA-N 2-[3-chloro-4-(3-chloro-4-methylphenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound C1=C(Cl)C(C)=CC=C1OC1=CC=C(C=2NC3=CC=C(C=C3N=2)C(N)=O)C=C1Cl BYAONKUTDKSCTA-UHFFFAOYSA-N 0.000 claims description 3
- FHQUCUVXNXLUMV-UHFFFAOYSA-N 2-[3-chloro-4-(4-fluoro-3-methylphenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound C1=C(F)C(C)=CC(OC=2C(=CC(=CC=2)C=2NC3=CC=C(C=C3N=2)C(N)=O)Cl)=C1 FHQUCUVXNXLUMV-UHFFFAOYSA-N 0.000 claims description 3
- NWSGQGNPAITUCX-UHFFFAOYSA-N 2-[4-(3,4-dichlorophenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C(Cl)C(Cl)=C1 NWSGQGNPAITUCX-UHFFFAOYSA-N 0.000 claims description 3
- TXGLUOQCFZQLHG-UHFFFAOYSA-N 2-[4-(3-chloro-4-fluorophenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C(F)C(Cl)=C1 TXGLUOQCFZQLHG-UHFFFAOYSA-N 0.000 claims description 3
- FXHGEANNJJDHMK-UHFFFAOYSA-N 2-[4-(3-chloro-4-fluorophenyl)sulfanylphenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1SC1=CC=C(F)C(Cl)=C1 FXHGEANNJJDHMK-UHFFFAOYSA-N 0.000 claims description 3
- PKIQLNKKGMPCHK-UHFFFAOYSA-N 2-[4-(3-chloro-4-fluorophenyl)sulfanylphenyl]-3h-benzimidazole-5-sulfonamide Chemical compound N=1C2=CC(S(=O)(=O)N)=CC=C2NC=1C(C=C1)=CC=C1SC1=CC=C(F)C(Cl)=C1 PKIQLNKKGMPCHK-UHFFFAOYSA-N 0.000 claims description 3
- OWOPCMLGEOLRDH-UHFFFAOYSA-N 2-[4-(3-chloro-4-methylphenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound C1=C(Cl)C(C)=CC=C1OC1=CC=C(C=2NC3=CC=C(C=C3N=2)C(N)=O)C=C1 OWOPCMLGEOLRDH-UHFFFAOYSA-N 0.000 claims description 3
- BDWGIUYERCLROD-UHFFFAOYSA-N 2-[4-(3-methoxyphenyl)sulfanylphenyl]-3h-benzimidazole-5-carboxamide Chemical compound COC1=CC=CC(SC=2C=CC(=CC=2)C=2NC3=CC=C(C=C3N=2)C(N)=O)=C1 BDWGIUYERCLROD-UHFFFAOYSA-N 0.000 claims description 3
- DQFBXMPFRTWEOC-UHFFFAOYSA-N 2-[4-(4-chloro-2-hydroxyphenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C(Cl)C=C1O DQFBXMPFRTWEOC-UHFFFAOYSA-N 0.000 claims description 3
- WFJNFYDWAZXCIJ-UHFFFAOYSA-N 2-[4-(4-chloro-3-fluorophenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C(Cl)C(F)=C1 WFJNFYDWAZXCIJ-UHFFFAOYSA-N 0.000 claims description 3
- RQKQQACLXABERV-UHFFFAOYSA-N 2-[4-(4-chloro-3-hydroxyphenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C(Cl)C(O)=C1 RQKQQACLXABERV-UHFFFAOYSA-N 0.000 claims description 3
- JKCDNKQAKWXQNO-UHFFFAOYSA-N 2-[4-(4-chlorophenoxy)phenyl]-1h-imidazo[4,5-b]pyridine-5-carboxamide Chemical compound N=1C2=NC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C(Cl)C=C1 JKCDNKQAKWXQNO-UHFFFAOYSA-N 0.000 claims description 3
- XCCULJHTWCXXQM-UHFFFAOYSA-N 2-[4-(4-chlorophenyl)sulfonylphenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1S(=O)(=O)C1=CC=C(Cl)C=C1 XCCULJHTWCXXQM-UHFFFAOYSA-N 0.000 claims description 3
- VBIMRSFMRWSBEL-UHFFFAOYSA-N 2-[4-(4-ethylphenyl)sulfanylphenyl]-3h-benzimidazole-5-carboxamide Chemical compound C1=CC(CC)=CC=C1SC1=CC=C(C=2NC3=CC=C(C=C3N=2)C(N)=O)C=C1 VBIMRSFMRWSBEL-UHFFFAOYSA-N 0.000 claims description 3
- OBGAXPZOBLEYIK-UHFFFAOYSA-N 2-[4-(4-iodophenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C(I)C=C1 OBGAXPZOBLEYIK-UHFFFAOYSA-N 0.000 claims description 3
- GAEMJVIRBHBIAF-UHFFFAOYSA-N 2-[4-(4-pyridin-2-ylpiperazin-1-yl)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1N(CC1)CCN1C1=CC=CC=N1 GAEMJVIRBHBIAF-UHFFFAOYSA-N 0.000 claims description 3
- NDFFIDXWQGDNAR-UHFFFAOYSA-N 2-[4-(naphthalen-2-ylsulfamoyl)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound C1=CC=CC2=CC(NS(=O)(=O)C3=CC=C(C=C3)C=3NC4=CC=C(C=C4N=3)C(=O)N)=CC=C21 NDFFIDXWQGDNAR-UHFFFAOYSA-N 0.000 claims description 3
- ZMHFEOJMVKVVDH-UHFFFAOYSA-N 2-[4-[(2,4-dichlorophenyl)sulfamoyl]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1S(=O)(=O)NC1=CC=C(Cl)C=C1Cl ZMHFEOJMVKVVDH-UHFFFAOYSA-N 0.000 claims description 3
- GWOSBFWKYVPXEI-UHFFFAOYSA-N 2-[4-[(4-bromophenyl)sulfamoyl]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1S(=O)(=O)NC1=CC=C(Br)C=C1 GWOSBFWKYVPXEI-UHFFFAOYSA-N 0.000 claims description 3
- CVGVSWYXRODYIS-UHFFFAOYSA-N 2-[4-[(4-chlorophenyl)-methylcarbamoyl]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound C=1C=C(C=2NC3=CC=C(C=C3N=2)C(N)=O)C=CC=1C(=O)N(C)C1=CC=C(Cl)C=C1 CVGVSWYXRODYIS-UHFFFAOYSA-N 0.000 claims description 3
- JUMNXHYLVIXBOA-UHFFFAOYSA-N 2-[4-[(4-chlorophenyl)-methylsulfamoyl]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound C=1C=C(C=2NC3=CC=C(C=C3N=2)C(N)=O)C=CC=1S(=O)(=O)N(C)C1=CC=C(Cl)C=C1 JUMNXHYLVIXBOA-UHFFFAOYSA-N 0.000 claims description 3
- QEMULFAUDKUPNT-UHFFFAOYSA-N 2-[4-[(4-chlorophenyl)carbamoyl]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1C(=O)NC1=CC=C(Cl)C=C1 QEMULFAUDKUPNT-UHFFFAOYSA-N 0.000 claims description 3
- BKQMUKMFGQVJLQ-UHFFFAOYSA-N 2-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(C=2NC3=CC=C(C=C3N=2)C(N)=O)C=C1 BKQMUKMFGQVJLQ-UHFFFAOYSA-N 0.000 claims description 3
- SNLBJYPVOBQKKR-UHFFFAOYSA-N 2-[4-[(4-nitrophenyl)sulfamoyl]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1S(=O)(=O)NC1=CC=C([N+]([O-])=O)C=C1 SNLBJYPVOBQKKR-UHFFFAOYSA-N 0.000 claims description 3
- RXUCRBVRFILDIS-UHFFFAOYSA-N 2-[4-[2-fluoro-5-(trifluoromethyl)phenoxy]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC(C(F)(F)F)=CC=C1F RXUCRBVRFILDIS-UHFFFAOYSA-N 0.000 claims description 3
- YOVVTBDGHWCNBU-UHFFFAOYSA-N 2-[4-[3-(diethylcarbamoyl)phenoxy]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound CCN(CC)C(=O)C1=CC=CC(OC=2C=CC(=CC=2)C=2NC3=CC=C(C=C3N=2)C(N)=O)=C1 YOVVTBDGHWCNBU-UHFFFAOYSA-N 0.000 claims description 3
- XTVIKGKDYZZIBD-UHFFFAOYSA-N 2-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1N(CC1)CCN1C1=CC=CC(Cl)=C1Cl XTVIKGKDYZZIBD-UHFFFAOYSA-N 0.000 claims description 3
- RTRXBFGAFBTCQB-UHFFFAOYSA-N 2-[4-[4-(3-chlorophenyl)piperazin-1-yl]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1N(CC1)CCN1C1=CC=CC(Cl)=C1 RTRXBFGAFBTCQB-UHFFFAOYSA-N 0.000 claims description 3
- JKOPNOKXGVFGRE-UHFFFAOYSA-N 2-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(=CC=2)C=2NC3=CC=C(C=C3N=2)C(N)=O)CC1 JKOPNOKXGVFGRE-UHFFFAOYSA-N 0.000 claims description 3
- GJUKYVSZBXVZBH-UHFFFAOYSA-N 2-[4-[4-(trifluoromethyl)phenoxy]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 GJUKYVSZBXVZBH-UHFFFAOYSA-N 0.000 claims description 3
- CMWOTYZIHHRJRP-UHFFFAOYSA-N 2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C(Cl)C(C(F)(F)F)=C1 CMWOTYZIHHRJRP-UHFFFAOYSA-N 0.000 claims description 3
- PPNMKGVBEAVBKZ-UHFFFAOYSA-N 2-[4-[[4-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1S(=O)(=O)NC1=CC=C(C(F)(F)F)C=C1 PPNMKGVBEAVBKZ-UHFFFAOYSA-N 0.000 claims description 3
- YSWHGFRQNXKHII-UHFFFAOYSA-N 2-[6-(4-chlorophenyl)sulfanylpyridin-3-yl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=N1)=CC=C1SC1=CC=C(Cl)C=C1 YSWHGFRQNXKHII-UHFFFAOYSA-N 0.000 claims description 3
- XAOUJXMYLLPPCM-UHFFFAOYSA-N 2-[6-(4-methylphenoxy)pyridin-3-yl]-3h-benzimidazole-5-carboxamide Chemical compound C1=CC(C)=CC=C1OC1=CC=C(C=2NC3=CC=C(C=C3N=2)C(N)=O)C=N1 XAOUJXMYLLPPCM-UHFFFAOYSA-N 0.000 claims description 3
- HOQFASLAKGMHRC-UHFFFAOYSA-N 2-[6-(4-methylphenyl)sulfanylpyridin-3-yl]-3h-benzimidazole-5-carboxamide Chemical compound C1=CC(C)=CC=C1SC1=CC=C(C=2NC3=CC=C(C=C3N=2)C(N)=O)C=N1 HOQFASLAKGMHRC-UHFFFAOYSA-N 0.000 claims description 3
- QELFWESNQXCDSC-UHFFFAOYSA-N 3-[4-[4-(6-carbamoyl-1h-benzimidazol-2-yl)phenoxy]phenyl]propanoic acid Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C(CCC(O)=O)C=C1 QELFWESNQXCDSC-UHFFFAOYSA-N 0.000 claims description 3
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 claims description 3
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 3
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000004245 indazol-3-yl group Chemical group [H]N1N=C(*)C2=C([H])C([H])=C([H])C([H])=C12 0.000 claims description 3
- 125000001624 naphthyl group Chemical group 0.000 claims description 3
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 claims description 3
- 125000004258 purin-2-yl group Chemical group [H]N1C2=NC(*)=NC([H])=C2N([H])C1([H])[H] 0.000 claims description 3
- 125000004544 purin-8-yl group Chemical group N1=CN=C2N=C(NC2=C1)* 0.000 claims description 3
- 238000006467 substitution reaction Methods 0.000 claims description 3
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 claims description 3
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 2
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 claims description 2
- CARBLJDZRGDDSV-UHFFFAOYSA-N 2-[3-chloro-4-[(4-chlorophenyl)sulfamoyl]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N1C2=CC(C(=O)N)=CC=C2N=C1C(C=C1Cl)=CC=C1S(=O)(=O)NC1=CC=C(Cl)C=C1 CARBLJDZRGDDSV-UHFFFAOYSA-N 0.000 claims description 2
- DAVKPQHZZGHLCG-UHFFFAOYSA-N 2-[4-(1,3-benzodioxol-5-yloxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound C1=C2OCOC2=CC(OC2=CC=C(C=C2)C=2NC3=CC=C(C=C3N=2)C(=O)N)=C1 DAVKPQHZZGHLCG-UHFFFAOYSA-N 0.000 claims description 2
- KQFWAHJPCZAWRR-UHFFFAOYSA-N 2-[4-(3,4-dimethoxyphenyl)sulfanylphenyl]-3h-benzimidazole-5-carboxamide Chemical compound C1=C(OC)C(OC)=CC=C1SC1=CC=C(C=2NC3=CC=C(C=C3N=2)C(N)=O)C=C1 KQFWAHJPCZAWRR-UHFFFAOYSA-N 0.000 claims description 2
- KFEQHDDFRVVFGF-UHFFFAOYSA-N 2-[4-(4-chloro-3-sulfamoylphenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N1C2=CC(C(=O)N)=CC=C2N=C1C(C=C1)=CC=C1OC1=CC=C(Cl)C(S(N)(=O)=O)=C1 KFEQHDDFRVVFGF-UHFFFAOYSA-N 0.000 claims description 2
- UMJSUXPOBMBISY-UHFFFAOYSA-N 2-[4-(4-chloroanilino)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N1C2=CC(C(=O)N)=CC=C2N=C1C(C=C1)=CC=C1NC1=CC=C(Cl)C=C1 UMJSUXPOBMBISY-UHFFFAOYSA-N 0.000 claims description 2
- FNCQORZVEHRZRC-UHFFFAOYSA-N 2-[4-(4-chlorophenoxy)phenyl]-3h-benzimidazole-5-sulfonamide Chemical compound N=1C2=CC(S(=O)(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C(Cl)C=C1 FNCQORZVEHRZRC-UHFFFAOYSA-N 0.000 claims description 2
- UFINQTABZSAHAA-UHFFFAOYSA-N 2-[4-[4-chloro-3-(dimethylamino)phenoxy]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound C1=C(Cl)C(N(C)C)=CC(OC=2C=CC(=CC=2)C=2NC3=CC(=CC=C3N=2)C(N)=O)=C1 UFINQTABZSAHAA-UHFFFAOYSA-N 0.000 claims description 2
- QSATYODVTPXBHQ-UHFFFAOYSA-N 2-[4-[4-chloro-3-(methanesulfonamido)phenoxy]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound C1=C(Cl)C(NS(=O)(=O)C)=CC(OC=2C=CC(=CC=2)C=2NC3=CC(=CC=C3N=2)C(N)=O)=C1 QSATYODVTPXBHQ-UHFFFAOYSA-N 0.000 claims description 2
- CNWIAOJFVAEIPP-UHFFFAOYSA-N 2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]-3h-benzimidazole-5-sulfonamide Chemical compound N=1C2=CC(S(=O)(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C(Cl)C(C(F)(F)F)=C1 CNWIAOJFVAEIPP-UHFFFAOYSA-N 0.000 claims description 2
- QYWJVCPTPQEBQA-UHFFFAOYSA-N 2-[6-(4-chlorophenoxy)pyridazin-3-yl]-3h-benzimidazole-5-carboxamide Chemical compound N1C2=CC(C(=O)N)=CC=C2N=C1C(N=N1)=CC=C1OC1=CC=C(Cl)C=C1 QYWJVCPTPQEBQA-UHFFFAOYSA-N 0.000 claims description 2
- WZAQGBNGGLBNHX-UHFFFAOYSA-N 2-[6-[(2,4-dichlorophenyl)sulfamoyl]pyridin-3-yl]-3h-benzimidazole-5-carboxamide Chemical compound N1C2=CC(C(=O)N)=CC=C2N=C1C(C=N1)=CC=C1S(=O)(=O)NC1=CC=C(Cl)C=C1Cl WZAQGBNGGLBNHX-UHFFFAOYSA-N 0.000 claims description 2
- QHGFZMGCLAYOHF-UHFFFAOYSA-N 2-[6-[(3,4-dichlorophenyl)sulfamoyl]pyridin-3-yl]-3h-benzimidazole-5-carboxamide Chemical compound N1C2=CC(C(=O)N)=CC=C2N=C1C(C=N1)=CC=C1S(=O)(=O)NC1=CC=C(Cl)C(Cl)=C1 QHGFZMGCLAYOHF-UHFFFAOYSA-N 0.000 claims description 2
- BVGJBRNVONUDJY-UHFFFAOYSA-N 2-[6-[(4-chlorophenyl)sulfamoyl]pyridin-3-yl]-3h-benzimidazole-5-carboxamide Chemical compound N1C2=CC(C(=O)N)=CC=C2N=C1C(C=N1)=CC=C1S(=O)(=O)NC1=CC=C(Cl)C=C1 BVGJBRNVONUDJY-UHFFFAOYSA-N 0.000 claims description 2
- XSOGJFDKBPOUFB-UHFFFAOYSA-N 2-[6-[(4-chlorophenyl)sulfonylamino]pyridin-3-yl]-3h-benzimidazole-5-carboxamide Chemical compound N1C2=CC(C(=O)N)=CC=C2N=C1C(C=N1)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C=C1 XSOGJFDKBPOUFB-UHFFFAOYSA-N 0.000 claims description 2
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 claims description 2
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 claims description 2
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 claims description 2
- FNLQDVXHDNFXIY-UHFFFAOYSA-N 3h-benzimidazole-5-carboxamide Chemical compound NC(=O)C1=CC=C2NC=NC2=C1 FNLQDVXHDNFXIY-UHFFFAOYSA-N 0.000 claims description 2
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 claims description 2
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 claims description 2
- 125000004860 4-ethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000006306 4-iodophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1I 0.000 claims description 2
- 125000004863 4-trifluoromethoxyphenyl group Chemical group [H]C1=C([H])C(OC(F)(F)F)=C([H])C([H])=C1* 0.000 claims description 2
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 claims description 2
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 claims description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000004571 thiomorpholin-4-yl group Chemical group N1(CCSCC1)* 0.000 claims description 2
- 125000001475 halogen functional group Chemical group 0.000 claims 2
- YJUFGFXVASPYFQ-UHFFFAOYSA-N 2,3-dihydro-1-benzothiophene Chemical compound C1=CC=C2SCCC2=C1 YJUFGFXVASPYFQ-UHFFFAOYSA-N 0.000 claims 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims 1
- 125000001931 aliphatic group Chemical group 0.000 claims 1
- MXMZCLLIUQEKSN-UHFFFAOYSA-N benzimidazoline Chemical compound C1=CC=C2NCNC2=C1 MXMZCLLIUQEKSN-UHFFFAOYSA-N 0.000 claims 1
- 101150095530 CDS1 gene Proteins 0.000 abstract description 34
- 239000002671 adjuvant Substances 0.000 abstract description 9
- 150000001556 benzimidazoles Chemical class 0.000 abstract description 9
- GAMYYCRTACQSBR-UHFFFAOYSA-N 4-azabenzimidazole Chemical class C1=CC=C2NC=NC2=N1 GAMYYCRTACQSBR-UHFFFAOYSA-N 0.000 abstract description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 116
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 108
- 238000000034 method Methods 0.000 description 108
- 238000005160 1H NMR spectroscopy Methods 0.000 description 104
- 210000004027 cell Anatomy 0.000 description 60
- 239000000203 mixture Chemical class 0.000 description 60
- 239000000460 chlorine Substances 0.000 description 50
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 45
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 39
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 37
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 33
- 239000011541 reaction mixture Substances 0.000 description 32
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 30
- AQJFATAFTQCRGC-UHFFFAOYSA-N 3-chloro-4-methylphenol Natural products CC1=CC=C(O)C(Cl)=C1 AQJFATAFTQCRGC-UHFFFAOYSA-N 0.000 description 29
- 239000000243 solution Substances 0.000 description 29
- VQZRLBWPEHFGCD-UHFFFAOYSA-N 3-chloro-4-methylphenol Chemical compound CC1=CC=C(O)C=C1Cl VQZRLBWPEHFGCD-UHFFFAOYSA-N 0.000 description 27
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 27
- 239000011734 sodium Substances 0.000 description 24
- 229920006395 saturated elastomer Polymers 0.000 description 23
- YUPBWHURNLRZQL-UHFFFAOYSA-N 4-(4-fluorophenoxy)benzaldehyde Chemical compound C1=CC(F)=CC=C1OC1=CC=C(C=O)C=C1 YUPBWHURNLRZQL-UHFFFAOYSA-N 0.000 description 20
- 102100025064 Cellular tumor antigen p53 Human genes 0.000 description 20
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 18
- 229910021529 ammonia Inorganic materials 0.000 description 18
- 230000000694 effects Effects 0.000 description 17
- 239000007787 solid Substances 0.000 description 17
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 15
- PFKFTWBEEFSNDU-UHFFFAOYSA-N 1,1'-Carbonyldiimidazole Substances C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 13
- RGJXMMUQTCONEI-UHFFFAOYSA-N 3,4-diaminobenzamide Chemical compound NC(=O)C1=CC=C(N)C(N)=C1 RGJXMMUQTCONEI-UHFFFAOYSA-N 0.000 description 13
- 108020004414 DNA Proteins 0.000 description 13
- 230000006907 apoptotic process Effects 0.000 description 13
- 230000002401 inhibitory effect Effects 0.000 description 13
- 230000005865 ionizing radiation Effects 0.000 description 13
- 239000002246 antineoplastic agent Substances 0.000 description 12
- 125000000623 heterocyclic group Chemical group 0.000 description 12
- 239000002244 precipitate Substances 0.000 description 12
- 239000000377 silicon dioxide Substances 0.000 description 12
- 230000002950 deficient Effects 0.000 description 11
- SDYWXFYBZPNOFX-UHFFFAOYSA-N 3,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C(Cl)=C1 SDYWXFYBZPNOFX-UHFFFAOYSA-N 0.000 description 10
- UOQXIWFBQSVDPP-UHFFFAOYSA-N 4-fluorobenzaldehyde Chemical compound FC1=CC=C(C=O)C=C1 UOQXIWFBQSVDPP-UHFFFAOYSA-N 0.000 description 10
- 241001465754 Metazoa Species 0.000 description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- 229940127089 cytotoxic agent Drugs 0.000 description 10
- 125000001072 heteroaryl group Chemical group 0.000 description 10
- 150000003254 radicals Chemical class 0.000 description 10
- 230000002829 reductive effect Effects 0.000 description 10
- 238000001914 filtration Methods 0.000 description 9
- 230000005855 radiation Effects 0.000 description 9
- 230000005778 DNA damage Effects 0.000 description 8
- 231100000277 DNA damage Toxicity 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical class CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- 239000002585 base Substances 0.000 description 8
- 125000005842 heteroatom Chemical group 0.000 description 8
- 239000007800 oxidant agent Substances 0.000 description 8
- 108090000623 proteins and genes Proteins 0.000 description 8
- AVJKDKWRVSSJPK-UHFFFAOYSA-N 1-(4-fluorophenyl)piperazine Chemical compound C1=CC(F)=CC=C1N1CCNCC1 AVJKDKWRVSSJPK-UHFFFAOYSA-N 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 241000699670 Mus sp. Species 0.000 description 7
- 150000001412 amines Chemical class 0.000 description 7
- 239000003795 chemical substances by application Substances 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 229930195733 hydrocarbon Natural products 0.000 description 7
- 230000005764 inhibitory process Effects 0.000 description 7
- 239000012074 organic phase Substances 0.000 description 7
- 102000004169 proteins and genes Human genes 0.000 description 7
- HEMGYNNCNNODNX-UHFFFAOYSA-N 3,4-diaminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1N HEMGYNNCNNODNX-UHFFFAOYSA-N 0.000 description 6
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- 239000004215 Carbon black (E152) Substances 0.000 description 6
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- VATYWCRQDJIRAI-UHFFFAOYSA-N p-aminobenzaldehyde Chemical compound NC1=CC=C(C=O)C=C1 VATYWCRQDJIRAI-UHFFFAOYSA-N 0.000 description 6
- 239000008194 pharmaceutical composition Substances 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 238000004007 reversed phase HPLC Methods 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- 210000001519 tissue Anatomy 0.000 description 6
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 5
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 5
- PBCZSGKMGDDXIJ-HQCWYSJUSA-N 7-hydroxystaurosporine Chemical compound N([C@H](O)C1=C2C3=CC=CC=C3N3C2=C24)C(=O)C1=C2C1=CC=CC=C1N4[C@H]1C[C@@H](NC)[C@@H](OC)[C@]3(C)O1 PBCZSGKMGDDXIJ-HQCWYSJUSA-N 0.000 description 5
- 0 C=*c1cc(Oc(cc2)ccc2-c2nc(cc(cc3)C(N)=O)c3[n]2)ccc1Cl Chemical compound C=*c1cc(Oc(cc2)ccc2-c2nc(cc(cc3)C(N)=O)c3[n]2)ccc1Cl 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 125000003342 alkenyl group Chemical group 0.000 description 5
- 125000003545 alkoxy group Chemical group 0.000 description 5
- 150000007942 carboxylates Chemical class 0.000 description 5
- 238000009833 condensation Methods 0.000 description 5
- 230000005494 condensation Effects 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 239000002552 dosage form Substances 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- 230000001965 increasing effect Effects 0.000 description 5
- 229920000728 polyester Polymers 0.000 description 5
- 125000006239 protecting group Chemical group 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- 230000001225 therapeutic effect Effects 0.000 description 5
- QULXUUQWVHVHSM-UHFFFAOYSA-N 3,4-diaminobenzenesulfonamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1N QULXUUQWVHVHSM-UHFFFAOYSA-N 0.000 description 4
- SMFFZOQLHYIRDA-UHFFFAOYSA-N 3,4-dimethoxyphenol Chemical group COC1=CC=C(O)C=C1OC SMFFZOQLHYIRDA-UHFFFAOYSA-N 0.000 description 4
- GVORVQPNNSASDM-UHFFFAOYSA-N 3-chloro-4-fluorobenzaldehyde Chemical compound FC1=CC=C(C=O)C=C1Cl GVORVQPNNSASDM-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 4
- 108090000672 Annexin A5 Proteins 0.000 description 4
- 102000004121 Annexin A5 Human genes 0.000 description 4
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 150000001299 aldehydes Chemical class 0.000 description 4
- 125000000304 alkynyl group Chemical group 0.000 description 4
- 239000001099 ammonium carbonate Substances 0.000 description 4
- 235000012501 ammonium carbonate Nutrition 0.000 description 4
- 238000003782 apoptosis assay Methods 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 4
- 125000004093 cyano group Chemical group *C#N 0.000 description 4
- 125000004122 cyclic group Chemical group 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 230000006870 function Effects 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical group COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 230000005522 programmed cell death Effects 0.000 description 4
- 230000004044 response Effects 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 3
- TXAMMAGOOCTGSB-UHFFFAOYSA-N 2-[4-(4-chlorophenyl)sulfanylphenyl]-3h-benzimidazole-5-carboxylic acid Chemical compound N=1C2=CC(C(=O)O)=CC=C2NC=1C(C=C1)=CC=C1SC1=CC=C(Cl)C=C1 TXAMMAGOOCTGSB-UHFFFAOYSA-N 0.000 description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- FQBOEBTWFUPCQR-UHFFFAOYSA-N 4,5-diamino-2-chlorobenzamide Chemical compound NC(=O)C1=CC(N)=C(N)C=C1Cl FQBOEBTWFUPCQR-UHFFFAOYSA-N 0.000 description 3
- ATGVBRQQWGDSHD-UHFFFAOYSA-N 4-(3,4-dichlorophenoxy)benzaldehyde Chemical compound C1=C(Cl)C(Cl)=CC=C1OC1=CC=C(C=O)C=C1 ATGVBRQQWGDSHD-UHFFFAOYSA-N 0.000 description 3
- BLCXBCYVCDPFEU-UHFFFAOYSA-N 4-(4-chlorophenoxy)benzaldehyde Chemical compound C1=CC(Cl)=CC=C1OC1=CC=C(C=O)C=C1 BLCXBCYVCDPFEU-UHFFFAOYSA-N 0.000 description 3
- FIARHGLPZDXHLJ-UHFFFAOYSA-N 4-(4-chlorophenyl)sulfanylbenzaldehyde Chemical compound C1=CC(Cl)=CC=C1SC1=CC=C(C=O)C=C1 FIARHGLPZDXHLJ-UHFFFAOYSA-N 0.000 description 3
- HDYIVWXWRBPPTK-UHFFFAOYSA-N 4-acetamido-2-chloro-5-nitrobenzamide Chemical compound CC(=O)NC1=CC(Cl)=C(C(N)=O)C=C1[N+]([O-])=O HDYIVWXWRBPPTK-UHFFFAOYSA-N 0.000 description 3
- SGILKVUOQHYDHT-UHFFFAOYSA-N 4-acetamido-2-chloro-5-nitrobenzoic acid Chemical compound CC(=O)NC1=CC(Cl)=C(C(O)=O)C=C1[N+]([O-])=O SGILKVUOQHYDHT-UHFFFAOYSA-N 0.000 description 3
- RZNRQVIXISJXTK-UHFFFAOYSA-N 4-formyl-n-phenylbenzamide Chemical compound C1=CC(C=O)=CC=C1C(=O)NC1=CC=CC=C1 RZNRQVIXISJXTK-UHFFFAOYSA-N 0.000 description 3
- YRXZIHANXVKUHP-UHFFFAOYSA-N 6-bromo-3-nitropyridin-2-amine Chemical compound NC1=NC(Br)=CC=C1[N+]([O-])=O YRXZIHANXVKUHP-UHFFFAOYSA-N 0.000 description 3
- RDJILYVRVOTMTQ-UHFFFAOYSA-N 6-methoxy-3-nitropyridin-2-amine Chemical compound COC1=CC=C([N+]([O-])=O)C(N)=N1 RDJILYVRVOTMTQ-UHFFFAOYSA-N 0.000 description 3
- ZKHQWZAMYRWXGA-KQYNXXCUSA-J ATP(4-) Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O)[C@@H](O)[C@H]1O ZKHQWZAMYRWXGA-KQYNXXCUSA-J 0.000 description 3
- ZKHQWZAMYRWXGA-UHFFFAOYSA-N Adenosine triphosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP(O)(=O)OP(O)(O)=O)C(O)C1O ZKHQWZAMYRWXGA-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 3
- 241000282412 Homo Species 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- 108091000080 Phosphotransferase Proteins 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000003213 activating effect Effects 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 125000004103 aminoalkyl group Chemical group 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 239000007822 coupling agent Substances 0.000 description 3
- 230000034994 death Effects 0.000 description 3
- 238000001514 detection method Methods 0.000 description 3
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical compound [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 3
- 208000035475 disorder Diseases 0.000 description 3
- 239000003937 drug carrier Substances 0.000 description 3
- 238000003818 flash chromatography Methods 0.000 description 3
- 239000001963 growth medium Substances 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 230000007246 mechanism Effects 0.000 description 3
- 150000004702 methyl esters Chemical class 0.000 description 3
- 150000005217 methyl ethers Chemical class 0.000 description 3
- IRLVSZGEDODSLF-UHFFFAOYSA-N n-(3,4-dichlorophenyl)-4-formylbenzenesulfonamide Chemical compound C1=C(Cl)C(Cl)=CC=C1NS(=O)(=O)C1=CC=C(C=O)C=C1 IRLVSZGEDODSLF-UHFFFAOYSA-N 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 230000000269 nucleophilic effect Effects 0.000 description 3
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 3
- 102000020233 phosphotransferase Human genes 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 108090000765 processed proteins & peptides Proteins 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 230000009396 radiation induced apoptosis Effects 0.000 description 3
- 230000008439 repair process Effects 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- 210000004989 spleen cell Anatomy 0.000 description 3
- 238000010186 staining Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 125000000547 substituted alkyl group Chemical group 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- 210000004881 tumor cell Anatomy 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- YBJHBAHKTGYVGT-ZKWXMUAHSA-N (+)-Biotin Chemical group N1C(=O)N[C@@H]2[C@H](CCCCC(=O)O)SC[C@@H]21 YBJHBAHKTGYVGT-ZKWXMUAHSA-N 0.000 description 2
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 2
- 125000003821 2-(trimethylsilyl)ethoxymethyl group Chemical group [H]C([H])([H])[Si](C([H])([H])[H])(C([H])([H])[H])C([H])([H])C(OC([H])([H])[*])([H])[H] 0.000 description 2
- PETRWTHZSKVLRE-UHFFFAOYSA-N 2-Methoxy-4-methylphenol Chemical compound COC1=CC(C)=CC=C1O PETRWTHZSKVLRE-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 2
- DHXAWJBRNZPFMP-UHFFFAOYSA-N 2-[4-(4-aminophenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C(N)C=C1 DHXAWJBRNZPFMP-UHFFFAOYSA-N 0.000 description 2
- BCMSRTVJHVFYFF-UHFFFAOYSA-N 2-[4-(4-chlorophenyl)sulfanylphenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1SC1=CC=C(Cl)C=C1 BCMSRTVJHVFYFF-UHFFFAOYSA-N 0.000 description 2
- AYVQDEPKWVWSGO-UHFFFAOYSA-N 2-[4-(4-hydroxyphenyl)sulfanylphenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1SC1=CC=C(O)C=C1 AYVQDEPKWVWSGO-UHFFFAOYSA-N 0.000 description 2
- CZANOMAFBFTCEG-UHFFFAOYSA-N 2-[4-(4-methoxyphenoxy)phenyl]-n-methyl-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)NC)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C(OC)C=C1 CZANOMAFBFTCEG-UHFFFAOYSA-N 0.000 description 2
- VBGDUXMEPZYIGT-UHFFFAOYSA-N 2-[4-(4-nitrophenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1 VBGDUXMEPZYIGT-UHFFFAOYSA-N 0.000 description 2
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 2
- KMQWNQKESAHDKD-UHFFFAOYSA-N 2-chloro-4-fluorobenzaldehyde Chemical group FC1=CC=C(C=O)C(Cl)=C1 KMQWNQKESAHDKD-UHFFFAOYSA-N 0.000 description 2
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 2
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- POXXEEYWYKIEOF-UHFFFAOYSA-N 3,4-dichloro-n-(4-formylphenyl)benzenesulfonamide Chemical compound C1=C(Cl)C(Cl)=CC=C1S(=O)(=O)NC1=CC=C(C=O)C=C1 POXXEEYWYKIEOF-UHFFFAOYSA-N 0.000 description 2
- PMRXAXHHFVVMHO-UHFFFAOYSA-N 3-[4-(6-carbamoyl-1h-benzimidazol-2-yl)phenoxy]benzoic acid Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=CC(C(O)=O)=C1 PMRXAXHHFVVMHO-UHFFFAOYSA-N 0.000 description 2
- IJFXRHURBJZNAO-UHFFFAOYSA-N 3-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=CC(O)=C1 IJFXRHURBJZNAO-UHFFFAOYSA-N 0.000 description 2
- UXCMNUUPBMYDLJ-UHFFFAOYSA-N 4-(4-chlorophenyl)benzaldehyde Chemical compound C1=CC(Cl)=CC=C1C1=CC=C(C=O)C=C1 UXCMNUUPBMYDLJ-UHFFFAOYSA-N 0.000 description 2
- ZVMXCNFUJPLQFT-UHFFFAOYSA-N 4-(4-fluorophenyl)benzaldehyde Chemical compound C1=CC(F)=CC=C1C1=CC=C(C=O)C=C1 ZVMXCNFUJPLQFT-UHFFFAOYSA-N 0.000 description 2
- CAVOZKQLNJFSNL-UHFFFAOYSA-N 4-[4-(4-fluorophenyl)piperazin-1-yl]benzaldehyde Chemical compound C1=CC(F)=CC=C1N1CCN(C=2C=CC(C=O)=CC=2)CC1 CAVOZKQLNJFSNL-UHFFFAOYSA-N 0.000 description 2
- TZXJLFBEXYSTJG-UHFFFAOYSA-N 4-acetamido-2-chlorobenzoic acid Chemical compound CC(=O)NC1=CC=C(C(O)=O)C(Cl)=C1 TZXJLFBEXYSTJG-UHFFFAOYSA-N 0.000 description 2
- CLYXBROQZKYOOJ-UHFFFAOYSA-N 4-amino-2-chloro-5-nitrobenzamide Chemical compound NC(=O)C1=CC([N+]([O-])=O)=C(N)C=C1Cl CLYXBROQZKYOOJ-UHFFFAOYSA-N 0.000 description 2
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 description 2
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical group NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 2
- VZXOZSQDJJNBRC-UHFFFAOYSA-N 4-chlorobenzenethiol Chemical group SC1=CC=C(Cl)C=C1 VZXOZSQDJJNBRC-UHFFFAOYSA-N 0.000 description 2
- HXDOZKJGKXYMEW-UHFFFAOYSA-N 4-ethylphenol Chemical group CCC1=CC=C(O)C=C1 HXDOZKJGKXYMEW-UHFFFAOYSA-N 0.000 description 2
- RVYGYYVGWSCWGY-UHFFFAOYSA-N 4-fluoro-3-methylphenol Chemical group CC1=CC(O)=CC=C1F RVYGYYVGWSCWGY-UHFFFAOYSA-N 0.000 description 2
- GOUHYARYYWKXHS-UHFFFAOYSA-N 4-formylbenzoic acid Chemical compound OC(=O)C1=CC=C(C=O)C=C1 GOUHYARYYWKXHS-UHFFFAOYSA-N 0.000 description 2
- QXSAKPUBHTZHKW-UHFFFAOYSA-N 4-hydroxybenzamide Chemical group NC(=O)C1=CC=C(O)C=C1 QXSAKPUBHTZHKW-UHFFFAOYSA-N 0.000 description 2
- JOOXCMJARBKPKM-UHFFFAOYSA-M 4-oxopentanoate Chemical compound CC(=O)CCC([O-])=O JOOXCMJARBKPKM-UHFFFAOYSA-M 0.000 description 2
- QWLHJVDRPZNVBS-UHFFFAOYSA-N 4-phenoxybenzaldehyde Chemical compound C1=CC(C=O)=CC=C1OC1=CC=CC=C1 QWLHJVDRPZNVBS-UHFFFAOYSA-N 0.000 description 2
- ISDBWOPVZKNQDW-UHFFFAOYSA-N 4-phenylbenzaldehyde Chemical compound C1=CC(C=O)=CC=C1C1=CC=CC=C1 ISDBWOPVZKNQDW-UHFFFAOYSA-N 0.000 description 2
- QGGRYBBNOBLWNQ-UHFFFAOYSA-N 5,6-diaminopyridine-2-carbonitrile Chemical compound NC1=CC=C(C#N)N=C1N QGGRYBBNOBLWNQ-UHFFFAOYSA-N 0.000 description 2
- 125000004008 6 membered carbocyclic group Chemical group 0.000 description 2
- RRPKOJDIMOBIOE-UHFFFAOYSA-N 6-amino-5-nitropyridine-2-carbonitrile Chemical compound NC1=NC(C#N)=CC=C1[N+]([O-])=O RRPKOJDIMOBIOE-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- 229920000936 Agarose Polymers 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 206010003594 Ataxia telangiectasia Diseases 0.000 description 2
- 102000036365 BRCA1 Human genes 0.000 description 2
- 108700020463 BRCA1 Proteins 0.000 description 2
- 101150072950 BRCA1 gene Proteins 0.000 description 2
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical class CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- 239000007995 HEPES buffer Substances 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- OTPNDVKVEAIXTI-UHFFFAOYSA-N LSM-1274 Chemical compound C12=C3C4=C5C=CC=C[C]5N3C(O3)CCC3N2C2=CC=C[CH]C2=C1C1=C4C(=O)NC1=O OTPNDVKVEAIXTI-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 102000001253 Protein Kinase Human genes 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- LUSZGTFNYDARNI-UHFFFAOYSA-N Sesamol Chemical group OC1=CC=C2OCOC2=C1 LUSZGTFNYDARNI-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- 229940022663 acetate Drugs 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 239000003708 ampul Substances 0.000 description 2
- 230000001093 anti-cancer Effects 0.000 description 2
- 230000001640 apoptogenic effect Effects 0.000 description 2
- 125000003435 aroyl group Chemical group 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 210000003719 b-lymphocyte Anatomy 0.000 description 2
- 239000011324 bead Substances 0.000 description 2
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 2
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 2
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- 239000012148 binding buffer Substances 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 230000025084 cell cycle arrest Effects 0.000 description 2
- 239000013043 chemical agent Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 229940125904 compound 1 Drugs 0.000 description 2
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 238000004163 cytometry Methods 0.000 description 2
- 230000006735 deficit Effects 0.000 description 2
- 125000004663 dialkyl amino group Chemical group 0.000 description 2
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical compound C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 238000001943 fluorescence-activated cell sorting Methods 0.000 description 2
- 150000003948 formamides Chemical class 0.000 description 2
- 239000012634 fragment Substances 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 125000005241 heteroarylamino group Chemical group 0.000 description 2
- 150000004677 hydrates Chemical class 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 125000001041 indolyl group Chemical group 0.000 description 2
- 230000000977 initiatory effect Effects 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 230000001404 mediated effect Effects 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- 125000002757 morpholinyl group Chemical group 0.000 description 2
- 230000035772 mutation Effects 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 230000004987 nonapoptotic effect Effects 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 238000003305 oral gavage Methods 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- 239000008177 pharmaceutical agent Substances 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 150000004986 phenylenediamines Chemical class 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 230000026731 phosphorylation Effects 0.000 description 2
- 238000006366 phosphorylation reaction Methods 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 125000004193 piperazinyl group Chemical group 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- XJMOSONTPMZWPB-UHFFFAOYSA-M propidium iodide Chemical compound [I-].[I-].C12=CC(N)=CC=C2C2=CC=C(N)C=C2[N+](CCC[N+](C)(CC)CC)=C1C1=CC=CC=C1 XJMOSONTPMZWPB-UHFFFAOYSA-M 0.000 description 2
- 108060006633 protein kinase Proteins 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 125000006413 ring segment Chemical group 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 210000003491 skin Anatomy 0.000 description 2
- 239000012453 solvate Substances 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- 230000004083 survival effect Effects 0.000 description 2
- ILMRJRBKQSSXGY-UHFFFAOYSA-N tert-butyl(dimethyl)silicon Chemical group C[Si](C)C(C)(C)C ILMRJRBKQSSXGY-UHFFFAOYSA-N 0.000 description 2
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 2
- 125000004001 thioalkyl group Chemical group 0.000 description 2
- 238000011269 treatment regimen Methods 0.000 description 2
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 230000004614 tumor growth Effects 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- SODPIMGUZLOIPE-UHFFFAOYSA-N (4-chlorophenoxy)acetic acid Chemical compound OC(=O)COC1=CC=C(Cl)C=C1 SODPIMGUZLOIPE-UHFFFAOYSA-N 0.000 description 1
- YMVFJGSXZNNUDW-UHFFFAOYSA-N (4-chlorophenyl)methanamine Chemical compound NCC1=CC=C(Cl)C=C1 YMVFJGSXZNNUDW-UHFFFAOYSA-N 0.000 description 1
- FPVKHBSQESCIEP-UHFFFAOYSA-N (8S)-3-(2-deoxy-beta-D-erythro-pentofuranosyl)-3,6,7,8-tetrahydroimidazo[4,5-d][1,3]diazepin-8-ol Natural products C1C(O)C(CO)OC1N1C(NC=NCC2O)=C2N=C1 FPVKHBSQESCIEP-UHFFFAOYSA-N 0.000 description 1
- 125000006619 (C1-C6) dialkylamino group Chemical group 0.000 description 1
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 description 1
- 125000006705 (C5-C7) cycloalkyl group Chemical group 0.000 description 1
- FDKXTQMXEQVLRF-ZHACJKMWSA-N (E)-dacarbazine Chemical compound CN(C)\N=N\c1[nH]cnc1C(N)=O FDKXTQMXEQVLRF-ZHACJKMWSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- FTNJQNQLEGKTGD-UHFFFAOYSA-N 1,3-benzodioxole Chemical compound C1=CC=C2OCOC2=C1 FTNJQNQLEGKTGD-UHFFFAOYSA-N 0.000 description 1
- 150000000093 1,3-dioxanes Chemical class 0.000 description 1
- 125000006091 1,3-dioxolane group Chemical class 0.000 description 1
- RWYYNSXVFPESMC-UHFFFAOYSA-N 1,5-dihydro-2,4-benzodioxepine Chemical compound C1OCOCC2=CC=CC=C21 RWYYNSXVFPESMC-UHFFFAOYSA-N 0.000 description 1
- VHFVKMTVMIZMIK-UHFFFAOYSA-N 1-(3-chlorophenyl)piperazine Chemical compound ClC1=CC=CC(N2CCNCC2)=C1 VHFVKMTVMIZMIK-UHFFFAOYSA-N 0.000 description 1
- VWOJSRICSKDKAW-UHFFFAOYSA-N 1-(4-nitrophenyl)piperazine Chemical compound C1=CC([N+](=O)[O-])=CC=C1N1CCNCC1 VWOJSRICSKDKAW-UHFFFAOYSA-N 0.000 description 1
- MNCMBBIFTVWHIP-UHFFFAOYSA-N 1-anthracen-9-yl-2,2,2-trifluoroethanone Chemical group C1=CC=C2C(C(=O)C(F)(F)F)=C(C=CC=C3)C3=CC2=C1 MNCMBBIFTVWHIP-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- PJUPKRYGDFTMTM-UHFFFAOYSA-N 1-hydroxybenzotriazole;hydrate Chemical compound O.C1=CC=C2N(O)N=NC2=C1 PJUPKRYGDFTMTM-UHFFFAOYSA-N 0.000 description 1
- VSNHCAURESNICA-NJFSPNSNSA-N 1-oxidanylurea Chemical compound N[14C](=O)NO VSNHCAURESNICA-NJFSPNSNSA-N 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 1
- XYDLQHCWLVSLIN-UHFFFAOYSA-N 2,3-diaminobenzenesulfonamide Chemical compound NC1=CC=CC(S(N)(=O)=O)=C1N XYDLQHCWLVSLIN-UHFFFAOYSA-N 0.000 description 1
- UDQMXYJSNNCRAS-UHFFFAOYSA-N 2,3-dichlorophenylpiperazine Chemical compound ClC1=CC=CC(N2CCNCC2)=C1Cl UDQMXYJSNNCRAS-UHFFFAOYSA-N 0.000 description 1
- FFFIRKXTFQCCKJ-UHFFFAOYSA-M 2,4,6-trimethylbenzoate Chemical compound CC1=CC(C)=C(C([O-])=O)C(C)=C1 FFFIRKXTFQCCKJ-UHFFFAOYSA-M 0.000 description 1
- 125000001917 2,4-dinitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1*)[N+]([O-])=O)[N+]([O-])=O 0.000 description 1
- AVYGCQXNNJPXSS-UHFFFAOYSA-N 2,5-dichloroaniline Chemical group NC1=CC(Cl)=CC=C1Cl AVYGCQXNNJPXSS-UHFFFAOYSA-N 0.000 description 1
- YAIUOMMSSSVJLB-UHFFFAOYSA-N 2-(1,3-dioxan-5-yl)pyridine Chemical compound C1OCOCC1C1=CC=CC=N1 YAIUOMMSSSVJLB-UHFFFAOYSA-N 0.000 description 1
- NCLYKHALDBYCOC-UHFFFAOYSA-N 2-(3-nitrophenyl)-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C1=CC=CC([N+]([O-])=O)=C1 NCLYKHALDBYCOC-UHFFFAOYSA-N 0.000 description 1
- JZQQAMWHSMDRQY-UHFFFAOYSA-N 2-(4-phenoxyphenyl)-3h-benzimidazole-5-carboxylic acid Chemical compound N=1C2=CC(C(=O)O)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=CC=C1 JZQQAMWHSMDRQY-UHFFFAOYSA-N 0.000 description 1
- VXAXNRIWBUPKJB-UHFFFAOYSA-N 2-(4-phenylphenyl)-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1C1=CC=CC=C1 VXAXNRIWBUPKJB-UHFFFAOYSA-N 0.000 description 1
- BWRBAJRLCJBJOI-UHFFFAOYSA-N 2-(4-pyridin-2-ylphenyl)-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1C1=CC=CC=N1 BWRBAJRLCJBJOI-UHFFFAOYSA-N 0.000 description 1
- ZLTIPBBLNUNPEJ-UHFFFAOYSA-N 2-[2-chloro-4-(4-chlorophenoxy)phenyl]-3h-benzimidazole-5-carboxylic acid Chemical compound N=1C2=CC(C(=O)O)=CC=C2NC=1C(C(=C1)Cl)=CC=C1OC1=CC=C(Cl)C=C1 ZLTIPBBLNUNPEJ-UHFFFAOYSA-N 0.000 description 1
- WPDPUXBIFIAQKQ-UHFFFAOYSA-N 2-[4-(2-chloro-4-methylphenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound ClC1=CC(C)=CC=C1OC1=CC=C(C=2NC3=CC=C(C=C3N=2)C(N)=O)C=C1 WPDPUXBIFIAQKQ-UHFFFAOYSA-N 0.000 description 1
- PZSWBRRAYOUSFS-UHFFFAOYSA-N 2-[4-(2-chlorophenyl)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1C1=CC=CC=C1Cl PZSWBRRAYOUSFS-UHFFFAOYSA-N 0.000 description 1
- DXZOMIPCORHQTD-UHFFFAOYSA-N 2-[4-(3,4-dichlorophenoxy)phenyl]-1h-imidazo[4,5-b]pyridine-5-carbonitrile Chemical compound C1=C(Cl)C(Cl)=CC=C1OC1=CC=C(C=2NC3=CC=C(N=C3N=2)C#N)C=C1 DXZOMIPCORHQTD-UHFFFAOYSA-N 0.000 description 1
- IBZQSNUHUGJBSE-UHFFFAOYSA-N 2-[4-(3,4-dimethoxyphenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound C1=C(OC)C(OC)=CC=C1OC1=CC=C(C=2NC3=CC=C(C=C3N=2)C(N)=O)C=C1 IBZQSNUHUGJBSE-UHFFFAOYSA-N 0.000 description 1
- VRFNSWZSKMEKCH-UHFFFAOYSA-N 2-[4-(3,4-dimethylphenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound C1=C(C)C(C)=CC=C1OC1=CC=C(C=2NC3=CC=C(C=C3N=2)C(N)=O)C=C1 VRFNSWZSKMEKCH-UHFFFAOYSA-N 0.000 description 1
- MCIKWFRFZGHOFF-UHFFFAOYSA-N 2-[4-(3-chlorophenoxy)-3-nitrophenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1[N+]([O-])=O)=CC=C1OC1=CC=CC(Cl)=C1 MCIKWFRFZGHOFF-UHFFFAOYSA-N 0.000 description 1
- ORMYSOQVDNNQEX-UHFFFAOYSA-N 2-[4-(3-chlorophenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=CC(Cl)=C1 ORMYSOQVDNNQEX-UHFFFAOYSA-N 0.000 description 1
- FLVAMFDWUSKJBQ-UHFFFAOYSA-N 2-[4-(4-bromo-3-hydroxyphenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C(Br)C(O)=C1 FLVAMFDWUSKJBQ-UHFFFAOYSA-N 0.000 description 1
- PKRDORNUEFSJAI-UHFFFAOYSA-N 2-[4-(4-bromophenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C(Br)C=C1 PKRDORNUEFSJAI-UHFFFAOYSA-N 0.000 description 1
- RZBLWQIFTHBRAU-UHFFFAOYSA-N 2-[4-(4-chloro-2-methoxyphenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound COC1=CC(Cl)=CC=C1OC1=CC=C(C=2NC3=CC=C(C=C3N=2)C(N)=O)C=C1 RZBLWQIFTHBRAU-UHFFFAOYSA-N 0.000 description 1
- SPMJCKLIOKTQLW-UHFFFAOYSA-N 2-[4-(4-chlorophenoxy)phenyl]-n-methyl-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)NC)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C(Cl)C=C1 SPMJCKLIOKTQLW-UHFFFAOYSA-N 0.000 description 1
- CBVZRVMIRYIMRV-UHFFFAOYSA-N 2-[4-(4-chlorophenyl)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1C1=CC=C(Cl)C=C1 CBVZRVMIRYIMRV-UHFFFAOYSA-N 0.000 description 1
- LEXFBVDJGJMLED-UHFFFAOYSA-N 2-[4-(4-chlorophenyl)phenyl]-3h-benzimidazole-5-carboxylic acid Chemical compound N=1C2=CC(C(=O)O)=CC=C2NC=1C(C=C1)=CC=C1C1=CC=C(Cl)C=C1 LEXFBVDJGJMLED-UHFFFAOYSA-N 0.000 description 1
- XRGRHEXRUIGNAM-UHFFFAOYSA-N 2-[4-(4-chlorophenyl)sulfinylphenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1S(=O)C1=CC=C(Cl)C=C1 XRGRHEXRUIGNAM-UHFFFAOYSA-N 0.000 description 1
- QWFYWHDACZQFFO-UHFFFAOYSA-N 2-[4-(4-cyanophenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C(C#N)C=C1 QWFYWHDACZQFFO-UHFFFAOYSA-N 0.000 description 1
- OOHWQLZGFMQGJB-UHFFFAOYSA-N 2-[4-(4-ethylphenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound C1=CC(CC)=CC=C1OC1=CC=C(C=2NC3=CC=C(C=C3N=2)C(N)=O)C=C1 OOHWQLZGFMQGJB-UHFFFAOYSA-N 0.000 description 1
- ATNFQDVRYGTUEK-UHFFFAOYSA-N 2-[4-(4-fluoro-3-methylphenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound C1=C(F)C(C)=CC(OC=2C=CC(=CC=2)C=2NC3=CC=C(C=C3N=2)C(N)=O)=C1 ATNFQDVRYGTUEK-UHFFFAOYSA-N 0.000 description 1
- WRXAZYUZGQQWDN-UHFFFAOYSA-N 2-[4-(4-fluorophenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C(F)C=C1 WRXAZYUZGQQWDN-UHFFFAOYSA-N 0.000 description 1
- DPMBCATVGWHUTP-UHFFFAOYSA-N 2-[4-(4-fluorophenoxy)phenyl]-3h-benzimidazole-5-carboxylic acid Chemical compound N=1C2=CC(C(=O)O)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C(F)C=C1 DPMBCATVGWHUTP-UHFFFAOYSA-N 0.000 description 1
- NLDXIKCKGKBVSG-UHFFFAOYSA-N 2-[4-(4-fluorophenyl)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1C1=CC=C(F)C=C1 NLDXIKCKGKBVSG-UHFFFAOYSA-N 0.000 description 1
- RYAFWCGRSKQYBC-UHFFFAOYSA-N 2-[4-(4-methoxyphenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound C1=CC(OC)=CC=C1OC1=CC=C(C=2NC3=CC=C(C=C3N=2)C(N)=O)C=C1 RYAFWCGRSKQYBC-UHFFFAOYSA-N 0.000 description 1
- FJRSKRJSNXVBFF-UHFFFAOYSA-N 2-[4-(4-nitrophenoxy)phenyl]-3h-benzimidazole-5-carboxylic acid Chemical compound N=1C2=CC(C(=O)O)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1 FJRSKRJSNXVBFF-UHFFFAOYSA-N 0.000 description 1
- QHGMKZOYNBURMZ-UHFFFAOYSA-N 2-[4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound C1CCCC2=CC(OC3=CC=C(C=C3)C=3NC4=CC=C(C=C4N=3)C(=O)N)=CC=C21 QHGMKZOYNBURMZ-UHFFFAOYSA-N 0.000 description 1
- DMWUWDADLOZKKE-UHFFFAOYSA-N 2-[4-(5-chloro-2-methylphenoxy)phenyl]-3h-benzimidazole-5-carboxamide Chemical compound CC1=CC=C(Cl)C=C1OC1=CC=C(C=2NC3=CC=C(C=C3N=2)C(N)=O)C=C1 DMWUWDADLOZKKE-UHFFFAOYSA-N 0.000 description 1
- QTYJXXIMENOKOA-UHFFFAOYSA-N 2-[4-[2-fluoro-3-(trifluoromethyl)phenoxy]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=CC(C(F)(F)F)=C1F QTYJXXIMENOKOA-UHFFFAOYSA-N 0.000 description 1
- KXUAIUIQQYCOAQ-UHFFFAOYSA-N 2-[4-[3-(trifluoromethyl)phenoxy]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1OC1=CC=CC(C(F)(F)F)=C1 KXUAIUIQQYCOAQ-UHFFFAOYSA-N 0.000 description 1
- VFKVTJOBPHIFKV-UHFFFAOYSA-N 2-[4-[4-(4-nitrophenyl)piperazin-1-yl]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1N(CC1)CCN1C1=CC=C([N+]([O-])=O)C=C1 VFKVTJOBPHIFKV-UHFFFAOYSA-N 0.000 description 1
- OPXSHSZSDFFTNY-UHFFFAOYSA-N 2-[4-[4-(methanesulfonamido)phenoxy]phenyl]-3h-benzimidazole-5-carboxamide Chemical compound C1=CC(NS(=O)(=O)C)=CC=C1OC1=CC=C(C=2NC3=CC=C(C=C3N=2)C(N)=O)C=C1 OPXSHSZSDFFTNY-UHFFFAOYSA-N 0.000 description 1
- KMTGDCMRQATMNJ-UHFFFAOYSA-N 2-[4-[4-(trifluoromethoxy)phenyl]sulfanylphenyl]-3h-benzimidazole-5-carboxamide Chemical compound N=1C2=CC(C(=O)N)=CC=C2NC=1C(C=C1)=CC=C1SC1=CC=C(OC(F)(F)F)C=C1 KMTGDCMRQATMNJ-UHFFFAOYSA-N 0.000 description 1
- NAIGKGQHPIGYBB-UHFFFAOYSA-N 2-amino-7,9-dimethylpurin-9-ium-6-olate Chemical compound NC1=NC([O-])=C2N(C)C=[N+](C)C2=N1 NAIGKGQHPIGYBB-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- DVRGUTNVDGIKTP-UHFFFAOYSA-N 2-chloro-6-methoxy-3-nitropyridine Chemical compound COC1=CC=C([N+]([O-])=O)C(Cl)=N1 DVRGUTNVDGIKTP-UHFFFAOYSA-N 0.000 description 1
- DOICLFHNNMXINV-UHFFFAOYSA-N 2-fluoro-3-(trifluoromethyl)phenol Chemical group OC1=CC=CC(C(F)(F)F)=C1F DOICLFHNNMXINV-UHFFFAOYSA-N 0.000 description 1
- MCOSBFKOUQAIJS-UHFFFAOYSA-N 2-fluoro-5-(trifluoromethyl)phenol Chemical group OC1=CC(C(F)(F)F)=CC=C1F MCOSBFKOUQAIJS-UHFFFAOYSA-N 0.000 description 1
- JBIJLHTVPXGSAM-UHFFFAOYSA-N 2-naphthylamine Chemical group C1=CC=CC2=CC(N)=CC=C21 JBIJLHTVPXGSAM-UHFFFAOYSA-N 0.000 description 1
- GPVOTFQILZVCFP-UHFFFAOYSA-N 2-trityloxyacetic acid Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(OCC(=O)O)C1=CC=CC=C1 GPVOTFQILZVCFP-UHFFFAOYSA-N 0.000 description 1
- WDNBURPWRNALGP-UHFFFAOYSA-N 3,4-Dichlorophenol Chemical group OC1=CC=C(Cl)C(Cl)=C1 WDNBURPWRNALGP-UHFFFAOYSA-N 0.000 description 1
- NYIBPWGZGSXURD-UHFFFAOYSA-N 3,4-dichlorobenzenesulfonyl chloride Chemical compound ClC1=CC=C(S(Cl)(=O)=O)C=C1Cl NYIBPWGZGSXURD-UHFFFAOYSA-N 0.000 description 1
- MTKAJLNGIVXZIS-UHFFFAOYSA-N 3,4-dimethoxybenzenethiol Chemical group COC1=CC=C(S)C=C1OC MTKAJLNGIVXZIS-UHFFFAOYSA-N 0.000 description 1
- 125000002774 3,4-dimethoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000002862 3,4-xylenyl group Chemical group [H]C1=C(O*)C([H])=C(C(=C1[H])C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- MESJRHHDBDCQTH-UHFFFAOYSA-N 3-(dimethylamino)phenol Chemical group CN(C)C1=CC=CC(O)=C1 MESJRHHDBDCQTH-UHFFFAOYSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- UGEJOEBBMPOJMT-UHFFFAOYSA-N 3-(trifluoromethyl)phenol Chemical group OC1=CC=CC(C(F)(F)F)=C1 UGEJOEBBMPOJMT-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- SFSHSIFYTWIGSF-UHFFFAOYSA-N 3-chloro-4-fluorobenzenethiol Chemical compound FC1=CC=C(S)C=C1Cl SFSHSIFYTWIGSF-UHFFFAOYSA-N 0.000 description 1
- ZQXLIXHVJVAPLW-UHFFFAOYSA-N 3-chloro-4-fluorophenol Chemical compound OC1=CC=C(F)C(Cl)=C1 ZQXLIXHVJVAPLW-UHFFFAOYSA-N 0.000 description 1
- HORNXRXVQWOLPJ-UHFFFAOYSA-N 3-chlorophenol Chemical compound OC1=CC=CC(Cl)=C1 HORNXRXVQWOLPJ-UHFFFAOYSA-N 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- XMIIGOLPHOKFCH-UHFFFAOYSA-M 3-phenylpropionate Chemical compound [O-]C(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-M 0.000 description 1
- UOQHRZYJHNODNL-UHFFFAOYSA-N 4,5-bis(methoxymethyl)-1,3-dioxolane Chemical compound COCC1OCOC1COC UOQHRZYJHNODNL-UHFFFAOYSA-N 0.000 description 1
- PGMYZSDMJRFWKS-UHFFFAOYSA-N 4-(2-chlorophenyl)benzaldehyde Chemical compound ClC1=CC=CC=C1C1=CC=C(C=O)C=C1 PGMYZSDMJRFWKS-UHFFFAOYSA-N 0.000 description 1
- UXWLHPWCZJEEDL-UHFFFAOYSA-N 4-(2-nitrophenyl)-1,3-dioxolane Chemical compound [O-][N+](=O)C1=CC=CC=C1C1OCOC1 UXWLHPWCZJEEDL-UHFFFAOYSA-N 0.000 description 1
- AIHDGFJFFKLOGZ-UHFFFAOYSA-N 4-(3-chloro-4-fluorophenyl)sulfanylbenzaldehyde Chemical compound C1=C(Cl)C(F)=CC=C1SC1=CC=C(C=O)C=C1 AIHDGFJFFKLOGZ-UHFFFAOYSA-N 0.000 description 1
- GNIGRKXNSXZEHL-UHFFFAOYSA-N 4-(3-chloro-4-methylphenoxy)benzaldehyde Chemical compound C1=C(Cl)C(C)=CC=C1OC1=CC=C(C=O)C=C1 GNIGRKXNSXZEHL-UHFFFAOYSA-N 0.000 description 1
- FLWAMJZFOINMFU-UHFFFAOYSA-N 4-(3-chlorophenoxy)-3-nitrobenzaldehyde Chemical group [O-][N+](=O)C1=CC(C=O)=CC=C1OC1=CC=CC(Cl)=C1 FLWAMJZFOINMFU-UHFFFAOYSA-N 0.000 description 1
- PYODQZCRZBCXPW-UHFFFAOYSA-N 4-(4-formylphenoxy)benzonitrile Chemical compound C1=CC(C=O)=CC=C1OC1=CC=C(C#N)C=C1 PYODQZCRZBCXPW-UHFFFAOYSA-N 0.000 description 1
- OCHOSUFDGPHRJA-UHFFFAOYSA-N 4-(4-nitrophenoxy)benzaldehyde Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC1=CC=C(C=O)C=C1 OCHOSUFDGPHRJA-UHFFFAOYSA-N 0.000 description 1
- BLAURXPHWHQJKX-UHFFFAOYSA-N 4-(bromomethyl)-1,3-dioxolane Chemical compound BrCC1COCO1 BLAURXPHWHQJKX-UHFFFAOYSA-N 0.000 description 1
- JHVNSRJPBXPZJU-UHFFFAOYSA-N 4-(trifluoromethoxy)benzenethiol Chemical group FC(F)(F)OC1=CC=C(S)C=C1 JHVNSRJPBXPZJU-UHFFFAOYSA-N 0.000 description 1
- BAYGVMXZJBFEMB-UHFFFAOYSA-N 4-(trifluoromethyl)phenol Chemical compound OC1=CC=C(C(F)(F)F)C=C1 BAYGVMXZJBFEMB-UHFFFAOYSA-N 0.000 description 1
- PRYWVXRFNZLRKO-UHFFFAOYSA-N 4-[4-chloro-3-(trifluoromethyl)phenoxy]benzaldehyde Chemical compound C1=C(Cl)C(C(F)(F)F)=CC(OC=2C=CC(C=O)=CC=2)=C1 PRYWVXRFNZLRKO-UHFFFAOYSA-N 0.000 description 1
- GQGVBSHMRYHBTF-UOWFLXDJSA-N 4-amino-1-[(2r,4r,5r)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one Chemical compound O=C1N=C(N)N=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 GQGVBSHMRYHBTF-UOWFLXDJSA-N 0.000 description 1
- MBDUKNCPOPMRJQ-UHFFFAOYSA-N 4-amino-2-chlorobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C(Cl)=C1 MBDUKNCPOPMRJQ-UHFFFAOYSA-N 0.000 description 1
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 description 1
- WDFQBORIUYODSI-IDEBNGHGSA-N 4-bromoaniline Chemical group N[13C]1=[13CH][13CH]=[13C](Br)[13CH]=[13CH]1 WDFQBORIUYODSI-IDEBNGHGSA-N 0.000 description 1
- GZFGOTFRPZRKDS-UHFFFAOYSA-N 4-bromophenol Chemical compound OC1=CC=C(Br)C=C1 GZFGOTFRPZRKDS-UHFFFAOYSA-N 0.000 description 1
- RJTDVQUMWKUFAK-UHFFFAOYSA-N 4-but-3-enyl-1,3-dioxolane Chemical compound C=CCCC1COCO1 RJTDVQUMWKUFAK-UHFFFAOYSA-N 0.000 description 1
- ZLFPIEUWXNRPNM-UHFFFAOYSA-N 4-chloro-3-(trifluoromethyl)phenol Chemical group OC1=CC=C(Cl)C(C(F)(F)F)=C1 ZLFPIEUWXNRPNM-UHFFFAOYSA-N 0.000 description 1
- XLHYAEBESNFTCA-UHFFFAOYSA-N 4-chloro-3-fluorophenol Chemical group OC1=CC=C(Cl)C(F)=C1 XLHYAEBESNFTCA-UHFFFAOYSA-N 0.000 description 1
- XCEYKKJMLOFDSS-UHFFFAOYSA-N 4-chloro-n-methylaniline Chemical group CNC1=CC=C(Cl)C=C1 XCEYKKJMLOFDSS-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- WWQQPHUHTAZWDH-UHFFFAOYSA-N 4-ethylbenzenethiol Chemical group CCC1=CC=C(S)C=C1 WWQQPHUHTAZWDH-UHFFFAOYSA-N 0.000 description 1
- RHMPLDJJXGPMEX-UHFFFAOYSA-N 4-fluorophenol Chemical compound OC1=CC=C(F)C=C1 RHMPLDJJXGPMEX-UHFFFAOYSA-N 0.000 description 1
- VSMDINRNYYEDRN-UHFFFAOYSA-N 4-iodophenol Chemical compound OC1=CC=C(I)C=C1 VSMDINRNYYEDRN-UHFFFAOYSA-N 0.000 description 1
- NIFAOMSJMGEFTQ-UHFFFAOYSA-N 4-methoxybenzenethiol Chemical compound COC1=CC=C(S)C=C1 NIFAOMSJMGEFTQ-UHFFFAOYSA-N 0.000 description 1
- PHNDZBFLOPIMSM-UHFFFAOYSA-N 4-morpholin-4-ylaniline Chemical group C1=CC(N)=CC=C1N1CCOCC1 PHNDZBFLOPIMSM-UHFFFAOYSA-N 0.000 description 1
- DQJMCXJPJBFAKP-UHFFFAOYSA-N 4-naphthalen-2-yloxybenzaldehyde Chemical compound C1=CC(C=O)=CC=C1OC1=CC=C(C=CC=C2)C2=C1 DQJMCXJPJBFAKP-UHFFFAOYSA-N 0.000 description 1
- TYMLOMAKGOJONV-IDEBNGHGSA-N 4-nitroaniline Chemical group N[13C]1=[13CH][13CH]=[13C]([N+]([O-])=O)[13CH]=[13CH]1 TYMLOMAKGOJONV-IDEBNGHGSA-N 0.000 description 1
- BXRFQSNOROATLV-UHFFFAOYSA-N 4-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(C=O)C=C1 BXRFQSNOROATLV-UHFFFAOYSA-N 0.000 description 1
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 1
- OVKDCYKVNYLEHK-UHFFFAOYSA-N 4-phenyl-1,3-dioxolane Chemical compound O1COCC1C1=CC=CC=C1 OVKDCYKVNYLEHK-UHFFFAOYSA-N 0.000 description 1
- NNJMFJSKMRYHSR-UHFFFAOYSA-M 4-phenylbenzoate Chemical compound C1=CC(C(=O)[O-])=CC=C1C1=CC=CC=C1 NNJMFJSKMRYHSR-UHFFFAOYSA-M 0.000 description 1
- NMLYGLCBSFKJFI-UHFFFAOYSA-N 4-pyridin-2-ylbenzaldehyde Chemical compound C1=CC(C=O)=CC=C1C1=CC=CC=N1 NMLYGLCBSFKJFI-UHFFFAOYSA-N 0.000 description 1
- VNZCKMVWWJJZIL-UHFFFAOYSA-N 4-pyridin-3-yloxybenzaldehyde Chemical compound C1=CC(C=O)=CC=C1OC1=CC=CN=C1 VNZCKMVWWJJZIL-UHFFFAOYSA-N 0.000 description 1
- ODGIMMLDVSWADK-UHFFFAOYSA-N 4-trifluoromethylaniline Chemical group NC1=CC=C(C(F)(F)F)C=C1 ODGIMMLDVSWADK-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- NTCIAFWCCFAZLW-UHFFFAOYSA-N 5,5-dibromo-1,3-dioxane Chemical compound BrC1(Br)COCOC1 NTCIAFWCCFAZLW-UHFFFAOYSA-N 0.000 description 1
- UMKXSOXZAXIOPJ-UHFFFAOYSA-N 5,6,7,8-tetrahydro-2-naphthol Chemical compound C1CCCC2=CC(O)=CC=C21 UMKXSOXZAXIOPJ-UHFFFAOYSA-N 0.000 description 1
- WOVKYSAHUYNSMH-RRKCRQDMSA-N 5-bromodeoxyuridine Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(Br)=C1 WOVKYSAHUYNSMH-RRKCRQDMSA-N 0.000 description 1
- KKFPXGXMSBBNJI-UHFFFAOYSA-N 5-chloro-2-methylphenol Chemical group CC1=CC=C(Cl)C=C1O KKFPXGXMSBBNJI-UHFFFAOYSA-N 0.000 description 1
- JLECSPKJBGOVBW-UHFFFAOYSA-N 5-methylidene-1,3-dioxane Chemical compound C=C1COCOC1 JLECSPKJBGOVBW-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- GDUCSOHYPPLYFQ-UHFFFAOYSA-N 6-(4-chlorophenyl)sulfanylpyridine-3-carbaldehyde Chemical compound C1=CC(Cl)=CC=C1SC1=CC=C(C=O)C=N1 GDUCSOHYPPLYFQ-UHFFFAOYSA-N 0.000 description 1
- SISORSWVBWIJDU-UHFFFAOYSA-N 6-(4-methylphenoxy)pyridine-3-carbaldehyde Chemical compound C1=CC(C)=CC=C1OC1=CC=C(C=O)C=N1 SISORSWVBWIJDU-UHFFFAOYSA-N 0.000 description 1
- MOXXJTNUXDALFN-UHFFFAOYSA-N 6-(4-methylphenyl)sulfanylpyridine-3-carbaldehyde Chemical compound C1=CC(C)=CC=C1SC1=CC=C(C=O)C=N1 MOXXJTNUXDALFN-UHFFFAOYSA-N 0.000 description 1
- WYWHKKSPHMUBEB-UHFFFAOYSA-N 6-Mercaptoguanine Natural products N1C(N)=NC(=S)C2=C1N=CN2 WYWHKKSPHMUBEB-UHFFFAOYSA-N 0.000 description 1
- NUWWXSLQJUYGOW-UHFFFAOYSA-N 6-amino-5-nitro-1h-pyridin-2-one;hydrobromide Chemical compound Br.NC1=NC(O)=CC=C1[N+]([O-])=O NUWWXSLQJUYGOW-UHFFFAOYSA-N 0.000 description 1
- PBCZSGKMGDDXIJ-UHFFFAOYSA-N 7beta-hydroxystaurosporine Natural products C12=C3N4C5=CC=CC=C5C3=C3C(O)NC(=O)C3=C2C2=CC=CC=C2N1C1CC(NC)C(OC)C4(C)O1 PBCZSGKMGDDXIJ-UHFFFAOYSA-N 0.000 description 1
- 108700028369 Alleles Proteins 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 206010003571 Astrocytoma Diseases 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 108010006654 Bleomycin Proteins 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 101100220616 Caenorhabditis elegans chk-2 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- DLGOEMSEDOSKAD-UHFFFAOYSA-N Carmustine Chemical compound ClCCNC(=O)N(N=O)CCCl DLGOEMSEDOSKAD-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- PTOAARAWEBMLNO-KVQBGUIXSA-N Cladribine Chemical compound C1=NC=2C(N)=NC(Cl)=NC=2N1[C@H]1C[C@H](O)[C@@H](CO)O1 PTOAARAWEBMLNO-KVQBGUIXSA-N 0.000 description 1
- 206010009944 Colon cancer Diseases 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 1
- UHDGCWIWMRVCDJ-CCXZUQQUSA-N Cytarabine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1 UHDGCWIWMRVCDJ-CCXZUQQUSA-N 0.000 description 1
- 102100033215 DNA nucleotidylexotransferase Human genes 0.000 description 1
- 108010008286 DNA nucleotidylexotransferase Proteins 0.000 description 1
- 230000033616 DNA repair Effects 0.000 description 1
- 231100001074 DNA strand break Toxicity 0.000 description 1
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- 108050002772 E3 ubiquitin-protein ligase Mdm2 Proteins 0.000 description 1
- 102000012199 E3 ubiquitin-protein ligase Mdm2 Human genes 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- 206010073306 Exposure to radiation Diseases 0.000 description 1
- 108010040476 FITC-annexin A5 Proteins 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 241000380126 Gymnosteris Species 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- GQYIWUVLTXOXAJ-UHFFFAOYSA-N Lomustine Chemical compound ClCCN(N=O)C(=O)NC1CCCCC1 GQYIWUVLTXOXAJ-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 241001529936 Murinae Species 0.000 description 1
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 1
- 125000003047 N-acetyl group Chemical group 0.000 description 1
- PWRXBBUHVHBQBP-UHFFFAOYSA-N NC(c(cc1)cc2c1[nH]c(-c(cc1)ccc1SOC(Nc(c(Cl)c1)ccc1Cl)=O)n2)=O Chemical compound NC(c(cc1)cc2c1[nH]c(-c(cc1)ccc1SOC(Nc(c(Cl)c1)ccc1Cl)=O)n2)=O PWRXBBUHVHBQBP-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 108700020796 Oncogene Proteins 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 229920001213 Polysorbate 20 Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 229940124158 Protease/peptidase inhibitor Drugs 0.000 description 1
- 239000012979 RPMI medium Substances 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 229920002536 Scavenger resin Polymers 0.000 description 1
- 241000235347 Schizosaccharomyces pombe Species 0.000 description 1
- 101000944321 Schizosaccharomyces pombe (strain 972 / ATCC 24843) Serine/threonine-protein kinase cds1 Proteins 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 108010090804 Streptavidin Proteins 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- FOCVUCIESVLUNU-UHFFFAOYSA-N Thiotepa Chemical compound C1CN1P(N1CC1)(=S)N1CC1 FOCVUCIESVLUNU-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 102000040945 Transcription factor Human genes 0.000 description 1
- 108091023040 Transcription factor Proteins 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- XAKBSHICSHRJCL-UHFFFAOYSA-N [CH2]C(=O)C1=CC=CC=C1 Chemical group [CH2]C(=O)C1=CC=CC=C1 XAKBSHICSHRJCL-UHFFFAOYSA-N 0.000 description 1
- BLQCQNFLEGAHPA-RRKCRQDMSA-N [[(2r,3s,5r)-5-(5-bromo-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound O1[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)C[C@@H]1N1C(=O)NC(=O)C(Br)=C1 BLQCQNFLEGAHPA-RRKCRQDMSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 125000005585 adamantoate group Chemical group 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000004450 alkenylene group Chemical group 0.000 description 1
- 125000005256 alkoxyacyl group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 208000030961 allergic reaction Diseases 0.000 description 1
- 108010004469 allophycocyanin Proteins 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 230000006229 amino acid addition Effects 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 150000005415 aminobenzoic acids Chemical class 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 229960004909 aminosalicylic acid Drugs 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- YCOXTKKNXUZSKD-UHFFFAOYSA-N as-o-xylenol Natural products CC1=CC=C(O)C=C1C YCOXTKKNXUZSKD-UHFFFAOYSA-N 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- VSRXQHXAPYXROS-UHFFFAOYSA-N azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OC(=O)C1(C(O)=O)CCC1 VSRXQHXAPYXROS-UHFFFAOYSA-N 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- XMIIGOLPHOKFCH-UHFFFAOYSA-N beta-phenylpropanoic acid Natural products OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 1
- 229950011260 betanaphthol Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 229960002685 biotin Drugs 0.000 description 1
- 235000020958 biotin Nutrition 0.000 description 1
- 239000011616 biotin Substances 0.000 description 1
- 229960001561 bleomycin Drugs 0.000 description 1
- OYVAGSVQBOHSSS-UAPAGMARSA-O bleomycin A2 Chemical compound N([C@H](C(=O)N[C@H](C)[C@@H](O)[C@H](C)C(=O)N[C@@H]([C@H](O)C)C(=O)NCCC=1SC=C(N=1)C=1SC=C(N=1)C(=O)NCCC[S+](C)C)[C@@H](O[C@H]1[C@H]([C@@H](O)[C@H](O)[C@H](CO)O1)O[C@@H]1[C@H]([C@@H](OC(N)=O)[C@H](O)[C@@H](CO)O1)O)C=1N=CNC=1)C(=O)C1=NC([C@H](CC(N)=O)NC[C@H](N)C(N)=O)=NC(N)=C1C OYVAGSVQBOHSSS-UAPAGMARSA-O 0.000 description 1
- 229940098773 bovine serum albumin Drugs 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 229960002092 busulfan Drugs 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- FATUQANACHZLRT-KMRXSBRUSA-L calcium glucoheptonate Chemical compound [Ca+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)C([O-])=O FATUQANACHZLRT-KMRXSBRUSA-L 0.000 description 1
- STNNHWPJRRODGI-UHFFFAOYSA-N carbonic acid;n,n-diethylethanamine Chemical compound [O-]C([O-])=O.CC[NH+](CC)CC.CC[NH+](CC)CC STNNHWPJRRODGI-UHFFFAOYSA-N 0.000 description 1
- 229960004562 carboplatin Drugs 0.000 description 1
- 229960005243 carmustine Drugs 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000022131 cell cycle Effects 0.000 description 1
- 230000012820 cell cycle checkpoint Effects 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000013000 chemical inhibitor Substances 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 210000000038 chest Anatomy 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-M chloroacetate Chemical compound [O-]C(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-M 0.000 description 1
- 229940089960 chloroacetate Drugs 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 125000000490 cinnamyl group Chemical group C(C=CC1=CC=CC=C1)* 0.000 description 1
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 1
- 229960004316 cisplatin Drugs 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 229960002436 cladribine Drugs 0.000 description 1
- 230000005025 clonogenic survival Effects 0.000 description 1
- 210000001072 colon Anatomy 0.000 description 1
- 208000029742 colonic neoplasm Diseases 0.000 description 1
- 238000002648 combination therapy Methods 0.000 description 1
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 229960004397 cyclophosphamide Drugs 0.000 description 1
- 229960000684 cytarabine Drugs 0.000 description 1
- 229960003901 dacarbazine Drugs 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 229940120124 dichloroacetate Drugs 0.000 description 1
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000003534 dna topoisomerase inhibitor Substances 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-M dodecanoate Chemical compound CCCCCCCCCCCC([O-])=O POULHZVOKOAJMA-UHFFFAOYSA-M 0.000 description 1
- 229960004679 doxorubicin Drugs 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 238000000132 electrospray ionisation Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 210000003743 erythrocyte Anatomy 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- VJJPUSNTGOMMGY-MRVIYFEKSA-N etoposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@H](C)OC[C@H]4O3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 VJJPUSNTGOMMGY-MRVIYFEKSA-N 0.000 description 1
- 229960005420 etoposide Drugs 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012894 fetal calf serum Substances 0.000 description 1
- ODKNJVUHOIMIIZ-RRKCRQDMSA-N floxuridine Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(F)=C1 ODKNJVUHOIMIIZ-RRKCRQDMSA-N 0.000 description 1
- 229960000961 floxuridine Drugs 0.000 description 1
- MHMNJMPURVTYEJ-UHFFFAOYSA-N fluorescein-5-isothiocyanate Chemical compound O1C(=O)C2=CC(N=C=S)=CC=C2C21C1=CC=C(O)C=C1OC1=CC(O)=CC=C21 MHMNJMPURVTYEJ-UHFFFAOYSA-N 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 229960002949 fluorouracil Drugs 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000005338 frosted glass Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 210000000442 hair follicle cell Anatomy 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 210000003128 head Anatomy 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004404 heteroalkyl group Chemical group 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-M hexadecanoate Chemical compound CCCCCCCCCCCCCCCC([O-])=O IPCSVZSSVZVIGE-UHFFFAOYSA-M 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 210000005260 human cell Anatomy 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- TUJKJAMUKRIRHC-UHFFFAOYSA-N hydroxyl Chemical class [OH] TUJKJAMUKRIRHC-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- HOMGKSMUEGBAAB-UHFFFAOYSA-N ifosfamide Chemical compound ClCCNP1(=O)OCCCN1CCCl HOMGKSMUEGBAAB-UHFFFAOYSA-N 0.000 description 1
- 229960001101 ifosfamide Drugs 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 150000005232 imidazopyridines Chemical class 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 239000007972 injectable composition Substances 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- UWKQSNNFCGGAFS-XIFFEERXSA-N irinotecan Chemical compound C1=C2C(CC)=C3CN(C(C4=C([C@@](C(=O)OC4)(O)CC)C=4)=O)C=4C3=NC2=CC=C1OC(=O)N(CC1)CCC1N1CCCCC1 UWKQSNNFCGGAFS-XIFFEERXSA-N 0.000 description 1
- 229960004768 irinotecan Drugs 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 235000021190 leftovers Nutrition 0.000 description 1
- 229940058352 levulinate Drugs 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 229960002247 lomustine Drugs 0.000 description 1
- 210000003141 lower extremity Anatomy 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 229960004961 mechlorethamine Drugs 0.000 description 1
- HAWPXGHAZFHHAD-UHFFFAOYSA-N mechlorethamine Chemical compound ClCCN(C)CCCl HAWPXGHAZFHHAD-UHFFFAOYSA-N 0.000 description 1
- 238000002483 medication Methods 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- SGDBTWWWUNNDEQ-LBPRGKRZSA-N melphalan Chemical compound OC(=O)[C@@H](N)CC1=CC=C(N(CCCl)CCCl)C=C1 SGDBTWWWUNNDEQ-LBPRGKRZSA-N 0.000 description 1
- 229960001924 melphalan Drugs 0.000 description 1
- GLVAUDGFNGKCSF-UHFFFAOYSA-N mercaptopurine Chemical compound S=C1NC=NC2=C1NC=N2 GLVAUDGFNGKCSF-UHFFFAOYSA-N 0.000 description 1
- 229960001428 mercaptopurine Drugs 0.000 description 1
- 239000002207 metabolite Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 229960000485 methotrexate Drugs 0.000 description 1
- RMIODHQZRUFFFF-UHFFFAOYSA-M methoxyacetate Chemical compound COCC([O-])=O RMIODHQZRUFFFF-UHFFFAOYSA-M 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- CBKFHSNATJJWQK-UHFFFAOYSA-N n-pyridin-3-ylformamide Chemical class O=CNC1=CC=CN=C1 CBKFHSNATJJWQK-UHFFFAOYSA-N 0.000 description 1
- 125000005487 naphthalate group Chemical group 0.000 description 1
- 210000003739 neck Anatomy 0.000 description 1
- 125000004971 nitroalkyl group Chemical group 0.000 description 1
- 125000006574 non-aromatic ring group Chemical group 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 125000003729 nucleotide group Chemical group 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 210000001672 ovary Anatomy 0.000 description 1
- 229940039748 oxalate Drugs 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- AICOOMRHRUFYCM-ZRRPKQBOSA-N oxazine, 1 Chemical compound C([C@@H]1[C@H](C(C[C@]2(C)[C@@H]([C@H](C)N(C)C)[C@H](O)C[C@]21C)=O)CC1=CC2)C[C@H]1[C@@]1(C)[C@H]2N=C(C(C)C)OC1 AICOOMRHRUFYCM-ZRRPKQBOSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical group COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 125000006505 p-cyanobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C#N)C([H])([H])* 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 108700025694 p53 Genes Proteins 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- MRDGZSKYFPGAKP-UHFFFAOYSA-N para-methoxyphenylpiperazine Chemical compound C1=CC(OC)=CC=C1N1CCNCC1 MRDGZSKYFPGAKP-UHFFFAOYSA-N 0.000 description 1
- 239000003961 penetration enhancing agent Substances 0.000 description 1
- QMMOXUPEWRXHJS-UHFFFAOYSA-N pentene-2 Natural products CCC=CC QMMOXUPEWRXHJS-UHFFFAOYSA-N 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000006194 pentinyl group Chemical group 0.000 description 1
- FPVKHBSQESCIEP-JQCXWYLXSA-N pentostatin Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(N=CNC[C@H]2O)=C2N=C1 FPVKHBSQESCIEP-JQCXWYLXSA-N 0.000 description 1
- 229960002340 pentostatin Drugs 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000137 peptide hydrolase inhibitor Substances 0.000 description 1
- LCPDWSOZIOUXRV-UHFFFAOYSA-N phenoxyacetic acid Chemical compound OC(=O)COC1=CC=CC=C1 LCPDWSOZIOUXRV-UHFFFAOYSA-N 0.000 description 1
- 229940049953 phenylacetate Drugs 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- FAQJJMHZNSSFSM-UHFFFAOYSA-N phenylglyoxylic acid Chemical compound OC(=O)C(=O)C1=CC=CC=C1 FAQJJMHZNSSFSM-UHFFFAOYSA-N 0.000 description 1
- NIXKBAZVOQAHGC-UHFFFAOYSA-N phenylmethanesulfonic acid Chemical compound OS(=O)(=O)CC1=CC=CC=C1 NIXKBAZVOQAHGC-UHFFFAOYSA-N 0.000 description 1
- YZTJYBJCZXZGCT-UHFFFAOYSA-N phenylpiperazine Chemical compound C1CNCCN1C1=CC=CC=C1 YZTJYBJCZXZGCT-UHFFFAOYSA-N 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 239000002953 phosphate buffered saline Substances 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 230000000865 phosphorylative effect Effects 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- 229960005235 piperonyl butoxide Drugs 0.000 description 1
- 125000004591 piperonyl group Chemical group C(C1=CC=2OCOC2C=C1)* 0.000 description 1
- 125000005547 pivalate group Chemical group 0.000 description 1
- 238000007747 plating Methods 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 1
- 238000002600 positron emission tomography Methods 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 238000004321 preservation Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 229960000624 procarbazine Drugs 0.000 description 1
- CPTBDICYNRMXFX-UHFFFAOYSA-N procarbazine Chemical compound CNNCC1=CC=C(C(=O)NC(C)C)C=C1 CPTBDICYNRMXFX-UHFFFAOYSA-N 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical group CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 210000002307 prostate Anatomy 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- ZZYXNRREDYWPLN-UHFFFAOYSA-N pyridine-2,3-diamine Chemical compound NC1=CC=CN=C1N ZZYXNRREDYWPLN-UHFFFAOYSA-N 0.000 description 1
- GZRKXKUVVPSREJ-UHFFFAOYSA-N pyridinylpiperazine Chemical compound C1CNCCN1C1=CC=CC=N1 GZRKXKUVVPSREJ-UHFFFAOYSA-N 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- 238000011002 quantification Methods 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 230000002285 radioactive effect Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000028617 response to DNA damage stimulus Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 238000003345 scintillation counting Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 238000009097 single-agent therapy Methods 0.000 description 1
- 238000002603 single-photon emission computed tomography Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 210000000952 spleen Anatomy 0.000 description 1
- 230000003393 splenic effect Effects 0.000 description 1
- 210000004988 splenocyte Anatomy 0.000 description 1
- 239000004544 spot-on Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- ZSJLQEPLLKMAKR-GKHCUFPYSA-N streptozocin Chemical compound O=NN(C)C(=O)N[C@H]1[C@@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O ZSJLQEPLLKMAKR-GKHCUFPYSA-N 0.000 description 1
- 229960001052 streptozocin Drugs 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 125000004963 sulfonylalkyl group Chemical group 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- LAJZODKXOMJMPK-UHFFFAOYSA-N tellurium dioxide Chemical compound O=[Te]=O LAJZODKXOMJMPK-UHFFFAOYSA-N 0.000 description 1
- NRUKOCRGYNPUPR-QBPJDGROSA-N teniposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@@H](OC[C@H]4O3)C=3SC=CC=3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 NRUKOCRGYNPUPR-QBPJDGROSA-N 0.000 description 1
- 229960001278 teniposide Drugs 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- 125000004632 tetrahydrothiopyranyl group Chemical group S1C(CCCC1)* 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 229960001196 thiotepa Drugs 0.000 description 1
- 210000001541 thymus gland Anatomy 0.000 description 1
- GZNAASVAJNXPPW-UHFFFAOYSA-M tin(4+) chloride dihydrate Chemical compound O.O.[Cl-].[Sn+4] GZNAASVAJNXPPW-UHFFFAOYSA-M 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Substances O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 1
- MNRILEROXIRVNJ-UHFFFAOYSA-N tioguanine Chemical compound N1C(N)=NC(=S)C2=NC=N[C]21 MNRILEROXIRVNJ-UHFFFAOYSA-N 0.000 description 1
- 229960003087 tioguanine Drugs 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 239000012049 topical pharmaceutical composition Substances 0.000 description 1
- 229940044693 topoisomerase inhibitor Drugs 0.000 description 1
- UCFGDBYHRUNTLO-QHCPKHFHSA-N topotecan Chemical compound C1=C(O)C(CN(C)C)=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 UCFGDBYHRUNTLO-QHCPKHFHSA-N 0.000 description 1
- 229960000303 topotecan Drugs 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 229940066528 trichloroacetate Drugs 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- 125000000025 triisopropylsilyl group Chemical group C(C)(C)[Si](C(C)C)(C(C)C)* 0.000 description 1
- 239000013638 trimer Substances 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 238000013042 tunel staining Methods 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 229940070710 valerate Drugs 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 235000012431 wafers Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 125000001834 xanthenyl group Chemical group C1=CC=CC=2OC3=CC=CC=C3C(C12)* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/18—Benzimidazoles; Hydrogenated benzimidazoles with aryl radicals directly attached in position 2
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/10—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Veterinary Medicine (AREA)
- Pharmacology & Pharmacy (AREA)
- Public Health (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US33030401P | 2001-10-19 | 2001-10-19 | |
| US330304P | 2001-10-19 | ||
| PCT/US2002/033371 WO2003032984A1 (en) | 2001-10-19 | 2002-10-18 | 2-phenyl benzimidazoles and imidazo-[4,5]-pyridines as cdsi/chk2-inhibitors and adjuvants to chemotherapy or radiation therapy in the treatment of cancer |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE60221866D1 DE60221866D1 (de) | 2007-09-27 |
| DE60221866T2 true DE60221866T2 (de) | 2008-05-29 |
Family
ID=23289169
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE60221866T Expired - Lifetime DE60221866T2 (de) | 2001-10-19 | 2002-10-18 | 2-PHENYL BENZIMIDAZOLE UND IMIDAZO-i4,5ö-PYRIDINE ALS CDS1/CHK2-INHIBITOREN UND ADJUVANTIEN IN DER CHEMOTHERAPIE ODER STRAHLUNGSTHERAPIE ZUR BEHANDLUNG VON KREBS |
Country Status (12)
| Country | Link |
|---|---|
| US (2) | US7271261B2 (https=) |
| EP (1) | EP1435947B1 (https=) |
| JP (1) | JP4637481B2 (https=) |
| AT (1) | ATE369854T1 (https=) |
| BR (1) | BR0206161A (https=) |
| CA (1) | CA2464000C (https=) |
| DE (1) | DE60221866T2 (https=) |
| ES (1) | ES2292812T3 (https=) |
| NO (1) | NO20032759L (https=) |
| RS (1) | RS50939B (https=) |
| WO (1) | WO2003032984A1 (https=) |
| ZA (1) | ZA200305533B (https=) |
Families Citing this family (52)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN101870691A (zh) | 2002-08-19 | 2010-10-27 | 劳洛斯治疗公司 | 2,4,5-三取代的咪唑及其作为抗菌剂的用途 |
| DE10243027A1 (de) * | 2002-09-17 | 2004-03-25 | Bayer Ag | 2-Phenyl-benzimidazol-5-sulfonsäure aus isolierter 3,4-Diaminobenzol-sulfonsäure sowie deren Verwendung in kosmetischen Zubereitungen |
| US7132440B2 (en) | 2003-04-17 | 2006-11-07 | Janssen Pharmaceutica, N.V. | Substituted benzimidazoles and imidazo-[4,5]-pyridines |
| US20050078598A1 (en) * | 2003-08-21 | 2005-04-14 | Anuj Batra | Enhancement to the multi-band OFDM physical layer |
| CA2545942C (en) | 2003-11-14 | 2012-07-10 | Lorus Therapeutics Inc. | Aryl imidazoles and their use as anti-cancer agents |
| ES2362102T3 (es) * | 2004-06-30 | 2011-06-28 | Janssen Pharmaceutica Nv | Eteres de bencimidazol e imidazopiridina sustituidos con arilo como agentes anticáncer. |
| KR20060087386A (ko) * | 2005-01-28 | 2006-08-02 | 주식회사 대웅제약 | 신규 벤조이미다졸 유도체 및 이를 함유하는 약제학적조성물 |
| AU2006209117B2 (en) * | 2005-01-28 | 2009-12-10 | Daewoong Pharmaceutical Co., Ltd. | Novel benzoimidazole derivatives and pharmaceutical composition comprising the same |
| US7534796B2 (en) | 2005-02-18 | 2009-05-19 | Wyeth | Imidazo[4,5-b]pyridine antagonists of gonadotropin releasing hormone receptor |
| US7538113B2 (en) | 2005-02-18 | 2009-05-26 | Wyeth | 4-substituted imidazo[4,5-c]pyridine antagonists of gonadotropin releasing hormone receptor |
| US7582634B2 (en) | 2005-02-18 | 2009-09-01 | Wyeth | 7-substituted imidazo[4,5-c]pyridine antagonists of gonadotropin releasing hormone receptor |
| US20060223849A1 (en) | 2005-03-14 | 2006-10-05 | Mjalli Adnan M | Benzazole derivatives, compositions, and methods of use as beta-secretase inhibitors |
| US7531542B2 (en) | 2005-05-18 | 2009-05-12 | Wyeth | Benzooxazole and benzothiazole antagonists of gonadotropin releasing hormone receptor |
| AU2006250809B2 (en) | 2005-05-25 | 2011-05-12 | Lorus Therapeutics Inc. | 2-indolyl imidazo(4,5-D)phenanthroline derivatives and their use in the treatment of cancer |
| US7582636B2 (en) | 2005-05-26 | 2009-09-01 | Wyeth | Piperazinylimidazopyridine and piperazinyltriazolopyridine antagonists of Gonadotropin Releasing Hormone receptor |
| CA2612419C (en) * | 2005-06-23 | 2017-06-13 | Array Biopharma Inc. | Process for preparing benzimidazole compounds |
| JP5301999B2 (ja) * | 2005-10-31 | 2013-09-25 | メルク・シャープ・アンド・ドーム・コーポレーション | Cetp阻害薬 |
| JP5054770B2 (ja) | 2006-07-11 | 2012-10-24 | デウン ファーマシューティカル カンパニー リミテッド | 新規のビアリールベンゾイミダゾール誘導体及びこれを含む医薬組成物 |
| FR2904314A1 (fr) * | 2006-07-26 | 2008-02-01 | Centre Nat Rech Scient | Composes pyridaziniques et pyrroliques lineaires, procedes d'obtention et applications |
| AR063311A1 (es) * | 2006-10-18 | 2009-01-21 | Novartis Ag | Compuestos organicos |
| CA2681162C (en) | 2007-03-15 | 2015-11-24 | Novartis Ag | Benzyl and pyridine derivatives as modulators of hedgehog pathway |
| ATE518839T1 (de) * | 2007-08-23 | 2011-08-15 | Sanofi Sa | Azoloarin derivate, verfahren zu deren herstellung, diese verbindungen enthaltende arzneimittel und deren verwendung |
| GB0719644D0 (en) | 2007-10-05 | 2007-11-14 | Cancer Rec Tech Ltd | Therapeutic compounds and their use |
| CA2709203A1 (en) * | 2007-12-13 | 2009-06-18 | Siena Biotech S.P.A. | Hedgehog pathway antagonists and therapeutic applications thereof |
| JP2009171854A (ja) * | 2008-01-21 | 2009-08-06 | Olympus Corp | 細胞洗浄方法および移植物の製造方法 |
| GB0803018D0 (en) | 2008-02-19 | 2008-03-26 | Cancer Rec Tech Ltd | Therapeutic compounds and their use |
| WO2009129625A1 (en) * | 2008-04-22 | 2009-10-29 | Merck Frosst Canada Ltd. | Novel substituted heteroaromatic compounds as inhibitors of stearoyl-coenzyme a delta-9 desaturase |
| US20100041663A1 (en) | 2008-07-18 | 2010-02-18 | Novartis Ag | Organic Compounds as Smo Inhibitors |
| JP2012525389A (ja) | 2009-04-27 | 2012-10-22 | ハイ ポイント ファーマシューティカルズ,リミティド ライアビリティ カンパニー | 置換イソキノリン誘導体、医薬組成物、及びβ−セクレターゼ阻害剤としての使用方法 |
| EP2549874A4 (en) | 2010-03-23 | 2013-10-02 | High Point Pharmaceuticals Llc | SUBSTITUTED IMIDAZOLE [1,2-B] PYRIDAZINE DERIVATIVES, PHARMACEUTICAL COMPOSITIONS, AND METHODS OF USE AS BETA-SECRETASE INHIBITORS |
| US8609672B2 (en) | 2010-08-27 | 2013-12-17 | University Of The Pacific | Piperazinylpyrimidine analogues as protein kinase inhibitors |
| CA2810252C (en) * | 2010-09-10 | 2019-03-12 | Bio-Rad Laboratories, Inc. | Detection of rna-interacting regions in dna |
| MY165659A (en) * | 2010-09-28 | 2018-04-18 | Dae Woong Pharma | Novel method of preparing benzoimidazole derivatives |
| WO2012112606A1 (en) | 2011-02-15 | 2012-08-23 | Bio-Rad Laboratories, Inc. | Detecting methylati0n in a subpopulation of genomic dna |
| KR101387970B1 (ko) | 2011-04-20 | 2014-04-25 | 인제대학교 산학협력단 | 암 예방 및 치료용 조성물 및 건강기능식품 |
| JP6073910B2 (ja) | 2011-11-09 | 2017-02-01 | キャンサー・リサーチ・テクノロジー・リミテッド | 5−(ピリジン−2−イル−アミノ)−ピラジン−2−カルボニトリル化合物及びその治療使用 |
| ES2624307T3 (es) | 2012-05-15 | 2017-07-13 | Cancer Research Technology Ltd | 5-[[4-[[Morfolin-2-il]metilamino]-5-(trifluorometil)-2-piridil]amino]pirazin-2-carbonitrilo y usos terapéuticos del mismo |
| KR20160042811A (ko) | 2013-03-20 | 2016-04-20 | 압토스 바이오사이언시스 인코포레이티드 | 2-치환 이미다조[4,5-d]페난쓰롤린 유도체 및 암 치료에 있어서의 이의 용도 |
| CN103288803B (zh) * | 2013-05-17 | 2017-10-31 | 郎恒元 | 苯并咪唑酰胺类化合物及其制备方法和应用 |
| WO2015051304A1 (en) | 2013-10-04 | 2015-04-09 | Aptose Biosciences Inc. | Compositions, biomarkers and their use in treatment of cancer |
| CN104194778B (zh) * | 2014-09-25 | 2016-03-30 | 黑龙江大学 | 磷氧基团修饰n-苯基-苯并咪唑电子传输材料、合成方法及电致磷光器件的制备方法 |
| ES2973850T3 (es) * | 2016-09-20 | 2024-06-24 | Centre Leon Berard | Derivados del benzoimidazol como agentes anticancerígenos |
| WO2019089511A1 (en) | 2017-10-30 | 2019-05-09 | Aptose Biosciences Inc. | Aryl imidazoles for the treatment of cancer |
| WO2019243523A1 (en) | 2018-06-21 | 2019-12-26 | Cellestia Biotech Ag | Process for making amino diaryl ethers and amino diaryl ethers hydrochloride salts |
| BR112021020226A2 (pt) * | 2019-04-10 | 2021-12-07 | Cellestia Biotech Ag | Inibidores de via de sinalização notch e uso dos mesmos no tratamento de cânceres |
| CA3141405A1 (en) * | 2019-06-12 | 2020-12-17 | H. Charles Manning | Amino acid transport inhibitors and the uses thereof |
| TW202204348A (zh) | 2020-04-07 | 2022-02-01 | 美商西爾拉癌症醫學公司 | Chk1抑制劑之合成方法 |
| PT4408840T (pt) | 2021-09-27 | 2025-10-07 | Terns Pharmaceuticals Inc | Ácidos benzimidazolocarboxílicos como agonistas de glp-1r |
| CN118401519A (zh) | 2021-10-25 | 2024-07-26 | 拓臻制药公司 | 作为glp-1r激动剂的化合物 |
| CN119095843A (zh) | 2022-02-23 | 2024-12-06 | 拓臻制药公司 | 作为glp-1r激动剂的化合物 |
| EP4568664B1 (en) | 2023-04-07 | 2026-04-01 | Terns Pharmaceuticals, Inc. | Combination comprising a thr-beta agonist and a glp-1r agonist for use in treating obesity |
| CN119552166B (zh) * | 2024-11-29 | 2025-10-17 | 中国药科大学 | 一种parp1/cdk6双靶点抑制剂及其制备方法与应用 |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3346575A1 (de) | 1983-12-23 | 1985-07-04 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue benzimidazole, ihre herstellung und diese verbindungen enthaltende arzneimittel |
| LU85544A1 (fr) * | 1984-09-19 | 1986-04-03 | Cird | Derives heterocycliques aromatiques,leur procede de preparation et leur application dans les domaines therapeutique et cosmetique |
| DE3522230A1 (de) | 1985-06-21 | 1987-01-02 | Thomae Gmbh Dr K | Neue 2-arylimidazole, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung |
| GB9108279D0 (en) * | 1991-04-18 | 1991-06-05 | Ucb Sa | A method of preparing 1h-benzimidazoles |
| US5821258A (en) | 1994-12-27 | 1998-10-13 | Mitsui Chemicals, Inc. | Phenylbenzimidazole derivatives |
| WO1998006703A1 (en) | 1996-08-14 | 1998-02-19 | Warner-Lambert Company | 2-phenyl benzimidazole derivatives as mcp-1 antagonists |
| US5942532A (en) | 1997-09-05 | 1999-08-24 | Ortho Pharmaceutical Corporation | 2-substituted phenyl-benzimidazole antibacterial agents |
| AU747705C (en) | 1997-12-13 | 2004-09-23 | Bristol-Myers Squibb Company | Use of pyrazolo (3,4-b) pyridine as cyclin dependent kinase inhibitors |
| BR9910642A (pt) | 1998-05-22 | 2001-10-09 | Avanir Pharmaceuticals | Análogos de benzimidazol como reguladores descendentes de ige |
| IL142917A0 (en) * | 1998-11-03 | 2002-04-21 | Basf Ag | Substituted 2-phenylbenzimidazoles, the production thereof and their use |
| GB9914825D0 (en) * | 1999-06-24 | 1999-08-25 | Smithkline Beecham Spa | Novel compounds |
| YU54202A (sh) | 2000-01-18 | 2006-01-16 | Agouron Pharmaceuticals Inc. | Jedinjenja indazola, farmaceutske smeše i postupci za stimulisanje i inhibiranje ćelijske proliferacije |
| GB0007934D0 (en) * | 2000-03-31 | 2000-05-17 | Darwin Discovery Ltd | Chemical compounds |
| DE10026435A1 (de) * | 2000-05-29 | 2002-04-18 | Osram Opto Semiconductors Gmbh | Kalzium-Magnesium-Chlorosilikat-Leuchtstoff und seine Anwendung bei Lumineszenz-Konversions-LED |
| CN1203557C (zh) * | 2000-05-29 | 2005-05-25 | 电灯专利信托有限公司 | 基于发光二极管的发射白光的照明设备 |
| ATE350468T1 (de) | 2000-06-21 | 2007-01-15 | Chugai Pharmaceutical Co Ltd | Cds1-knockout-mäusen und davon abgeleitete zelllinien |
| US20060027785A1 (en) * | 2004-08-04 | 2006-02-09 | Intematix Corporation | Novel silicate-based yellow-green phosphors |
| US7311858B2 (en) * | 2004-08-04 | 2007-12-25 | Intematix Corporation | Silicate-based yellow-green phosphors |
| US20060279196A1 (en) * | 2005-06-02 | 2006-12-14 | Wei-Jen Hsu | White LED |
| JP2007231250A (ja) * | 2006-02-02 | 2007-09-13 | Nichia Chem Ind Ltd | 蛍光体及びそれを用いた発光装置 |
-
2002
- 2002-10-18 AT AT02770620T patent/ATE369854T1/de not_active IP Right Cessation
- 2002-10-18 DE DE60221866T patent/DE60221866T2/de not_active Expired - Lifetime
- 2002-10-18 US US10/273,487 patent/US7271261B2/en not_active Expired - Lifetime
- 2002-10-18 ES ES02770620T patent/ES2292812T3/es not_active Expired - Lifetime
- 2002-10-18 JP JP2003535787A patent/JP4637481B2/ja not_active Expired - Lifetime
- 2002-10-18 RS YUP-492/03A patent/RS50939B/sr unknown
- 2002-10-18 EP EP02770620A patent/EP1435947B1/en not_active Expired - Lifetime
- 2002-10-18 WO PCT/US2002/033371 patent/WO2003032984A1/en not_active Ceased
- 2002-10-18 BR BR0206161-9A patent/BR0206161A/pt not_active Application Discontinuation
- 2002-10-18 CA CA2464000A patent/CA2464000C/en not_active Expired - Lifetime
-
2003
- 2003-06-17 NO NO20032759A patent/NO20032759L/no unknown
- 2003-07-17 ZA ZA200305533A patent/ZA200305533B/en unknown
-
2007
- 2007-08-02 US US11/832,789 patent/US7504414B2/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US7271261B2 (en) | 2007-09-18 |
| DE60221866D1 (de) | 2007-09-27 |
| US7504414B2 (en) | 2009-03-17 |
| NO20032759L (no) | 2003-08-18 |
| JP2005506349A (ja) | 2005-03-03 |
| ES2292812T3 (es) | 2008-03-16 |
| US20080009493A1 (en) | 2008-01-10 |
| WO2003032984A8 (en) | 2003-11-20 |
| EP1435947A1 (en) | 2004-07-14 |
| BR0206161A (pt) | 2005-02-01 |
| US20030176438A1 (en) | 2003-09-18 |
| WO2003032984A1 (en) | 2003-04-24 |
| YU49203A (sh) | 2006-05-25 |
| JP4637481B2 (ja) | 2011-02-23 |
| RS50939B (sr) | 2010-08-31 |
| ATE369854T1 (de) | 2007-09-15 |
| ZA200305533B (en) | 2004-10-18 |
| EP1435947B1 (en) | 2007-08-15 |
| CA2464000C (en) | 2011-04-19 |
| NO20032759D0 (no) | 2003-06-17 |
| CA2464000A1 (en) | 2003-04-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE60221866T2 (de) | 2-PHENYL BENZIMIDAZOLE UND IMIDAZO-i4,5ö-PYRIDINE ALS CDS1/CHK2-INHIBITOREN UND ADJUVANTIEN IN DER CHEMOTHERAPIE ODER STRAHLUNGSTHERAPIE ZUR BEHANDLUNG VON KREBS | |
| DE60126286T2 (de) | Substituierte pyrazole | |
| DE69332762T2 (de) | Cathecoldiether als selektive pde iv hemmungsmittel | |
| EP1874769B1 (de) | Neuartige aza-heterozyklen als kinase-inhibitoren | |
| EP1874760B1 (de) | (lH-IND0L-7-YL)-(PYRIMIDIN-2 -YL-AMINO) METHANON DERIVATE UND VERWANDTE VERBINDUNGEN ALS IGF-Rl INHIBITOREN ZUR BEHANDLUNG VON KREBS | |
| DE60015594T2 (de) | Imidazolderivate und deren verwendung als raf kinase inhibitoren | |
| DE60317198T2 (de) | Proteinkinaseinhibitoren | |
| US6391872B1 (en) | Indazole bioisostere replacement of catechol in therapeutically active compounds | |
| EP1727820B1 (de) | Aminderivate mit tyrosinkinase hemmender wirkung | |
| DE69914357T2 (de) | Pyridin-4-yl oder pyrimidin-4-yl substituierte pyrazine | |
| SK27299A3 (en) | Indazole derivatives and their use as inhibitors of phosphodiesterase (pde) type iv and the production of tumor necrosis factor (tnf) | |
| DE102008031517A1 (de) | Pyrrolopyridinyl-pyrimidin-2-yl-amin-derivate | |
| EP1682548B1 (de) | Pyridopyrimidinone zur behandlung von krebserkrankungen | |
| EP2004651A2 (de) | Neuartige cyclobutyl-verbindungen als kinase-inhibitoren | |
| DE69709493T2 (de) | Substituierte Indazolderivate | |
| EP1799679B1 (de) | Als kinaseinhibitoren geeignete derivate des n,n'-diphenylharnstoffs | |
| DE60317684T4 (de) | SUBSTITUIERTE 2,4-DIHYDROPYRROLOc3,4BÜCHINOLIN-9-ONDERIVATE, DIE SICH ALS PHOSPHODIESTERASEINHIBITOREN EIGNEN | |
| WO2009092431A1 (de) | 4-(pyrrolo[2,3-c]pyridine-3-yl)-pyrimidin-2-amin-derivative | |
| EP1856116A1 (de) | Substituierte tetrahydro-pyrrolo-chinolinderivate als kinasemodulatoren, speziell der tyrosin- und raf-kinasen | |
| DE60101906T2 (de) | Phenyl-substituierte indolizinderivate und deren verwendung als histamin h3 liganden | |
| EP1869047A1 (de) | Purinderivate als inhibitoren von rezeptor-tyrosinkinase-aktivität | |
| EP1966212B1 (de) | Diazepinone | |
| EP1809629B1 (de) | Zur Behandlungen von Tumoren, Augenkrankheiten, Entzündungen sowie Erkrankungen des Immunsystems geeignete Derivate des N,N'-Diphenylharnstoffs | |
| WO2007068316A1 (de) | Hydroxychinolinderivate | |
| EP1720846A1 (de) | Verwendung von thiadiazolharnstoffderivaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition |