DE3639400C2 - - Google Patents
Info
- Publication number
- DE3639400C2 DE3639400C2 DE19863639400 DE3639400A DE3639400C2 DE 3639400 C2 DE3639400 C2 DE 3639400C2 DE 19863639400 DE19863639400 DE 19863639400 DE 3639400 A DE3639400 A DE 3639400A DE 3639400 C2 DE3639400 C2 DE 3639400C2
- Authority
- DE
- Germany
- Prior art keywords
- tert
- butyl
- alkyl
- hydroxyphenyl
- esters
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000002148 esters Chemical class 0.000 claims description 35
- -1 C5 to C12 cycloalkyl Chemical group 0.000 claims description 31
- 238000000034 method Methods 0.000 claims description 14
- 229920000098 polyolefin Polymers 0.000 claims description 13
- 150000001335 aliphatic alkanes Chemical class 0.000 claims description 12
- 125000003118 aryl group Chemical group 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 10
- 230000006641 stabilisation Effects 0.000 claims description 10
- 238000011105 stabilization Methods 0.000 claims description 10
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 10
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 claims description 9
- WPMYUUITDBHVQZ-UHFFFAOYSA-N 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid Chemical compound CC(C)(C)C1=CC(CCC(O)=O)=CC(C(C)(C)C)=C1O WPMYUUITDBHVQZ-UHFFFAOYSA-N 0.000 claims description 7
- 239000004743 Polypropylene Substances 0.000 claims description 7
- 150000001735 carboxylic acids Chemical class 0.000 claims description 7
- 229920001155 polypropylene Polymers 0.000 claims description 7
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 6
- 239000004698 Polyethylene Substances 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 229920000573 polyethylene Polymers 0.000 claims description 4
- 230000007935 neutral effect Effects 0.000 claims description 3
- UENWRTRMUIOCKN-UHFFFAOYSA-N benzyl thiol Chemical class SCC1=CC=CC=C1 UENWRTRMUIOCKN-UHFFFAOYSA-N 0.000 claims 1
- 239000003381 stabilizer Substances 0.000 description 36
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 18
- 229920000642 polymer Polymers 0.000 description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 10
- 229910052717 sulfur Inorganic materials 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 238000012360 testing method Methods 0.000 description 9
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 8
- 238000012545 processing Methods 0.000 description 8
- 239000011593 sulfur Substances 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 7
- 239000000654 additive Substances 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 230000000052 comparative effect Effects 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 6
- 238000005809 transesterification reaction Methods 0.000 description 6
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- PXMJCECEFTYEKE-UHFFFAOYSA-N Benzenepropanoic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-, methyl ester Chemical compound COC(=O)CCC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 PXMJCECEFTYEKE-UHFFFAOYSA-N 0.000 description 5
- 239000003963 antioxidant agent Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 238000004809 thin layer chromatography Methods 0.000 description 5
- 150000003573 thiols Chemical class 0.000 description 5
- ANMHSIXPUAKNLM-UHFFFAOYSA-N 2-benzylsulfanylethanol Chemical compound OCCSCC1=CC=CC=C1 ANMHSIXPUAKNLM-UHFFFAOYSA-N 0.000 description 4
- KWWZHCSQVRVQGF-UHFFFAOYSA-N 2-phenylsulfanylethanol Chemical compound OCCSC1=CC=CC=C1 KWWZHCSQVRVQGF-UHFFFAOYSA-N 0.000 description 4
- 230000032683 aging Effects 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 229920001971 elastomer Polymers 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 239000011261 inert gas Substances 0.000 description 4
- 239000005060 rubber Substances 0.000 description 4
- 230000035882 stress Effects 0.000 description 4
- QSOQDJFHQMQCQK-UHFFFAOYSA-N 2-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]ethanol Chemical compound CC1=C(C)C(C)=C(CSCCO)C(C)=C1C QSOQDJFHQMQCQK-UHFFFAOYSA-N 0.000 description 3
- XCAFZAPBIFLUQG-UHFFFAOYSA-N 2-[2-(2-phenylsulfanylethoxy)ethoxy]ethanol Chemical compound OCCOCCOCCSC1=CC=CC=C1 XCAFZAPBIFLUQG-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 3
- 235000013539 calcium stearate Nutrition 0.000 description 3
- 239000008116 calcium stearate Substances 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 3
- 238000006731 degradation reaction Methods 0.000 description 3
- 238000011161 development Methods 0.000 description 3
- 230000018109 developmental process Effects 0.000 description 3
- 238000002845 discoloration Methods 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 238000001125 extrusion Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229920000620 organic polymer Polymers 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 229920002857 polybutadiene Polymers 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 3
- 150000003568 thioethers Chemical class 0.000 description 3
- QZCLZVACBCSMFG-UHFFFAOYSA-N 2-(2-phenylsulfanylethoxy)ethanol Chemical compound OCCOCCSC1=CC=CC=C1 QZCLZVACBCSMFG-UHFFFAOYSA-N 0.000 description 2
- YXZOWAVBWUAUGP-UHFFFAOYSA-N 2-cyclohexylsulfanylethanol Chemical compound OCCSC1CCCCC1 YXZOWAVBWUAUGP-UHFFFAOYSA-N 0.000 description 2
- WPMYUUITDBHVQZ-UHFFFAOYSA-M 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CC(C)(C)C1=CC(CCC([O-])=O)=CC(C(C)(C)C)=C1O WPMYUUITDBHVQZ-UHFFFAOYSA-M 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 239000006057 Non-nutritive feed additive Substances 0.000 description 2
- JKIJEFPNVSHHEI-UHFFFAOYSA-N Phenol, 2,4-bis(1,1-dimethylethyl)-, phosphite (3:1) Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=CC=C1OP(OC=1C(=CC(=CC=1)C(C)(C)C)C(C)(C)C)OC1=CC=C(C(C)(C)C)C=C1C(C)(C)C JKIJEFPNVSHHEI-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 239000005062 Polybutadiene Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- YHWCPXVTRSHPNY-UHFFFAOYSA-N butan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCC[O-].CCCC[O-].CCCC[O-].CCCC[O-] YHWCPXVTRSHPNY-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 2
- 150000001993 dienes Chemical class 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 150000002009 diols Chemical class 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 150000002432 hydroperoxides Chemical class 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- KRNSKBDDWIOLTO-UHFFFAOYSA-N 1-(bromomethyl)-2,3,4,5,6-pentamethylbenzene Chemical compound CC1=C(C)C(C)=C(CBr)C(C)=C1C KRNSKBDDWIOLTO-UHFFFAOYSA-N 0.000 description 1
- KGRVJHAUYBGFFP-UHFFFAOYSA-N 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical compound CC(C)(C)C1=CC(C)=CC(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O KGRVJHAUYBGFFP-UHFFFAOYSA-N 0.000 description 1
- KDCZKAGJWWVOMR-UHFFFAOYSA-N 2-benzylsulfanylethyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound C(C1=CC=CC=C1)SCCOC(CCC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C)=O KDCZKAGJWWVOMR-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- XTODZNILOHCYAM-UHFFFAOYSA-N 2-phenylsulfanylethyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound C1(=CC=CC=C1)SCCOC(CCC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C)=O XTODZNILOHCYAM-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- KMTRUDSVKNLOMY-UHFFFAOYSA-N Ethylene carbonate Chemical compound O=C1OCCO1 KMTRUDSVKNLOMY-UHFFFAOYSA-N 0.000 description 1
- 239000012963 UV stabilizer Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 238000007605 air drying Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- SMZOGRDCAXLAAR-UHFFFAOYSA-N aluminium isopropoxide Chemical compound [Al+3].CC(C)[O-].CC(C)[O-].CC(C)[O-] SMZOGRDCAXLAAR-UHFFFAOYSA-N 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000005815 base catalysis Methods 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- AFRJJFRNGGLMDW-UHFFFAOYSA-N lithium amide Chemical compound [Li+].[NH2-] AFRJJFRNGGLMDW-UHFFFAOYSA-N 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 150000005673 monoalkenes Chemical class 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004597 plastic additive Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 238000012667 polymer degradation Methods 0.000 description 1
- 239000002861 polymer material Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- PXXNTAGJWPJAGM-UHFFFAOYSA-N vertaline Natural products C1C2C=3C=C(OC)C(OC)=CC=3OC(C=C3)=CC=C3CCC(=O)OC1CC1N2CCCC1 PXXNTAGJWPJAGM-UHFFFAOYSA-N 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 238000004383 yellowing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C321/00—Thiols, sulfides, hydropolysulfides or polysulfides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19863639400 DE3639400A1 (de) | 1986-11-18 | 1986-11-18 | Ester von 3-tert.-butyl- bzw. 3-tert.-butyl-5-alkyl-4-hydroxyphenyl-(alkan)-carbonsaeuren mit oxethylaten von monofunktionellen thiophenolen und thiolen, verfahren zu ihrer herstellung und ihre verwendung als stabilisatoren |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19863639400 DE3639400A1 (de) | 1986-11-18 | 1986-11-18 | Ester von 3-tert.-butyl- bzw. 3-tert.-butyl-5-alkyl-4-hydroxyphenyl-(alkan)-carbonsaeuren mit oxethylaten von monofunktionellen thiophenolen und thiolen, verfahren zu ihrer herstellung und ihre verwendung als stabilisatoren |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3639400A1 DE3639400A1 (de) | 1988-05-26 |
| DE3639400C2 true DE3639400C2 (enExample) | 1989-03-23 |
Family
ID=6314210
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19863639400 Granted DE3639400A1 (de) | 1986-11-18 | 1986-11-18 | Ester von 3-tert.-butyl- bzw. 3-tert.-butyl-5-alkyl-4-hydroxyphenyl-(alkan)-carbonsaeuren mit oxethylaten von monofunktionellen thiophenolen und thiolen, verfahren zu ihrer herstellung und ihre verwendung als stabilisatoren |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE3639400A1 (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN101294113B (zh) * | 2007-04-28 | 2011-02-09 | 中国石油化工股份有限公司石油化工科学研究院 | 绝缘油组合物 |
| DE102017220555A1 (de) * | 2017-11-17 | 2019-05-23 | Fraunhofer-Gesellschaft zur Förderung der angewandten Forschung e.V. | Verbindungen mit stabilisierender Wirkung, Verfahren zu deren Herstellung, Zusammensetzung enthaltend diese stabilisierenden Verbindungen, Verfahren zur Stabilisierung einer organischen Komponente sowie Verwendung von stabilisierenden Verbindungen |
Family Cites Families (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE637444A (enExample) * | ||||
| US3644482A (en) * | 1961-10-30 | 1972-02-22 | Geigy Ag J R | (4-hydroxy-5-alkylphenyl) alkanoic acid esters of polyols |
| US3441575A (en) * | 1961-10-30 | 1969-04-29 | Geigy Chem Corp | Esters of di(lower)alkylhydroxyphenyl alkanoic acid containing a hetro atom |
| NL284832A (enExample) * | 1961-10-30 | |||
| US3247240A (en) * | 1962-01-05 | 1966-04-19 | Geigy Ag J R | Process for the preparation of carbonyl compounds containing a hindered phenol group |
| US3285855A (en) * | 1965-03-11 | 1966-11-15 | Geigy Chem Corp | Stabilization of organic material with esters containing an alkylhydroxy-phenyl group |
| CA969192A (en) * | 1968-06-21 | 1975-06-10 | Ciba-Geigy Corporation | Polymeric antioxidants |
| DE1948570A1 (de) * | 1968-09-25 | 1970-04-23 | Ici Ltd | Phenole |
| US3681431A (en) * | 1970-02-06 | 1972-08-01 | Ciba Geigy Corp | N-OCTADECYL 3,5-DI-t-BUTYL-4-HYDROXYBENZOATE |
| US3862130A (en) * | 1970-04-27 | 1975-01-21 | Goodrich Co B F | Alkylhydroxyp henylcarboalkoxy-substituted nitrogen heterocycles |
| CH549407A (de) * | 1970-07-06 | 1974-05-31 | Ciba Geigy Ag | Verwendung sterisch gehinderter phenolestern von glykolen als stabilisatoren. |
| DE2364121A1 (de) * | 1972-12-27 | 1974-07-11 | Ciba Geigy Ag | Verfahren zur herstellung von hydroxyalkylphenylderivaten |
| DE2364126A1 (de) * | 1972-12-27 | 1974-07-11 | Ciba Geigy Ag | Verfahren zur herstellung von hydroxyalkylphenylderivaten |
| US3988363A (en) * | 1973-09-25 | 1976-10-26 | Ciba-Geigy Corporation | 2,4,6-Trialkyl L-3-hydroxyphenylalkanoates |
| US3896146A (en) * | 1973-12-28 | 1975-07-22 | Ciba Geigy Corp | 3,5-dialkyl-4-hydroxyphenylalkyl substituted tricyclic imides |
| US3956361A (en) * | 1974-05-23 | 1976-05-11 | Ciba-Geigy Corporation | Hindered phenolic derivatives of norbornane thioalcohols |
| DE3060772D1 (en) * | 1979-03-09 | 1982-10-21 | Ciba Geigy Ag | Process for the preparation of esters of mercaptoalcanols with hydroxyphenylcarboxylic acids |
| US4297492A (en) * | 1979-03-23 | 1981-10-27 | Ciba-Geigy Corporation | Phenolic-1,3,5-triazines |
| US4322303A (en) * | 1979-09-18 | 1982-03-30 | Ciba-Geigy Corporation | Dithiophosphate stabilizers |
| US4417071A (en) * | 1980-03-04 | 1983-11-22 | Ciba-Geigy Corporation | Phenols useful as stabilizers |
| US4385143A (en) * | 1980-09-26 | 1983-05-24 | Sumitomo Chemical Company, Limited | Stabilizer for synthetic resins |
-
1986
- 1986-11-18 DE DE19863639400 patent/DE3639400A1/de active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE3639400A1 (de) | 1988-05-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4734519A (en) | Pentaerythritol co-esters | |
| DE2512895A1 (de) | Phenolester und phenolamide | |
| DE2501285A1 (de) | Neue phenolacetale | |
| EP0017614A1 (de) | Verfahren zur Herstellung von Estern von Mercapto-alkanolen mit Hydroxyphenylcarbonsäuren | |
| JPS6191235A (ja) | 新規の有機スルフィド化合物 | |
| EP0057427B1 (de) | Chromanderivate | |
| EP0214935B1 (de) | Sterisch gehinderte Siliciumesterstabilisatoren | |
| DE3639400C2 (enExample) | ||
| EP0271649B1 (de) | Ester von 3-tert.-Butyl- bzw. 3-tert.-Butyl-5-alkyl-4-hydroxylphenyl-(alkan)-carbonsäuren mit Oxethylaten von Bis-(4- bzw. 2-hydroxyphenyl)-alkanen, -oxiden, -sulfiden und -sulfonen, von Tris-(4-hydroxyphenyl)-alkanen und von 1,3,5-Tris-(4-hydroxyphenyl-isopropyliden)-arylen, Verfahren zu ihrer Herstellung und ihre Verwendung als Stabilisatoren | |
| US4634728A (en) | Polyol carboxyalkylthioalkanoamidophenol compounds and organic material stabilized therewith | |
| EP0057425A1 (de) | Chromanderivate | |
| EP0268039B1 (de) | Ester von 3-tert.Butyl- bzw. 3-tert.-Butyl-5-alkyl-4-hydroxyphenyl-(alkan-)-carbonsäuren mit Oxethylaten von Polythiolen, Verfahren zu ihrer Herstellung und ihre Verwendung als Stabilisatoren | |
| EP0130522A1 (de) | Alterungsschutzmittel, ihre Herstellung und diese enthaltende Polymere | |
| DE2346458C2 (de) | Thiaalkylphenole, deren Herstellung und das mit ihrer Hilfe stabilisierte organische Material | |
| DE69012929T2 (de) | Phosphitverbindung und deren anwendung. | |
| EP0155474A1 (de) | Bis-,Tris-, Tetrakis-und Pentakis-(substituiertes hydroxy-phenylthio)-alkane und-cycloalkane und sie enthaltende Stoffzusammensetzungen | |
| US4569959A (en) | Isocyanurate esters of thioamidophenols and polyolefin polymeric compositions stabilized therewith | |
| DE3639354C2 (enExample) | ||
| DE3639339C1 (en) | Diesters of bis-alpha,omega-(2-hydroxyethylthio)alkanes with 3-tert-butyl- or 3-tert-butyl-5-alkyl-4-hydroxyphenyl(alkane)carboxylic acids and their use as stabilisers for polyolefins and polydienes | |
| EP0268037B1 (de) | Ester von 3-tert.-Butyl- bzw. 3-tert.-Butyl-5-alkyl-4-hydroxyphenyl-(alkan)-carbonsäuren mit Oxethylaten von Polyhydroxy-aromaten, Verfahren zu ihrer Herstellung und ihre Verwendung als Stabilisatoren | |
| EP0152022B1 (de) | Di-(substituiertes hydroxyphenylthio)-alkane und -cycloalkane und sie enthaltende Stoffzusammensetzungen | |
| DE2347997A1 (de) | Bicyclische phosphorverbindungen | |
| EP0116517B1 (de) | Ester oder Anhydride von substituierten 4-(Hydroxyphenylthio)bernsteinsäuren | |
| US4645853A (en) | Hindered phenolic oxamide compounds and stabilized compositions | |
| EP0452266B1 (de) | Isoindolinon-Verbindungen als Stabilisatoren für organische Materialien |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |