DE3109259C2 - - Google Patents
Info
- Publication number
- DE3109259C2 DE3109259C2 DE3109259A DE3109259A DE3109259C2 DE 3109259 C2 DE3109259 C2 DE 3109259C2 DE 3109259 A DE3109259 A DE 3109259A DE 3109259 A DE3109259 A DE 3109259A DE 3109259 C2 DE3109259 C2 DE 3109259C2
- Authority
- DE
- Germany
- Prior art keywords
- layer
- group
- elimination
- polymers
- diffusion
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 229920000642 polymer Polymers 0.000 claims description 101
- 238000009792 diffusion process Methods 0.000 claims description 69
- 238000007068 beta-elimination reaction Methods 0.000 claims description 58
- 239000000203 mixture Substances 0.000 claims description 54
- 239000011159 matrix material Substances 0.000 claims description 40
- 238000012546 transfer Methods 0.000 claims description 33
- 238000012545 processing Methods 0.000 claims description 29
- 239000003513 alkali Substances 0.000 claims description 26
- 229920001577 copolymer Polymers 0.000 claims description 26
- 239000000126 substance Substances 0.000 claims description 25
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 230000035699 permeability Effects 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 16
- 229920000536 2-Acrylamido-2-methylpropane sulfonic acid Polymers 0.000 claims description 15
- XHZPRMZZQOIPDS-UHFFFAOYSA-N 2-Methyl-2-[(1-oxo-2-propenyl)amino]-1-propanesulfonic acid Chemical compound OS(=O)(=O)CC(C)(C)NC(=O)C=C XHZPRMZZQOIPDS-UHFFFAOYSA-N 0.000 claims description 15
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 13
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 239000000178 monomer Substances 0.000 claims description 12
- 229910052757 nitrogen Inorganic materials 0.000 claims description 10
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 230000003213 activating effect Effects 0.000 claims description 7
- 125000003118 aryl group Chemical group 0.000 claims description 7
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 6
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 6
- 230000005540 biological transmission Effects 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 4
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 claims description 4
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 claims description 3
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 3
- 229940088644 n,n-dimethylacrylamide Drugs 0.000 claims description 3
- YLGYACDQVQQZSW-UHFFFAOYSA-N n,n-dimethylprop-2-enamide Chemical compound CN(C)C(=O)C=C YLGYACDQVQQZSW-UHFFFAOYSA-N 0.000 claims description 3
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 claims description 3
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 claims description 2
- 125000002837 carbocyclic group Chemical group 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 2
- 239000000470 constituent Substances 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- SWXVUIWOUIDPGS-UHFFFAOYSA-N diacetone alcohol Chemical compound CC(=O)CC(C)(C)O SWXVUIWOUIDPGS-UHFFFAOYSA-N 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 229920001519 homopolymer Polymers 0.000 claims description 2
- SNVLJLYUUXKWOJ-UHFFFAOYSA-N methylidenecarbene Chemical group C=[C] SNVLJLYUUXKWOJ-UHFFFAOYSA-N 0.000 claims description 2
- PZWRHDSUKRJIDJ-UHFFFAOYSA-N n-(2-amino-2-oxoethyl)-2-methylprop-2-enamide Chemical compound CC(=C)C(=O)NCC(N)=O PZWRHDSUKRJIDJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 150000003457 sulfones Chemical class 0.000 claims description 2
- 125000003375 sulfoxide group Chemical group 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims 1
- GVGGWUXGMRTNIK-UHFFFAOYSA-N n-(2-amino-2-oxoethyl)prop-2-enamide Chemical compound NC(=O)CNC(=O)C=C GVGGWUXGMRTNIK-UHFFFAOYSA-N 0.000 claims 1
- 239000010410 layer Substances 0.000 description 206
- 239000000975 dye Substances 0.000 description 63
- 239000010408 film Substances 0.000 description 39
- 239000000243 solution Substances 0.000 description 31
- 238000011161 development Methods 0.000 description 29
- 239000000839 emulsion Substances 0.000 description 29
- -1 For example Chemical group 0.000 description 28
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- 238000006243 chemical reaction Methods 0.000 description 24
- 229910052709 silver Inorganic materials 0.000 description 23
- 239000004332 silver Substances 0.000 description 23
- 239000000463 material Substances 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- FXEBUIXQVGMBNZ-UHFFFAOYSA-N 2-[2-cyanoethyl(prop-2-enoyl)amino]-2-methylpropanoic acid Chemical compound OC(=O)C(C)(C)N(C(=O)C=C)CCC#N FXEBUIXQVGMBNZ-UHFFFAOYSA-N 0.000 description 16
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical class CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 15
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 15
- 230000003472 neutralizing effect Effects 0.000 description 15
- 239000004793 Polystyrene Substances 0.000 description 14
- 238000002360 preparation method Methods 0.000 description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- 230000008859 change Effects 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 238000001212 derivatisation Methods 0.000 description 10
- 238000006116 polymerization reaction Methods 0.000 description 10
- 239000004094 surface-active agent Substances 0.000 description 10
- 238000012360 testing method Methods 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- 238000006386 neutralization reaction Methods 0.000 description 9
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 8
- 150000008064 anhydrides Chemical class 0.000 description 8
- 230000002209 hydrophobic effect Effects 0.000 description 8
- OMNKZBIFPJNNIO-UHFFFAOYSA-N n-(2-methyl-4-oxopentan-2-yl)prop-2-enamide Chemical compound CC(=O)CC(C)(C)NC(=O)C=C OMNKZBIFPJNNIO-UHFFFAOYSA-N 0.000 description 8
- 230000002829 reductive effect Effects 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- 238000009826 distribution Methods 0.000 description 7
- 230000008569 process Effects 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000010521 absorption reaction Methods 0.000 description 6
- 230000006978 adaptation Effects 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 239000011229 interlayer Substances 0.000 description 6
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 6
- 230000002028 premature Effects 0.000 description 6
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 5
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 5
- 125000006850 spacer group Chemical group 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000010348 incorporation Methods 0.000 description 4
- 230000005012 migration Effects 0.000 description 4
- 238000013508 migration Methods 0.000 description 4
- 239000010409 thin film Substances 0.000 description 4
- 239000004408 titanium dioxide Substances 0.000 description 4
- URXHQLZNKOFJOD-JTQLQIEISA-N (2R)-2-[ethyl(prop-2-enoyl)amino]-2-methyl-3-methylsulfonylpropanoic acid Chemical compound CS(=O)(=O)C[C@](N(C(C=C)=O)CC)(C(=O)O)C URXHQLZNKOFJOD-JTQLQIEISA-N 0.000 description 3
- JIGUICYYOYEXFS-UHFFFAOYSA-N 3-tert-butylbenzene-1,2-diol Chemical compound CC(C)(C)C1=CC=CC(O)=C1O JIGUICYYOYEXFS-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 238000010276 construction Methods 0.000 description 3
- 230000008030 elimination Effects 0.000 description 3
- 238000003379 elimination reaction Methods 0.000 description 3
- 230000004927 fusion Effects 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 239000003999 initiator Substances 0.000 description 3
- SURQXAFEQWPFPV-UHFFFAOYSA-L iron(2+) sulfate heptahydrate Chemical compound O.O.O.O.O.O.O.[Fe+2].[O-]S([O-])(=O)=O SURQXAFEQWPFPV-UHFFFAOYSA-L 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 230000000704 physical effect Effects 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- WSGYTJNNHPZFKR-UHFFFAOYSA-N 3-hydroxypropanenitrile Chemical compound OCCC#N WSGYTJNNHPZFKR-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 2
- 239000000370 acceptor Substances 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 150000003926 acrylamides Chemical class 0.000 description 2
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical class ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 230000004888 barrier function Effects 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 238000005282 brightening Methods 0.000 description 2
- 150000001718 carbodiimides Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000000295 complement effect Effects 0.000 description 2
- 239000013039 cover film Substances 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 230000003111 delayed effect Effects 0.000 description 2
- ZQMIGQNCOMNODD-UHFFFAOYSA-N diacetyl peroxide Chemical compound CC(=O)OOC(C)=O ZQMIGQNCOMNODD-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- IZKUWTDESDNCCG-UHFFFAOYSA-N n'-acetylprop-2-enehydrazide Chemical compound CC(=O)NNC(=O)C=C IZKUWTDESDNCCG-UHFFFAOYSA-N 0.000 description 2
- 230000000269 nucleophilic effect Effects 0.000 description 2
- 239000012466 permeate Substances 0.000 description 2
- 238000005554 pickling Methods 0.000 description 2
- 239000013047 polymeric layer Substances 0.000 description 2
- 230000000717 retained effect Effects 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- JONTXEXBTWSUKE-UHFFFAOYSA-N 2-(2-aminoethylsulfanyl)ethanamine Chemical compound NCCSCCN JONTXEXBTWSUKE-UHFFFAOYSA-N 0.000 description 1
- PRAMZQXXPOLCIY-UHFFFAOYSA-N 2-(2-methylprop-2-enoyloxy)ethanesulfonic acid Chemical compound CC(=C)C(=O)OCCS(O)(=O)=O PRAMZQXXPOLCIY-UHFFFAOYSA-N 0.000 description 1
- FUOOLUPWFVMBKG-UHFFFAOYSA-N 2-Aminoisobutyric acid Chemical compound CC(C)(N)C(O)=O FUOOLUPWFVMBKG-UHFFFAOYSA-N 0.000 description 1
- AYHBRSKXFVQPPX-UHFFFAOYSA-M 2-methyl-1-(2-phenylethyl)pyridin-1-ium;bromide Chemical compound [Br-].CC1=CC=CC=[N+]1CCC1=CC=CC=C1 AYHBRSKXFVQPPX-UHFFFAOYSA-M 0.000 description 1
- KFTYFTKODBWKOU-UHFFFAOYSA-N 2-methylsulfonylethanol Chemical compound CS(=O)(=O)CCO KFTYFTKODBWKOU-UHFFFAOYSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- DLHITURSJUTRKN-UHFFFAOYSA-N 3-methyl-2-(prop-2-enoylamino)butanamide Chemical compound CC(C)C(C(N)=O)NC(=O)C=C DLHITURSJUTRKN-UHFFFAOYSA-N 0.000 description 1
- SHVCSCWHWMSGTE-UHFFFAOYSA-N 6-methyluracil Chemical compound CC1=CC(=O)NC(=O)N1 SHVCSCWHWMSGTE-UHFFFAOYSA-N 0.000 description 1
- LHCPRYRLDOSKHK-UHFFFAOYSA-N 7-deaza-8-aza-adenine Chemical compound NC1=NC=NC2=C1C=NN2 LHCPRYRLDOSKHK-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 101000654674 Homo sapiens Semaphorin-6A Proteins 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 102100032795 Semaphorin-6A Human genes 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- PCSMJKASWLYICJ-UHFFFAOYSA-N Succinic aldehyde Chemical compound O=CCCC=O PCSMJKASWLYICJ-UHFFFAOYSA-N 0.000 description 1
- GAMPNQJDUFQVQO-UHFFFAOYSA-N acetic acid;phthalic acid Chemical compound CC(O)=O.OC(=O)C1=CC=CC=C1C(O)=O GAMPNQJDUFQVQO-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000005250 alkyl acrylate group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 235000008206 alpha-amino acids Nutrition 0.000 description 1
- 150000001371 alpha-amino acids Chemical class 0.000 description 1
- 229920006318 anionic polymer Polymers 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- 238000012662 bulk polymerization Methods 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229920003090 carboxymethyl hydroxyethyl cellulose Polymers 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229910052681 coesite Inorganic materials 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 229910052906 cristobalite Inorganic materials 0.000 description 1
- 238000006210 cyclodehydration reaction Methods 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000007720 emulsion polymerization reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 238000010528 free radical solution polymerization reaction Methods 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229920000578 graft copolymer Polymers 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 238000005213 imbibition Methods 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000004372 methylthioethyl group Chemical group [H]C([H])([H])SC([H])([H])C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- WFKDPJRCBCBQNT-UHFFFAOYSA-N n,2-dimethylprop-2-enamide Chemical compound CNC(=O)C(C)=C WFKDPJRCBCBQNT-UHFFFAOYSA-N 0.000 description 1
- QRWZCJXEAOZAAW-UHFFFAOYSA-N n,n,2-trimethylprop-2-enamide Chemical compound CN(C)C(=O)C(C)=C QRWZCJXEAOZAAW-UHFFFAOYSA-N 0.000 description 1
- UUORTJUPDJJXST-UHFFFAOYSA-N n-(2-hydroxyethyl)prop-2-enamide Chemical compound OCCNC(=O)C=C UUORTJUPDJJXST-UHFFFAOYSA-N 0.000 description 1
- RWJGITGQDQSWJG-UHFFFAOYSA-N n-(3-methoxypropyl)prop-2-enamide Chemical compound COCCCNC(=O)C=C RWJGITGQDQSWJG-UHFFFAOYSA-N 0.000 description 1
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 1
- BYJPRUDFDZPCBH-UHFFFAOYSA-N n-[2-(2-hydroxyethoxy)ethyl]prop-2-enamide Chemical compound OCCOCCNC(=O)C=C BYJPRUDFDZPCBH-UHFFFAOYSA-N 0.000 description 1
- DCBBWYIVFRLKCD-UHFFFAOYSA-N n-[2-(dimethylamino)ethyl]-2-methylprop-2-enamide Chemical compound CN(C)CCNC(=O)C(C)=C DCBBWYIVFRLKCD-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- YPHQUSNPXDGUHL-UHFFFAOYSA-N n-methylprop-2-enamide Chemical compound CNC(=O)C=C YPHQUSNPXDGUHL-UHFFFAOYSA-N 0.000 description 1
- ALIFPGGMJDWMJH-UHFFFAOYSA-N n-phenyldiazenylaniline Chemical compound C=1C=CC=CC=1NN=NC1=CC=CC=C1 ALIFPGGMJDWMJH-UHFFFAOYSA-N 0.000 description 1
- QNILTEGFHQSKFF-UHFFFAOYSA-N n-propan-2-ylprop-2-enamide Chemical compound CC(C)NC(=O)C=C QNILTEGFHQSKFF-UHFFFAOYSA-N 0.000 description 1
- WDFKEEALECCKTJ-UHFFFAOYSA-N n-propylprop-2-enamide Chemical compound CCCNC(=O)C=C WDFKEEALECCKTJ-UHFFFAOYSA-N 0.000 description 1
- XFHJDMUEHUHAJW-UHFFFAOYSA-N n-tert-butylprop-2-enamide Chemical compound CC(C)(C)NC(=O)C=C XFHJDMUEHUHAJW-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920006267 polyester film Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 239000012966 redox initiator Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 125000000467 secondary amino group Chemical class [H]N([*:1])[*:2] 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 229910052682 stishovite Inorganic materials 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000010557 suspension polymerization reaction Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 229910052905 tridymite Inorganic materials 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000012463 white pigment Substances 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C8/00—Diffusion transfer processes or agents therefor; Photosensitive materials for such processes
- G03C8/42—Structural details
- G03C8/52—Bases or auxiliary layers; Substances therefor
- G03C8/54—Timing layers
Landscapes
- Engineering & Computer Science (AREA)
- Architecture (AREA)
- Structural Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Pyrrole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Materials For Photolithography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/130,527 US4288523A (en) | 1980-03-14 | 1980-03-14 | Diffusion control layers in diffusion transfer photographic products |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3109259A1 DE3109259A1 (de) | 1982-03-18 |
| DE3109259C2 true DE3109259C2 (enFirst) | 1992-05-27 |
Family
ID=22445102
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3153622A Expired - Fee Related DE3153622C2 (enFirst) | 1980-03-14 | 1981-03-11 | |
| DE19813109259 Granted DE3109259A1 (de) | 1980-03-14 | 1981-03-11 | Polymere fuer die diffusionssteuerung in diffusionsuebertragungs-filmeinheiten |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3153622A Expired - Fee Related DE3153622C2 (enFirst) | 1980-03-14 | 1981-03-11 |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4288523A (enFirst) |
| JP (1) | JPS56166212A (enFirst) |
| AU (1) | AU540804B2 (enFirst) |
| CA (1) | CA1148558A (enFirst) |
| DE (2) | DE3153622C2 (enFirst) |
| FR (1) | FR2478108B1 (enFirst) |
| GB (1) | GB2072166B (enFirst) |
| NL (1) | NL189003C (enFirst) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4391895A (en) * | 1981-01-02 | 1983-07-05 | Polaroid Corporation | Diffusion control layers for diffusion transfer photographic film |
| US4777276A (en) * | 1981-10-29 | 1988-10-11 | Minnesota Mining And Manufacturing Company | Acrylamidoacylated oligomers |
| DE3217020A1 (de) * | 1982-05-06 | 1983-11-10 | Agfa-Gevaert Ag, 5090 Leverkusen | Photographisches aufzeichnungsmaterial |
| US4451619A (en) * | 1982-09-30 | 1984-05-29 | Minnesota Mining And Manufacturing Company | Method of hydrophilizing or hydrophobizing polymers |
| US4522996A (en) * | 1982-12-29 | 1985-06-11 | Polaroid Corporation | β-eliminating polymers for diffusion control in photographic products |
| US4458001A (en) * | 1982-12-29 | 1984-07-03 | Polaroid Corporation | β-Eliminating polymers for diffusion control in photographic products |
| US4631327A (en) * | 1982-12-29 | 1986-12-23 | Polaroid Corporation | β-Elimination polymers useful for providing diffusion control layers in diffusion transfer photographic products |
| US4461824A (en) * | 1982-12-29 | 1984-07-24 | Polaroid Corporation | Diffusion control layers in diffusion transfer photographic products |
| US4547451A (en) * | 1983-05-09 | 1985-10-15 | Polaroid Corporation, Patent Dept. | Hydrolyzable diffusion control layers in photographic products |
| JPS606649A (ja) * | 1983-06-24 | 1985-01-14 | Daicel Chem Ind Ltd | モノマ− |
| US4504569A (en) * | 1983-08-26 | 1985-03-12 | Eastman Kodak Company | Photographic material with a temporary barrier layer comprising a chill-gelable polymer |
| ES8800696A1 (es) * | 1985-05-27 | 1987-11-16 | Nippon Paint Co Ltd | Un procedimiento para la preparacion de un polialquenoilisocianato. |
| US4873171A (en) * | 1988-05-02 | 1989-10-10 | Polaroid Corporation | Image-receiving element for diffusion transfer photographic product |
| US4981933A (en) * | 1989-06-23 | 1991-01-01 | Polaroid Corporation | Azlactone copolymers |
| US5175081A (en) * | 1990-08-31 | 1992-12-29 | Minnesota Mining And Manufacturing Company | Post-processsing stabilization of photothermographic emulsions |
| US5235015A (en) * | 1991-02-21 | 1993-08-10 | Minnesota Mining And Manufacturing Company | High speed aqueous solvent developable photopolymer compositions |
| US6846525B2 (en) * | 1993-03-19 | 2005-01-25 | Xerox Corporation | Recording sheets containing purine, pyrimidine, benzimidazole, imidazolidine, urazole, pyrazole, triazole, benzotriazole, tetrazole, and pyrazine compounds |
| US5576146A (en) * | 1995-01-17 | 1996-11-19 | Imation Corp. | Photosensitive polymer-containing systems with increased shelf-lives |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL218146A (enFirst) * | 1956-02-13 | 1900-01-01 | ||
| US3362819A (en) * | 1962-11-01 | 1968-01-09 | Polaroid Corp | Color diffusion transfer photographic products and processes utilizing an image receiving element containing a polymeric acid layer |
| US3384483A (en) * | 1964-03-23 | 1968-05-21 | Eastmean Kodak Company | Multicolor dye developer image transfer systems |
| BE679642A (enFirst) * | 1965-04-23 | 1966-10-18 | ||
| DE1745330A1 (de) | 1966-07-01 | 1971-08-26 | Roehm Gmbh | Verfahren zur Herstellung vernetzender UEberzugsmassen |
| US3488327A (en) * | 1967-06-30 | 1970-01-06 | Roehm & Haas Gmbh | Preparation of coating materials |
| US3415644A (en) * | 1967-03-10 | 1968-12-10 | Polaroid Corp | Novel photographic products and processes |
| US3421892A (en) * | 1967-05-26 | 1969-01-14 | Polaroid Corp | Novel photographic products and processes |
| US3772025A (en) * | 1967-10-16 | 1973-11-13 | Polaroid Corp | Diffusion transfer receiving sheets |
| CA943694A (en) * | 1968-03-01 | 1974-03-12 | Hyman L. Cohen | Polymers and photographic elements containing same |
| US3625685A (en) * | 1971-02-26 | 1971-12-07 | Polaroid Corp | Photographic color diffusion-transfer element comprising aqueous film-forming synthetic polymer suspension layers intermediate its sensitive layers and processes for their use |
| US3721565A (en) * | 1971-07-06 | 1973-03-20 | Polaroid Corp | Polymeric binders for photographic emulsions |
| BE793586A (fr) * | 1971-12-29 | 1973-06-29 | Eastman Kodak Co | Emulsion photographique aux halogenures d'argent contenant un liant polymere synthetique ameliore |
| JPS5246496B2 (enFirst) * | 1972-03-07 | 1977-11-25 | ||
| US3925083A (en) | 1973-01-02 | 1975-12-09 | Polaroid Corp | Synthetic silver halide emulsion binder |
| JPS5612859B2 (enFirst) * | 1973-08-30 | 1981-03-25 | ||
| JPS599897B2 (ja) * | 1975-06-23 | 1984-03-06 | 富士写真フイルム株式会社 | カラ−カクサンテンシヤシヤシンホウヨウザイリヨウ |
| US4120727A (en) * | 1975-12-08 | 1978-10-17 | Polaroid Corporation | Polymeric cyanoalkyl acrylate silver halide peptizer |
| US4157418A (en) * | 1978-02-08 | 1979-06-05 | Minnesota Mining And Manufacturing Company | Acrylic functional aminocarboxylic acids and derivatives as components of pressure sensitive adhesives |
| JPS5933897B2 (ja) * | 1978-04-03 | 1984-08-18 | 富士写真フイルム株式会社 | 写真要素 |
| US4172939A (en) * | 1978-08-29 | 1979-10-30 | E. I. Du Pont De Nemours And Company | Vulcanizable ethylene/vinyl acetate/carbon monoxide terpolymers |
| US4201587A (en) * | 1978-09-15 | 1980-05-06 | Polaroid Corporation | Graft copolymers as diffusion control layers in photographic diffusion transfer products |
-
1980
- 1980-03-14 US US06/130,527 patent/US4288523A/en not_active Expired - Lifetime
-
1981
- 1981-02-20 GB GB8105438A patent/GB2072166B/en not_active Expired
- 1981-03-06 AU AU68134/81A patent/AU540804B2/en not_active Ceased
- 1981-03-11 DE DE3153622A patent/DE3153622C2/de not_active Expired - Fee Related
- 1981-03-11 DE DE19813109259 patent/DE3109259A1/de active Granted
- 1981-03-13 FR FR8105109A patent/FR2478108B1/fr not_active Expired
- 1981-03-13 JP JP3640881A patent/JPS56166212A/ja active Granted
- 1981-03-13 CA CA000373010A patent/CA1148558A/en not_active Expired
- 1981-03-13 NL NLAANVRAGE8101242,A patent/NL189003C/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NL189003B (nl) | 1992-07-01 |
| FR2478108B1 (fr) | 1986-03-21 |
| FR2478108A1 (fr) | 1981-09-18 |
| DE3109259A1 (de) | 1982-03-18 |
| AU540804B2 (en) | 1984-12-06 |
| US4288523A (en) | 1981-09-08 |
| NL8101242A (nl) | 1981-10-01 |
| AU6813481A (en) | 1981-09-17 |
| CA1148558A (en) | 1983-06-21 |
| GB2072166B (en) | 1984-06-20 |
| DE3153622C2 (enFirst) | 1992-02-06 |
| NL189003C (nl) | 1992-12-01 |
| JPS56166212A (en) | 1981-12-21 |
| GB2072166A (en) | 1981-09-30 |
| JPH0261022B2 (enFirst) | 1990-12-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3109259C2 (enFirst) | ||
| DE2816226A1 (de) | Photographisches silberhalogenidmaterial mit dem gehalt eines ultraviolettlicht absorbierenden mittels sowie verfahren zur verringerung des effektes von ultraviolettlicht auf das photographische silberhalogenidmaterial | |
| DE2319723C2 (de) | Photographisches Aufzeichnungsmaterial für das Farbdiffusionsübertragungsverfahren | |
| DE3116044C2 (de) | Photographisches Aufzeichnungsmaterial nach dem Diffusionsübertragungsverfahren | |
| DE2817607C2 (enFirst) | ||
| DE2725591A1 (de) | Polymere farbkuppler zur verwendung in farbphotographischen silberhalogenidmaterialien | |
| DE3719880A1 (de) | Farbfotografisches waermeentwicklungsverfahren | |
| DE2738903A1 (de) | Photographisches element | |
| DE69508652T2 (de) | Photographische Verarbeitungszusammensetzungen mit einem hydrophob-modifizierten Verdickungsmittel | |
| DE2754514A1 (de) | Photographische elemente fuer das farbdiffusionsuebertragungsverfahren | |
| DE2915870C2 (enFirst) | ||
| DE2729820A1 (de) | Photographisches farbdiffusionsuebertragungsmaterial | |
| EP0226953B1 (de) | Farbfotografisches Aufzeichnungsmaterial | |
| DE1797198C3 (de) | Bildempfangsmaterial sowie photo graphisches Aufzeichnungsmaterial fur das Farbstoffdiffuisionsubertragungsver fahren | |
| DE2652464A1 (de) | Fotografische filmeinheit zur herstellung farbiger uebertragsbilder | |
| DE3139156C2 (enFirst) | ||
| DE2729819C3 (de) | Photographisches Aufzeichnungsmaterial für das Diffusionsübertragungsverfahren | |
| DE3025080A1 (de) | Photographisches aufzeichnungsmaterial fuer das farbdiffusionsuebertragungsverfahren | |
| DE3207000A1 (de) | Photographisches aufzeichnungsmaterial | |
| DE69601925T2 (de) | Bildempfangselement für photographische und photothermographische diffusionsübertragungsprodukte | |
| DE2816525A1 (de) | Photographisches element | |
| DE3014672C2 (enFirst) | ||
| US4546159A (en) | Eliminating polymers useful in diffusion control layers | |
| DE2058263C3 (de) | Lichtempfindliches fotografisches Aufzeichnungsmaterial | |
| DE2716505A1 (de) | Photographisches aufzeichnungsmaterial |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8172 | Supplementary division/partition in: |
Ref country code: DE Ref document number: 3153622 Format of ref document f/p: P |
|
| Q171 | Divided out to: |
Ref country code: DE Ref document number: 3153622 |
|
| AH | Division in |
Ref country code: DE Ref document number: 3153622 Format of ref document f/p: P |
|
| AH | Division in |
Ref country code: DE Ref document number: 3153622 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |