DE3721262A1 - Transportable biertheke - Google Patents
Transportable bierthekeInfo
- Publication number
- DE3721262A1 DE3721262A1 DE19873721262 DE3721262A DE3721262A1 DE 3721262 A1 DE3721262 A1 DE 3721262A1 DE 19873721262 DE19873721262 DE 19873721262 DE 3721262 A DE3721262 A DE 3721262A DE 3721262 A1 DE3721262 A1 DE 3721262A1
- Authority
- DE
- Germany
- Prior art keywords
- beer
- counter
- lid
- counter according
- bar
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 235000013405 beer Nutrition 0.000 title claims abstract description 57
- 230000008878 coupling Effects 0.000 claims description 4
- 238000010168 coupling process Methods 0.000 claims description 4
- 238000005859 coupling reaction Methods 0.000 claims description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract description 2
- 238000000151 deposition Methods 0.000 abstract 1
- 239000011521 glass Substances 0.000 abstract 1
- 239000000446 fuel Substances 0.000 description 4
- 230000004308 accommodation Effects 0.000 description 2
- 230000005611 electricity Effects 0.000 description 2
- 238000005057 refrigeration Methods 0.000 description 2
- 239000002351 wastewater Substances 0.000 description 2
- GQWNECFJGBQMBO-UHFFFAOYSA-N Molindone hydrochloride Chemical compound Cl.O=C1C=2C(CC)=C(C)NC=2CCC1CN1CCOCC1 GQWNECFJGBQMBO-UHFFFAOYSA-N 0.000 description 1
- 235000004443 Ricinus communis Nutrition 0.000 description 1
- 240000000528 Ricinus communis Species 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000013505 freshwater Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000005286 illumination Methods 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B67—OPENING, CLOSING OR CLEANING BOTTLES, JARS OR SIMILAR CONTAINERS; LIQUID HANDLING
- B67D—DISPENSING, DELIVERING OR TRANSFERRING LIQUIDS, NOT OTHERWISE PROVIDED FOR
- B67D1/00—Apparatus or devices for dispensing beverages on draught
- B67D1/06—Mountings or arrangements of dispensing apparatus in or on shop or bar counters
Landscapes
- Devices For Dispensing Beverages (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19873721262 DE3721262A1 (de) | 1986-08-30 | 1987-06-27 | Transportable biertheke |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19868623315 DE8623315U1 (de) | 1986-08-30 | 1986-08-30 | Transportable Biertheke |
| DE19873721262 DE3721262A1 (de) | 1986-08-30 | 1987-06-27 | Transportable biertheke |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3721262A1 true DE3721262A1 (de) | 1988-03-10 |
| DE3721262C2 DE3721262C2 (cg-RX-API-DMAC10.html) | 1989-06-22 |
Family
ID=25857017
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19873721262 Granted DE3721262A1 (de) | 1986-08-30 | 1987-06-27 | Transportable biertheke |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE3721262A1 (cg-RX-API-DMAC10.html) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE9416223U1 (de) * | 1994-10-10 | 1995-02-02 | WINTER Karosserie- und Fahrzeugbau GmbH, 02763 Zittau | Mobile Ausschankeinrichtung in kompakter Bauweise |
| CZ304460B6 (cs) * | 2012-10-09 | 2014-05-14 | Chladírenský Servis Jedlička S.R.O. | Prosklený výčepní chladicí pult s regulací výkonu chlazení |
| WO2014104879A1 (en) * | 2012-12-27 | 2014-07-03 | Ludo Beheer B.V. | A tapping device and a coupling |
| KR20190041762A (ko) * | 2017-10-13 | 2019-04-23 | 주식회사 비어라인 | 음료 분배 장치 |
| EP2763568B1 (en) * | 2011-10-07 | 2023-08-02 | Walstad Miller, Tonia | Furniture with integrated storage for water or other material |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE29518436U1 (de) * | 1995-11-21 | 1996-01-11 | Overesch, Werner, 48629 Metelen | Transportable Klein-Theke |
| DE19626519C2 (de) * | 1996-07-02 | 1998-07-16 | Oleg Von Cube | Tresen (Transportabler/es Tresen/Pult) |
| DE29811864U1 (de) | 1998-07-03 | 1998-10-01 | Dokters, Karin, 49770 Dohren | Transportable Vorrichtung zur Bereitstellung von Lebensmitteln und Getränken bei Veranstaltungen |
| DE10116098C2 (de) * | 2000-03-30 | 2003-12-24 | Rieber Gmbh & Co Kg | Küchensystem |
Citations (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB716397A (en) * | 1952-06-12 | 1954-10-06 | Benjamin Thomas Potter | Improvements in boxes, cases and the like |
| DE1694574U (de) * | 1954-02-19 | 1955-03-10 | Kuehlindustrie Kaelte Schuster | Kuehlmoebel, insbesondere bierkuehlbuefett. |
| DE1899317U (de) * | 1964-05-23 | 1964-08-20 | Wilhelm Dieckhoff | Bier-schank-bar. |
| US3327902A (en) * | 1965-10-22 | 1967-06-27 | Alterwitz Melvin | Chilled beverage dispensing system |
| DE6941361U (de) * | 1969-10-24 | 1970-11-12 | Revay Gyula | Zusammenklappbares moebelstueck |
| US3735898A (en) * | 1970-12-28 | 1973-05-29 | Northrop Corp | Portable beverage dispensing apparatus |
| DE7326824U (de) * | 1973-11-29 | Boehme F | Em als Koffer verwendbarer Tisch | |
| GB2007625A (en) * | 1977-11-03 | 1979-05-23 | Hercri Sa | A Liquid Refreshment Dispensing Machine |
| US4488623A (en) * | 1983-10-06 | 1984-12-18 | Linnell Ii William S | Canoe travel box |
| DE8418895U1 (de) * | 1984-06-22 | 1985-07-18 | Wähning, Eckhard, 4407 Emsdetten | Küchenblock |
-
1987
- 1987-06-27 DE DE19873721262 patent/DE3721262A1/de active Granted
Patent Citations (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE7326824U (de) * | 1973-11-29 | Boehme F | Em als Koffer verwendbarer Tisch | |
| GB716397A (en) * | 1952-06-12 | 1954-10-06 | Benjamin Thomas Potter | Improvements in boxes, cases and the like |
| DE1694574U (de) * | 1954-02-19 | 1955-03-10 | Kuehlindustrie Kaelte Schuster | Kuehlmoebel, insbesondere bierkuehlbuefett. |
| DE1899317U (de) * | 1964-05-23 | 1964-08-20 | Wilhelm Dieckhoff | Bier-schank-bar. |
| US3327902A (en) * | 1965-10-22 | 1967-06-27 | Alterwitz Melvin | Chilled beverage dispensing system |
| DE6941361U (de) * | 1969-10-24 | 1970-11-12 | Revay Gyula | Zusammenklappbares moebelstueck |
| US3735898A (en) * | 1970-12-28 | 1973-05-29 | Northrop Corp | Portable beverage dispensing apparatus |
| GB2007625A (en) * | 1977-11-03 | 1979-05-23 | Hercri Sa | A Liquid Refreshment Dispensing Machine |
| US4488623A (en) * | 1983-10-06 | 1984-12-18 | Linnell Ii William S | Canoe travel box |
| DE8418895U1 (de) * | 1984-06-22 | 1985-07-18 | Wähning, Eckhard, 4407 Emsdetten | Küchenblock |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE9416223U1 (de) * | 1994-10-10 | 1995-02-02 | WINTER Karosserie- und Fahrzeugbau GmbH, 02763 Zittau | Mobile Ausschankeinrichtung in kompakter Bauweise |
| EP2763568B1 (en) * | 2011-10-07 | 2023-08-02 | Walstad Miller, Tonia | Furniture with integrated storage for water or other material |
| CZ304460B6 (cs) * | 2012-10-09 | 2014-05-14 | Chladírenský Servis Jedlička S.R.O. | Prosklený výčepní chladicí pult s regulací výkonu chlazení |
| WO2014104879A1 (en) * | 2012-12-27 | 2014-07-03 | Ludo Beheer B.V. | A tapping device and a coupling |
| KR20190041762A (ko) * | 2017-10-13 | 2019-04-23 | 주식회사 비어라인 | 음료 분배 장치 |
Also Published As
| Publication number | Publication date |
|---|---|
| DE3721262C2 (cg-RX-API-DMAC10.html) | 1989-06-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP3334311B1 (de) | Wandschrank, insbesondere küchen-wandschrank | |
| DE3721262A1 (de) | Transportable biertheke | |
| DE2546938A1 (de) | Ausstellungsgestell mit lageverstellung fuer artikel | |
| DE10116098C2 (de) | Küchensystem | |
| EP0523063A1 (de) | Zerlegbare vitrine. | |
| DE9010785U1 (de) | Kühlgerät, insbesondere Einbau-Kühlschrank | |
| DE8623315U1 (de) | Transportable Biertheke | |
| DE4133635A1 (de) | Gastronomisches geraetesystem | |
| DE19924999C2 (de) | Transportable Warm- und Kaltausgabe | |
| DE1933183A1 (de) | Kastenfoermiges Moebelstueck | |
| DE102005021848A1 (de) | Kühl- und/oder Gefriergerät | |
| DE3620016A1 (de) | Sammelbehaelter-kommode oder -einbauschrank | |
| DE29813519U1 (de) | Zusammensteckbare Vitrine | |
| DE4436608A1 (de) | Einbauküche | |
| AT14963U1 (de) | Wandschrank, insbesondere Küchen-Wandschrank | |
| DE102004040604A1 (de) | Transportabler mobiler Ausstellungsstand | |
| DE655348C (de) | Kuechenmoebel | |
| DE29608833U1 (de) | Ablagesystem zur Ablage von Gegenständen | |
| DE29615517U1 (de) | Aufbewahrungs- bzw. Präsentationseinrichtung, insbesondere für Waren | |
| DE202004013105U1 (de) | Transportabler mobiler Ausstellungsstand | |
| DE4406980A1 (de) | Unterschrank für Aquarien, Terrarien oder dergleichen | |
| DE10127701B4 (de) | Demontierbare Ganzglasvitrine | |
| DE9213258U1 (de) | Lebensmittel-Behältnis für Großkücheneinrichtungen | |
| DE9218614U1 (de) | Haushalt-Kühlschrank | |
| DE8104986U1 (de) | "sockeltisch" |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |