DE3124172A1 - Sulfonsaeuregruppenhaltige farbstoffe - Google Patents
Sulfonsaeuregruppenhaltige farbstoffeInfo
- Publication number
- DE3124172A1 DE3124172A1 DE19813124172 DE3124172A DE3124172A1 DE 3124172 A1 DE3124172 A1 DE 3124172A1 DE 19813124172 DE19813124172 DE 19813124172 DE 3124172 A DE3124172 A DE 3124172A DE 3124172 A1 DE3124172 A1 DE 3124172A1
- Authority
- DE
- Germany
- Prior art keywords
- nhso
- amino
- acid
- parts
- sulfonic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000975 dye Substances 0.000 title claims description 16
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical group OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 title claims description 5
- 239000000460 chlorine Substances 0.000 claims description 33
- 239000010985 leather Substances 0.000 claims description 33
- 150000001875 compounds Chemical class 0.000 claims description 25
- -1 hydroxy, amino Chemical group 0.000 claims description 18
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 16
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 13
- 238000004043 dyeing Methods 0.000 claims description 9
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 6
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 5
- 125000004442 acylamino group Chemical group 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 150000001733 carboxylic acid esters Chemical class 0.000 claims description 5
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 239000011737 fluorine Substances 0.000 claims description 5
- 125000004423 acyloxy group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- 125000005110 aryl thio group Chemical group 0.000 claims description 4
- 125000005521 carbonamide group Chemical group 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 229910052742 iron Inorganic materials 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 229910052804 chromium Inorganic materials 0.000 claims description 2
- 239000011651 chromium Substances 0.000 claims description 2
- 239000010941 cobalt Substances 0.000 claims description 2
- 229910017052 cobalt Inorganic materials 0.000 claims description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 2
- 150000001879 copper Chemical class 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 239000000835 fiber Substances 0.000 claims description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 2
- 229910052759 nickel Inorganic materials 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 150000003459 sulfonic acid esters Chemical class 0.000 claims description 2
- 125000000542 sulfonic acid group Chemical group 0.000 claims description 2
- 230000008878 coupling Effects 0.000 description 26
- 238000010168 coupling process Methods 0.000 description 26
- 238000005859 coupling reaction Methods 0.000 description 26
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 25
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 22
- 239000002253 acid Substances 0.000 description 17
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 16
- 239000000243 solution Substances 0.000 description 15
- 239000000047 product Substances 0.000 description 12
- 238000010186 staining Methods 0.000 description 12
- 239000007864 aqueous solution Substances 0.000 description 11
- 229910021577 Iron(II) chloride Inorganic materials 0.000 description 10
- NMCUIPGRVMDVDB-UHFFFAOYSA-L iron dichloride Chemical compound Cl[Fe]Cl NMCUIPGRVMDVDB-UHFFFAOYSA-L 0.000 description 10
- 150000004698 iron complex Chemical class 0.000 description 9
- 238000000034 method Methods 0.000 description 9
- 239000000725 suspension Substances 0.000 description 9
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 8
- 235000010288 sodium nitrite Nutrition 0.000 description 8
- ARAINKADEARZLZ-ZHACJKMWSA-N 4,4,5,5-tetramethyl-2-[(e)-2-phenylethenyl]-1,3,2-dioxaborolane Chemical compound O1C(C)(C)C(C)(C)OB1\C=C\C1=CC=CC=C1 ARAINKADEARZLZ-ZHACJKMWSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- UQRRCQRFQGOHAI-UHFFFAOYSA-N n-(3-aminophenyl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=CC(N)=C1 UQRRCQRFQGOHAI-UHFFFAOYSA-N 0.000 description 6
- 150000008049 diazo compounds Chemical class 0.000 description 4
- 239000001103 potassium chloride Substances 0.000 description 4
- 235000011164 potassium chloride Nutrition 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- LTASFWDWBYFZQQ-UHFFFAOYSA-N 2-amino-5-nitrobenzenesulfonic acid Chemical compound NC1=CC=C([N+]([O-])=O)C=C1S(O)(=O)=O LTASFWDWBYFZQQ-UHFFFAOYSA-N 0.000 description 3
- DQIVFTJHYKDOMZ-UHFFFAOYSA-N 96-67-3 Chemical compound NC1=CC([N+]([O-])=O)=CC(S(O)(=O)=O)=C1O DQIVFTJHYKDOMZ-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 229910006069 SO3H Inorganic materials 0.000 description 3
- 239000007900 aqueous suspension Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000004040 coloring Methods 0.000 description 3
- 238000010668 complexation reaction Methods 0.000 description 3
- 150000004696 coordination complex Chemical class 0.000 description 3
- 238000001465 metallisation Methods 0.000 description 3
- QXYMVUZOGFVPGH-UHFFFAOYSA-N picramic acid Chemical compound NC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O QXYMVUZOGFVPGH-UHFFFAOYSA-N 0.000 description 3
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 description 2
- ZCGVPUAAMCMLTM-UHFFFAOYSA-N 2-amino-5-chlorobenzenesulfonic acid Chemical compound NC1=CC=C(Cl)C=C1S(O)(=O)=O ZCGVPUAAMCMLTM-UHFFFAOYSA-N 0.000 description 2
- KZKGEEGADAWJFS-UHFFFAOYSA-N 2-amino-5-methoxybenzenesulfonic acid Chemical compound COC1=CC=C(N)C(S(O)(=O)=O)=C1 KZKGEEGADAWJFS-UHFFFAOYSA-N 0.000 description 2
- LTPSRQRIPCVMKQ-UHFFFAOYSA-N 2-amino-5-methylbenzenesulfonic acid Chemical compound CC1=CC=C(N)C(S(O)(=O)=O)=C1 LTPSRQRIPCVMKQ-UHFFFAOYSA-N 0.000 description 2
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 2
- RHPXYZMDLOJTFF-UHFFFAOYSA-N 3-amino-4-hydroxy-5-nitrobenzenesulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC([N+]([O-])=O)=C1O RHPXYZMDLOJTFF-UHFFFAOYSA-N 0.000 description 2
- ULUIMLJNTCECJU-UHFFFAOYSA-N 3-amino-4-hydroxybenzenesulfonate;hydron Chemical compound NC1=CC(S(O)(=O)=O)=CC=C1O ULUIMLJNTCECJU-UHFFFAOYSA-N 0.000 description 2
- YCTAOQGPWNTYJE-UHFFFAOYSA-N 3-amino-5-chloro-2-hydroxybenzenesulfonic acid Chemical compound NC1=CC(Cl)=CC(S(O)(=O)=O)=C1O YCTAOQGPWNTYJE-UHFFFAOYSA-N 0.000 description 2
- MTJGVAJYTOXFJH-UHFFFAOYSA-N 3-aminonaphthalene-1,5-disulfonic acid Chemical compound C1=CC=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 MTJGVAJYTOXFJH-UHFFFAOYSA-N 0.000 description 2
- ZDIRCGKEOWZBIM-UHFFFAOYSA-N 4-amino-2-methylbenzenesulfonic acid Chemical compound CC1=CC(N)=CC=C1S(O)(=O)=O ZDIRCGKEOWZBIM-UHFFFAOYSA-N 0.000 description 2
- NEECEUZBAHTVIN-UHFFFAOYSA-N 4-amino-3-chlorobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1Cl NEECEUZBAHTVIN-UHFFFAOYSA-N 0.000 description 2
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 2
- HYLOSPCJTPLXSF-UHFFFAOYSA-N 5-amino-2-anilinobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1NC1=CC=CC=C1 HYLOSPCJTPLXSF-UHFFFAOYSA-N 0.000 description 2
- JXZGTFLJFKLVAX-UHFFFAOYSA-N 5-amino-2-methoxybenzenesulfonic acid Chemical compound COC1=CC=C(N)C=C1S(O)(=O)=O JXZGTFLJFKLVAX-UHFFFAOYSA-N 0.000 description 2
- HTYRTGGIOAMLRR-UHFFFAOYSA-N 5-amino-4-hydroxybenzene-1,3-disulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC(S(O)(=O)=O)=C1O HTYRTGGIOAMLRR-UHFFFAOYSA-N 0.000 description 2
- GFPQSWFFPRQEHH-UHFFFAOYSA-N 7-aminonaphthalene-1,3,6-trisulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(S(O)(=O)=O)C(N)=CC2=C1S(O)(=O)=O GFPQSWFFPRQEHH-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 229910014033 C-OH Inorganic materials 0.000 description 2
- 229910014570 C—OH Inorganic materials 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- 239000012670 alkaline solution Substances 0.000 description 2
- 150000001989 diazonium salts Chemical class 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- ZGZFEDUYJFEJAW-UHFFFAOYSA-N n-(4-aminophenyl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C(N)C=C1 ZGZFEDUYJFEJAW-UHFFFAOYSA-N 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- CYCGXYKRUBKWHT-UHFFFAOYSA-N 1-(2,5-dichlorophenyl)piperazine;dihydrochloride Chemical compound Cl.Cl.ClC1=CC=C(Cl)C(N2CCNCC2)=C1 CYCGXYKRUBKWHT-UHFFFAOYSA-N 0.000 description 1
- VLZVIIYRNMWPSN-UHFFFAOYSA-N 2-Amino-4-nitrophenol Chemical compound NC1=CC([N+]([O-])=O)=CC=C1O VLZVIIYRNMWPSN-UHFFFAOYSA-N 0.000 description 1
- DOPJTDJKZNWLRB-UHFFFAOYSA-N 2-Amino-5-nitrophenol Chemical compound NC1=CC=C([N+]([O-])=O)C=C1O DOPJTDJKZNWLRB-UHFFFAOYSA-N 0.000 description 1
- QQDKXJSYZGJGKJ-UHFFFAOYSA-N 2-amino-3,4,6-trichlorophenol Chemical compound NC1=C(O)C(Cl)=CC(Cl)=C1Cl QQDKXJSYZGJGKJ-UHFFFAOYSA-N 0.000 description 1
- CFCXQQUQLZIZPI-UHFFFAOYSA-N 2-amino-3,5-dimethylbenzenesulfonic acid Chemical compound CC1=CC(C)=C(N)C(S(O)(=O)=O)=C1 CFCXQQUQLZIZPI-UHFFFAOYSA-N 0.000 description 1
- IDXBVHWWMUPXIU-UHFFFAOYSA-N 2-amino-3-chlorobenzenesulfonic acid Chemical compound NC1=C(Cl)C=CC=C1S(O)(=O)=O IDXBVHWWMUPXIU-UHFFFAOYSA-N 0.000 description 1
- WASQBNCGNUTVNI-UHFFFAOYSA-N 2-amino-4,6-dichlorophenol Chemical compound NC1=CC(Cl)=CC(Cl)=C1O WASQBNCGNUTVNI-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- VRLPHBSFRWMMPW-UHFFFAOYSA-N 2-amino-4-chloro-5-methylbenzenesulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=C(N)C=C1Cl VRLPHBSFRWMMPW-UHFFFAOYSA-N 0.000 description 1
- ZARYBZGMUVAJMK-UHFFFAOYSA-N 2-amino-4-chloro-5-nitrophenol Chemical compound NC1=CC(Cl)=C([N+]([O-])=O)C=C1O ZARYBZGMUVAJMK-UHFFFAOYSA-N 0.000 description 1
- MHAFRUMLQZZSIN-UHFFFAOYSA-N 2-amino-4-chloro-6-nitrophenol Chemical compound NC1=CC(Cl)=CC([N+]([O-])=O)=C1O MHAFRUMLQZZSIN-UHFFFAOYSA-N 0.000 description 1
- OMQCGHBXGJBBOL-UHFFFAOYSA-N 2-amino-4-chlorobenzenesulfonic acid Chemical compound NC1=CC(Cl)=CC=C1S(O)(=O)=O OMQCGHBXGJBBOL-UHFFFAOYSA-N 0.000 description 1
- SWFNPENEBHAHEB-UHFFFAOYSA-N 2-amino-4-chlorophenol Chemical compound NC1=CC(Cl)=CC=C1O SWFNPENEBHAHEB-UHFFFAOYSA-N 0.000 description 1
- ZAZOGYUKHDTXGF-UHFFFAOYSA-N 2-amino-4-methoxy-6-nitrobenzenesulfonic acid Chemical compound COC1=CC(N)=C(S(O)(=O)=O)C([N+]([O-])=O)=C1 ZAZOGYUKHDTXGF-UHFFFAOYSA-N 0.000 description 1
- AJWIWEGQLDDWQC-UHFFFAOYSA-N 2-amino-4-methyl-6-nitrophenol Chemical compound CC1=CC(N)=C(O)C([N+]([O-])=O)=C1 AJWIWEGQLDDWQC-UHFFFAOYSA-N 0.000 description 1
- VYZCFAPUHSSYCC-UHFFFAOYSA-N 2-amino-5-chloro-4-methylbenzenesulfonic acid Chemical compound CC1=CC(N)=C(S(O)(=O)=O)C=C1Cl VYZCFAPUHSSYCC-UHFFFAOYSA-N 0.000 description 1
- KTFUNVBAGAPLLC-UHFFFAOYSA-N 2-amino-5-ethoxybenzenesulfonic acid Chemical compound CCOC1=CC=C(N)C(S(O)(=O)=O)=C1 KTFUNVBAGAPLLC-UHFFFAOYSA-N 0.000 description 1
- GLABVBIYGGDCNO-UHFFFAOYSA-N 2-amino-5-methoxybenzene-1,4-disulfonic acid Chemical compound COC1=CC(S(O)(=O)=O)=C(N)C=C1S(O)(=O)=O GLABVBIYGGDCNO-UHFFFAOYSA-N 0.000 description 1
- MJNYPLCGWXFYPD-UHFFFAOYSA-N 2-amino-5-sulfobenzoic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1C(O)=O MJNYPLCGWXFYPD-UHFFFAOYSA-N 0.000 description 1
- ZMXYNJXDULEQCK-UHFFFAOYSA-N 2-amino-p-cresol Chemical compound CC1=CC=C(O)C(N)=C1 ZMXYNJXDULEQCK-UHFFFAOYSA-N 0.000 description 1
- HLCPWBZNUKCSBN-UHFFFAOYSA-N 2-aminobenzonitrile Chemical compound NC1=CC=CC=C1C#N HLCPWBZNUKCSBN-UHFFFAOYSA-N 0.000 description 1
- YAIKCRUPEVOINQ-UHFFFAOYSA-N 2-aminonaphthalene-1,5-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC2=C(S(O)(=O)=O)C(N)=CC=C21 YAIKCRUPEVOINQ-UHFFFAOYSA-N 0.000 description 1
- XTTIQGSLJBWVIV-UHFFFAOYSA-N 2-methyl-4-nitroaniline Chemical compound CC1=CC([N+]([O-])=O)=CC=C1N XTTIQGSLJBWVIV-UHFFFAOYSA-N 0.000 description 1
- DLURHXYXQYMPLT-UHFFFAOYSA-N 2-nitro-p-toluidine Chemical compound CC1=CC=C(N)C([N+]([O-])=O)=C1 DLURHXYXQYMPLT-UHFFFAOYSA-N 0.000 description 1
- VZLLZDZTQPBHAZ-UHFFFAOYSA-N 2-nitroaniline-4-sulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1[N+]([O-])=O VZLLZDZTQPBHAZ-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- GXINVVNDQWECJP-UHFFFAOYSA-N 3-amino-2-hydroxy-5-methylbenzenesulfonic acid Chemical compound CC1=CC(N)=C(O)C(S(O)(=O)=O)=C1 GXINVVNDQWECJP-UHFFFAOYSA-N 0.000 description 1
- ZLTOYIGWKLTQBJ-UHFFFAOYSA-N 3-amino-2-hydroxy-5-sulfobenzoic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC(C(O)=O)=C1O ZLTOYIGWKLTQBJ-UHFFFAOYSA-N 0.000 description 1
- XJQRCFRVWZHIPN-UHFFFAOYSA-N 3-amino-4-chlorobenzenesulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC=C1Cl XJQRCFRVWZHIPN-UHFFFAOYSA-N 0.000 description 1
- AVQFHKYAVVQYQO-UHFFFAOYSA-N 3-amino-4-hydroxybenzenesulfonamide Chemical compound NC1=CC(S(N)(=O)=O)=CC=C1O AVQFHKYAVVQYQO-UHFFFAOYSA-N 0.000 description 1
- QGTXBWMKRGHPDD-UHFFFAOYSA-N 3-amino-5-chloro-4-hydroxybenzenesulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC(Cl)=C1O QGTXBWMKRGHPDD-UHFFFAOYSA-N 0.000 description 1
- MMIOLIPHTSCWDG-UHFFFAOYSA-N 3-amino-5-nitrobenzenesulfonic acid Chemical compound NC1=CC([N+]([O-])=O)=CC(S(O)(=O)=O)=C1 MMIOLIPHTSCWDG-UHFFFAOYSA-N 0.000 description 1
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 1
- UCTREIIEJSFTDI-UHFFFAOYSA-N 3-aminonaphthalene-2,7-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(S(O)(=O)=O)C(N)=CC2=C1 UCTREIIEJSFTDI-UHFFFAOYSA-N 0.000 description 1
- XJCVRTZCHMZPBD-UHFFFAOYSA-N 3-nitroaniline Chemical compound NC1=CC=CC([N+]([O-])=O)=C1 XJCVRTZCHMZPBD-UHFFFAOYSA-N 0.000 description 1
- GDIIPKWHAQGCJF-UHFFFAOYSA-N 4-Amino-2-nitrotoluene Chemical compound CC1=CC=C(N)C=C1[N+]([O-])=O GDIIPKWHAQGCJF-UHFFFAOYSA-N 0.000 description 1
- FOINSAWEWXUXPQ-UHFFFAOYSA-N 4-acetamido-2-aminobenzenesulfonic acid Chemical compound CC(=O)NC1=CC=C(S(O)(=O)=O)C(N)=C1 FOINSAWEWXUXPQ-UHFFFAOYSA-N 0.000 description 1
- SJCTXIKOXTUQHC-UHFFFAOYSA-N 4-amino-2,5-dichlorobenzenesulfonic acid Chemical compound NC1=CC(Cl)=C(S(O)(=O)=O)C=C1Cl SJCTXIKOXTUQHC-UHFFFAOYSA-N 0.000 description 1
- ZZNAYFWAXZJITH-UHFFFAOYSA-N 4-amino-3-nitrobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1[N+]([O-])=O ZZNAYFWAXZJITH-UHFFFAOYSA-N 0.000 description 1
- UEJMIJRZMMUVRI-UHFFFAOYSA-N 4-amino-5-chlorobenzene-1,3-disulfonic acid Chemical compound NC1=C(Cl)C=C(S(O)(=O)=O)C=C1S(O)(=O)=O UEJMIJRZMMUVRI-UHFFFAOYSA-N 0.000 description 1
- UNHSZULCZYJZML-UHFFFAOYSA-N 4-amino-5-methylbenzene-1,2-disulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=C(S(O)(=O)=O)C=C1N UNHSZULCZYJZML-UHFFFAOYSA-N 0.000 description 1
- KKBQCLVIBFUKGQ-UHFFFAOYSA-N 4-amino-5-methylbenzene-1,3-disulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=CC(S(O)(=O)=O)=C1N KKBQCLVIBFUKGQ-UHFFFAOYSA-N 0.000 description 1
- YBAZINRZQSAIAY-UHFFFAOYSA-N 4-aminobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1 YBAZINRZQSAIAY-UHFFFAOYSA-N 0.000 description 1
- PHZVGKMVVKFBCX-UHFFFAOYSA-N 4-aminonaphthalene-1,5-disulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=C2C(N)=CC=C(S(O)(=O)=O)C2=C1 PHZVGKMVVKFBCX-UHFFFAOYSA-N 0.000 description 1
- PBGKNXWGYQPUJK-UHFFFAOYSA-N 4-chloro-2-nitroaniline Chemical compound NC1=CC=C(Cl)C=C1[N+]([O-])=O PBGKNXWGYQPUJK-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 1
- PHRVJZNHPVJYOM-UHFFFAOYSA-N 5-acetamido-2-aminobenzenesulfonic acid Chemical compound CC(=O)NC1=CC=C(N)C(S(O)(=O)=O)=C1 PHRVJZNHPVJYOM-UHFFFAOYSA-N 0.000 description 1
- NTPCHAXHWPDMEI-UHFFFAOYSA-N 5-amino-2,4-dimethylbenzenesulfonic acid Chemical compound CC1=CC(C)=C(S(O)(=O)=O)C=C1N NTPCHAXHWPDMEI-UHFFFAOYSA-N 0.000 description 1
- GHBWBMDGBCKAQU-UHFFFAOYSA-N 5-amino-2-[2-(4-nitro-2-sulfophenyl)ethenyl]benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1C=CC1=CC=C([N+]([O-])=O)C=C1S(O)(=O)=O GHBWBMDGBCKAQU-UHFFFAOYSA-N 0.000 description 1
- VPXCXBHLKDPWQV-UHFFFAOYSA-N 5-amino-2-chlorobenzenesulfonic acid Chemical compound NC1=CC=C(Cl)C(S(O)(=O)=O)=C1 VPXCXBHLKDPWQV-UHFFFAOYSA-N 0.000 description 1
- BRKFTWHPLMMNHF-UHFFFAOYSA-N 5-amino-2-methylbenzenesulfonic acid Chemical compound CC1=CC=C(N)C=C1S(O)(=O)=O BRKFTWHPLMMNHF-UHFFFAOYSA-N 0.000 description 1
- KZZWQCKYLNIOBT-UHFFFAOYSA-N 5-amino-2-nitrobenzoic acid Chemical compound NC1=CC=C([N+]([O-])=O)C(C(O)=O)=C1 KZZWQCKYLNIOBT-UHFFFAOYSA-N 0.000 description 1
- UWPJYQYRSWYIGZ-UHFFFAOYSA-N 5-aminonaphthalene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(N)=CC=CC2=C1 UWPJYQYRSWYIGZ-UHFFFAOYSA-N 0.000 description 1
- DSBIJCMXAIKKKI-UHFFFAOYSA-N 5-nitro-o-toluidine Chemical compound CC1=CC=C([N+]([O-])=O)C=C1N DSBIJCMXAIKKKI-UHFFFAOYSA-N 0.000 description 1
- KZCSUEYBKAPKNH-UHFFFAOYSA-N 6-aminonaphthalene-1,3-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KZCSUEYBKAPKNH-UHFFFAOYSA-N 0.000 description 1
- YUNBHHWDQDGWHC-UHFFFAOYSA-N 6-aminonaphthalene-1-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC2=CC(N)=CC=C21 YUNBHHWDQDGWHC-UHFFFAOYSA-N 0.000 description 1
- SEMRCUIXRUXGJX-UHFFFAOYSA-N 6-aminonaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=CC(N)=CC=C21 SEMRCUIXRUXGJX-UHFFFAOYSA-N 0.000 description 1
- TWLMSPNQBKSXOP-UHFFFAOYSA-N 6358-09-4 Chemical compound NC1=CC([N+]([O-])=O)=CC(Cl)=C1O TWLMSPNQBKSXOP-UHFFFAOYSA-N 0.000 description 1
- HKTWHHAJDJCUPC-UHFFFAOYSA-N 7-aminonaphthalene-1,3,5-trisulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 HKTWHHAJDJCUPC-UHFFFAOYSA-N 0.000 description 1
- CMOLPZZVECHXKN-UHFFFAOYSA-N 7-aminonaphthalene-1,3-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(S(O)(=O)=O)C2=CC(N)=CC=C21 CMOLPZZVECHXKN-UHFFFAOYSA-N 0.000 description 1
- OKAUOXITMZTUOJ-UHFFFAOYSA-N 7-aminonaphthalene-2-sulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 OKAUOXITMZTUOJ-UHFFFAOYSA-N 0.000 description 1
- YDEOXZHCPCPPJG-UHFFFAOYSA-N 8-aminonaphthalene-1,6-disulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=C2C(N)=CC(S(O)(=O)=O)=CC2=C1 YDEOXZHCPCPPJG-UHFFFAOYSA-N 0.000 description 1
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000001049 brown dye Substances 0.000 description 1
- 125000006309 butyl amino group Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- YAQKGZXXQNKEET-UHFFFAOYSA-N clazolam Chemical compound C1C(=O)N(C)C2=CC=C(Cl)C=C2C2C3=CC=CC=C3CCN21 YAQKGZXXQNKEET-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- CZHASNCRXYVDAO-UHFFFAOYSA-N n-(3-amino-4-chlorophenyl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C(Cl)C(N)=C1 CZHASNCRXYVDAO-UHFFFAOYSA-N 0.000 description 1
- XTXFISCMHNBZDW-UHFFFAOYSA-N n-(3-amino-4-methylphenyl)methanesulfonamide Chemical compound CC1=CC=C(NS(C)(=O)=O)C=C1N XTXFISCMHNBZDW-UHFFFAOYSA-N 0.000 description 1
- PEMGGJDINLGTON-UHFFFAOYSA-N n-(3-aminophenyl)acetamide Chemical compound CC(=O)NC1=CC=CC(N)=C1 PEMGGJDINLGTON-UHFFFAOYSA-N 0.000 description 1
- KPFGGEHCIZEMTD-UHFFFAOYSA-N n-chloro-4-nitroaniline Chemical compound [O-][N+](=O)C1=CC=C(NCl)C=C1 KPFGGEHCIZEMTD-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B45/00—Complex metal compounds of azo dyes
- C09B45/02—Preparation from dyes containing in o-position a hydroxy group and in o'-position hydroxy, alkoxy, carboxyl, amino or keto groups
- C09B45/24—Disazo or polyazo compounds
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B33/00—Disazo and polyazo dyes of the types A->K<-B, A->B->K<-C, or the like, prepared by diazotising and coupling
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Detergent Compositions (AREA)
- Indole Compounds (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19813124172 DE3124172A1 (de) | 1981-06-19 | 1981-06-19 | Sulfonsaeuregruppenhaltige farbstoffe |
| US06/380,711 US4491543A (en) | 1981-06-19 | 1982-05-21 | Dis-, tris-, and tetrakisazo compounds containing resorcinol, sulfonylamino, and two or three sulfonic acid groups |
| DE8282105144T DE3261127D1 (en) | 1981-06-19 | 1982-06-12 | Dyestuffs containing sulphonic acid groups |
| EP82105144A EP0068245B1 (de) | 1981-06-19 | 1982-06-12 | Sulfonsäuregruppenhaltige Farbstoffe |
| JP57101506A JPS57212256A (en) | 1981-06-19 | 1982-06-15 | Sulfonic acid group-containing dye |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19813124172 DE3124172A1 (de) | 1981-06-19 | 1981-06-19 | Sulfonsaeuregruppenhaltige farbstoffe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3124172A1 true DE3124172A1 (de) | 1982-12-30 |
Family
ID=6134955
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19813124172 Withdrawn DE3124172A1 (de) | 1981-06-19 | 1981-06-19 | Sulfonsaeuregruppenhaltige farbstoffe |
| DE8282105144T Expired DE3261127D1 (en) | 1981-06-19 | 1982-06-12 | Dyestuffs containing sulphonic acid groups |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8282105144T Expired DE3261127D1 (en) | 1981-06-19 | 1982-06-12 | Dyestuffs containing sulphonic acid groups |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4491543A (enExample) |
| EP (1) | EP0068245B1 (enExample) |
| JP (1) | JPS57212256A (enExample) |
| DE (2) | DE3124172A1 (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES2058334T3 (es) * | 1987-12-16 | 1994-11-01 | Ciba Geigy Ag | Procedimiento para la obtencion de colorantes poliazoicos. |
| GB9022355D0 (en) * | 1990-10-15 | 1990-11-28 | Sandoz Ltd | Improvements in or relating to organic compounds |
| GB9022354D0 (en) * | 1990-10-15 | 1990-11-28 | Sandoz Ltd | Improvements in or relating to organic compounds |
| DE4126995A1 (de) * | 1991-08-16 | 1993-02-18 | Basf Ag | Fliessfaehige farbstoffpraeparationen, die polyazofarbstoffe enthalten |
| DE19613315A1 (de) * | 1996-04-03 | 1997-10-09 | Basf Ag | Trisazofarbstoffe |
| KR100398089B1 (ko) * | 2001-02-12 | 2003-09-19 | 학교법인 한양학원 | 아조계 염료와 이의 용도 |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB371866A (en) * | 1931-01-28 | 1932-04-28 | Ici Ltd | Azo dyestuffs for leather |
| US2030991A (en) * | 1932-06-28 | 1936-02-18 | Du Pont | Azo dyes and methods for their preparation |
| US2018234A (en) * | 1932-07-26 | 1935-10-22 | Du Pont | Azo dye and method for its preparation |
| US2061545A (en) * | 1933-09-15 | 1936-11-24 | Firm Of J R Geigy A G | Conversion products of azo dyestuffs and their production |
| US2111559A (en) * | 1933-11-25 | 1938-03-22 | Gen Aniline Works Inc | Azo dyestuffs containing a heavy metal in a complex form |
| US2080191A (en) * | 1935-01-24 | 1937-05-11 | Soc Of Chemical Ind | Complex metal compounds of disazo dyestuffs |
| US2135433A (en) * | 1935-10-26 | 1938-11-01 | Gen Aniline Works Inc | Azo dyestuffs |
| US2259735A (en) * | 1939-10-31 | 1941-10-21 | American Cyanamid Co | Metallized acid polyazo dyes |
| US2563091A (en) * | 1941-07-22 | 1951-08-07 | Celanese Corp | Dyes |
| US2420630A (en) * | 1942-08-15 | 1947-05-13 | Eastman Kodak Co | Disazo dye compounds |
| FR980276A (fr) * | 1943-01-15 | 1951-05-10 | Francolor Sa | Colorants polyazoïques, leurs complexes métalliques et leurs procédés de fabrication |
| US2454683A (en) * | 1945-04-16 | 1948-11-23 | Sandoz Ltd | Metallizable polyazo dyestuffs |
| US2606898A (en) * | 1949-02-21 | 1952-08-12 | Celanese Corp | Azo dyestuffs |
| FR1012664A (fr) * | 1950-01-26 | 1952-07-16 | Francolor Sa | Colorants polyazoïques, leurs complexes métalliques et leurs procédés de fabrication |
| FR1109435A (fr) * | 1953-06-23 | 1956-01-27 | Geigy Ag J R | Colorants trisazoïques diazotables et leur procédé de préparation |
| US3189593A (en) * | 1962-02-28 | 1965-06-15 | Sandoz Ltd | Polyazo dyes |
| CH531032A (de) * | 1969-05-23 | 1972-11-30 | Sandoz Ag | Verfahren zur Herstellung von Polyazoverbindungen und ihrer Metallkomplexverbindungen |
| DE2238159A1 (de) * | 1972-08-03 | 1974-02-14 | Bayer Ag | Trisazo-kupferkomplexfarbstoffe |
| FR2324689A1 (fr) * | 1974-01-14 | 1977-04-15 | Ugine Kuhlmann | Nouveaux colorants trisazoiques hydrosolubles |
| DE2514008C2 (de) * | 1974-04-10 | 1984-03-08 | Sandoz-Patent-GmbH, 7850 Lörrach | Organische Verbindungen, deren Herstellung und Verwendung |
-
1981
- 1981-06-19 DE DE19813124172 patent/DE3124172A1/de not_active Withdrawn
-
1982
- 1982-05-21 US US06/380,711 patent/US4491543A/en not_active Expired - Lifetime
- 1982-06-12 DE DE8282105144T patent/DE3261127D1/de not_active Expired
- 1982-06-12 EP EP82105144A patent/EP0068245B1/de not_active Expired
- 1982-06-15 JP JP57101506A patent/JPS57212256A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE3261127D1 (en) | 1984-12-06 |
| JPH0330630B2 (enExample) | 1991-05-01 |
| EP0068245B1 (de) | 1984-10-31 |
| JPS57212256A (en) | 1982-12-27 |
| EP0068245A1 (de) | 1983-01-05 |
| US4491543A (en) | 1985-01-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0078007B1 (de) | Metallkomplexe von Polyazofarbstoffen | |
| DE3124172A1 (de) | Sulfonsaeuregruppenhaltige farbstoffe | |
| DE2302582C3 (de) | Wasserlösliche Azofarbstoffe der Diamino-pyrimidin-Reihe, Verfahren zu ihrer Herstellung und Farbstoffzubereitungen | |
| DE1807642A1 (de) | Verfahren zur Herstellung von Farbstoffen | |
| EP0016975B1 (de) | Polyazofarbstoffe sowie ihre Verwendung zum Färben von amino- und hydroxygruppenhaltigen Fasermaterialien und Leder | |
| EP0319474B1 (de) | Verfahren zur Herstellung von 1:2-Metallkomplexazofarbstoffen | |
| EP0140252B1 (de) | Polyazofarbstoffe | |
| EP0011873B1 (de) | Polyazofarbstoffe, deren Herstellung und Verwendung zum Färben von Cellulosematerialien | |
| EP0043439B1 (de) | Trisazo/azoxyfarbstoffgemische, Verfahren zu ihrer Herstellung sowie ihre Verwendung | |
| DE3428836A1 (de) | Azoverbindungen | |
| EP0241414B1 (de) | Verfahren zur Herstellung von 1:2-Metallkomplexazofarbstoffen | |
| EP0891395B1 (de) | Trisazofarbstoffe | |
| DE1644254C3 (de) | Schwermetallhaltige wasserlösliche faserreaktive und -nichtreaktive Formazanazofarbstoffe, deren Herstellung und Verwendung | |
| DE2918633A1 (de) | Kobalt-komplexfarbstoffe | |
| EP0087715B1 (de) | Sulfonamid- und aminogruppenfreie Metallkomplexfarbstoffe | |
| DE1966888C3 (de) | Wasserlösliche Azofarbstoffe und deren Verwendung zum Färben von pflanzlichen und tierischen Fasern | |
| DE1904113A1 (de) | Verfahren zur Herstellung von faserreaktiven schwermetallhaltigen Formazanfarbstoffen | |
| DE909383C (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE398792C (de) | Verfahren zur Herstellung saurer Azofarbstoffe | |
| DE178803C (enExample) | ||
| EP0212412A2 (de) | Polyazofarbstoffe | |
| DE945642C (de) | Verfahren zur Herstellung von metallisierbaren Monoazofarbstoffen | |
| DE2450884A1 (de) | Neue metallkomplexfarbstoffe, deren herstellung und verwendung | |
| DE141398C (enExample) | ||
| DE1292272B (de) | Verfahren zur Herstellung von wasserloeslichen faserreaktiven Farbstoffen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |