DE3837006C2 - - Google Patents
Info
- Publication number
- DE3837006C2 DE3837006C2 DE3837006A DE3837006A DE3837006C2 DE 3837006 C2 DE3837006 C2 DE 3837006C2 DE 3837006 A DE3837006 A DE 3837006A DE 3837006 A DE3837006 A DE 3837006A DE 3837006 C2 DE3837006 C2 DE 3837006C2
- Authority
- DE
- Germany
- Prior art keywords
- mass
- carbide
- hard
- chromium
- hard metal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 229910052751 metal Inorganic materials 0.000 claims description 26
- 239000002184 metal Substances 0.000 claims description 26
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 19
- 229910052804 chromium Inorganic materials 0.000 claims description 12
- 239000011651 chromium Substances 0.000 claims description 12
- 229910052759 nickel Inorganic materials 0.000 claims description 11
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 9
- 238000005245 sintering Methods 0.000 claims description 9
- 239000011230 binding agent Substances 0.000 claims description 8
- 239000000463 material Substances 0.000 claims description 8
- UONOETXJSWQNOL-UHFFFAOYSA-N tungsten carbide Chemical compound [W+]#[C-] UONOETXJSWQNOL-UHFFFAOYSA-N 0.000 claims description 7
- NRTOMJZYCJJWKI-UHFFFAOYSA-N Titanium nitride Chemical compound [Ti]#N NRTOMJZYCJJWKI-UHFFFAOYSA-N 0.000 claims description 4
- 239000002994 raw material Substances 0.000 claims description 4
- UNASZPQZIFZUSI-UHFFFAOYSA-N methylidyneniobium Chemical compound [Nb]#C UNASZPQZIFZUSI-UHFFFAOYSA-N 0.000 claims description 2
- NFFIWVVINABMKP-UHFFFAOYSA-N methylidynetantalum Chemical compound [Ta]#C NFFIWVVINABMKP-UHFFFAOYSA-N 0.000 claims description 2
- 229910003468 tantalcarbide Inorganic materials 0.000 claims description 2
- MTPVUVINMAGMJL-UHFFFAOYSA-N trimethyl(1,1,2,2,2-pentafluoroethyl)silane Chemical compound C[Si](C)(C)C(F)(F)C(F)(F)F MTPVUVINMAGMJL-UHFFFAOYSA-N 0.000 claims description 2
- 229910045601 alloy Inorganic materials 0.000 description 8
- 239000000956 alloy Substances 0.000 description 8
- 230000007797 corrosion Effects 0.000 description 7
- 238000005260 corrosion Methods 0.000 description 7
- 150000002739 metals Chemical class 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 3
- 239000012298 atmosphere Substances 0.000 description 3
- 239000011261 inert gas Substances 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 239000012300 argon atmosphere Substances 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 150000001247 metal acetylides Chemical class 0.000 description 2
- 229910001092 metal group alloy Inorganic materials 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229910052750 molybdenum Inorganic materials 0.000 description 2
- QIJNJJZPYXGIQM-UHFFFAOYSA-N 1lambda4,2lambda4-dimolybdacyclopropa-1,2,3-triene Chemical compound [Mo]=C=[Mo] QIJNJJZPYXGIQM-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229910039444 MoC Inorganic materials 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 229910026551 ZrC Inorganic materials 0.000 description 1
- OTCHGXYCWNXDOA-UHFFFAOYSA-N [C].[Zr] Chemical compound [C].[Zr] OTCHGXYCWNXDOA-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- UFGZSIPAQKLCGR-UHFFFAOYSA-N chromium carbide Chemical compound [Cr]#C[Cr]C#[Cr] UFGZSIPAQKLCGR-UHFFFAOYSA-N 0.000 description 1
- VNNRSPGTAMTISX-UHFFFAOYSA-N chromium nickel Chemical compound [Cr].[Ni] VNNRSPGTAMTISX-UHFFFAOYSA-N 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 238000005056 compaction Methods 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910003470 tongbaite Inorganic materials 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C22—METALLURGY; FERROUS OR NON-FERROUS ALLOYS; TREATMENT OF ALLOYS OR NON-FERROUS METALS
- C22C—ALLOYS
- C22C29/00—Alloys based on carbides, oxides, nitrides, borides, or silicides, e.g. cermets, or other metal compounds, e.g. oxynitrides, sulfides
- C22C29/02—Alloys based on carbides, oxides, nitrides, borides, or silicides, e.g. cermets, or other metal compounds, e.g. oxynitrides, sulfides based on carbides or carbonitrides
-
- C—CHEMISTRY; METALLURGY
- C22—METALLURGY; FERROUS OR NON-FERROUS ALLOYS; TREATMENT OF ALLOYS OR NON-FERROUS METALS
- C22C—ALLOYS
- C22C29/00—Alloys based on carbides, oxides, nitrides, borides, or silicides, e.g. cermets, or other metal compounds, e.g. oxynitrides, sulfides
- C22C29/02—Alloys based on carbides, oxides, nitrides, borides, or silicides, e.g. cermets, or other metal compounds, e.g. oxynitrides, sulfides based on carbides or carbonitrides
- C22C29/06—Alloys based on carbides, oxides, nitrides, borides, or silicides, e.g. cermets, or other metal compounds, e.g. oxynitrides, sulfides based on carbides or carbonitrides based on carbides, but not containing other metal compounds
- C22C29/067—Alloys based on carbides, oxides, nitrides, borides, or silicides, e.g. cermets, or other metal compounds, e.g. oxynitrides, sulfides based on carbides or carbonitrides based on carbides, but not containing other metal compounds comprising a particular metallic binder
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Mechanical Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Powder Metallurgy (AREA)
- Cutting Tools, Boring Holders, And Turrets (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3837006A DE3837006C3 (de) | 1988-10-31 | 1988-10-31 | Hartmetall |
| IN757CA1989 IN172467B (enExample) | 1988-10-31 | 1989-09-15 | |
| US07/684,901 US5223020A (en) | 1988-10-31 | 1989-10-18 | Hard-metal body |
| JP1510590A JPH04501438A (ja) | 1988-10-31 | 1989-10-18 | 超硬金属体 |
| PCT/DE1989/000662 WO1990005200A1 (de) | 1988-10-31 | 1989-10-18 | Hartmetallkörper |
| EP89911363A EP0561768A1 (de) | 1988-10-31 | 1989-10-18 | Hartmetallkörper |
| ES8903664A ES2016766A6 (es) | 1988-10-31 | 1989-10-30 | Cuerpo de metal duro a base de carburo de wolframio. |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3837006A DE3837006C3 (de) | 1988-10-31 | 1988-10-31 | Hartmetall |
| IN757CA1989 IN172467B (enExample) | 1988-10-31 | 1989-09-15 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE3837006A1 DE3837006A1 (de) | 1990-05-03 |
| DE3837006C2 true DE3837006C2 (enExample) | 1990-08-30 |
| DE3837006C3 DE3837006C3 (de) | 1993-11-18 |
Family
ID=25873777
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3837006A Expired - Fee Related DE3837006C3 (de) | 1988-10-31 | 1988-10-31 | Hartmetall |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US5223020A (enExample) |
| EP (1) | EP0561768A1 (enExample) |
| JP (1) | JPH04501438A (enExample) |
| DE (1) | DE3837006C3 (enExample) |
| IN (1) | IN172467B (enExample) |
| WO (1) | WO1990005200A1 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1992013112A1 (en) * | 1991-01-25 | 1992-08-06 | Sandvik Ab | Corrosion resistant cemented carbide |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5925197A (en) * | 1992-01-24 | 1999-07-20 | Sandvik Ab | Hard alloys for tools in the wood industry |
| US5447549A (en) * | 1992-02-20 | 1995-09-05 | Mitsubishi Materials Corporation | Hard alloy |
| DE4340652C2 (de) * | 1993-11-30 | 2003-10-16 | Widia Gmbh | Verbundwerkstoff und Verfahren zu seiner Herstellung |
| US5543235A (en) * | 1994-04-26 | 1996-08-06 | Sintermet | Multiple grade cemented carbide articles and a method of making the same |
| DE69710899T2 (de) * | 1996-07-11 | 2002-11-28 | Sandvik Ab (Publ), Sandviken | Sinterverfahren |
| DE69739311D1 (de) | 1996-12-16 | 2009-04-30 | Sumitomo Electric Industries | Sinterkarbid, verfahren zu dessen herstellung und sinterkarbidwerkzeuge |
| RU2129619C1 (ru) * | 1997-04-22 | 1999-04-27 | Институт материаловедения Дальневосточного отделения РАН | Шихта электродного материала для электроискрового легирования |
| US6071469A (en) * | 1997-06-23 | 2000-06-06 | Sandvik Ab | Sintering method with cooling from sintering temperature to below 1200° C. in a hydrogen and noble gas atmosphere |
| US6228484B1 (en) * | 1999-05-26 | 2001-05-08 | Widia Gmbh | Composite body, especially for a cutting tool |
| US6521353B1 (en) | 1999-08-23 | 2003-02-18 | Kennametal Pc Inc. | Low thermal conductivity hard metal |
| TWI291458B (en) * | 2001-10-12 | 2007-12-21 | Phild Co Ltd | Method and device for producing titanium-containing high performance water |
| EP1997575B1 (en) * | 2001-12-05 | 2011-07-27 | Baker Hughes Incorporated | Consolidated hard material and applications |
| DE10225521A1 (de) * | 2002-06-10 | 2003-12-18 | Widia Gmbh | Hartmetall-Substratkörper und Verfahren zu dessen Herstellung |
| DE10239358A1 (de) * | 2002-08-24 | 2004-02-26 | Kämpfer, Hans-Peter | Als Zyklon ausgebildeter Fliehkraftabscheider |
| RU2280093C2 (ru) * | 2004-11-01 | 2006-07-20 | Государственное учреждение "Институт химии твердого тела" Уральского отделения Российской академии наук | Шихта для изготовления электрода для электроискрового легирования |
| ES2644500T3 (es) * | 2008-12-18 | 2017-11-29 | Sandvik Intellectual Property Ab | Cuchilla para cortador rotativo |
| US10738821B2 (en) * | 2018-07-30 | 2020-08-11 | XR Downhole, LLC | Polycrystalline diamond radial bearing |
| CN114657434A (zh) * | 2022-03-25 | 2022-06-24 | 成都西顿硬质合金有限公司 | 一种硬质合金的材料及制备方法 |
| CN116590586A (zh) * | 2023-04-14 | 2023-08-15 | 深圳市海明润超硬材料股份有限公司 | 一种硬质合金基体、聚晶金刚石复合片及其制备方法 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE764144C (de) * | 1939-09-05 | 1952-07-24 | Hartmetallwerkzeugfabrik Meuts | Verfahren zum Herstellen von harten Auflagen fuer Messer, Schneidwerkzeuge und sonstige Arbeitsgeraete |
| US3215510A (en) * | 1963-10-02 | 1965-11-02 | Gen Electric | Alloy |
| US3623849A (en) * | 1969-08-25 | 1971-11-30 | Int Nickel Co | Sintered refractory articles of manufacture |
| EP0002888B1 (en) * | 1977-12-23 | 1982-01-20 | S.S.S. Patents Limited | Power transmission system |
| JPS5613695A (en) * | 1979-07-11 | 1981-02-10 | Mitsubishi Electric Corp | Ion nitriding devide power supply utilizing glow discharge |
| JPS5716161A (en) * | 1980-07-02 | 1982-01-27 | Ngk Spark Plug Co Ltd | Preparation of coating tip for cutting |
| US4330333A (en) * | 1980-08-29 | 1982-05-18 | The Valeron Corporation | High titanium nitride cutting material |
| JPS59229431A (ja) * | 1983-05-20 | 1984-12-22 | Mitsubishi Metal Corp | 切削工具用高靭性サ−メツトの製造法 |
| US4628178A (en) * | 1984-05-29 | 1986-12-09 | Sumitomo Electric Industries, Ltd. | Tool for warm and hot forgings and process for manufacturing the same |
| DE3511220A1 (de) * | 1985-03-28 | 1986-10-09 | Fried. Krupp Gmbh, 4300 Essen | Hartmetall und verfahren zu seiner herstellung |
| US4649084A (en) * | 1985-05-06 | 1987-03-10 | General Electric Company | Process for adhering an oxide coating on a cobalt-enriched zone, and articles made from said process |
-
1988
- 1988-10-31 DE DE3837006A patent/DE3837006C3/de not_active Expired - Fee Related
-
1989
- 1989-09-15 IN IN757CA1989 patent/IN172467B/en unknown
- 1989-10-18 EP EP89911363A patent/EP0561768A1/de not_active Ceased
- 1989-10-18 JP JP1510590A patent/JPH04501438A/ja active Pending
- 1989-10-18 WO PCT/DE1989/000662 patent/WO1990005200A1/de not_active Ceased
- 1989-10-18 US US07/684,901 patent/US5223020A/en not_active Expired - Fee Related
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1992013112A1 (en) * | 1991-01-25 | 1992-08-06 | Sandvik Ab | Corrosion resistant cemented carbide |
Also Published As
| Publication number | Publication date |
|---|---|
| JPH04501438A (ja) | 1992-03-12 |
| DE3837006C3 (de) | 1993-11-18 |
| US5223020A (en) | 1993-06-29 |
| WO1990005200A1 (de) | 1990-05-17 |
| EP0561768A1 (de) | 1993-09-29 |
| IN172467B (enExample) | 1993-08-14 |
| DE3837006A1 (de) | 1990-05-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3837006C2 (enExample) | ||
| DE2937724C2 (de) | Pulvermetallurgisch hergestelltes Stahlerzeugnis mit hohem Vanadiumcarbid- Anteil | |
| DE2005707C3 (de) | Hartstoffpulver zur Herstellung von metallgebundenen Hartstofflegierungen | |
| DE3418403C2 (de) | Verfahren zum Herstellen eines Cermets mit hoher Zähigkeit zur Verwendung in Schneidwerkzeugen | |
| DE3117539C2 (enExample) | ||
| DE69734515T2 (de) | Gesinterte hartlegierung | |
| DE3238555C2 (enExample) | ||
| DE19907749A1 (de) | Gesinterter Hartmetallkörper und dessen Verwendung | |
| DE1296930B (de) | Umhuellte Schweisselektrode auf Nickel-Chrom-Basis | |
| DE2407410B2 (de) | Karbidhartmetall mit ausscheidungshärtbarer metallischer Matrix | |
| DE3881979T2 (de) | Legiertes Stahlpulver für Pulvermetallurgische Verfahren. | |
| AT405296B (de) | Gleitlagerwerkstoff aus einer bis auf erschmelzungsbedingte verunreinigungen siliciumfreien aluminiumlegierung | |
| DE19950595C1 (de) | Verfahren zur Herstellung von Sinterteilen aus einer Aluminiumsintermischung | |
| CH662130A5 (de) | Legierung auf kobaltbasis, insbesondere fuer ventile und ventilsitze an verbrennungsmotoren. | |
| EP0214679B1 (de) | Korrosionsfeste Hartmetall-Legierung | |
| DE1558805C3 (de) | Verfahren zur Herstellung von verformten Werkstücken aus dispersionsverstärkten Metallen oder Legierungen | |
| DE2940970T1 (de) | Padding alloys based on nickel | |
| DE2745209A1 (de) | Magnetwerkstoff | |
| DE1142445B (de) | Verwendung von Titanlegierungen zur Herstellung von Teilen, die nach dem Schweissen dehnbar bleiben | |
| EP0130177B1 (de) | Sinterlegierung auf Eisenbasis | |
| DE2137650A1 (de) | Carbid Metall Verbundstoff und Ver fahren zu dessen Herstellung | |
| DE3785746T2 (de) | Abriebfeste, gesinterte legierung und deren herstellung. | |
| DE2718594C2 (de) | Verfahren zur Herstellung eines mit Eisen gebundenen Wolframcarbid-Pulverkompaktkörpers sowie hartgesinterte Wolframcarbid-Kompaktkörper | |
| EP4334054A1 (de) | Sinterkarbid-material | |
| DE1191113B (de) | Verfahren zur pulvermetallurgischen Herstellung von kriechfesten Legierungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8366 | Restricted maintained after opposition proceedings | ||
| 8305 | Restricted maintenance of patent after opposition | ||
| D4 | Patent maintained restricted | ||
| 8339 | Ceased/non-payment of the annual fee |