DE3780438T2 - N-substituierte cyclische amine, ihre herstellung sowie pharmazeutische zusammensetzungen die sie enthalten. - Google Patents
N-substituierte cyclische amine, ihre herstellung sowie pharmazeutische zusammensetzungen die sie enthalten.Info
- Publication number
- DE3780438T2 DE3780438T2 DE8787310332T DE3780438T DE3780438T2 DE 3780438 T2 DE3780438 T2 DE 3780438T2 DE 8787310332 T DE8787310332 T DE 8787310332T DE 3780438 T DE3780438 T DE 3780438T DE 3780438 T2 DE3780438 T2 DE 3780438T2
- Authority
- DE
- Germany
- Prior art keywords
- group
- pharmaceutically acceptable
- substituted
- formula
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 6
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 175
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 53
- 150000003839 salts Chemical class 0.000 claims description 51
- 150000002148 esters Chemical class 0.000 claims description 42
- 150000001408 amides Chemical class 0.000 claims description 34
- 239000012453 solvate Substances 0.000 claims description 33
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 29
- 238000011282 treatment Methods 0.000 claims description 25
- 125000001424 substituent group Chemical group 0.000 claims description 18
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 17
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 14
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 claims description 13
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 13
- 238000011321 prophylaxis Methods 0.000 claims description 13
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 11
- 125000005843 halogen group Chemical group 0.000 claims description 10
- 208000010412 Glaucoma Diseases 0.000 claims description 8
- 239000003814 drug Substances 0.000 claims description 8
- 229910052757 nitrogen Inorganic materials 0.000 claims description 8
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 7
- 206010020772 Hypertension Diseases 0.000 claims description 6
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 6
- 208000010110 spontaneous platelet aggregation Diseases 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 201000001421 hyperglycemia Diseases 0.000 claims description 5
- 230000005764 inhibitory process Effects 0.000 claims description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 5
- 229920006395 saturated elastomer Polymers 0.000 claims description 5
- 125000004642 (C1-C12) alkoxy group Chemical group 0.000 claims description 4
- 208000020401 Depressive disease Diseases 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 230000003345 hyperglycaemic effect Effects 0.000 claims description 4
- 125000006239 protecting group Chemical group 0.000 claims description 4
- 239000003937 drug carrier Substances 0.000 claims description 3
- SGOFAUSEYBZKDQ-UHFFFAOYSA-N brl-44408 Chemical compound C1C2=CC=CC=C2C(C)N1CC1=NCCN1 SGOFAUSEYBZKDQ-UHFFFAOYSA-N 0.000 claims description 2
- 239000004615 ingredient Substances 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims 1
- 125000003277 amino group Chemical group 0.000 claims 1
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 1
- 230000001225 therapeutic effect Effects 0.000 claims 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 94
- -1 C1−12-alkyl radical Chemical class 0.000 description 72
- 238000005160 1H NMR spectroscopy Methods 0.000 description 54
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 45
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 39
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 36
- 238000000034 method Methods 0.000 description 34
- 239000000203 mixture Substances 0.000 description 31
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- WEVYAHXRMPXWCK-UHFFFAOYSA-N acetonitrile Substances CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 25
- 150000003254 radicals Chemical class 0.000 description 25
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 22
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 21
- 239000003921 oil Substances 0.000 description 20
- 239000000243 solution Substances 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- XFKYKTBPRBZDFG-UHFFFAOYSA-N 2-aminoacetonitrile;hydrochloride Chemical compound Cl.NCC#N XFKYKTBPRBZDFG-UHFFFAOYSA-N 0.000 description 13
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 13
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 12
- 125000000217 alkyl group Chemical group 0.000 description 11
- 238000003756 stirring Methods 0.000 description 10
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000012280 lithium aluminium hydride Substances 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 7
- 229910052801 chlorine Inorganic materials 0.000 description 7
- 238000009472 formulation Methods 0.000 description 7
- 238000001727 in vivo Methods 0.000 description 7
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- WNZQDUSMALZDQF-UHFFFAOYSA-N 2-benzofuran-1(3H)-one Chemical compound C1=CC=C2C(=O)OCC2=C1 WNZQDUSMALZDQF-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 125000003342 alkenyl group Chemical group 0.000 description 6
- 150000005840 aryl radicals Chemical class 0.000 description 6
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 5
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 229910052731 fluorine Inorganic materials 0.000 description 5
- 239000011737 fluorine Substances 0.000 description 5
- 239000008103 glucose Substances 0.000 description 5
- 150000002391 heterocyclic compounds Chemical class 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 125000000304 alkynyl group Chemical group 0.000 description 4
- 125000001309 chloro group Chemical group Cl* 0.000 description 4
- 239000006071 cream Substances 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 3
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 3
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000003885 eye ointment Substances 0.000 description 3
- 239000006210 lotion Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 238000007363 ring formation reaction Methods 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- YFKDYUAWZOTHBR-UHFFFAOYSA-N (3-chlorophenyl)-[2-(hydroxymethyl)phenyl]methanol Chemical compound OCC1=CC=CC=C1C(O)C1=CC=CC(Cl)=C1 YFKDYUAWZOTHBR-UHFFFAOYSA-N 0.000 description 2
- DLYQDBJPCWSEOG-UHFFFAOYSA-N (4-chlorophenyl)-[2-(hydroxymethyl)phenyl]methanol Chemical compound OCC1=CC=CC=C1C(O)C1=CC=C(Cl)C=C1 DLYQDBJPCWSEOG-UHFFFAOYSA-N 0.000 description 2
- PRPGZLYWOJPAQZ-UHFFFAOYSA-N (4-fluorophenyl)-[2-(hydroxymethyl)phenyl]methanol Chemical compound OCC1=CC=CC=C1C(O)C1=CC=C(F)C=C1 PRPGZLYWOJPAQZ-UHFFFAOYSA-N 0.000 description 2
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 2
- WKTKZTHJURGRCS-UHFFFAOYSA-N 1-(1-bromoethyl)-2-(bromomethyl)-4-fluorobenzene Chemical compound CC(Br)C1=CC=C(F)C=C1CBr WKTKZTHJURGRCS-UHFFFAOYSA-N 0.000 description 2
- ZDIIQBBHSCTBSA-UHFFFAOYSA-N 1-(1-bromoethyl)-2-(bromomethyl)benzene Chemical compound CC(Br)C1=CC=CC=C1CBr ZDIIQBBHSCTBSA-UHFFFAOYSA-N 0.000 description 2
- KWNYHTJYVNGZLT-UHFFFAOYSA-N 1-(bromomethyl)-2-(1-bromo-2-methylpropyl)benzene Chemical compound CC(C)C(Br)C1=CC=CC=C1CBr KWNYHTJYVNGZLT-UHFFFAOYSA-N 0.000 description 2
- SRXQMFBMZYBDHL-UHFFFAOYSA-N 1-(bromomethyl)-2-(1-bromo-2-phenylethyl)benzene Chemical compound BrCC1=CC=CC=C1C(Br)CC1=CC=CC=C1 SRXQMFBMZYBDHL-UHFFFAOYSA-N 0.000 description 2
- DHXJVRKOMCZIGC-UHFFFAOYSA-N 1-(bromomethyl)-2-(1-bromopropyl)benzene Chemical compound CCC(Br)C1=CC=CC=C1CBr DHXJVRKOMCZIGC-UHFFFAOYSA-N 0.000 description 2
- FOSMCOZZFVEVEI-UHFFFAOYSA-N 1-[2-(hydroxymethyl)phenyl]-2-methylpropan-1-ol Chemical compound CC(C)C(O)C1=CC=CC=C1CO FOSMCOZZFVEVEI-UHFFFAOYSA-N 0.000 description 2
- XVKYPJPUAOOGBQ-UHFFFAOYSA-N 1-[2-(hydroxymethyl)phenyl]ethanol Chemical compound CC(O)C1=CC=CC=C1CO XVKYPJPUAOOGBQ-UHFFFAOYSA-N 0.000 description 2
- YOPCEQFSKFFDFX-UHFFFAOYSA-N 1-[2-(hydroxymethyl)phenyl]propan-1-ol Chemical compound CCC(O)C1=CC=CC=C1CO YOPCEQFSKFFDFX-UHFFFAOYSA-N 0.000 description 2
- LVWVCBRVMUTASX-UHFFFAOYSA-N 1-[4-chloro-2-(hydroxymethyl)phenyl]ethanol Chemical compound CC(O)C1=CC=C(Cl)C=C1CO LVWVCBRVMUTASX-UHFFFAOYSA-N 0.000 description 2
- QOAFLEFMDRYUOQ-UHFFFAOYSA-N 1-[4-fluoro-2-(hydroxymethyl)phenyl]ethanol Chemical compound CC(O)C1=CC=C(F)C=C1CO QOAFLEFMDRYUOQ-UHFFFAOYSA-N 0.000 description 2
- SRGXPYOWCGEETK-UHFFFAOYSA-N 1-[5-chloro-2-(4,4-dimethyl-5h-1,3-oxazol-2-yl)phenyl]ethanol Chemical compound CC(O)C1=CC(Cl)=CC=C1C1=NC(C)(C)CO1 SRGXPYOWCGEETK-UHFFFAOYSA-N 0.000 description 2
- VXUBSYMOZUEHFT-UHFFFAOYSA-N 1-[5-chloro-2-(hydroxymethyl)phenyl]ethanol Chemical compound CC(O)C1=CC(Cl)=CC=C1CO VXUBSYMOZUEHFT-UHFFFAOYSA-N 0.000 description 2
- LPFGYBMCILOKFL-UHFFFAOYSA-N 2-(1-bromoethyl)-1-(bromomethyl)-4-chlorobenzene Chemical compound CC(Br)C1=CC(Cl)=CC=C1CBr LPFGYBMCILOKFL-UHFFFAOYSA-N 0.000 description 2
- KPGXRSRHYNQIFN-UHFFFAOYSA-N 2-oxoglutaric acid Chemical compound OC(=O)CCC(=O)C(O)=O KPGXRSRHYNQIFN-UHFFFAOYSA-N 0.000 description 2
- FKIPOBDSQPYMBX-UHFFFAOYSA-N 4-chloro-1-(1-chloroethyl)-2-(chloromethyl)benzene Chemical compound CC(Cl)C1=CC=C(Cl)C=C1CCl FKIPOBDSQPYMBX-UHFFFAOYSA-N 0.000 description 2
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 2
- AYUIAKBVMWPHOM-UHFFFAOYSA-N 5-chloro-2-(4,4-dimethyl-5h-1,3-oxazol-2-yl)benzaldehyde Chemical compound CC1(C)COC(C=2C(=CC(Cl)=CC=2)C=O)=N1 AYUIAKBVMWPHOM-UHFFFAOYSA-N 0.000 description 2
- JDVDBELYXVERBK-UHFFFAOYSA-N 5-chloro-7-methyl-3h-2-benzofuran-1-one Chemical compound CC1=CC(Cl)=CC2=C1C(=O)OC2 JDVDBELYXVERBK-UHFFFAOYSA-N 0.000 description 2
- WCUZDBVNYVCMHV-UHFFFAOYSA-N 6-fluoro-3-methyl-3h-2-benzofuran-1-one Chemical compound FC1=CC=C2C(C)OC(=O)C2=C1 WCUZDBVNYVCMHV-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- DXOSSHXQEWEVGJ-UHFFFAOYSA-N [2-(hydroxymethyl)phenyl]-(4-methoxyphenyl)methanol Chemical compound C1=CC(OC)=CC=C1C(O)C1=CC=CC=C1CO DXOSSHXQEWEVGJ-UHFFFAOYSA-N 0.000 description 2
- DAWFJLYKWAQDIE-UHFFFAOYSA-N [2-(hydroxymethyl)phenyl]-(4-methylphenyl)methanol Chemical compound C1=CC(C)=CC=C1C(O)C1=CC=CC=C1CO DAWFJLYKWAQDIE-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 125000005036 alkoxyphenyl group Chemical group 0.000 description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 description 2
- 108020004101 alpha-2 Adrenergic Receptor Proteins 0.000 description 2
- HXXFSFRBOHSIMQ-VFUOTHLCSA-N alpha-D-glucose 1-phosphate Chemical compound OC[C@H]1O[C@H](OP(O)(O)=O)[C@H](O)[C@@H](O)[C@@H]1O HXXFSFRBOHSIMQ-VFUOTHLCSA-N 0.000 description 2
- AWUCVROLDVIAJX-UHFFFAOYSA-N alpha-glycerophosphate Natural products OCC(O)COP(O)(O)=O AWUCVROLDVIAJX-UHFFFAOYSA-N 0.000 description 2
- 102000015006 alpha2-adrenergic receptor activity proteins Human genes 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 125000000068 chlorophenyl group Chemical group 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- 239000003889 eye drop Substances 0.000 description 2
- 229940012356 eye drops Drugs 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 125000001207 fluorophenyl group Chemical group 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229950010772 glucose-1-phosphate Drugs 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 159000000001 potassium salts Chemical class 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- AWUCVROLDVIAJX-GSVOUGTGSA-N sn-glycerol 3-phosphate Chemical compound OC[C@@H](O)COP(O)(O)=O AWUCVROLDVIAJX-GSVOUGTGSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- 230000000699 topical effect Effects 0.000 description 2
- 239000012049 topical pharmaceutical composition Substances 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 1
- UCTWMZQNUQWSLP-VIFPVBQESA-N (R)-adrenaline Chemical compound CNC[C@H](O)C1=CC=C(O)C(O)=C1 UCTWMZQNUQWSLP-VIFPVBQESA-N 0.000 description 1
- 229930182837 (R)-adrenaline Natural products 0.000 description 1
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 description 1
- OUXVXXHQSWROCS-UHFFFAOYSA-N 1-[2-(hydroxymethyl)phenyl]-2-phenylethanol Chemical compound OCC1=CC=CC=C1C(O)CC1=CC=CC=C1 OUXVXXHQSWROCS-UHFFFAOYSA-N 0.000 description 1
- SHCFCJUJGBRSPO-UHFFFAOYSA-N 1-cyclohexylcyclohexan-1-amine Chemical compound C1CCCCC1C1(N)CCCCC1 SHCFCJUJGBRSPO-UHFFFAOYSA-N 0.000 description 1
- FSMXJLAATHSRCB-UHFFFAOYSA-N 2-(3-chlorobenzoyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CC=CC(Cl)=C1 FSMXJLAATHSRCB-UHFFFAOYSA-N 0.000 description 1
- YWECCEXWKFHHQJ-UHFFFAOYSA-N 2-(4-chlorobenzoyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CC=C(Cl)C=C1 YWECCEXWKFHHQJ-UHFFFAOYSA-N 0.000 description 1
- XCQDCQKNZXMXGM-UHFFFAOYSA-N 2-(4-chlorophenyl)-4,4-dimethyl-5h-1,3-oxazole Chemical compound CC1(C)COC(C=2C=CC(Cl)=CC=2)=N1 XCQDCQKNZXMXGM-UHFFFAOYSA-N 0.000 description 1
- FJAZVXUPZQSZKI-UHFFFAOYSA-N 2-(4-fluorobenzoyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CC=C(F)C=C1 FJAZVXUPZQSZKI-UHFFFAOYSA-N 0.000 description 1
- ICQOWIXIHDDXDI-UHFFFAOYSA-N 2-(4-methylbenzoyl)benzoic acid Chemical compound C1=CC(C)=CC=C1C(=O)C1=CC=CC=C1C(O)=O ICQOWIXIHDDXDI-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- QDAWXRKTSATEOP-UHFFFAOYSA-N 2-acetylbenzoic acid Chemical compound CC(=O)C1=CC=CC=C1C(O)=O QDAWXRKTSATEOP-UHFFFAOYSA-N 0.000 description 1
- JYBOOAWVGOYQFU-UHFFFAOYSA-N 2-propanoylbenzoic acid Chemical compound CCC(=O)C1=CC=CC=C1C(O)=O JYBOOAWVGOYQFU-UHFFFAOYSA-N 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- UIUCGMLLTRXRBF-UHFFFAOYSA-N 4'-Methoxybenzophenone-2-carboxylic acid Chemical compound C1=CC(OC)=CC=C1C(=O)C1=CC=CC=C1C(O)=O UIUCGMLLTRXRBF-UHFFFAOYSA-N 0.000 description 1
- IYTJRMRETHPZAC-UHFFFAOYSA-N 4,4-dibenzylpiperidine Chemical compound C1CNCCC1(CC=1C=CC=CC=1)CC1=CC=CC=C1 IYTJRMRETHPZAC-UHFFFAOYSA-N 0.000 description 1
- AJZKMDAYNXJZOR-UHFFFAOYSA-N 6-amino-3-methyl-3h-2-benzofuran-1-one Chemical compound NC1=CC=C2C(C)OC(=O)C2=C1 AJZKMDAYNXJZOR-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 208000002705 Glucose Intolerance Diseases 0.000 description 1
- 206010018429 Glucose tolerance impaired Diseases 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- JVVXZOOGOGPDRZ-SLFFLAALSA-N [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine Chemical compound NC[C@]1(C)CCC[C@]2(C)C3=CC=C(C(C)C)C=C3CC[C@H]21 JVVXZOOGOGPDRZ-SLFFLAALSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000670 adrenergic alpha-2 receptor antagonist Substances 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 159000000013 aluminium salts Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- HOPRXXXSABQWAV-UHFFFAOYSA-N anhydrous collidine Natural products CC1=CC=NC(C)=C1C HOPRXXXSABQWAV-UHFFFAOYSA-N 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 238000006254 arylation reaction Methods 0.000 description 1
- 229940072107 ascorbate Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- UPABQMWFWCMOFV-UHFFFAOYSA-N benethamine Chemical compound C=1C=CC=CC=1CNCCC1=CC=CC=C1 UPABQMWFWCMOFV-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- BLGXFZZNTVWLAY-UHFFFAOYSA-N beta-Yohimbin Natural products C1=CC=C2C(CCN3CC4CCC(O)C(C4CC33)C(=O)OC)=C3NC2=C1 BLGXFZZNTVWLAY-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000004067 bulking agent Substances 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- UTBIMNXEDGNJFE-UHFFFAOYSA-N collidine Natural products CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 230000020335 dealkylation Effects 0.000 description 1
- 238000006900 dealkylation reaction Methods 0.000 description 1
- 238000005890 dearylation reaction Methods 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 125000006264 diethylaminomethyl group Chemical group [H]C([H])([H])C([H])([H])N(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003974 emollient agent Substances 0.000 description 1
- 229960005139 epinephrine Drugs 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- UUBJKHVFGWGJKX-UHFFFAOYSA-N hydrate tetrahydrochloride Chemical compound O.Cl.Cl.Cl.Cl UUBJKHVFGWGJKX-UHFFFAOYSA-N 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 230000001631 hypertensive effect Effects 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 125000000686 lactone group Chemical group 0.000 description 1
- WGOPGODQLGJZGL-UHFFFAOYSA-N lithium;butane Chemical compound [Li+].CC[CH-]C WGOPGODQLGJZGL-UHFFFAOYSA-N 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 229940096984 ophthalmic cream Drugs 0.000 description 1
- 229940069265 ophthalmic ointment Drugs 0.000 description 1
- 238000003305 oral gavage Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 125000005633 phthalidyl group Chemical group 0.000 description 1
- 239000001253 polyvinylpolypyrrolidone Substances 0.000 description 1
- 235000013809 polyvinylpolypyrrolidone Nutrition 0.000 description 1
- 229920000523 polyvinylpolypyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 238000000159 protein binding assay Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 229910052705 radium Inorganic materials 0.000 description 1
- BLGXFZZNTVWLAY-DIRVCLHFSA-N rauwolscine Chemical compound C1=CC=C2C(CCN3C[C@H]4CC[C@H](O)[C@H]([C@H]4C[C@H]33)C(=O)OC)=C3NC2=C1 BLGXFZZNTVWLAY-DIRVCLHFSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000008109 sodium starch glycolate Substances 0.000 description 1
- 229940079832 sodium starch glycolate Drugs 0.000 description 1
- 229920003109 sodium starch glycolate Polymers 0.000 description 1
- 229910001495 sodium tetrafluoroborate Inorganic materials 0.000 description 1
- 239000007892 solid unit dosage form Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 229940032147 starch Drugs 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 239000008009 topical excipient Substances 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000759 toxicological effect Toxicity 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 238000002424 x-ray crystallography Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB868628415A GB8628415D0 (en) | 1986-11-27 | 1986-11-27 | Compounds |
| GB878705238A GB8705238D0 (en) | 1987-03-06 | 1987-03-06 | Compounds |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3780438D1 DE3780438D1 (de) | 1992-08-20 |
| DE3780438T2 true DE3780438T2 (de) | 1993-01-28 |
Family
ID=26291597
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8787310332T Expired - Fee Related DE3780438T2 (de) | 1986-11-27 | 1987-11-23 | N-substituierte cyclische amine, ihre herstellung sowie pharmazeutische zusammensetzungen die sie enthalten. |
Country Status (10)
| Country | Link |
|---|---|
| US (2) | US4918083A (enExample) |
| EP (1) | EP0275639B1 (enExample) |
| KR (1) | KR880011141A (enExample) |
| AU (1) | AU600994B2 (enExample) |
| DE (1) | DE3780438T2 (enExample) |
| DK (1) | DK619187A (enExample) |
| ES (1) | ES2051750T3 (enExample) |
| GR (1) | GR3005601T3 (enExample) |
| NZ (1) | NZ222683A (enExample) |
| PT (1) | PT86215B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8529546D0 (en) * | 1985-11-30 | 1986-01-08 | Beecham Group Plc | Compounds |
| AU601877B2 (en) * | 1987-10-19 | 1990-09-20 | Beecham Group Plc | Substituted imidazoles |
| GB8916150D0 (en) * | 1989-07-14 | 1989-08-31 | Beecham Group Plc | Novel compounds |
| US5726197A (en) * | 1992-11-02 | 1998-03-10 | Syntex (U.S.A.) Inc. | Isoindolinyl derivatives |
| DE102008061686A1 (de) | 2008-12-11 | 2010-06-17 | Bayer Materialscience Ag | Verfahren zur Herstellung von Isocyanaten in der Gasphase |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3836536A (en) * | 1972-06-08 | 1974-09-17 | Warner Lambert Co | 1,2,3,4-tetrahydro-3-aminomethyliso-quinolines |
| US3941803A (en) * | 1975-03-28 | 1976-03-02 | The Upjohn Company | 2-(Imidazol-1-yl)benzophenones |
| EP0003901B1 (en) * | 1978-02-24 | 1981-08-05 | Pfizer Limited | 3-(imidazol-1-ylalkyl)indoles as selective inhibitors of thromboxane synthetase,pharmaceutical compositions thereof, and methods for preparing them |
| GB2021100B (en) * | 1978-04-17 | 1982-08-25 | Beiersdorf Ag | Heterocyclic amines |
| WO1980000840A1 (fr) * | 1978-10-12 | 1980-05-01 | Sandoz Ag | Amines cycliques n-substituees, leur preparation et remedes les contenant |
| DE3133302A1 (de) * | 1981-08-22 | 1983-03-03 | Beiersdorf Ag, 2000 Hamburg | Isoindolin-2-yl-amino-imidazoline und isoindolin-2-yl-guanidine, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| US4511573A (en) * | 1983-05-17 | 1985-04-16 | Ciba-Geigy Corporation | 3-Substituted-2-(heteroaryl) indoles |
| GB8531615D0 (en) * | 1985-12-23 | 1986-02-05 | Zambeletti Spa L | Compounds |
-
1987
- 1987-11-23 ES ES87310332T patent/ES2051750T3/es not_active Expired - Lifetime
- 1987-11-23 DE DE8787310332T patent/DE3780438T2/de not_active Expired - Fee Related
- 1987-11-23 EP EP87310332A patent/EP0275639B1/en not_active Expired - Lifetime
- 1987-11-24 US US07/124,902 patent/US4918083A/en not_active Expired - Fee Related
- 1987-11-25 PT PT86215A patent/PT86215B/pt not_active IP Right Cessation
- 1987-11-25 DK DK619187A patent/DK619187A/da not_active Application Discontinuation
- 1987-11-25 AU AU81696/87A patent/AU600994B2/en not_active Ceased
- 1987-11-25 NZ NZ222683A patent/NZ222683A/xx unknown
- 1987-11-26 KR KR870013386A patent/KR880011141A/ko not_active Ceased
-
1990
- 1990-03-14 US US07/493,351 patent/US5077299A/en not_active Expired - Lifetime
-
1992
- 1992-09-03 GR GR920401927T patent/GR3005601T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU600994B2 (en) | 1990-08-30 |
| EP0275639B1 (en) | 1992-07-15 |
| DK619187D0 (da) | 1987-11-25 |
| PT86215B (pt) | 1990-11-07 |
| DE3780438D1 (de) | 1992-08-20 |
| NZ222683A (en) | 1989-11-28 |
| DK619187A (da) | 1988-05-28 |
| ES2051750T3 (es) | 1994-07-01 |
| PT86215A (en) | 1987-12-01 |
| US5077299A (en) | 1991-12-31 |
| KR880011141A (ko) | 1988-10-26 |
| GR3005601T3 (enExample) | 1993-06-07 |
| AU8169687A (en) | 1988-06-02 |
| US4918083A (en) | 1990-04-17 |
| EP0275639A1 (en) | 1988-07-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3875073T2 (de) | 3-(4(1-substituierte-4-piperazinyl)butyl)-4-thiazolidinone, verfahren zu deren herstellung und ihre anwendung als arzneimittel. | |
| EP0934311B1 (de) | Neue heterocyclylmethyl-substituierte pyrazolderivate und ihre verwendung in der behandlung von herz-kreislauf-erkrankungen | |
| DE60108900T2 (de) | Phenylethenyl- oder phenylethinylderivate als glutamatrezeptorantagonisten | |
| DE60003709T2 (de) | Substituierte azole | |
| DE69716062T2 (de) | Benzofuran-derivate und deren verwendung | |
| DE69314855T2 (de) | Verzweigte Alkylaminothiazolederivate, Verfahren zu ihrer Herstellung und pharmazeutische Zusammenstellungen die sie enthalten | |
| DE60309057T2 (de) | Azabicycloderivate als antagonisten des muscarinischen rezeptors | |
| DE69110254T2 (de) | Hydroxychinolonderivate. | |
| DE69533284T2 (de) | Neue cyclische und acyclische amide zur erhöhung der neurotransmitter ausschüttung | |
| DE3788982T2 (de) | Trans-6-[2-(N-heteroaryl)-3,5-disubstituiertes)pyrazol-4-yl)-ethyl] oder -ethenyl]tetrahydro-4-hydroxypyran-2-on-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung. | |
| DE69409337T2 (de) | Verzweigte Aminothiazole-Derivate, Verfahren zu ihrer Herstellung und pharmazeutische Zusammenstellungen die sie enthalten | |
| EP0170117A1 (de) | Oxindol-Derivate, Verfahren zu ihrer Herstellung, diese Verbindungen enthaltende Arzneimittel und Zwischenprodukte | |
| DE69006907T2 (de) | Arylthiazolylimidazole als 5HT3-Antagonisten. | |
| DE68904342T2 (de) | Cyclische amide. | |
| DE68911699T2 (de) | Diamin-Verbindungen. | |
| DE69324212T2 (de) | Indol-7-carboxamide Derivate als Analgetika | |
| EP0282502A1 (de) | Imidazol-derivate. | |
| DE69719511T2 (de) | Antivirale 2,4-pyrimidindion-derivate und verfahren zu ihrer herstellung | |
| DE3780438T2 (de) | N-substituierte cyclische amine, ihre herstellung sowie pharmazeutische zusammensetzungen die sie enthalten. | |
| DE69408674T2 (de) | Phenylpyrrol-derivate und ihre verwendung als dopamin d3 antagonisten | |
| DE69131057T2 (de) | 3-[1,Thiazolidinylbutyl-4-piperazinyl]-1H-Indazole, Verfahren zu ihrer Herstellung und ihre Verwendung als Medikamente | |
| DE68925173T2 (de) | 4-Methyl und 4-Ethyl substituierte Pyrrolidin-2-one | |
| DE69227207T2 (de) | 1-Piperazinyl-2-butene und 2-butyne, Zwischenverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel | |
| EP0350437B1 (de) | 3,4-Disubstituierte Phenyl-Heterocyclen und deren Verwendung | |
| DE60106572T2 (de) | IMIDAZOLVERBINDUNGEN ALS Alpha2-ADRENOREZEPTOREN ANTAGONISTEN |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |