DE3321943A1 - Blei- und bariumfreie anzuendsaetze - Google Patents
Blei- und bariumfreie anzuendsaetzeInfo
- Publication number
- DE3321943A1 DE3321943A1 DE19833321943 DE3321943A DE3321943A1 DE 3321943 A1 DE3321943 A1 DE 3321943A1 DE 19833321943 DE19833321943 DE 19833321943 DE 3321943 A DE3321943 A DE 3321943A DE 3321943 A1 DE3321943 A1 DE 3321943A1
- Authority
- DE
- Germany
- Prior art keywords
- lead
- barium
- weight
- ignition
- free
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 229940105296 zinc peroxide Drugs 0.000 claims description 13
- DLINORNFHVEIFE-UHFFFAOYSA-N hydrogen peroxide;zinc Chemical compound [Zn].OO DLINORNFHVEIFE-UHFFFAOYSA-N 0.000 claims description 12
- 239000002360 explosive Substances 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 8
- 239000007800 oxidant agent Substances 0.000 claims description 6
- 150000004655 tetrazenes Chemical class 0.000 claims description 5
- 159000000008 strontium salts Chemical class 0.000 claims description 4
- IUKSYUOJRHDWRR-UHFFFAOYSA-N 2-diazonio-4,6-dinitrophenolate Chemical compound [O-]C1=C([N+]#N)C=C([N+]([O-])=O)C=C1[N+]([O-])=O IUKSYUOJRHDWRR-UHFFFAOYSA-N 0.000 claims description 3
- 230000037452 priming Effects 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 239000000126 substance Substances 0.000 description 8
- 239000003638 chemical reducing agent Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- UBXAKNTVXQMEAG-UHFFFAOYSA-L strontium sulfate Chemical compound [Sr+2].[O-]S([O-])(=O)=O UBXAKNTVXQMEAG-UHFFFAOYSA-L 0.000 description 4
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 3
- 230000001680 brushing effect Effects 0.000 description 3
- 230000035945 sensitivity Effects 0.000 description 3
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- FDLIWJBIOFBYIV-UHFFFAOYSA-N [O-]NO.[O-]NO.[Sr+2] Chemical compound [O-]NO.[O-]NO.[Sr+2] FDLIWJBIOFBYIV-UHFFFAOYSA-N 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 2
- IWOUKMZUPDVPGQ-UHFFFAOYSA-N barium nitrate Chemical compound [Ba+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O IWOUKMZUPDVPGQ-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000006835 compression Effects 0.000 description 2
- 238000007906 compression Methods 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 150000002611 lead compounds Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- OKWLCUWJPPORKE-UHFFFAOYSA-N 1,2,3,4,5-pentanitro-6-(2-nitrophenyl)sulfanylbenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1SC1=C([N+]([O-])=O)C([N+]([O-])=O)=C([N+]([O-])=O)C([N+]([O-])=O)=C1[N+]([O-])=O OKWLCUWJPPORKE-UHFFFAOYSA-N 0.000 description 1
- YSIBQULRFXITSW-OWOJBTEDSA-N 1,3,5-trinitro-2-[(e)-2-(2,4,6-trinitrophenyl)ethenyl]benzene Chemical compound [O-][N+](=O)C1=CC([N+](=O)[O-])=CC([N+]([O-])=O)=C1\C=C\C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O YSIBQULRFXITSW-OWOJBTEDSA-N 0.000 description 1
- JYVCTRIETNESMX-UHFFFAOYSA-N 1-(1,4,5,5,6,6-hexanitrocyclohex-2-en-1-yl)-3-phenylurea Chemical compound [N+](=O)([O-])C1C(C(C(C=C1)(NC(NC1=CC=CC=C1)=O)[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] JYVCTRIETNESMX-UHFFFAOYSA-N 0.000 description 1
- RBZGEUJLKTVORU-UHFFFAOYSA-N 12014-84-5 Chemical compound [Ce]#[Si] RBZGEUJLKTVORU-UHFFFAOYSA-N 0.000 description 1
- PXPBDJVBNWDUFM-UHFFFAOYSA-N 2,3,4,6-tetranitrophenol Chemical compound OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C([N+]([O-])=O)=C1[N+]([O-])=O PXPBDJVBNWDUFM-UHFFFAOYSA-N 0.000 description 1
- MKWKGRNINWTHMC-UHFFFAOYSA-N 4,5,6-trinitrobenzene-1,2,3-triamine Chemical compound NC1=C(N)C([N+]([O-])=O)=C([N+]([O-])=O)C([N+]([O-])=O)=C1N MKWKGRNINWTHMC-UHFFFAOYSA-N 0.000 description 1
- VOCQWAVXXOSMKV-UHFFFAOYSA-N 4-diazo-2,3-dinitrocyclohexa-1,5-dien-1-ol 1H-pyrazole Chemical compound N1N=CC=C1.[N+](=[N-])=C1C(C(=C(C=C1)O)[N+](=O)[O-])[N+](=O)[O-] VOCQWAVXXOSMKV-UHFFFAOYSA-N 0.000 description 1
- 239000000028 HMX Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229910000861 Mg alloy Inorganic materials 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- TZRXHJWUDPFEEY-UHFFFAOYSA-N Pentaerythritol Tetranitrate Chemical compound [O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O TZRXHJWUDPFEEY-UHFFFAOYSA-N 0.000 description 1
- 239000000026 Pentaerythritol tetranitrate Substances 0.000 description 1
- UATJOMSPNYCXIX-UHFFFAOYSA-N Trinitrobenzene Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 UATJOMSPNYCXIX-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- GZLNLVXMCQOSRE-UHFFFAOYSA-N [Zn].[N+](=[N-])=C1C(C(=C(C=C1)O)[N+](=O)[O-])[N+](=O)[O-] Chemical compound [Zn].[N+](=[N-])=C1C(C(=C(C=C1)O)[N+](=O)[O-])[N+](=O)[O-] GZLNLVXMCQOSRE-UHFFFAOYSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000003570 air Substances 0.000 description 1
- SNAAJJQQZSMGQD-UHFFFAOYSA-N aluminum magnesium Chemical compound [Mg].[Al] SNAAJJQQZSMGQD-UHFFFAOYSA-N 0.000 description 1
- 239000012080 ambient air Substances 0.000 description 1
- 150000001553 barium compounds Chemical class 0.000 description 1
- ZJRXSAYFZMGQFP-UHFFFAOYSA-N barium peroxide Chemical compound [Ba+2].[O-][O-] ZJRXSAYFZMGQFP-UHFFFAOYSA-N 0.000 description 1
- 229910021346 calcium silicide Inorganic materials 0.000 description 1
- RRTQFNGJENAXJJ-UHFFFAOYSA-N cerium magnesium Chemical compound [Mg].[Ce] RRTQFNGJENAXJJ-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000003344 environmental pollutant Substances 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 238000010304 firing Methods 0.000 description 1
- 231100001261 hazardous Toxicity 0.000 description 1
- CBCIHIVRDWLAME-UHFFFAOYSA-N hexanitrodiphenylamine Chemical compound [O-][N+](=O)C1=CC([N+](=O)[O-])=CC([N+]([O-])=O)=C1NC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O CBCIHIVRDWLAME-UHFFFAOYSA-N 0.000 description 1
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- RLJMLMKIBZAXJO-UHFFFAOYSA-N lead nitrate Chemical compound [O-][N+](=O)O[Pb]O[N+]([O-])=O RLJMLMKIBZAXJO-UHFFFAOYSA-N 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- -1 mono- Chemical compound 0.000 description 1
- NKDXVHGJEHYZHY-UHFFFAOYSA-N n,n'-bis(2,4,6-trinitrophenyl)oxamide Chemical compound [O-][N+](=O)C1=CC([N+](=O)[O-])=CC([N+]([O-])=O)=C1NC(=O)C(=O)NC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O NKDXVHGJEHYZHY-UHFFFAOYSA-N 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- UZGLIIJVICEWHF-UHFFFAOYSA-N octogen Chemical group [O-][N+](=O)N1CN([N+]([O-])=O)CN([N+]([O-])=O)CN([N+]([O-])=O)C1 UZGLIIJVICEWHF-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 229960004321 pentaerithrityl tetranitrate Drugs 0.000 description 1
- ACVYVLVWPXVTIT-UHFFFAOYSA-M phosphinate Chemical compound [O-][PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-M 0.000 description 1
- 231100000719 pollutant Toxicity 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920001004 polyvinyl nitrate Polymers 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- KQAGKTURZUKUCH-UHFFFAOYSA-L strontium oxalate Chemical compound [Sr+2].[O-]C(=O)C([O-])=O KQAGKTURZUKUCH-UHFFFAOYSA-L 0.000 description 1
- IXHMHWIBCIYOAZ-UHFFFAOYSA-N styphnic acid Chemical compound OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C(O)=C1[N+]([O-])=O IXHMHWIBCIYOAZ-UHFFFAOYSA-N 0.000 description 1
- YPMOSINXXHVZIL-UHFFFAOYSA-N sulfanylideneantimony Chemical class [Sb]=S YPMOSINXXHVZIL-UHFFFAOYSA-N 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06C—DETONATING OR PRIMING DEVICES; FUSES; CHEMICAL LIGHTERS; PYROPHORIC COMPOSITIONS
- C06C7/00—Non-electric detonators; Blasting caps; Primers
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Air Bags (AREA)
- Compositions Of Oxide Ceramics (AREA)
- Catalysts (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Glass Compositions (AREA)
- Cosmetics (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Paints Or Removers (AREA)
Priority Applications (17)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833321943 DE3321943A1 (de) | 1983-06-18 | 1983-06-18 | Blei- und bariumfreie anzuendsaetze |
| EP84105762A EP0129081B1 (de) | 1983-06-18 | 1984-05-19 | Blei- und bariumfreie Anzündsätze |
| DE8484105762T DE3466526D1 (en) | 1983-06-18 | 1984-05-19 | Primers free of lead and barium |
| GR75024A GR74365B (cg-RX-API-DMAC10.html) | 1983-06-18 | 1984-06-14 | |
| YU1042/84A YU43364B (en) | 1983-06-18 | 1984-06-14 | Process for making pyrotecnic compositions for firing without lead and barium |
| MX201662A MX161714A (es) | 1983-06-18 | 1984-06-14 | Una composicion para cargas fulminantes libre de plomo y bario |
| PT78748A PT78748B (en) | 1983-06-18 | 1984-06-15 | Process for preparing lead and barium free initiating charges |
| IL72119A IL72119A (en) | 1983-06-18 | 1984-06-15 | Lead-and barium-free ignition charges |
| SU843755487A RU2053212C1 (ru) | 1983-06-18 | 1984-06-15 | Запальный состав |
| AU29403/84A AU575565B2 (en) | 1983-06-18 | 1984-06-15 | Lead and barium-free ignition charges |
| DD84264194A DD220301A5 (de) | 1983-06-18 | 1984-06-15 | Blei- und bariumfreie anzuendsaetze |
| CA000456711A CA1220342A (en) | 1983-06-18 | 1984-06-15 | Lead and barium-free ignition charges |
| FI842437A FI79519C (fi) | 1983-06-18 | 1984-06-15 | Bly- och bariumfri taendsats. |
| BR8402923A BR8402923A (pt) | 1983-06-18 | 1984-06-15 | Cargas de ignicao isentas de chumbo e de bario |
| US06/621,684 US4581082A (en) | 1983-06-18 | 1984-06-18 | Primer charges free of lead and barium |
| JP59123906A JPS6011291A (ja) | 1983-06-18 | 1984-06-18 | 鉛−及びバリウム不含の点火薬 |
| SU894614077A RU2071960C1 (ru) | 1983-06-18 | 1989-05-18 | Запальный состав |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833321943 DE3321943A1 (de) | 1983-06-18 | 1983-06-18 | Blei- und bariumfreie anzuendsaetze |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3321943A1 true DE3321943A1 (de) | 1984-12-20 |
| DE3321943C2 DE3321943C2 (cg-RX-API-DMAC10.html) | 1987-08-20 |
Family
ID=6201742
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19833321943 Granted DE3321943A1 (de) | 1983-06-18 | 1983-06-18 | Blei- und bariumfreie anzuendsaetze |
| DE8484105762T Expired DE3466526D1 (en) | 1983-06-18 | 1984-05-19 | Primers free of lead and barium |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8484105762T Expired DE3466526D1 (en) | 1983-06-18 | 1984-05-19 | Primers free of lead and barium |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4581082A (cg-RX-API-DMAC10.html) |
| EP (1) | EP0129081B1 (cg-RX-API-DMAC10.html) |
| JP (1) | JPS6011291A (cg-RX-API-DMAC10.html) |
| AU (1) | AU575565B2 (cg-RX-API-DMAC10.html) |
| BR (1) | BR8402923A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1220342A (cg-RX-API-DMAC10.html) |
| DD (1) | DD220301A5 (cg-RX-API-DMAC10.html) |
| DE (2) | DE3321943A1 (cg-RX-API-DMAC10.html) |
| FI (1) | FI79519C (cg-RX-API-DMAC10.html) |
| GR (1) | GR74365B (cg-RX-API-DMAC10.html) |
| IL (1) | IL72119A (cg-RX-API-DMAC10.html) |
| MX (1) | MX161714A (cg-RX-API-DMAC10.html) |
| PT (1) | PT78748B (cg-RX-API-DMAC10.html) |
| RU (2) | RU2053212C1 (cg-RX-API-DMAC10.html) |
| YU (1) | YU43364B (cg-RX-API-DMAC10.html) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3707694A1 (de) * | 1987-03-11 | 1988-09-29 | Dynamit Nobel Ag | Elektrisch anzuendbare anzuendsaetze fuer huelsenlose munition und treibkartuschen |
| DE19540278A1 (de) * | 1995-10-28 | 1997-04-30 | Dynamit Nobel Ag | Blei- und Barium-freie Anzündsätze |
| WO1999048842A1 (de) * | 1998-03-20 | 1999-09-30 | Dynamit Nobel Gmbh Explosivstoff- Und Systemtechnik | Durch elektrische auslösung anzündbare initialexplosivstoffe und anzündsätze |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4963201A (en) * | 1990-01-10 | 1990-10-16 | Blount, Inc. | Primer composition |
| GB2313371B (en) * | 1990-04-04 | 1998-02-18 | Breed Automotive Tech | A high temperature stable,low input energy primer/detonator |
| US5216199A (en) * | 1991-07-08 | 1993-06-01 | Blount, Inc. | Lead-free primed rimfire cartridge |
| US5167736A (en) * | 1991-11-04 | 1992-12-01 | Olin Corporation | Nontoxic priming mix |
| US5567252A (en) * | 1992-01-09 | 1996-10-22 | Olin Corporation | Nontoxic priming mix |
| US5417160A (en) * | 1993-12-01 | 1995-05-23 | Olin Corporation | Lead-free priming mixture for percussion primer |
| IT1266171B1 (it) * | 1994-07-15 | 1996-12-23 | Europa Metalli Sezione Difesa | Miscela innescante esente da materiali tossici ed innesco a percussione per cartucce utilizzante tale miscela. |
| EP0704415B1 (en) * | 1994-08-27 | 1999-03-03 | Eley Limited | Primer composition |
| US5466315A (en) * | 1994-09-06 | 1995-11-14 | Federal-Hoffman, Inc. | Non-toxic primer for center-fire cartridges |
| DE19548544A1 (de) * | 1995-12-23 | 1997-06-26 | Dynamit Nobel Ag | Initialsprengstoff-freie Anzündmischung |
| US5811725A (en) * | 1996-11-18 | 1998-09-22 | Aerojet-General Corporation | Hybrid rocket propellants containing azo compounds |
| DE19901988A1 (de) * | 1999-01-20 | 2000-08-03 | Dynamit Nobel Ag | Knallpatronen und Treibkartuschen |
| ATA75099A (de) * | 1999-04-28 | 2001-03-15 | Hirtenberger Ag | Anzündmischung |
| US6478903B1 (en) | 2000-10-06 | 2002-11-12 | Ra Brands, Llc | Non-toxic primer mix |
| US6544363B1 (en) | 2000-10-30 | 2003-04-08 | Federal Cartridge Company | Non-toxic, heavy-metal-free shotshell primer mix |
| AT410315B (de) * | 2001-11-14 | 2003-03-25 | Josef Koehler | Signaturarmer und schadstoffreduzierter, pyrotechnischer darstellungskörper |
| US6878221B1 (en) | 2003-01-30 | 2005-04-12 | Olin Corporation | Lead-free nontoxic explosive mix |
| US7216708B1 (en) * | 2003-09-12 | 2007-05-15 | Bond Lesley O | Reactive stimulation of oil and gas wells |
| US7165614B1 (en) | 2003-09-12 | 2007-01-23 | Bond Lesley O | Reactive stimulation of oil and gas wells |
| US8784583B2 (en) | 2004-01-23 | 2014-07-22 | Ra Brands, L.L.C. | Priming mixtures for small arms |
| RU2269503C1 (ru) * | 2004-10-05 | 2006-02-10 | Закрытое акционерное общество "Новосибирский патронный завод" (ЗАО НПЗ) | Ударный состав |
| US20060219341A1 (en) | 2005-03-30 | 2006-10-05 | Johnston Harold E | Heavy metal free, environmentally green percussion primer and ordnance and systems incorporating same |
| US8540828B2 (en) | 2008-08-19 | 2013-09-24 | Alliant Techsystems Inc. | Nontoxic, noncorrosive phosphorus-based primer compositions and an ordnance element including the same |
| US7857921B2 (en) * | 2006-03-02 | 2010-12-28 | Alliant Techsystems Inc. | Nontoxic, noncorrosive phosphorus-based primer compositions |
| US8641842B2 (en) | 2011-08-31 | 2014-02-04 | Alliant Techsystems Inc. | Propellant compositions including stabilized red phosphorus, a method of forming same, and an ordnance element including the same |
| US8192568B2 (en) | 2007-02-09 | 2012-06-05 | Alliant Techsystems Inc. | Non-toxic percussion primers and methods of preparing the same |
| CA2942312C (en) * | 2007-02-09 | 2019-05-28 | Vista Outdoor Operations Llc | Non-toxic percussion primers and methods of preparing the same |
| US8206522B2 (en) | 2010-03-31 | 2012-06-26 | Alliant Techsystems Inc. | Non-toxic, heavy-metal free sensitized explosive percussion primers and methods of preparing the same |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2806599A1 (de) * | 1978-02-16 | 1979-08-23 | Dynamit Nobel Ag | Mono- und dinitrodihydroxydiazobenzole |
| DE2952069C2 (de) * | 1979-12-22 | 1983-02-17 | Dynamit Nobel Ag, 5210 Troisdorf | Verwendung von Zinkperoxid in sprengstoffhaltigen oder pyrotechnischen Gemischen |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE350564C (de) * | 1920-03-27 | 1922-03-22 | Erwin Ott Dr | Verfahren zur Herstellung von Initialzuendmitteln und von Treib- und Sprengmitteln |
| US3862866A (en) * | 1971-08-02 | 1975-01-28 | Specialty Products Dev Corp | Gas generator composition and method |
| JPS50105808A (cg-RX-API-DMAC10.html) * | 1974-01-28 | 1975-08-20 | ||
| US4209351A (en) * | 1978-06-05 | 1980-06-24 | The United States Of America As Represented By The Secretary Of The Army | Ambient cured smokeless liner/inhibitor for propellants |
-
1983
- 1983-06-18 DE DE19833321943 patent/DE3321943A1/de active Granted
-
1984
- 1984-05-19 DE DE8484105762T patent/DE3466526D1/de not_active Expired
- 1984-05-19 EP EP84105762A patent/EP0129081B1/de not_active Expired
- 1984-06-14 MX MX201662A patent/MX161714A/es unknown
- 1984-06-14 GR GR75024A patent/GR74365B/el unknown
- 1984-06-14 YU YU1042/84A patent/YU43364B/xx unknown
- 1984-06-15 PT PT78748A patent/PT78748B/pt not_active IP Right Cessation
- 1984-06-15 BR BR8402923A patent/BR8402923A/pt not_active IP Right Cessation
- 1984-06-15 IL IL72119A patent/IL72119A/xx unknown
- 1984-06-15 AU AU29403/84A patent/AU575565B2/en not_active Ceased
- 1984-06-15 FI FI842437A patent/FI79519C/fi not_active IP Right Cessation
- 1984-06-15 DD DD84264194A patent/DD220301A5/de not_active IP Right Cessation
- 1984-06-15 RU SU843755487A patent/RU2053212C1/ru active
- 1984-06-15 CA CA000456711A patent/CA1220342A/en not_active Expired
- 1984-06-18 JP JP59123906A patent/JPS6011291A/ja active Pending
- 1984-06-18 US US06/621,684 patent/US4581082A/en not_active Expired - Lifetime
-
1989
- 1989-05-18 RU SU894614077A patent/RU2071960C1/ru active
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2806599A1 (de) * | 1978-02-16 | 1979-08-23 | Dynamit Nobel Ag | Mono- und dinitrodihydroxydiazobenzole |
| DE2952069C2 (de) * | 1979-12-22 | 1983-02-17 | Dynamit Nobel Ag, 5210 Troisdorf | Verwendung von Zinkperoxid in sprengstoffhaltigen oder pyrotechnischen Gemischen |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3707694A1 (de) * | 1987-03-11 | 1988-09-29 | Dynamit Nobel Ag | Elektrisch anzuendbare anzuendsaetze fuer huelsenlose munition und treibkartuschen |
| DE19540278A1 (de) * | 1995-10-28 | 1997-04-30 | Dynamit Nobel Ag | Blei- und Barium-freie Anzündsätze |
| WO1999048842A1 (de) * | 1998-03-20 | 1999-09-30 | Dynamit Nobel Gmbh Explosivstoff- Und Systemtechnik | Durch elektrische auslösung anzündbare initialexplosivstoffe und anzündsätze |
Also Published As
| Publication number | Publication date |
|---|---|
| PT78748B (en) | 1986-07-14 |
| MX161714A (es) | 1990-12-18 |
| FI79519B (fi) | 1989-09-29 |
| EP0129081A1 (de) | 1984-12-27 |
| YU43364B (en) | 1989-06-30 |
| GR74365B (cg-RX-API-DMAC10.html) | 1984-06-28 |
| FI842437L (fi) | 1984-12-19 |
| DE3466526D1 (en) | 1987-11-05 |
| AU2940384A (en) | 1984-12-20 |
| RU2071960C1 (ru) | 1997-01-20 |
| IL72119A (en) | 1987-10-20 |
| EP0129081B1 (de) | 1987-09-30 |
| DD220301A5 (de) | 1985-03-27 |
| JPS6011291A (ja) | 1985-01-21 |
| AU575565B2 (en) | 1988-08-04 |
| PT78748A (en) | 1984-07-01 |
| YU104284A (en) | 1986-10-31 |
| FI842437A0 (fi) | 1984-06-15 |
| DE3321943C2 (cg-RX-API-DMAC10.html) | 1987-08-20 |
| CA1220342A (en) | 1987-04-14 |
| US4581082A (en) | 1986-04-08 |
| BR8402923A (pt) | 1985-05-28 |
| RU2053212C1 (ru) | 1996-01-27 |
| FI79519C (fi) | 1990-01-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3321943A1 (de) | Blei- und bariumfreie anzuendsaetze | |
| DE60116453T2 (de) | Nicht-toxische Zündmittelmischung | |
| EP0031045B1 (de) | Verwendung von Zinkperoxid als Oxidationsmittel für Sprengstoffe und pyrotechnische Gemische | |
| EP0800496B1 (de) | Blei- und barium-freie anzündsätze | |
| DE3616004C2 (de) | Zündmittel-Zusammensetzung | |
| DE68904921T2 (de) | Zuendladungen und verfahren zu ihrer herstellung. | |
| EP2027080B1 (de) | Anzündsatz | |
| DE69303334T2 (de) | Initialladung für die Randfeuerzündung und Verfahren zu ihrer Herstellung | |
| DE3707694C2 (cg-RX-API-DMAC10.html) | ||
| DE3326884A1 (de) | Verfahren zum verdecken sichtbarer und infraroter strahlung und nebelmunition zur durchfuehrung dieses verfahrens | |
| DE69513251T2 (de) | Nichtgiftige Materialien enthaltende, schlagempfindliche Zündmittelzusammensetzung und deren Verwendung für Perkussionszündsatzpatronen | |
| DE60011109T2 (de) | Nicht-toxische und nicht-korrosive anzündmischung | |
| DE2733700C2 (de) | Übungsgefechtskopf für Artillerieraketen | |
| DE3243425C2 (cg-RX-API-DMAC10.html) | ||
| EP2352710B1 (de) | Anzündsätze mit verbesserter anzündleistung | |
| DE3242106C1 (de) | Treibladungsmassen für Rohrwaffen | |
| CH685940A5 (de) | Perkussionszundsatz fur Handfeuerwaffen, Verfahren zu seiner Herstellung sowie dessen Verwendung. | |
| WO2000066517A1 (de) | Anzündmischung | |
| DE10164381B4 (de) | Signaturarmer und schadstoffreduzierter, pyrotechnischer Darstellungskörper | |
| EP1616845B1 (de) | Schüttbares Treibladungspulver | |
| DE2808394B2 (de) | Tetrazen enthaltendes, anstichempfindliches Zündstoffgemisch und dessen Verwendung | |
| DE1942207A1 (de) | Zeitzuenderladung | |
| DE2263761A1 (de) | Wettersprengstoffe mit hoher energie und sicherheit | |
| DE2852174C2 (cg-RX-API-DMAC10.html) | ||
| DE1805358C3 (de) | Zündmittelgemisch für Feststofftreibladungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: DYNAMIT NOBEL AG, 5210 TROISDORF, DE |