DE3602087C2 - Spiroxazin-Verbindungen und fotochrome Zusammensetzung, die diese enthält - Google Patents
Spiroxazin-Verbindungen und fotochrome Zusammensetzung, die diese enthältInfo
- Publication number
- DE3602087C2 DE3602087C2 DE3602087A DE3602087A DE3602087C2 DE 3602087 C2 DE3602087 C2 DE 3602087C2 DE 3602087 A DE3602087 A DE 3602087A DE 3602087 A DE3602087 A DE 3602087A DE 3602087 C2 DE3602087 C2 DE 3602087C2
- Authority
- DE
- Germany
- Prior art keywords
- compound
- spiroxazine
- following formula
- group
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 150000001875 compounds Chemical class 0.000 title claims description 82
- 239000000203 mixture Substances 0.000 title description 14
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 claims description 30
- 238000002360 preparation method Methods 0.000 claims description 19
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 10
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 150000002989 phenols Chemical class 0.000 claims description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 8
- 239000002904 solvent Substances 0.000 claims description 8
- 125000001931 aliphatic group Chemical group 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- -1 bisphenol compound Chemical class 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- 239000012454 non-polar solvent Substances 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 238000005804 alkylation reaction Methods 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 239000002798 polar solvent Substances 0.000 claims description 4
- 229930185605 Bisphenol Natural products 0.000 claims description 3
- 125000004450 alkenylene group Chemical group 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N p-toluenesulfonic acid Substances CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 3
- 239000003054 catalyst Substances 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 10
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims 5
- 125000006702 (C1-C18) alkyl group Chemical group 0.000 claims 3
- GCKMFJBGXUYNAG-HLXURNFRSA-N Methyltestosterone Chemical group C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@](C)(O)[C@@]1(C)CC2 GCKMFJBGXUYNAG-HLXURNFRSA-N 0.000 claims 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims 2
- 230000029936 alkylation Effects 0.000 claims 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 2
- 239000000463 material Substances 0.000 description 17
- 229920006267 polyester film Polymers 0.000 description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 238000010992 reflux Methods 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 238000004040 coloring Methods 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical class C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 5
- 230000000052 comparative effect Effects 0.000 description 5
- TZXJJSAQSRHKCZ-UHFFFAOYSA-N 2-methoxyethyl 4-methylbenzenesulfonate Chemical compound COCCOS(=O)(=O)C1=CC=C(C)C=C1 TZXJJSAQSRHKCZ-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 229920001225 polyester resin Polymers 0.000 description 4
- 239000004645 polyester resin Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 230000008034 disappearance Effects 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 2
- FLHJIAFUWHPJRT-UHFFFAOYSA-N 2,3,3-trimethylindole Chemical compound C1=CC=C2C(C)(C)C(C)=NC2=C1 FLHJIAFUWHPJRT-UHFFFAOYSA-N 0.000 description 2
- PBKGNJXLJQARIN-UHFFFAOYSA-N 2-(2-methoxyethoxy)ethyl 4-methylbenzenesulfonate Chemical compound COCCOCCOS(=O)(=O)C1=CC=C(C)C=C1 PBKGNJXLJQARIN-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 230000000873 masking effect Effects 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 2
- 239000005033 polyvinylidene chloride Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 229920006230 thermoplastic polyester resin Polymers 0.000 description 2
- RQANZEULSMUTTJ-UHFFFAOYSA-N 1,1-dichloroethene;hydrochloride Chemical compound Cl.ClC(Cl)=C RQANZEULSMUTTJ-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- YXAOOTNFFAQIPZ-UHFFFAOYSA-N 1-nitrosonaphthalen-2-ol Chemical compound C1=CC=CC2=C(N=O)C(O)=CC=C21 YXAOOTNFFAQIPZ-UHFFFAOYSA-N 0.000 description 1
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 description 1
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical compound C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 1
- ULDFPQKCKOFNOF-UHFFFAOYSA-N 5-nitrosoquinolin-6-ol Chemical compound N1=CC=CC2=C(N=O)C(O)=CC=C21 ULDFPQKCKOFNOF-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- FIMJSWFMQJGVAM-UHFFFAOYSA-N chloroform;hydrate Chemical compound O.ClC(Cl)Cl FIMJSWFMQJGVAM-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002605 large molecules Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229920005990 polystyrene resin Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/10—Spiro-condensed systems
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/685—Compositions containing spiro-condensed pyran compounds or derivatives thereof, as photosensitive substances
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Electrochromic Elements, Electrophoresis, Or Variable Reflection Or Absorption Elements (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP60012191A JPS61263982A (ja) | 1985-01-25 | 1985-01-25 | 3,3−ジメチル−スピロ〔インドリノ−2,3′−ナフト〔2,1−b〕(1,4)オキサジン〕系化合物 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3602087A1 DE3602087A1 (de) | 1986-07-31 |
| DE3602087C2 true DE3602087C2 (de) | 1997-03-20 |
Family
ID=11798509
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3602087A Expired - Fee Related DE3602087C2 (de) | 1985-01-25 | 1986-01-24 | Spiroxazin-Verbindungen und fotochrome Zusammensetzung, die diese enthält |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4719296A (Direct) |
| JP (1) | JPS61263982A (Direct) |
| CH (1) | CH667928A5 (Direct) |
| DE (1) | DE3602087C2 (Direct) |
| GB (1) | GB2171404B (Direct) |
Families Citing this family (50)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8627859D0 (en) * | 1986-11-21 | 1986-12-31 | Pilkington Brothers Plc | Spiro-oxazine compounds |
| DE3852831T2 (de) * | 1987-02-02 | 1995-05-18 | Toray Industries | Photochrome Verbindung. |
| US4931219A (en) * | 1987-07-27 | 1990-06-05 | Ppg Industries, Inc. | Photochromic compound and articles containing the same |
| US4981614A (en) * | 1987-09-21 | 1991-01-01 | Canon Kabushiki Kaisha | Solid solution |
| JPH0794657B2 (ja) * | 1987-10-16 | 1995-10-11 | 日産自動車株式会社 | フォトクロミック感光性材料 |
| US5021196A (en) * | 1988-01-25 | 1991-06-04 | Ppg Industries, Inc. | Method for preparing variable-light transmittance article |
| US4968454A (en) * | 1988-01-25 | 1990-11-06 | Ppg Industries, Inc. | Variable-light transmittance article and method for preparing same |
| US4986934A (en) * | 1988-03-25 | 1991-01-22 | Ppg Industries, Inc. | Photochromic compound and articles containing the same |
| US4936995A (en) * | 1988-05-17 | 1990-06-26 | Ppg Industries, Inc. | Photochromic compound and articles containing the same |
| JP2545606B2 (ja) * | 1988-07-05 | 1996-10-23 | 呉羽化学工業株式会社 | フォトクロミック化合物およびフォトクロミック組成物 |
| FR2647789B1 (fr) * | 1989-06-05 | 1994-07-22 | Essilor Int | Composes photochromiques de type indolino-spiro-oxazine, leur procede de preparation, compositions et articles photochromiques contenant de tels composes |
| FR2677357B1 (fr) * | 1991-06-10 | 1995-06-23 | Tokuyama Soka Kk | Spiro-oxazine et matiere photochromique la contenant. |
| US5405958A (en) * | 1992-12-21 | 1995-04-11 | Transitions Optical, Inc. | Photochromic spiro(indoline)naphthoxazine compounds |
| DE69431075T2 (de) * | 1994-10-13 | 2003-03-13 | Ppg Industries Ohio, Inc. | Photochrome naphthoxazin-verbindungen |
| US5581090A (en) * | 1995-10-25 | 1996-12-03 | Solartech Enterprises, Llc | Photochromic ultraviolet detector |
| WO2000015629A1 (en) * | 1998-09-11 | 2000-03-23 | Ppg Industries Ohio, Inc. | Polymerizable polyalkoxylated naphthopyrans |
| US5961892A (en) * | 1998-09-11 | 1999-10-05 | Ppg Industries Ohio, Inc. | Polyalkoxylated naphthopyrans |
| US6555028B2 (en) | 1998-09-11 | 2003-04-29 | Transitions Optical, Inc. | Polymeric matrix compatibilized naphthopyrans |
| US6296785B1 (en) | 1999-09-17 | 2001-10-02 | Ppg Industries Ohio, Inc. | Indeno-fused photochromic naphthopyrans |
| US6348604B1 (en) | 1999-09-17 | 2002-02-19 | Ppg Industries Ohio, Inc. | Photochromic naphthopyrans |
| WO2001057106A1 (en) * | 2000-02-04 | 2001-08-09 | Ppg Industries Ohio, Inc. | Photochromic coated articles |
| US6433043B1 (en) * | 2000-11-28 | 2002-08-13 | Transitions Optical, Inc. | Removable imbibition composition of photochromic compound and kinetic enhancing additive |
| US20030096935A1 (en) * | 2001-11-16 | 2003-05-22 | Nagpal Vidhu J. | Impact resistant polyureaurethane and method of preparation |
| US20060241273A1 (en) * | 2001-11-16 | 2006-10-26 | Bojkova Nina V | High impact poly (urethane urea) polysulfides |
| US20070142604A1 (en) * | 2005-12-16 | 2007-06-21 | Nina Bojkova | Polyurethanes and sulfur-containing polyurethanes and methods of preparation |
| US8017720B2 (en) * | 2005-12-16 | 2011-09-13 | Ppg Industries Ohio, Inc. | Sulfur-containing oligomers and high index polyurethanes prepared therefrom |
| US20040021133A1 (en) * | 2002-07-31 | 2004-02-05 | Nagpal Vidhu J. | High refractive index polymerizable composition |
| US7009032B2 (en) * | 2002-12-20 | 2006-03-07 | Ppg Industries Ohio, Inc. | Sulfide-containing polythiols |
| DE602005014976D1 (de) * | 2004-04-09 | 2009-07-30 | Fujifilm Corp | Flachdruckplattenvorläufer und Flachdruckverfahren. |
| US20050274055A1 (en) | 2004-06-09 | 2005-12-15 | Cook Roger B | Color-changing fishing equipment |
| US7465415B2 (en) * | 2004-07-30 | 2008-12-16 | Ppg Industries Ohio, Inc. | Photochromic materials derived from ring-opening monomers and photochromic initiators |
| US11248083B2 (en) | 2004-09-01 | 2022-02-15 | Ppg Industries Ohio, Inc. | Aircraft windows |
| US11008418B2 (en) | 2004-09-01 | 2021-05-18 | Ppg Industries Ohio, Inc. | Polyurethanes, articles and coatings prepared therefrom and methods of making the same |
| US11149107B2 (en) | 2004-09-01 | 2021-10-19 | Ppg Industries Ohio, Inc. | Polyurethanes, articles and coatings prepared therefrom and methods of making the same |
| US20090280329A1 (en) | 2004-09-01 | 2009-11-12 | Ppg Industries Ohio, Inc. | Polyurethanes, Articles and Coatings Prepared Therefrom and Methods of Making the Same |
| US9598527B2 (en) | 2004-09-01 | 2017-03-21 | Ppg Industries Ohio, Inc. | Polyurethanes, articles and coatings prepared therefrom and methods of making the same |
| US20090280709A1 (en) | 2004-09-01 | 2009-11-12 | Ppg Industries Ohio, Inc. | Polyurethanes, Articles and Coatings Prepared Therefrom and Methods of Making the Same |
| US9464169B2 (en) | 2004-09-01 | 2016-10-11 | Ppg Industries Ohio, Inc. | Polyurethanes, articles and coatings prepared therefrom and methods of making the same |
| US11591436B2 (en) | 2004-09-01 | 2023-02-28 | Ppg Industries Ohio, Inc. | Polyurethane article and methods of making the same |
| CN102030880A (zh) | 2006-05-05 | 2011-04-27 | Ppg工业俄亥俄公司 | 由硫醚官能的低聚多硫醇制备的组合物和制品 |
| US8188181B2 (en) * | 2009-09-22 | 2012-05-29 | Corning Incorporated | Photochromic compositions, resins and articles obtained therefrom |
| US9568643B2 (en) | 2012-12-13 | 2017-02-14 | Ppg Industries Ohio, Inc. | Polyurethane urea-containing compositions and optical articles and methods for preparing them |
| US20210284778A1 (en) | 2020-03-11 | 2021-09-16 | Alcon Inc. | Photochromic polydiorganosiloxane vinylic crosslinkers |
| EP4158392A1 (en) | 2020-06-02 | 2023-04-05 | Alcon Inc. | Method for making photochromic contact lenses |
| HUE069854T2 (hu) | 2020-10-28 | 2025-04-28 | Alcon Inc | Eljárás fotokróm kontaktlencsék elõállítására |
| EP4240578B1 (en) | 2020-11-04 | 2024-12-18 | Alcon Inc. | Method for making photochromic contact lenses |
| EP4240579B1 (en) | 2020-11-04 | 2024-12-04 | Alcon Inc. | Method for making photochromic contact lenses |
| KR20230131494A (ko) | 2021-03-08 | 2023-09-13 | 알콘 인코포레이티드 | 광기능성 콘택트 렌즈의 제조 방법 |
| KR20230144634A (ko) | 2021-04-01 | 2023-10-16 | 알콘 인코포레이티드 | 광변색성 콘택트 렌즈의 제조 방법 |
| KR20240153593A (ko) | 2022-04-28 | 2024-10-23 | 알콘 인코포레이티드 | Uv- 및 hevl-흡수 안과용 렌즈의 제조 방법 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4948631B1 (Direct) * | 1968-10-28 | 1974-12-23 | ||
| DE1927849A1 (de) * | 1969-05-31 | 1970-12-10 | Licentia Gmbh | Spiroverbindung |
| US4215010A (en) * | 1978-09-08 | 1980-07-29 | American Optical Corporation | Photochromic compounds |
| US4440672A (en) * | 1982-03-22 | 1984-04-03 | American Optical Corporation | Photochromic composition resistant to fatigue |
| US4634767A (en) * | 1985-09-03 | 1987-01-06 | Ppg Industries, Inc. | Method for preparing spiro(indoline)-type photochromic compounds |
-
1985
- 1985-01-25 JP JP60012191A patent/JPS61263982A/ja active Granted
-
1986
- 1986-01-22 GB GB08601533A patent/GB2171404B/en not_active Expired
- 1986-01-24 CH CH281/86A patent/CH667928A5/de not_active IP Right Cessation
- 1986-01-24 DE DE3602087A patent/DE3602087C2/de not_active Expired - Fee Related
- 1986-01-27 US US06/822,449 patent/US4719296A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| GB8601533D0 (en) | 1986-02-26 |
| GB2171404B (en) | 1988-09-14 |
| JPH0481996B2 (Direct) | 1992-12-25 |
| DE3602087A1 (de) | 1986-07-31 |
| GB2171404A (en) | 1986-08-28 |
| CH667928A5 (de) | 1988-11-15 |
| JPS61263982A (ja) | 1986-11-21 |
| US4719296A (en) | 1988-01-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3602087C2 (de) | Spiroxazin-Verbindungen und fotochrome Zusammensetzung, die diese enthält | |
| DE3524519C2 (Direct) | ||
| DE69726231T2 (de) | Lichtbildfähige lagerstabile Zusammensetzungen mit verbesserten Leuko-Farbstoffen | |
| DE69106799T2 (de) | Photochrome Zusammensetzungen. | |
| DE69806367T2 (de) | Rot färbende hyperchromische 3h-naphto(2,1-b)pyranen | |
| DE1293773B (de) | Substituierte Spiro-[(2'H-1'-benzopyran)-2, 2'-indoline] | |
| DE2811025A1 (de) | Silbersalze von 3-amino-1,2,4-mercaptotriazolderivaten | |
| EP0489689B1 (de) | Photochrome Naphthacenchinone, Verfahren zu deren Herstellung und deren Verwendung | |
| EP0339661B1 (de) | Photochrome Substanzen (IV) | |
| DE69807105T2 (de) | Photochromische verbindungen | |
| DE1927849A1 (de) | Spiroverbindung | |
| DE69325240T2 (de) | Photochrome Verbindungen | |
| DE2541267C3 (de) | Photographisches Aufzeichnungsmaterial | |
| JPH0372118B2 (Direct) | ||
| DE3248962C2 (Direct) | ||
| DE901498C (de) | Lichtempfindliches fotografisches Material | |
| DE2049700A1 (de) | Silberfreies photographisches Auf zeichnungsmatenal | |
| DE1294382B (de) | Substituierte Spiro-[(2'H-1'-benzopyran)-2, 2'-indoline] | |
| EP0017699B1 (de) | Derivate des 2-Hydroxy-naphthalins und Diazotypiematerial, das diese als Kupplungskomponente enthält | |
| DE68924629T2 (de) | Spirooxazin-verbindungen. | |
| DE69117429T2 (de) | Photochromes Material und optisches Speichermedium, das dieses verwendet | |
| DE69026217T2 (de) | Photochrome und photoempfindliche Spiroindolinoxazinverbindungen und Verfahren zu ihrer Herstellung | |
| DE2242761A1 (de) | Photographisches material | |
| DE1620070A1 (de) | Substituierte 1,3,3-Trimethyl-Spiro(2'H-1'-Benzopyran-2',2-Indoline) | |
| DE69006387T2 (de) | Farbstoffe als Lichthofschutz im nahen Infrarot. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8127 | New person/name/address of the applicant |
Owner name: MITSUBISHI KASEI CORP., TOKIO/TOKYO, JP |
|
| 8110 | Request for examination paragraph 44 | ||
| 8125 | Change of the main classification |
Ipc: C07D498/10 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |