DE3237401A1 - Schlagzaehe polyamide - Google Patents
Schlagzaehe polyamideInfo
- Publication number
- DE3237401A1 DE3237401A1 DE19823237401 DE3237401A DE3237401A1 DE 3237401 A1 DE3237401 A1 DE 3237401A1 DE 19823237401 DE19823237401 DE 19823237401 DE 3237401 A DE3237401 A DE 3237401A DE 3237401 A1 DE3237401 A1 DE 3237401A1
- Authority
- DE
- Germany
- Prior art keywords
- polyamides
- weight
- polyamide
- acid
- impact
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000004952 Polyamide Substances 0.000 title claims description 53
- 229920002647 polyamide Polymers 0.000 title claims description 53
- 238000000465 moulding Methods 0.000 claims description 17
- 229920005862 polyol Polymers 0.000 claims description 10
- -1 hydrocarbon polyol Chemical class 0.000 claims description 9
- 229920002732 Polyanhydride Polymers 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 8
- 229920000647 polyepoxide Polymers 0.000 claims description 8
- 239000000654 additive Substances 0.000 claims description 6
- 229920000570 polyether Polymers 0.000 claims description 6
- 229920000728 polyester Polymers 0.000 claims description 5
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 4
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- 239000000463 material Substances 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- 239000003607 modifier Substances 0.000 description 13
- 229920001577 copolymer Polymers 0.000 description 11
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 10
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 8
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 8
- 238000000034 method Methods 0.000 description 8
- 150000003077 polyols Chemical class 0.000 description 8
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 7
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 7
- 238000002474 experimental method Methods 0.000 description 6
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 6
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical class O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 6
- 229920000642 polymer Polymers 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 230000009969 flowable effect Effects 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 239000005062 Polybutadiene Substances 0.000 description 4
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 239000001361 adipic acid Substances 0.000 description 4
- 235000011037 adipic acid Nutrition 0.000 description 4
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- 150000001991 dicarboxylic acids Chemical class 0.000 description 4
- VOZRXNHHFUQHIL-UHFFFAOYSA-N glycidyl methacrylate Chemical compound CC(=C)C(=O)OCC1CO1 VOZRXNHHFUQHIL-UHFFFAOYSA-N 0.000 description 4
- 238000001746 injection moulding Methods 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 4
- 239000004014 plasticizer Substances 0.000 description 4
- 229920002857 polybutadiene Polymers 0.000 description 4
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 239000000956 alloy Substances 0.000 description 3
- 229910045601 alloy Inorganic materials 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- QSAWQNUELGIYBC-UHFFFAOYSA-N cyclohexane-1,2-dicarboxylic acid Chemical compound OC(=O)C1CCCCC1C(O)=O QSAWQNUELGIYBC-UHFFFAOYSA-N 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 150000002924 oxiranes Chemical class 0.000 description 3
- 229920005906 polyester polyol Polymers 0.000 description 3
- 239000007790 solid phase Substances 0.000 description 3
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- 229920002292 Nylon 6 Polymers 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 229920000578 graft copolymer Polymers 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 238000006068 polycondensation reaction Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- NIDNOXCRFUCAKQ-UMRXKNAASA-N (1s,2r,3s,4r)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid Chemical compound C1[C@H]2C=C[C@@H]1[C@H](C(=O)O)[C@@H]2C(O)=O NIDNOXCRFUCAKQ-UMRXKNAASA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- PWGJDPKCLMLPJW-UHFFFAOYSA-N 1,8-diaminooctane Chemical compound NCCCCCCCCN PWGJDPKCLMLPJW-UHFFFAOYSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- FXNDIJDIPNCZQJ-UHFFFAOYSA-N 2,4,4-trimethylpent-1-ene Chemical group CC(=C)CC(C)(C)C FXNDIJDIPNCZQJ-UHFFFAOYSA-N 0.000 description 1
- YQPCHPBGAALCRT-UHFFFAOYSA-N 2-[1-(carboxymethyl)cyclohexyl]acetic acid Chemical compound OC(=O)CC1(CC(O)=O)CCCCC1 YQPCHPBGAALCRT-UHFFFAOYSA-N 0.000 description 1
- AWFYPPSBLUWMFQ-UHFFFAOYSA-N 2-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]-1-(1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NN=C(O1)CC(=O)N1CC2=C(CC1)NN=C2 AWFYPPSBLUWMFQ-UHFFFAOYSA-N 0.000 description 1
- RNLHGQLZWXBQNY-UHFFFAOYSA-N 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine Chemical compound CC1(C)CC(N)CC(C)(CN)C1 RNLHGQLZWXBQNY-UHFFFAOYSA-N 0.000 description 1
- DEXFNLNNUZKHNO-UHFFFAOYSA-N 6-[3-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-3-oxopropyl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)C(CCC1=CC2=C(NC(O2)=O)C=C1)=O DEXFNLNNUZKHNO-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Natural products CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 230000001055 chewing effect Effects 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 229920006039 crystalline polyamide Polymers 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- IFDVQVHZEKPUSC-UHFFFAOYSA-N cyclohex-3-ene-1,2-dicarboxylic acid Chemical compound OC(=O)C1CCC=CC1C(O)=O IFDVQVHZEKPUSC-UHFFFAOYSA-N 0.000 description 1
- QYQADNCHXSEGJT-UHFFFAOYSA-N cyclohexane-1,1-dicarboxylate;hydron Chemical compound OC(=O)C1(C(O)=O)CCCCC1 QYQADNCHXSEGJT-UHFFFAOYSA-N 0.000 description 1
- FOTKYAAJKYLFFN-UHFFFAOYSA-N decane-1,10-diol Chemical compound OCCCCCCCCCCO FOTKYAAJKYLFFN-UHFFFAOYSA-N 0.000 description 1
- KEIQPMUPONZJJH-UHFFFAOYSA-N dicyclohexylmethanediamine Chemical class C1CCCCC1C(N)(N)C1CCCCC1 KEIQPMUPONZJJH-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 229910001651 emery Inorganic materials 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- IYWCBYFJFZCCGV-UHFFFAOYSA-N formamide;hydrate Chemical compound O.NC=O IYWCBYFJFZCCGV-UHFFFAOYSA-N 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 125000003055 glycidyl group Chemical group C(C1CO1)* 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- ACCCMOQWYVYDOT-UHFFFAOYSA-N hexane-1,1-diol Chemical compound CCCCCC(O)O ACCCMOQWYVYDOT-UHFFFAOYSA-N 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 239000004413 injection moulding compound Substances 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 230000006855 networking Effects 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- RPQRDASANLAFCM-UHFFFAOYSA-N oxiran-2-ylmethyl prop-2-enoate Chemical compound C=CC(=O)OCC1CO1 RPQRDASANLAFCM-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001228 polyisocyanate Polymers 0.000 description 1
- 239000005056 polyisocyanate Substances 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 239000012744 reinforcing agent Substances 0.000 description 1
- 239000012763 reinforcing filler Substances 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 229920006114 semi-crystalline semi-aromatic polyamide Polymers 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- UFDHBDMSHIXOKF-UHFFFAOYSA-N tetrahydrophthalic acid Natural products OC(=O)C1=C(C(O)=O)CCCC1 UFDHBDMSHIXOKF-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L77/00—Compositions of polyamides obtained by reactions forming a carboxylic amide link in the main chain; Compositions of derivatives of such polymers
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Epoxy Resins (AREA)
- Polyamides (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19823237401 DE3237401A1 (de) | 1982-10-08 | 1982-10-08 | Schlagzaehe polyamide |
| DE8383109792T DE3372630D1 (en) | 1982-10-08 | 1983-09-30 | Impact resistant polyamides |
| EP83109792A EP0106241B1 (de) | 1982-10-08 | 1983-09-30 | Schlagzähe Polyamide |
| JP58185212A JPS5991149A (ja) | 1982-10-08 | 1983-10-05 | ポリアミド成型組成物 |
| US06/856,164 US4820771A (en) | 1982-08-10 | 1986-04-25 | High impact polyamides |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19823237401 DE3237401A1 (de) | 1982-10-08 | 1982-10-08 | Schlagzaehe polyamide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3237401A1 true DE3237401A1 (de) | 1984-04-12 |
Family
ID=6175305
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19823237401 Withdrawn DE3237401A1 (de) | 1982-08-10 | 1982-10-08 | Schlagzaehe polyamide |
| DE8383109792T Expired DE3372630D1 (en) | 1982-10-08 | 1983-09-30 | Impact resistant polyamides |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8383109792T Expired DE3372630D1 (en) | 1982-10-08 | 1983-09-30 | Impact resistant polyamides |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4820771A (cg-RX-API-DMAC10.html) |
| EP (1) | EP0106241B1 (cg-RX-API-DMAC10.html) |
| JP (1) | JPS5991149A (cg-RX-API-DMAC10.html) |
| DE (2) | DE3237401A1 (cg-RX-API-DMAC10.html) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4221969A1 (de) * | 1992-07-03 | 1994-01-05 | Inst Polymerforschung Dresden | Verfahren zur Herstellung von Polyamid-Polyester-Blends mit verbesserter Phasenverträglichkeit |
| CN116003996A (zh) * | 2023-02-20 | 2023-04-25 | 达柏博(苏州)新材料有限公司 | 一种尼龙薄膜及其制备方法 |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS62116661A (ja) * | 1985-11-15 | 1987-05-28 | Daiseru Hiyurusu Kk | ポリアミド樹脂組成物 |
| EP0227053A3 (en) * | 1985-12-23 | 1988-09-07 | General Electric Company | Thermoplastic blends containing polyamide and epoxy functional compounds |
| US4877848A (en) * | 1985-12-23 | 1989-10-31 | General Electric Company | Thermoplastic blends containing polyamide and epoxy functional compound |
| DE3641499A1 (de) * | 1986-12-04 | 1988-06-16 | Basf Ag | Thermoplastische formmassen auf der basis von polyestern und polyamiden |
| US4942200A (en) * | 1987-05-21 | 1990-07-17 | E. I. Du Pont De Nemours And Company | Polyamide-polyarylate composition containing elastomeric modifier and epoxy-functional copolymer |
| CA1335008C (en) * | 1987-12-08 | 1995-03-28 | Tetsuo Hamada | Polyamide composition |
| US5283282A (en) * | 1987-12-08 | 1994-02-01 | Asahi Kasei Kogyo Kabushiki Kaisha | Polyamide composition |
| DE68921824T2 (de) * | 1988-09-30 | 1995-07-13 | Kawasaki Steel Co | Thermoplastische Harzzusammensetzung. |
| DE4029327A1 (de) * | 1990-09-15 | 1992-03-19 | Bayer Ag | Polyamidmassen fuer verpackungsmaterialien und ihre verwendung |
| NL9002253A (nl) * | 1990-10-17 | 1992-05-18 | Akzo Nv | Kunststofsamenstelling op basis van een thermoplastisch mengsel van een polyamide en een polyester. |
| DE4112668A1 (de) * | 1991-04-18 | 1992-10-22 | Huels Chemische Werke Ag | Thermoplastische mehrschichtverbunde |
| DE59208069D1 (de) * | 1991-11-14 | 1997-04-03 | Huels Chemische Werke Ag | Thermoplastische Mehrschichtverbunde |
| ATE302808T1 (de) * | 1999-05-21 | 2005-09-15 | Ciba Sc Holding Ag | Molekulargewichtsaufbau und modifizierung von polykondensaten |
| DE10329110A1 (de) * | 2003-06-27 | 2005-02-03 | Ems-Chemie Ag | Polyamidformmasse, Verfahren zur Herstellung der Polyamidformmasse und Formteile herstellbar aus der Polyamidformmasse |
| KR100864605B1 (ko) * | 2007-06-29 | 2008-10-23 | 로디아폴리아마이드 주식회사 | 페인트 부착성이 강화된 열가소성 폴리아마이드 수지조성물 |
| WO2016202577A1 (en) * | 2015-06-19 | 2016-12-22 | Basf Se | Polyamide compositions with high melt flow and good mechanical properties |
| FR3087780B1 (fr) | 2018-10-31 | 2021-07-09 | Arkema France | Composition permettant de retarder la formation d'hydrates de gaz |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3484339A (en) * | 1966-05-02 | 1969-12-16 | Eastman Kodak Co | Blends of polyesters containing free carboxyl groups and laminate thereof |
| DE1694958B2 (de) * | 1967-07-06 | 1976-06-10 | Veba-Cbemie AG, 4660 Gelsenkirchen-Buer | Verfahren zur herstellung von kunststoffen durch umsetzung von polyamiden mit epoxydverbindungen |
| US3848023A (en) * | 1973-02-22 | 1974-11-12 | Monsanto Co | Antistatic composition and fiber made therefrom |
| US3873353A (en) * | 1973-03-05 | 1975-03-25 | Allied Chem | Antistatic fiber |
| JPS51105355A (ja) * | 1975-03-13 | 1976-09-17 | Toray Industries | Netsukasoseijushisoseibutsu |
| DE2612011A1 (de) * | 1976-03-20 | 1977-09-22 | Bayer Ag | Verfahren zur herstellung von schlagzaehen thermoplastischen formmassen |
| US4086295A (en) * | 1976-12-16 | 1978-04-25 | Asahi Kasei Kogyo Kabushiki Kaisha | Polyamide composition |
| US4320213A (en) * | 1978-10-30 | 1982-03-16 | Monsanto Company | High-impact polyamide molding resin compositions |
| JPS5910700B2 (ja) * | 1978-12-06 | 1984-03-10 | 東洋紡績株式会社 | ポリエステル樹脂組成物 |
| US4283502A (en) * | 1979-04-30 | 1981-08-11 | E. I. Du Pont De Nemours And Company | Polyamide resins |
| DE3105365A1 (de) * | 1981-02-13 | 1982-09-02 | Bayer Ag, 5090 Leverkusen | Blockcopolymere |
| DD205441A1 (de) * | 1982-06-18 | 1983-12-28 | Leuna Werke Veb | Verfahren zur herstellung von hochviskosen antielektrostatischen polyamid-6-formmassen |
| JPS5927942A (ja) * | 1982-08-09 | 1984-02-14 | Asahi Chem Ind Co Ltd | 耐熱性の良好な熱可塑性重合体組成物 |
-
1982
- 1982-10-08 DE DE19823237401 patent/DE3237401A1/de not_active Withdrawn
-
1983
- 1983-09-30 DE DE8383109792T patent/DE3372630D1/de not_active Expired
- 1983-09-30 EP EP83109792A patent/EP0106241B1/de not_active Expired
- 1983-10-05 JP JP58185212A patent/JPS5991149A/ja active Granted
-
1986
- 1986-04-25 US US06/856,164 patent/US4820771A/en not_active Expired - Fee Related
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4221969A1 (de) * | 1992-07-03 | 1994-01-05 | Inst Polymerforschung Dresden | Verfahren zur Herstellung von Polyamid-Polyester-Blends mit verbesserter Phasenverträglichkeit |
| CN116003996A (zh) * | 2023-02-20 | 2023-04-25 | 达柏博(苏州)新材料有限公司 | 一种尼龙薄膜及其制备方法 |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5991149A (ja) | 1984-05-25 |
| EP0106241A2 (de) | 1984-04-25 |
| US4820771A (en) | 1989-04-11 |
| EP0106241A3 (en) | 1985-04-03 |
| DE3372630D1 (en) | 1987-08-27 |
| EP0106241B1 (de) | 1987-07-22 |
| JPH0352784B2 (cg-RX-API-DMAC10.html) | 1991-08-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0523445B1 (de) | Thermoplastische Formmassen aus semikristallinem und amorphem Polyamid, deren Verwendung und Verfahren zu ihrer Herstellung | |
| EP0106241B1 (de) | Schlagzähe Polyamide | |
| EP0002761B1 (de) | Schlagzähe Polyamidformmassen | |
| DE2734693A1 (de) | Hochschlagzaehe polyamidlegierungen | |
| DE3613527A1 (de) | Schlagzaehe polyamid-formmassen | |
| DE3728334C2 (cg-RX-API-DMAC10.html) | ||
| DE2612011A1 (de) | Verfahren zur herstellung von schlagzaehen thermoplastischen formmassen | |
| DE3806271A1 (de) | Thermoplastische formmassen auf der basis von polyamiden und ethylencopolymerisaten | |
| DE2728319A1 (de) | Polyester/nylon-cokondensat | |
| DE68920622T2 (de) | Polyketonzusammensetzungen. | |
| EP0194523B1 (de) | Hydrophobierte, leichtfliessende thermoplastische Polyamide | |
| EP0591731B1 (de) | Fliessfähige Polyamidformmassen | |
| DE69013711T2 (de) | Polymerzusammensetzung. | |
| DE69410777T2 (de) | Polyamidharzzusammensetzung | |
| DE3040999A1 (de) | Thermoplastische formmassen | |
| DE4119146C2 (de) | Polymer-Mischungen Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2343445B2 (de) | Verwendung von epoxidharzen zum verbessern der verarbeitbarkeit thermoplastischer kunstharzmassen | |
| DE2703416A1 (de) | Gefuellte polyamidformmassen mit erhoehter zaehigkeit | |
| DE2654346A1 (de) | Polyamid-formmassen | |
| DE69525324T2 (de) | Thermoplastische polyesterharzzusammensetzung | |
| DE69411349T2 (de) | Thermoplastische Zusammensetzungen auf Basis von Nylon und Polyacrylkautschuk | |
| EP0082379B1 (de) | Leichtfliessende, schlagzähe Polyamide | |
| DE1669702A1 (de) | Verfahren zur Herstellung von schlagzaehen thermoplastischen Formmassen | |
| DE2654168C2 (de) | Polyamidlegierungen | |
| DE3023918A1 (de) | Leitfliessende, schlagzaehe polyamide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8141 | Disposal/no request for examination |