DE3134363A1 - "verfahren zur herstellung von diphosphaspiro-verbindungen" - Google Patents
"verfahren zur herstellung von diphosphaspiro-verbindungen"Info
- Publication number
- DE3134363A1 DE3134363A1 DE19813134363 DE3134363A DE3134363A1 DE 3134363 A1 DE3134363 A1 DE 3134363A1 DE 19813134363 DE19813134363 DE 19813134363 DE 3134363 A DE3134363 A DE 3134363A DE 3134363 A1 DE3134363 A1 DE 3134363A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- phosphonic acid
- pentaerythritol
- anhydride
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 150000001875 compounds Chemical class 0.000 title claims description 23
- 238000004519 manufacturing process Methods 0.000 title description 2
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 claims description 25
- 238000006243 chemical reaction Methods 0.000 claims description 20
- 150000003008 phosphonic acid esters Chemical class 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 13
- NJLHHACGWKAWKL-UHFFFAOYSA-N ClP(Cl)=O Chemical compound ClP(Cl)=O NJLHHACGWKAWKL-UHFFFAOYSA-N 0.000 claims description 11
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 claims description 11
- 150000008064 anhydrides Chemical class 0.000 claims description 11
- 238000002360 preparation method Methods 0.000 claims description 8
- XNQULTQRGBXLIA-UHFFFAOYSA-O phosphonic anhydride Chemical compound O[P+](O)=O XNQULTQRGBXLIA-UHFFFAOYSA-O 0.000 claims description 7
- 239000012442 inert solvent Substances 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000007789 gas Substances 0.000 description 8
- 239000000725 suspension Substances 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 238000000921 elemental analysis Methods 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 229910052698 phosphorus Inorganic materials 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 239000013078 crystal Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- VONWDASPFIQPDY-UHFFFAOYSA-N dimethyl methylphosphonate Chemical compound COP(C)(=O)OC VONWDASPFIQPDY-UHFFFAOYSA-N 0.000 description 3
- 230000008030 elimination Effects 0.000 description 3
- 238000003379 elimination reaction Methods 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000001291 vacuum drying Methods 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 238000010924 continuous production Methods 0.000 description 2
- IBDMRHDXAQZJAP-UHFFFAOYSA-N dichlorophosphorylbenzene Chemical compound ClP(Cl)(=O)C1=CC=CC=C1 IBDMRHDXAQZJAP-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 229940050176 methyl chloride Drugs 0.000 description 2
- SCLFRABIDYGTAZ-UHFFFAOYSA-N methylphosphonic acid dichloride Chemical compound CP(Cl)(Cl)=O SCLFRABIDYGTAZ-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 238000005809 transesterification reaction Methods 0.000 description 2
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- CCQOIBGABQRPJK-UHFFFAOYSA-N [hydroxy(methyl)phosphoryl]oxy-methylphosphinic acid Chemical compound CP(O)(=O)OP(C)(O)=O CCQOIBGABQRPJK-UHFFFAOYSA-N 0.000 description 1
- HPUPGAFDTWIMBR-UHFFFAOYSA-N [methyl(phenoxy)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(=O)(C)OC1=CC=CC=C1 HPUPGAFDTWIMBR-UHFFFAOYSA-N 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- FBSFTJQYCLLGKH-UHFFFAOYSA-N cyclohexylphosphonic acid Chemical compound OP(O)(=O)C1CCCCC1 FBSFTJQYCLLGKH-UHFFFAOYSA-N 0.000 description 1
- MRRAOBIIOMSKQB-UHFFFAOYSA-N dichlorophosphorylcyclohexane Chemical compound ClP(Cl)(=O)C1CCCCC1 MRRAOBIIOMSKQB-UHFFFAOYSA-N 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- -1 methyl- Chemical group 0.000 description 1
- YACKEPLHDIMKIO-UHFFFAOYSA-N methylphosphonic acid Chemical compound CP(O)(O)=O YACKEPLHDIMKIO-UHFFFAOYSA-N 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/6564—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having phosphorus atoms, with or without nitrogen, oxygen, sulfur, selenium or tellurium atoms, as ring hetero atoms
- C07F9/6571—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having phosphorus atoms, with or without nitrogen, oxygen, sulfur, selenium or tellurium atoms, as ring hetero atoms having phosphorus and oxygen atoms as the only ring hetero atoms
- C07F9/657163—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having phosphorus atoms, with or without nitrogen, oxygen, sulfur, selenium or tellurium atoms, as ring hetero atoms having phosphorus and oxygen atoms as the only ring hetero atoms the ring phosphorus atom being bound to at least one carbon atom
- C07F9/657181—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having phosphorus atoms, with or without nitrogen, oxygen, sulfur, selenium or tellurium atoms, as ring hetero atoms having phosphorus and oxygen atoms as the only ring hetero atoms the ring phosphorus atom being bound to at least one carbon atom the ring phosphorus atom and, at least, one ring oxygen atom being part of a (thio)phosphonic acid derivative
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH660580 | 1980-09-02 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3134363A1 true DE3134363A1 (de) | 1982-07-15 |
| DE3134363C2 DE3134363C2 (https=) | 1990-01-18 |
Family
ID=4312193
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19813134363 Granted DE3134363A1 (de) | 1980-09-02 | 1981-08-31 | "verfahren zur herstellung von diphosphaspiro-verbindungen" |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4402882A (https=) |
| JP (1) | JPS5777692A (https=) |
| CA (1) | CA1159076A (https=) |
| DE (1) | DE3134363A1 (https=) |
| FR (1) | FR2489333A1 (https=) |
| GB (1) | GB2083042B (https=) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3504646A1 (de) | 1985-02-12 | 1986-08-14 | Basf Ag, 6700 Ludwigshafen | Halogenfreie, selbstverloeschende thermoplastische formmasse |
| DE4407272C2 (de) * | 1994-03-04 | 1996-01-11 | Cassella Ag | Verfahren zur Herstellung cyclischer Vinylphosphonsäureester |
| US20090163627A1 (en) * | 2007-12-20 | 2009-06-25 | Cheil Industries Inc. | Symmetric Cyclic Phosphonate Compound, Method of Preparing the Same and Flame Retardant Styrenic Resin Composition Including the Same |
| EP2264093A1 (de) * | 2009-06-16 | 2010-12-22 | THOR GmbH | Flammgeschützte Polyamidformmassen |
| RU2598603C2 (ru) * | 2015-02-03 | 2016-09-27 | Российская Федерация, От Имени Которой Выступает Министерство Промышленности И Торговли Российской Федерации | Экологически безопасные антипирены на основе оксиэтилированных полиэфиров метоксиметилфосфоновой кислоты |
| CN107011384B (zh) * | 2017-04-24 | 2019-02-15 | 中节能万润股份有限公司 | 一种环状丙基膦酸酐的制备方法 |
Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3141032A (en) * | 1963-01-23 | 1964-07-14 | Union Carbide Corp | Dialkyl pentaerythritol diphosphonates and phosphite phosphonates |
| FR1503429A (fr) * | 1965-12-14 | 1967-11-24 | Ciba Geigy | Procédé de préparation d'esters cycliques de l'acide phosphonique |
| DE2456532A1 (de) * | 1973-12-03 | 1975-06-05 | Ciba Geigy Ag | Phosphonospirobisphenole, ein verfahren zu ihrer herstellung und ihre verwendung |
| US3962377A (en) * | 1973-09-25 | 1976-06-08 | Ciba-Geigy Corporation | 2,3,5-Trialkyl-4-hydroxybenzylphosphonates and phosphinates |
| GB1439092A (en) * | 1974-04-17 | 1976-06-09 | Borg Warner | Hindered phenol pentaerythritol phosphonate |
| US3984502A (en) * | 1974-04-12 | 1976-10-05 | Stauffer Chemical Company | Method of preparing vinyl phosphonate ester of pentaerythritol |
| DE2836771A1 (de) * | 1977-09-06 | 1979-03-15 | Gen Electric | Flammhemmende zusammensetzung aus polyphenylenaether, polystyrolharz und cyclischem phosphonat |
| US4174343A (en) * | 1978-05-05 | 1979-11-13 | American Cyanamid Company | Pentaerythrityl diphosphonate-ammonium polyphosphate combinations as flame retardants for olefin polymers |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3391229A (en) * | 1965-11-24 | 1968-07-02 | Hooker Chemical Corp | Monoesters of phosphonic acids and process for the production thereof |
-
1981
- 1981-08-21 US US06/295,170 patent/US4402882A/en not_active Expired - Fee Related
- 1981-08-27 GB GB8126186A patent/GB2083042B/en not_active Expired
- 1981-08-31 CA CA000384868A patent/CA1159076A/en not_active Expired
- 1981-08-31 FR FR8116538A patent/FR2489333A1/fr active Granted
- 1981-08-31 DE DE19813134363 patent/DE3134363A1/de active Granted
- 1981-09-01 JP JP56137676A patent/JPS5777692A/ja active Granted
Patent Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3141032A (en) * | 1963-01-23 | 1964-07-14 | Union Carbide Corp | Dialkyl pentaerythritol diphosphonates and phosphite phosphonates |
| FR1503429A (fr) * | 1965-12-14 | 1967-11-24 | Ciba Geigy | Procédé de préparation d'esters cycliques de l'acide phosphonique |
| US3962377A (en) * | 1973-09-25 | 1976-06-08 | Ciba-Geigy Corporation | 2,3,5-Trialkyl-4-hydroxybenzylphosphonates and phosphinates |
| DE2456532A1 (de) * | 1973-12-03 | 1975-06-05 | Ciba Geigy Ag | Phosphonospirobisphenole, ein verfahren zu ihrer herstellung und ihre verwendung |
| US3984502A (en) * | 1974-04-12 | 1976-10-05 | Stauffer Chemical Company | Method of preparing vinyl phosphonate ester of pentaerythritol |
| GB1439092A (en) * | 1974-04-17 | 1976-06-09 | Borg Warner | Hindered phenol pentaerythritol phosphonate |
| DE2836771A1 (de) * | 1977-09-06 | 1979-03-15 | Gen Electric | Flammhemmende zusammensetzung aus polyphenylenaether, polystyrolharz und cyclischem phosphonat |
| US4174343A (en) * | 1978-05-05 | 1979-11-13 | American Cyanamid Company | Pentaerythrityl diphosphonate-ammonium polyphosphate combinations as flame retardants for olefin polymers |
Non-Patent Citations (2)
| Title |
|---|
| Helvet. Chim. Acta 46, 1963, 2461-64 * |
| J. Org. Chem. 42/2, 1977, 379-81 * |
Also Published As
| Publication number | Publication date |
|---|---|
| GB2083042B (en) | 1984-01-18 |
| JPS5777692A (en) | 1982-05-15 |
| FR2489333A1 (fr) | 1982-03-05 |
| DE3134363C2 (https=) | 1990-01-18 |
| GB2083042A (en) | 1982-03-17 |
| JPH0141639B2 (https=) | 1989-09-06 |
| US4402882A (en) | 1983-09-06 |
| CA1159076A (en) | 1983-12-20 |
| FR2489333B1 (https=) | 1984-07-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE19522876C1 (de) | Verfahren zur Herstellung eines DOP-haltigen Gemisches und dessen Verwendung | |
| EP0708109B1 (de) | Verfahren zur Herstellung phosphorhaltiger Dicarbonsäuren | |
| EP0032202B1 (de) | Verfahren zur Herstellung neutraler Phosphorigsäurearylester | |
| DE19620023C2 (de) | Verfahren zur Herstellung von Phosphinat- oder Phosphonatgruppen enthaltenden tertiären Phosphanen und neue Phosphinatgruppen enthaltende tertiäre Phosphane | |
| DE3134363C2 (https=) | ||
| EP0803508B1 (de) | Verfahren zur Herstellung von Aluminiumsalzen von Phosphinsäuren | |
| DE2526689C2 (de) | Verfahren zur Herstellung von 2,5-Dioxo-1,2-Oxa-phospholanen | |
| EP0789027A1 (de) | Verfahren zur Herstellung von Phosphonigsäuremonoalkylestern | |
| EP0435071B1 (de) | Verfahren zur Herstellung hydrolysestabiler organischer Phosphite | |
| DE69918077T2 (de) | Verfahren zur herstellung von spirobisphosphiten | |
| EP0008366B1 (de) | Verfahren zur Herstellung neutraler Phosphorsäureester nach dem Phasengrenzflächenverfahren und nach diesem Verfahren hergestellte Verbindungen | |
| DE2643474C2 (de) | Verfahren zur Herstellung von Phosphitchloriden | |
| DE3940765A1 (de) | Verfahren zur herstellung reiner cyclischer phosphorsaeurediarylester | |
| DE3139984C2 (https=) | ||
| DE2002629C3 (de) | Verfahren zur Herstellung von asymmetrischen Alkanthiophosphonsäure-O.O- und Alkan-dithiophosphonsäure-O.S-diestern | |
| DE19603570C2 (de) | Verfahren zur Herstellung von 6-Alkoxy-(6H)-dibenz[c,e][1,2]-oxaphosphorinen | |
| DE2449466C2 (de) | Neue ungesättigte phosphorhaltige Carbonsäurederivate und Verfahren zu deren Herstellung | |
| DE69903145T2 (de) | Herstellung von spirobis-phosphiten aus feingemahlenem pentaerythritol | |
| DE2129583C3 (de) | Verfahren zur Herstellung von Phosphinsäureanhydriden | |
| DE2230913A1 (de) | Verfahren zur Herstellung von Estern der Phosphorsäuren | |
| DE2643442A1 (de) | Verfahren zur herstellung von phosphitchloriden | |
| DE69810758T2 (de) | Verfahren zur reinigung von neomenthyldiphenylphosphinen mittels methanol | |
| DE819999C (de) | Verfahren zur Herstellung von 0, 0-Diestern von Thiophosphorsaeuremonochlorid | |
| EP0568012B1 (de) | Bisphosphinoalkane | |
| EP0826690A1 (de) | Verfahren zur Herstellung von 2-Cyanoethyl-phosphinsäureestern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |