DE3424107A1 - Organogermaniumverbindung und diese als wirkstoff enthaltender opioidpeptidaseinhibitor - Google Patents
Organogermaniumverbindung und diese als wirkstoff enthaltender opioidpeptidaseinhibitorInfo
- Publication number
- DE3424107A1 DE3424107A1 DE3424107A DE3424107A DE3424107A1 DE 3424107 A1 DE3424107 A1 DE 3424107A1 DE 3424107 A DE3424107 A DE 3424107A DE 3424107 A DE3424107 A DE 3424107A DE 3424107 A1 DE3424107 A1 DE 3424107A1
- Authority
- DE
- Germany
- Prior art keywords
- compound
- opioid
- inhibitor
- active ingredient
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000004480 active ingredient Substances 0.000 title claims description 9
- 150000001875 compounds Chemical class 0.000 title description 46
- 239000003112 inhibitor Substances 0.000 title description 9
- -1 Organogermanium compound Chemical class 0.000 claims description 21
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 230000002401 inhibitory effect Effects 0.000 description 17
- 102000004190 Enzymes Human genes 0.000 description 16
- 108090000790 Enzymes Proteins 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 102000001490 Opioid Peptides Human genes 0.000 description 15
- 108010093625 Opioid Peptides Proteins 0.000 description 15
- 239000003399 opiate peptide Substances 0.000 description 15
- 230000000694 effects Effects 0.000 description 13
- 102000004400 Aminopeptidases Human genes 0.000 description 12
- 108090000915 Aminopeptidases Proteins 0.000 description 12
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 10
- 102000035195 Peptidases Human genes 0.000 description 9
- 108091005804 Peptidases Proteins 0.000 description 9
- 235000019833 protease Nutrition 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- URLZCHNOLZSCCA-VABKMULXSA-N Leu-enkephalin Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(O)=O)NC(=O)CNC(=O)CNC(=O)[C@@H](N)CC=1C=CC(O)=CC=1)C1=CC=CC=C1 URLZCHNOLZSCCA-VABKMULXSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 238000000034 method Methods 0.000 description 8
- 241000283690 Bos taurus Species 0.000 description 7
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 7
- 238000004566 IR spectroscopy Methods 0.000 description 7
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 7
- 238000001727 in vivo Methods 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 238000000921 elemental analysis Methods 0.000 description 6
- 239000007789 gas Substances 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 125000000082 organogermanium group Chemical group 0.000 description 6
- 125000001424 substituent group Chemical group 0.000 description 6
- 108010083141 dipeptidyl carboxypeptidase Proteins 0.000 description 5
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 229960005181 morphine Drugs 0.000 description 5
- 210000003205 muscle Anatomy 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- RRJCLYMGCZJLBQ-UHFFFAOYSA-N Arphamenine B Natural products NC(N)=NCCCC(N)C(=O)CC(C(O)=O)CC1=CC=C(O)C=C1 RRJCLYMGCZJLBQ-UHFFFAOYSA-N 0.000 description 4
- 210000001175 cerebrospinal fluid Anatomy 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 229910052732 germanium Inorganic materials 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 230000000118 anti-neoplastic effect Effects 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 210000004556 brain Anatomy 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 230000003533 narcotic effect Effects 0.000 description 3
- XEABSBMNTNXEJM-UHFFFAOYSA-N propagermanium Chemical compound OC(=O)CC[Ge](=O)O[Ge](=O)CCC(O)=O XEABSBMNTNXEJM-UHFFFAOYSA-N 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- HMGUILIKOXYYFP-KZCZEQIWSA-N (2r,5s)-5-amino-2-benzyl-8-(diaminomethylideneamino)-4-oxooctanoic acid;hydrochloride Chemical compound Cl.NC(N)=NCCC[C@H](N)C(=O)C[C@H](C(O)=O)CC1=CC=CC=C1 HMGUILIKOXYYFP-KZCZEQIWSA-N 0.000 description 2
- MEKOFIRRDATTAG-UHFFFAOYSA-N 2,2,5,8-tetramethyl-3,4-dihydrochromen-6-ol Chemical compound C1CC(C)(C)OC2=C1C(C)=C(O)C=C2C MEKOFIRRDATTAG-UHFFFAOYSA-N 0.000 description 2
- MIAXGDNPGHKUKI-UHFFFAOYSA-N 2-methyl-3-trichlorogermylbutanoic acid Chemical compound OC(=O)C(C)C(C)[Ge](Cl)(Cl)Cl MIAXGDNPGHKUKI-UHFFFAOYSA-N 0.000 description 2
- 108010064733 Angiotensins Proteins 0.000 description 2
- 102000015427 Angiotensins Human genes 0.000 description 2
- FQRLGZIGRMSTAX-UHFFFAOYSA-N Arphamenine A Natural products NC(N)=NCCCC(N)C(=O)CC(C(O)=O)CC1=CC=CC=C1 FQRLGZIGRMSTAX-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- 102000005367 Carboxypeptidases Human genes 0.000 description 2
- 108010006303 Carboxypeptidases Proteins 0.000 description 2
- 241000282693 Cercopithecidae Species 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 101000930822 Giardia intestinalis Dipeptidyl-peptidase 4 Proteins 0.000 description 2
- 206010028980 Neoplasm Diseases 0.000 description 2
- 229940122344 Peptidase inhibitor Drugs 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000007721 medicinal effect Effects 0.000 description 2
- XELZGAJCZANUQH-UHFFFAOYSA-N methyl 1-acetylthieno[3,2-c]pyrazole-5-carboxylate Chemical compound CC(=O)N1N=CC2=C1C=C(C(=O)OC)S2 XELZGAJCZANUQH-UHFFFAOYSA-N 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- 239000004081 narcotic agent Substances 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 150000005599 propionic acid derivatives Chemical class 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- AAXWBCKQYLBQKY-IRXDYDNUSA-N (2s)-2-[[(2s)-2-[(2-benzamidoacetyl)amino]-3-(1h-imidazol-5-yl)propanoyl]amino]-4-methylpentanoic acid Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(O)=O)NC(=O)CNC(=O)C=1C=CC=CC=1)C1=CN=CN1 AAXWBCKQYLBQKY-IRXDYDNUSA-N 0.000 description 1
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- QKNYBSVHEMOAJP-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol;hydron;chloride Chemical compound Cl.OCC(N)(CO)CO QKNYBSVHEMOAJP-UHFFFAOYSA-N 0.000 description 1
- XRYJTKGEJGVBCC-UHFFFAOYSA-N 2-germylpropanoic acid Chemical compound CC([GeH3])C(O)=O XRYJTKGEJGVBCC-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- 206010067484 Adverse reaction Diseases 0.000 description 1
- VGGGPCQERPFHOB-MCIONIFRSA-N Bestatin Chemical compound CC(C)C[C@H](C(O)=O)NC(=O)[C@@H](O)[C@H](N)CC1=CC=CC=C1 VGGGPCQERPFHOB-MCIONIFRSA-N 0.000 description 1
- VGGGPCQERPFHOB-UHFFFAOYSA-N Bestatin Natural products CC(C)CC(C(O)=O)NC(=O)C(O)C(N)CC1=CC=CC=C1 VGGGPCQERPFHOB-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 206010012335 Dependence Diseases 0.000 description 1
- 206010052804 Drug tolerance Diseases 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 229910005742 Ge—C Inorganic materials 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 208000001953 Hypotension Diseases 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 230000006838 adverse reaction Effects 0.000 description 1
- 229960002478 aldosterone Drugs 0.000 description 1
- 239000002416 angiotensin derivative Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- TXHIDIHEXDFONW-UHFFFAOYSA-N benzene;propan-2-one Chemical compound CC(C)=O.C1=CC=CC=C1 TXHIDIHEXDFONW-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- LMSNZLCSZWZZGU-UHFFFAOYSA-N butan-1-ol;hydrochloride Chemical compound Cl.CCCCO LMSNZLCSZWZZGU-UHFFFAOYSA-N 0.000 description 1
- DNSISZSEWVHGLH-UHFFFAOYSA-N butanamide Chemical compound CCCC(N)=O DNSISZSEWVHGLH-UHFFFAOYSA-N 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000000502 dialysis Methods 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- GIEAINOVPLDQPT-UHFFFAOYSA-N ethylgermanium Chemical compound CC[Ge] GIEAINOVPLDQPT-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000026781 habituation Effects 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 108010016268 hippuryl-histidyl-leucine Proteins 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 208000021822 hypotensive Diseases 0.000 description 1
- 230000001077 hypotensive effect Effects 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 230000005311 nuclear magnetism Effects 0.000 description 1
- 229940124641 pain reliever Drugs 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 230000008288 physiological mechanism Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000008213 purified water Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000029865 regulation of blood pressure Effects 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 238000002076 thermal analysis method Methods 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- MUDDKLJPADVVKF-UHFFFAOYSA-N trichlorogermane Chemical compound Cl[GeH](Cl)Cl MUDDKLJPADVVKF-UHFFFAOYSA-N 0.000 description 1
- 229950009811 ubenimex Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/30—Germanium compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP11985683A JPS6012981A (ja) | 1983-07-01 | 1983-07-01 | オピオイド分解酵素阻害剤 |
| JP12572583A JPS6016997A (ja) | 1983-07-11 | 1983-07-11 | オピオイド分解酵素阻害剤 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3424107A1 true DE3424107A1 (de) | 1985-01-10 |
| DE3424107C2 DE3424107C2 (https=) | 1990-03-29 |
Family
ID=26457521
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3424107A Granted DE3424107A1 (de) | 1983-07-01 | 1984-06-29 | Organogermaniumverbindung und diese als wirkstoff enthaltender opioidpeptidaseinhibitor |
Country Status (5)
| Country | Link |
|---|---|
| US (2) | US4681960A (https=) |
| CH (1) | CH660192B (https=) |
| DE (1) | DE3424107A1 (https=) |
| FR (1) | FR2548187B1 (https=) |
| GB (1) | GB2142635B (https=) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3619426A1 (de) * | 1984-12-18 | 1987-12-17 | Asai Germanium Res Inst | Mittel zur erhoehung der widerstandskraft gegen erkaeltungskrankheiten bei patienten mit eingeschraenkter lungenfunktion |
| DE3720151A1 (de) * | 1986-06-18 | 1987-12-23 | Asai Germanium Res Inst | Aktivator fuer osteoblasten |
| DE3836652A1 (de) * | 1987-10-29 | 1989-05-11 | Asai Germanium Res Inst | Mittel zur verringerung der durch verabreichung von ciclosporin verursachten nierenschaedigung |
| DE3836651A1 (de) * | 1987-10-29 | 1989-05-11 | Asai Germanium Res Inst | Mittel zum verbessern der durch einen gestoerten blutkreislauf eingeschraenkten funktionen von organen |
| DE3836650A1 (de) * | 1987-10-29 | 1989-05-11 | Asai Germanium Res Inst | Loesung zum waschen und aufbewahren entnommener organe |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS60226592A (ja) * | 1984-04-25 | 1985-11-11 | Asai Gerumaniumu Kenkyusho:Kk | 抗酸化剤 |
| JP2752630B2 (ja) * | 1988-03-29 | 1998-05-18 | 大鵬薬品工業株式会社 | 新規安息香酸誘導体及びその製造方法 |
| JP2652556B2 (ja) * | 1988-08-29 | 1997-09-10 | 株式会社浅井ゲルマニウム研究所 | 有機ゲルマニウム化合物及びその製造方法 |
| AU3955297A (en) * | 1997-03-11 | 1998-09-29 | Kuzmin, Konstantin Kuzmich | Process for increasing the therapeutic effect and reducing the toxicity of drugs, metals, and organic and inorganic compounds |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4271084A (en) * | 1978-03-01 | 1981-06-02 | Ryuichi Sato | Germanium-containing organic polymer and the process for the production of the same |
| JPS55105696A (en) * | 1979-02-09 | 1980-08-13 | Norihiro Kakimoto | Production of organogermanium sesquioxide |
| JPS55122717A (en) * | 1979-03-15 | 1980-09-20 | Asai Gerumaniumu Kenkyusho:Kk | Interferon inducer |
| JPS57197288A (en) * | 1981-05-29 | 1982-12-03 | Nagaoka Koryo Kk | Chemical substance tetra(2-aminoethylmetrapto) germane hydrochloride and its preparation |
| JPS5935916B2 (ja) * | 1981-06-09 | 1984-08-31 | 紀博 柿本 | 有機ゲルマニウム化合物及びその製造方法 |
| US4508654A (en) * | 1982-02-01 | 1985-04-02 | Industrial Technology Research Institute | Preparation of bis-carboxy ethyl germanium sesquioxide and its propionic acid derivatives |
-
1984
- 1984-06-29 GB GB08416614A patent/GB2142635B/en not_active Expired
- 1984-06-29 DE DE3424107A patent/DE3424107A1/de active Granted
- 1984-06-29 CH CH315384A patent/CH660192B/fr unknown
- 1984-06-29 FR FR8410392A patent/FR2548187B1/fr not_active Expired
- 1984-07-02 US US06/626,787 patent/US4681960A/en not_active Expired - Lifetime
-
1986
- 1986-11-14 US US06/930,561 patent/US4748187A/en not_active Expired - Lifetime
Non-Patent Citations (5)
| Title |
|---|
| Biochem. Biophys. Res. Commun. 105, Biochem. Biophys. Res. Commun. 105, 1982, 470-75 * |
| Biochim. Biophys. Acta 756, 1983, 223-29 * |
| Heterocycles 23, 1985, S. 2681-84 * |
| J. Amer. Chem. Soc. 98, 1976, 8287-89 * |
| Life Sciences 25, 1979, 2065-70 * |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3619426A1 (de) * | 1984-12-18 | 1987-12-17 | Asai Germanium Res Inst | Mittel zur erhoehung der widerstandskraft gegen erkaeltungskrankheiten bei patienten mit eingeschraenkter lungenfunktion |
| DE3720151A1 (de) * | 1986-06-18 | 1987-12-23 | Asai Germanium Res Inst | Aktivator fuer osteoblasten |
| DE3836652A1 (de) * | 1987-10-29 | 1989-05-11 | Asai Germanium Res Inst | Mittel zur verringerung der durch verabreichung von ciclosporin verursachten nierenschaedigung |
| DE3836651A1 (de) * | 1987-10-29 | 1989-05-11 | Asai Germanium Res Inst | Mittel zum verbessern der durch einen gestoerten blutkreislauf eingeschraenkten funktionen von organen |
| DE3836650A1 (de) * | 1987-10-29 | 1989-05-11 | Asai Germanium Res Inst | Loesung zum waschen und aufbewahren entnommener organe |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2548187B1 (fr) | 1988-07-15 |
| CH660192B (https=) | 1987-03-31 |
| US4681960A (en) | 1987-07-21 |
| GB2142635A (en) | 1985-01-23 |
| US4748187A (en) | 1988-05-31 |
| GB8416614D0 (en) | 1984-08-01 |
| GB2142635B (en) | 1987-03-18 |
| DE3424107C2 (https=) | 1990-03-29 |
| FR2548187A1 (fr) | 1985-01-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3784905T2 (de) | Gamma-l-glutamyl-l-cysteinethylester und arzneimittel, die dieses als aktives mittel enthalten. | |
| DE69527980T2 (de) | Chalcone und ihre ester mit antiproliferativer aktivität in gebärmutter, ovar- und brusttumoren | |
| DE3424107A1 (de) | Organogermaniumverbindung und diese als wirkstoff enthaltender opioidpeptidaseinhibitor | |
| DE69001111T2 (de) | Antikrebs-zusammensetzung. | |
| DE69001722T2 (de) | Entzuendungshemmende und/oder antiallergische zusammensetzung, die glutathionderivate enthaelt. | |
| DE3425404C2 (de) | Verwendung von Germaniumsesquisulfiden als Antineoplastikum | |
| DE2941288A1 (de) | Cystein-derivate | |
| CH666273A5 (de) | Verfahren zur herstellung einer neuen haemin-komplexverbindung und diese als wirksubstanz enthaltende pharmazeutische zubereitungen. | |
| EP0021184B1 (de) | Sekretinpräparate mit verstärkter und protrahierter Wirkung, Verfahren zu ihrer Herstellung sowie Dihydroxybenzoyl-L-tyrosin | |
| DE68919475T2 (de) | Bivalente liganden, wirksam für die blockierung des enzyms acat. | |
| DE2416428C2 (de) | Pyroglutamyl-histidyl-prolinamide, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE69001004T2 (de) | Zusammensetzung gegen leberkrankheiten. | |
| DE3634496C2 (de) | Glukosylmoranolinderivate und ihre Herstellung | |
| EP0194571B1 (de) | Heterocyclische Disulfide, Verfahren zu ihrer Herstellung und pharmazeutische Mittel, die diese Verbindungen enthalten | |
| EP0400499A2 (de) | Neue Acylaminosäurederivate enthaltende Arzneimittel und Diätetika | |
| DE2202690A1 (de) | Verfahren zur Herstellung der Antibiotika 20798 RP und 27706 RP,sowie das Antibiotikum 27706 RP und Zusammensetzungen,die es enthalten | |
| DE69518258T2 (de) | Kortikoidderivate und pharmazeutische und kosmetische Zusammensetzungen | |
| DE2738498C3 (de) | H2-Chloräthyl)-l-nitroso-3-(2-acetamido-2desoxy- ß -D-glucopyranosyl)- harnstoffe, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| EP0196330B1 (de) | Verwendung von pyrrothinderivaten | |
| DE69104291T2 (de) | Spergulinähnliche Verbindungen und ihre Verwendung. | |
| DE4229048A1 (de) | Ester von 9-Chlor-Prostaglandinen, Verfahren zu ihrer Herstellung und ihre pharmazeutische Verwendung | |
| DE2549863C3 (de) | Pyridoxyliden-p-amino-benzoesäurederivate, deren Herstellung und Verwendung | |
| DE2560038C2 (de) | H2-Chloräthyl)-1 nitroso-3-(hydroxycyclohexyl)harnstoffe, dieselben enthaltende Arzneimittel und Verfahren zur Herstellung der ersteren | |
| DE2559558C3 (de) | Apovincaminsäureamide, deren Salze mit Säuren, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2908032A1 (de) | Acetale und hemiacetale von aminoaldehyden und diese enthaltende therapeutische zubereitungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |