DE4444738A1 - Verfahren zur Herstellung von Carbonylverbindungen durch katalysierte Oxidation von Olefinen und in Mikroemulsionen angeordnete Katalysatoren - Google Patents
Verfahren zur Herstellung von Carbonylverbindungen durch katalysierte Oxidation von Olefinen und in Mikroemulsionen angeordnete KatalysatorenInfo
- Publication number
- DE4444738A1 DE4444738A1 DE4444738A DE4444738A DE4444738A1 DE 4444738 A1 DE4444738 A1 DE 4444738A1 DE 4444738 A DE4444738 A DE 4444738A DE 4444738 A DE4444738 A DE 4444738A DE 4444738 A1 DE4444738 A1 DE 4444738A1
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- microemulsion
- catalyst
- weight
- substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000004530 micro-emulsion Substances 0.000 title claims description 54
- 239000003054 catalyst Substances 0.000 title claims description 38
- 238000000034 method Methods 0.000 title claims description 38
- 150000001336 alkenes Chemical class 0.000 title claims description 25
- 238000007254 oxidation reaction Methods 0.000 title claims description 25
- 230000003647 oxidation Effects 0.000 title claims description 24
- 230000008569 process Effects 0.000 title claims description 16
- 150000001728 carbonyl compounds Chemical class 0.000 title claims description 4
- 238000002360 preparation method Methods 0.000 title claims description 3
- 239000007789 gas Substances 0.000 claims description 31
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 21
- 239000001301 oxygen Substances 0.000 claims description 21
- 229910052760 oxygen Inorganic materials 0.000 claims description 21
- 239000004094 surface-active agent Substances 0.000 claims description 15
- 150000001875 compounds Chemical class 0.000 claims description 13
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 12
- 229910052736 halogen Inorganic materials 0.000 claims description 11
- 150000002367 halogens Chemical class 0.000 claims description 11
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 8
- 239000012429 reaction media Substances 0.000 claims description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 150000004053 quinones Chemical class 0.000 claims description 6
- -1 trimethylene, tetramethylene Chemical group 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- 239000003960 organic solvent Substances 0.000 claims description 5
- 150000002941 palladium compounds Chemical class 0.000 claims description 5
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 239000007809 chemical reaction catalyst Substances 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 229910052742 iron Inorganic materials 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 claims description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 3
- 229910002666 PdCl2 Inorganic materials 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- 239000010949 copper Substances 0.000 claims description 3
- 150000002739 metals Chemical class 0.000 claims description 3
- 238000010405 reoxidation reaction Methods 0.000 claims description 3
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims description 2
- 229910052684 Cerium Inorganic materials 0.000 claims description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 2
- 229910052787 antimony Inorganic materials 0.000 claims description 2
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 150000007942 carboxylates Chemical class 0.000 claims description 2
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 claims description 2
- 229910017052 cobalt Inorganic materials 0.000 claims description 2
- 239000010941 cobalt Substances 0.000 claims description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 claims description 2
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical group C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 claims description 2
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052737 gold Inorganic materials 0.000 claims description 2
- 239000010931 gold Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 150000002736 metal compounds Chemical class 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 229910052759 nickel Inorganic materials 0.000 claims description 2
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 claims description 2
- 229910052697 platinum Inorganic materials 0.000 claims description 2
- 229910052703 rhodium Inorganic materials 0.000 claims description 2
- 239000010948 rhodium Substances 0.000 claims description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 2
- 150000003871 sulfonates Chemical class 0.000 claims description 2
- 229910052718 tin Inorganic materials 0.000 claims description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical class CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims 2
- 239000003426 co-catalyst Substances 0.000 claims 2
- 229910021592 Copper(II) chloride Inorganic materials 0.000 claims 1
- 239000002563 ionic surfactant Substances 0.000 claims 1
- 239000002736 nonionic surfactant Substances 0.000 claims 1
- 239000012071 phase Substances 0.000 description 24
- 239000000203 mixture Substances 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 16
- 239000000047 product Substances 0.000 description 11
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 9
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 8
- 239000000243 solution Substances 0.000 description 7
- KWKAKUADMBZCLK-UHFFFAOYSA-N 1-octene Chemical compound CCCCCCC=C KWKAKUADMBZCLK-UHFFFAOYSA-N 0.000 description 6
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 6
- QQONPFPTGQHPMA-UHFFFAOYSA-N Propene Chemical compound CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 6
- 239000000839 emulsion Substances 0.000 description 6
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 5
- 239000007800 oxidant agent Substances 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 238000000926 separation method Methods 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 229910000831 Steel Inorganic materials 0.000 description 4
- 230000008901 benefit Effects 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 4
- LPIQUOYDBNQMRZ-UHFFFAOYSA-N cyclopentene Chemical compound C1CC=CC1 LPIQUOYDBNQMRZ-UHFFFAOYSA-N 0.000 description 4
- 239000007791 liquid phase Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000010959 steel Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 230000007704 transition Effects 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- 239000000306 component Substances 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- TVMXDCGIABBOFY-UHFFFAOYSA-N n-Octanol Natural products CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 3
- 238000010587 phase diagram Methods 0.000 description 3
- 239000011949 solid catalyst Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- ZPVFWPFBNIEHGJ-UHFFFAOYSA-N 2-octanone Chemical compound CCCCCCC(C)=O ZPVFWPFBNIEHGJ-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000001307 helium Substances 0.000 description 2
- 229910052734 helium Inorganic materials 0.000 description 2
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- BKIMMITUMNQMOS-UHFFFAOYSA-N nonane Chemical compound CCCCCCCCC BKIMMITUMNQMOS-UHFFFAOYSA-N 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 229910000489 osmium tetroxide Inorganic materials 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 230000007306 turnover Effects 0.000 description 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 1
- WOAHJDHKFWSLKE-UHFFFAOYSA-N 1,2-benzoquinone Chemical compound O=C1C=CC=CC1=O WOAHJDHKFWSLKE-UHFFFAOYSA-N 0.000 description 1
- 150000005208 1,4-dihydroxybenzenes Chemical class 0.000 description 1
- RZVHIXYEVGDQDX-UHFFFAOYSA-N 9,10-anthraquinone Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3C(=O)C2=C1 RZVHIXYEVGDQDX-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 229930192627 Naphthoquinone Natural products 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 241001474977 Palla Species 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 1
- 229910052768 actinide Inorganic materials 0.000 description 1
- 150000001255 actinides Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 230000027455 binding Effects 0.000 description 1
- 238000009739 binding Methods 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000012159 carrier gas Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- LMBFMVXAZKYKDT-UHFFFAOYSA-N cyclopentanone cyclopentene Chemical compound C1=CCCC1.C1(CCCC1)=O LMBFMVXAZKYKDT-UHFFFAOYSA-N 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000010813 internal standard method Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- MVFCKEFYUDZOCX-UHFFFAOYSA-N iron(2+);dinitrate Chemical compound [Fe+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O MVFCKEFYUDZOCX-UHFFFAOYSA-N 0.000 description 1
- ACKFDYCQCBEDNU-UHFFFAOYSA-J lead(2+);tetraacetate Chemical compound [Pb+2].CC([O-])=O.CC([O-])=O.CC([O-])=O.CC([O-])=O ACKFDYCQCBEDNU-UHFFFAOYSA-J 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- ONLRKTIYOMZEJM-UHFFFAOYSA-N n-methylmethanamine oxide Chemical compound C[NH+](C)[O-] ONLRKTIYOMZEJM-UHFFFAOYSA-N 0.000 description 1
- 150000002791 naphthoquinones Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000012285 osmium tetroxide Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- GPNDARIEYHPYAY-UHFFFAOYSA-N palladium(ii) nitrate Chemical compound [Pd+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O GPNDARIEYHPYAY-UHFFFAOYSA-N 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- GPRLSGONYQIRFK-MNYXATJNSA-N triton Chemical compound [3H+] GPRLSGONYQIRFK-MNYXATJNSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/27—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation
- C07C45/32—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation with molecular oxygen
- C07C45/33—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation with molecular oxygen of CHx-moieties
- C07C45/34—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation with molecular oxygen of CHx-moieties in unsaturated compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/27—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation
- C07C45/32—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation with molecular oxygen
- C07C45/33—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation with molecular oxygen of CHx-moieties
- C07C45/34—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation with molecular oxygen of CHx-moieties in unsaturated compounds
- C07C45/35—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation with molecular oxygen of CHx-moieties in unsaturated compounds in propene or isobutene
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4444738A DE4444738A1 (de) | 1994-12-15 | 1994-12-15 | Verfahren zur Herstellung von Carbonylverbindungen durch katalysierte Oxidation von Olefinen und in Mikroemulsionen angeordnete Katalysatoren |
| EP95119054A EP0717025B1 (de) | 1994-12-15 | 1995-12-04 | Verfahren zur Herstellung von Carbonylverbindungen durch katalysierte Oxidation von Olefinen und in Mikroemulsionen angeordnete Katalysatoren |
| US08/568,054 US5710342A (en) | 1994-12-15 | 1995-12-06 | Process for preparing carbonyl compounds by catalysed oxidation of olefins and catalysts present microemulsions |
| JP7346278A JPH08259491A (ja) | 1994-12-15 | 1995-12-13 | オレフインの接触酸化によつてカルボニル化合物を製造するための方法、及びマイクロエマルシヨン中に存在する触媒 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4444738A DE4444738A1 (de) | 1994-12-15 | 1994-12-15 | Verfahren zur Herstellung von Carbonylverbindungen durch katalysierte Oxidation von Olefinen und in Mikroemulsionen angeordnete Katalysatoren |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE4444738A1 true DE4444738A1 (de) | 1996-06-20 |
Family
ID=6535913
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE4444738A Withdrawn DE4444738A1 (de) | 1994-12-15 | 1994-12-15 | Verfahren zur Herstellung von Carbonylverbindungen durch katalysierte Oxidation von Olefinen und in Mikroemulsionen angeordnete Katalysatoren |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US5710342A (https=) |
| EP (1) | EP0717025B1 (https=) |
| JP (1) | JPH08259491A (https=) |
| DE (1) | DE4444738A1 (https=) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1514689B1 (en) | 1998-05-18 | 2006-11-08 | Seiko Epson Corporation | Ink cartridge for an ink-jet printing apparatus |
| DE10201783A1 (de) * | 2002-01-17 | 2003-08-21 | Stockhausen Chem Fab Gmbh | Verfahren zur Oxidation ungesättigter Kohlenwasserstoffe |
| US7872135B2 (en) | 2002-07-16 | 2011-01-18 | Siegfried Ltd. | Method for introducing a 1,2-double bond into 3-oxo-4-azasteroid compounds |
| RU2321592C2 (ru) * | 2002-07-16 | 2008-04-10 | Зигфрид Генерикс Интернэшнл Аг | Способ введения 1,2-двойной связи в 3-оксо-4-азастероидные соединения |
| US8304584B2 (en) | 2007-06-27 | 2012-11-06 | H R D Corporation | Method of making alkylene glycols |
| US7491856B2 (en) | 2007-06-27 | 2009-02-17 | H R D Corporation | Method of making alkylene glycols |
| US7479576B1 (en) * | 2007-06-27 | 2009-01-20 | H R D Corporation | Method of hydrogenating aldehydes and ketones |
| US7652175B2 (en) * | 2007-06-27 | 2010-01-26 | H R D Corporation | High shear process for the production of acetaldehyde |
| CN102548942A (zh) * | 2009-10-08 | 2012-07-04 | 吉坤日矿日石能源株式会社 | 酮的制造方法 |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1049845B (de) * | 1957-01-04 | 1959-02-05 | Consortium Elektrochem Ind | Verfahren zur Herstellung von Carbonylverbindungen |
| DE1061767B (de) * | 1957-06-07 | 1959-07-23 | Consortium Elektrochem Ind | Verfahren zur Herstellung von Aldehyden und Ketonen |
| DE1080994B (de) * | 1957-06-28 | 1960-05-05 | Consortium Elektrochem Ind | Verfahren zur Herstellung von Aldehyden und Ketonen |
| JPS52111530A (en) * | 1976-03-16 | 1977-09-19 | Bayer Ag | Process for preparing aromatic orthoohydroxy aldehyde and orthoohydroxy ketone |
| DE2618055A1 (de) * | 1976-04-24 | 1977-11-10 | Bayer Ag | Verfahren zur herstellung von aromatischen o-hydroxyaldehyden und o-hydroxyketonen |
| US4152354A (en) * | 1977-06-29 | 1979-05-01 | Phillips Petroleum Company | Olefin oxidation process |
| DE2805402A1 (de) * | 1978-02-09 | 1979-08-16 | Bayer Ag | Verfahren zur herstellung von o-nitrobenzaldehyd |
| FR2435455A1 (fr) * | 1978-09-05 | 1980-04-04 | Kuraray Co | Procede de preparation d'un compose carbonyle |
| JPS60330B2 (ja) * | 1982-02-17 | 1985-01-07 | 工業技術院長 | シクロペンタノンの製造方法 |
| CA1243041A (en) * | 1982-09-30 | 1988-10-11 | Howard Alper | Process for the conversion of a terminal carbon- carbon double bond of an olefinic hydrocarbon to carbonyl groups |
| US4806692A (en) * | 1985-01-21 | 1989-02-21 | Babcock-Hitachi Kabushiki Kaisha | Process for producing an oxygen-containing organic compound from olefins |
| FR2612512B1 (fr) * | 1987-03-20 | 1989-06-30 | Lille 11 Universite Droit Sant | Procede d'oxydation de composes organiques par l'eau oxygenee en presence d'un catalyseur |
| EP0498305B1 (en) * | 1991-02-01 | 1995-12-27 | Idemitsu Kosan Company Limited | Process for preparing carbonyl compounds |
| US5414137A (en) * | 1992-05-29 | 1995-05-09 | Idemitsu Kosan Company Limited | Process for preparing carbonyl compounds |
-
1994
- 1994-12-15 DE DE4444738A patent/DE4444738A1/de not_active Withdrawn
-
1995
- 1995-12-04 EP EP95119054A patent/EP0717025B1/de not_active Expired - Lifetime
- 1995-12-06 US US08/568,054 patent/US5710342A/en not_active Expired - Fee Related
- 1995-12-13 JP JP7346278A patent/JPH08259491A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| EP0717025B1 (de) | 1999-06-09 |
| EP0717025A2 (de) | 1996-06-19 |
| EP0717025A3 (https=) | 1996-07-24 |
| JPH08259491A (ja) | 1996-10-08 |
| US5710342A (en) | 1998-01-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0912540B1 (de) | Verfahren zur herstellung von phthaliden | |
| EP3429982B1 (de) | Verfahren zur herstellung von prenol und prenal aus isoprenol | |
| DE1281426B (de) | Verfahren zur Herstellung von 2, 6-Di-tertiaer-butyl-hydrochinon | |
| DE2201411B2 (de) | Verfahren zur oxydativen Spaltung von ungesättigten Kohlenwasserstoffen | |
| DE4444738A1 (de) | Verfahren zur Herstellung von Carbonylverbindungen durch katalysierte Oxidation von Olefinen und in Mikroemulsionen angeordnete Katalysatoren | |
| DE2358460C2 (https=) | ||
| DE1768529A1 (de) | Verfahren zur Herstellung von Cycloalkanol/Cycloalkanon-Gemischen | |
| EP2411356B1 (de) | Verfahren zur herstellung aliphatischer carbonsäuren aus aldehyden durch mikroreaktionstechnik | |
| DE2526851A1 (de) | Verfahren zur herstellung von ketoisophoron | |
| DE3048690A1 (de) | Katalysator zur dehydrierung von sauerstoffhaltigen derivaten der cyclohexanreihe zu den entsprechenden cyclischen ketonen und/oder phenolen und verfahren zur dehydrierung von sauerstoffhaltigen derivaten der cyclohexanreihe zu den entsprechenden cyclischen ketonen und/oder phenolen unter verwendung des genannten katalysators | |
| DE3874061T2 (de) | Oxidierungsverfahren von sekundaeren alkylsubstituierten naphthalinen. | |
| DE2049113C3 (https=) | ||
| DE2338291A1 (de) | Verfahren zur herstellung von citral | |
| EP0034804A2 (de) | Verfahren zur Herstellung von höheren gesättigten Ketonen | |
| EP0939070B1 (de) | Verfahren zur Herstellung von Sechsring-Carbocyclen | |
| WO2019042520A1 (de) | Verfahren zur herstellung von terpenaldehyden und -ketonen | |
| DE60007282T2 (de) | Verfahren und zusammensetzung zur hydroxylierung von aromatischen substraten | |
| DE2327437C2 (de) | Verfahren zur Herstellung von Cumarin und 6-Methylcumarin | |
| DE1158963B (de) | Verfahren zur Oxydation von gesaettigten Kohlenwasserstoffen | |
| DE69309980T2 (de) | Verfahren zur Herstellung eines Cycloalkanon und/oder einem Cycloalkanol | |
| DE2225450C3 (de) | Verfahren zur gleichzeitigen Herstellung von Propylenoxid und Essigsäure | |
| DE2430082B1 (de) | Verfahren zur Herstellung von Acetoxybutanal | |
| DE1643985C3 (de) | S-lsopropyl^nitro-phenyl-dimethyl-carbinol und 3,5-Diisopropyl-4-nitro-phenyldimethylcarbinol und Verfahren zu deren Herstellung | |
| DE2027536C (https=) | ||
| DE1951318C (de) | Verfahren zur Gewinnung von 6-Hydroperoxyhexansäure |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |