DE3215266A1 - Hydraulischer kraftverstaerker fuer fahrzeug-bremsanlagen - Google Patents
Hydraulischer kraftverstaerker fuer fahrzeug-bremsanlagenInfo
- Publication number
- DE3215266A1 DE3215266A1 DE19823215266 DE3215266A DE3215266A1 DE 3215266 A1 DE3215266 A1 DE 3215266A1 DE 19823215266 DE19823215266 DE 19823215266 DE 3215266 A DE3215266 A DE 3215266A DE 3215266 A1 DE3215266 A1 DE 3215266A1
- Authority
- DE
- Germany
- Prior art keywords
- booster
- chamber
- piston
- booster piston
- bore
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000012530 fluid Substances 0.000 claims description 21
- 230000002787 reinforcement Effects 0.000 claims description 7
- 230000003321 amplification Effects 0.000 claims description 6
- 238000003199 nucleic acid amplification method Methods 0.000 claims description 6
- 230000006870 function Effects 0.000 description 5
- 230000007423 decrease Effects 0.000 description 3
- 238000010586 diagram Methods 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- DOETVZCFKJCYJV-UHFFFAOYSA-N 6-(4,5-dihydro-1h-imidazol-2-yl)-2-[4-(4,5-dihydro-1h-imidazol-2-yl)phenyl]-1h-indole Chemical compound N1CCN=C1C1=CC=C(C=2NC3=CC(=CC=C3C=2)C=2NCCN=2)C=C1 DOETVZCFKJCYJV-UHFFFAOYSA-N 0.000 description 1
- 101100286286 Dictyostelium discoideum ipi gene Proteins 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000002996 emotional effect Effects 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B60—VEHICLES IN GENERAL
- B60T—VEHICLE BRAKE CONTROL SYSTEMS OR PARTS THEREOF; BRAKE CONTROL SYSTEMS OR PARTS THEREOF, IN GENERAL; ARRANGEMENT OF BRAKING ELEMENTS ON VEHICLES IN GENERAL; PORTABLE DEVICES FOR PREVENTING UNWANTED MOVEMENT OF VEHICLES; VEHICLE MODIFICATIONS TO FACILITATE COOLING OF BRAKES
- B60T13/00—Transmitting braking action from initiating means to ultimate brake actuator with power assistance or drive; Brake systems incorporating such transmitting means, e.g. air-pressure brake systems
- B60T13/10—Transmitting braking action from initiating means to ultimate brake actuator with power assistance or drive; Brake systems incorporating such transmitting means, e.g. air-pressure brake systems with fluid assistance, drive, or release
- B60T13/12—Transmitting braking action from initiating means to ultimate brake actuator with power assistance or drive; Brake systems incorporating such transmitting means, e.g. air-pressure brake systems with fluid assistance, drive, or release the fluid being liquid
- B60T13/14—Transmitting braking action from initiating means to ultimate brake actuator with power assistance or drive; Brake systems incorporating such transmitting means, e.g. air-pressure brake systems with fluid assistance, drive, or release the fluid being liquid using accumulators or reservoirs fed by pumps
- B60T13/142—Systems with master cylinder
- B60T13/143—Master cylinder mechanically coupled with booster
Landscapes
- Engineering & Computer Science (AREA)
- Transportation (AREA)
- Mechanical Engineering (AREA)
- Braking Systems And Boosters (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8112632 | 1981-04-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3215266A1 true DE3215266A1 (de) | 1982-11-11 |
Family
ID=10521327
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19823215266 Withdrawn DE3215266A1 (de) | 1981-04-23 | 1982-04-23 | Hydraulischer kraftverstaerker fuer fahrzeug-bremsanlagen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4444440A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS57186570A (cg-RX-API-DMAC7.html) |
| DE (1) | DE3215266A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2504476A1 (cg-RX-API-DMAC7.html) |
| IT (1) | IT1190788B (cg-RX-API-DMAC7.html) |
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3433439A1 (de) * | 1984-09-12 | 1986-03-20 | Alfred Teves Gmbh, 6000 Frankfurt | Hydraulischer verstaerker, insbesondere fuer bremsanlagen von kraftfahrzeugen |
| DE3541483A1 (de) * | 1985-11-23 | 1987-05-27 | Teves Gmbh Alfred | Schlupfgeregelte bremsanlage |
| DE3542418A1 (de) * | 1985-11-30 | 1987-06-04 | Teves Gmbh Alfred | Hydraulischer kraftverstaerker |
| DE3543479A1 (de) * | 1985-12-09 | 1987-06-11 | Teves Gmbh Alfred | Bremsdruckgeber fuer eine hydraulische bremsanlage, insbesondere fuer kraftfahrzeuge |
| DE3609279A1 (de) * | 1986-03-19 | 1987-09-24 | Teves Gmbh Alfred | Bremsdruckgeber fuer eine hydraulische kraftfahrzeugbremsanlage |
| DE3609280A1 (de) * | 1986-03-19 | 1987-10-22 | Teves Gmbh Alfred | Bremsdruckgeber fuer eine hydraulische kraftfahrzeugbremsanlage |
| DE3820539A1 (de) * | 1987-06-16 | 1988-12-29 | Honda Motor Co Ltd | Hydraulischer druckverstaerker |
| EP0554840A1 (en) * | 1992-02-04 | 1993-08-11 | FIAT AUTO S.p.A. | A master cylinder for a motor-vehicle braking system |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3230082A1 (de) * | 1982-08-13 | 1984-02-16 | Alfred Teves Gmbh, 6000 Frankfurt | Hydraulische bremsanlage |
| KR890000299A (ko) * | 1987-06-24 | 1989-03-13 | 나카하라 츠네오 | 유압부우스터 |
| US4796958A (en) * | 1987-08-26 | 1989-01-10 | Allied-Signal Inc. | Integrated anti-lock braking system |
| US4995677A (en) * | 1989-03-13 | 1991-02-26 | Honda Giken Kogyo Kabushiki Kaisha | Hydraulic braking pressure control system |
| US5056874A (en) * | 1990-11-03 | 1991-10-15 | General Motors Corporation | Brake control valve |
| GB0025519D0 (en) * | 2000-03-30 | 2000-11-29 | Ap Racing Ltd | Brake fluid cooling system |
| EP3500463B1 (en) * | 2016-08-18 | 2022-04-06 | Carlisle Industrial Brake&Friction | Dual master cylinder brake assembly with quick-fill function |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3201624A1 (de) * | 1981-01-21 | 1982-09-16 | Lucas Industries Ltd., Birmingham, West Midlands | Hydraulischer kraftverstaerker, insbesondere fuer kraftfahrzeug-bremsanlagen |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3879948A (en) * | 1974-06-12 | 1975-04-29 | Gen Motors Corp | Hydraulic booster |
| JPS5390564A (en) * | 1977-01-18 | 1978-08-09 | Aisin Seiki Co Ltd | Hydraulic brake for vehicle |
| AU512657B2 (en) * | 1977-05-19 | 1980-10-23 | Girling Limited | Hydraulic power boosters for vehicle braking systems |
| DE2744408A1 (de) * | 1977-10-03 | 1979-04-05 | Teves Gmbh Alfred | Bremskraftverstaerker |
| DE2917684A1 (de) * | 1979-05-02 | 1980-11-20 | Teves Gmbh Alfred | Bremsgeraet mit hydraulischer verstaerkung |
-
1982
- 1982-04-12 US US06/367,337 patent/US4444440A/en not_active Expired - Fee Related
- 1982-04-23 FR FR8207036A patent/FR2504476A1/fr not_active Withdrawn
- 1982-04-23 DE DE19823215266 patent/DE3215266A1/de not_active Withdrawn
- 1982-04-23 IT IT20901/82A patent/IT1190788B/it active
- 1982-04-23 JP JP57068549A patent/JPS57186570A/ja active Granted
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3201624A1 (de) * | 1981-01-21 | 1982-09-16 | Lucas Industries Ltd., Birmingham, West Midlands | Hydraulischer kraftverstaerker, insbesondere fuer kraftfahrzeug-bremsanlagen |
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3433439A1 (de) * | 1984-09-12 | 1986-03-20 | Alfred Teves Gmbh, 6000 Frankfurt | Hydraulischer verstaerker, insbesondere fuer bremsanlagen von kraftfahrzeugen |
| DE3541483A1 (de) * | 1985-11-23 | 1987-05-27 | Teves Gmbh Alfred | Schlupfgeregelte bremsanlage |
| DE3542418A1 (de) * | 1985-11-30 | 1987-06-04 | Teves Gmbh Alfred | Hydraulischer kraftverstaerker |
| DE3543479A1 (de) * | 1985-12-09 | 1987-06-11 | Teves Gmbh Alfred | Bremsdruckgeber fuer eine hydraulische bremsanlage, insbesondere fuer kraftfahrzeuge |
| US4741161A (en) * | 1985-12-09 | 1988-05-03 | Alfred Teves Gmbh | Braking pressure generator for a hydraulic brake system for automotive vehicles |
| DE3609279A1 (de) * | 1986-03-19 | 1987-09-24 | Teves Gmbh Alfred | Bremsdruckgeber fuer eine hydraulische kraftfahrzeugbremsanlage |
| DE3609280A1 (de) * | 1986-03-19 | 1987-10-22 | Teves Gmbh Alfred | Bremsdruckgeber fuer eine hydraulische kraftfahrzeugbremsanlage |
| DE3820539A1 (de) * | 1987-06-16 | 1988-12-29 | Honda Motor Co Ltd | Hydraulischer druckverstaerker |
| EP0554840A1 (en) * | 1992-02-04 | 1993-08-11 | FIAT AUTO S.p.A. | A master cylinder for a motor-vehicle braking system |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2504476A1 (fr) | 1982-10-29 |
| IT1190788B (it) | 1988-02-24 |
| IT8220901A0 (it) | 1982-04-23 |
| JPH0313105B2 (cg-RX-API-DMAC7.html) | 1991-02-21 |
| JPS57186570A (en) | 1982-11-17 |
| US4444440A (en) | 1984-04-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3131095C2 (cg-RX-API-DMAC7.html) | ||
| DE3215266A1 (de) | Hydraulischer kraftverstaerker fuer fahrzeug-bremsanlagen | |
| DE3315730C2 (de) | Hydraulischer Kraftverstärker | |
| DE3224828A1 (de) | Hydraulischer kraftverstaerker fuer fahrzeug-bremsanlagen | |
| DE2461295A1 (de) | Bremsgeraet fuer kraftfahrzeuge | |
| DE2937853A1 (de) | Bremsensteuersystem | |
| DE2413762A1 (de) | Hydraulischer kraftverstaerker | |
| DE3507484C2 (de) | Hydraulische Bremsanlage | |
| DE4024384A1 (de) | Blockiergeschuetzte kraftfahrzeugbremsanlage | |
| DE3049274A1 (de) | Hydraulischer kraftverstaerker fuer fahrzeug-hydraulikanlagen | |
| DE19932670C2 (de) | Hauptzylinderanordnung | |
| DE2526838A1 (de) | Hydraulischer hauptzylinder mit veraenderlichem verstaerkungsverhaeltnis | |
| DE2941808A1 (de) | Steuerventilanordnung fuer eine druckmitteldruck-bremsanlage | |
| DE60105453T2 (de) | Hydraulische Zwillingsverstärkerbaugruppe für hydraulische Fahrzeugbremsanlagen | |
| DE3201624A1 (de) | Hydraulischer kraftverstaerker, insbesondere fuer kraftfahrzeug-bremsanlagen | |
| DE8815245U1 (de) | Betätigungsvorrichtung für Fahrzeug-Bremsanlagen | |
| DE1277046B (de) | Betaetigungseinrichtung, insbesondere fuer Kraftfahrzeugbremsen | |
| DE2433567C2 (de) | Bremsventil für zwei getrennt oder gleichzeitig zu betätigende Bremskreise | |
| DE19834193C1 (de) | Hauptzylinder mit verbesserten Notbremseigenschaften für eine hydraulische Fahrzeugbremsanlage | |
| DE2407296A1 (de) | Hydraulischer bremskraftverstaerker | |
| EP1126998B1 (de) | Unterdruckbremskraftverstärker mit magnetloser notbremshilfe | |
| DE3321126A1 (de) | Hydraulischer kraftverstaerker fuer fahrzeug-hydraulikanlagen | |
| DE2903661A1 (de) | Pedalbetaetigbarer bremskraftverstaerker fuer fahrzeugbremsanlagen | |
| DE10010385B4 (de) | Unterdruckbremskraftverstärker mit verbesserter magnetloser Notbremshilfe | |
| DE2165776B2 (de) | Hydraulischer Kraftverstärker für den Hauptzylinder einer Kraftfahrzeug-Brems anlage |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8139 | Disposal/non-payment of the annual fee |