DE3105778A1 - Verfahren zur herstellung von trimethinfarbstoffen - Google Patents
Verfahren zur herstellung von trimethinfarbstoffenInfo
- Publication number
- DE3105778A1 DE3105778A1 DE19813105778 DE3105778A DE3105778A1 DE 3105778 A1 DE3105778 A1 DE 3105778A1 DE 19813105778 DE19813105778 DE 19813105778 DE 3105778 A DE3105778 A DE 3105778A DE 3105778 A1 DE3105778 A1 DE 3105778A1
- Authority
- DE
- Germany
- Prior art keywords
- methylene
- indole
- dihydro
- trimethyl
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000975 dye Substances 0.000 title claims description 28
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 47
- -1 benzyloxy, phenoxy Chemical group 0.000 claims description 24
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 19
- 239000000203 mixture Substances 0.000 claims description 15
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 13
- 238000009833 condensation Methods 0.000 claims description 10
- 230000005494 condensation Effects 0.000 claims description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 8
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 7
- 235000019253 formic acid Nutrition 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 150000001447 alkali salts Chemical class 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000005521 carbonamide group Chemical group 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 229940124530 sulfonamide Drugs 0.000 claims description 2
- 150000003456 sulfonamides Chemical class 0.000 claims description 2
- 125000003387 indolinyl group Chemical class N1(CCC2=CC=CC=C12)* 0.000 claims 2
- KJNSHVJSFPXZRZ-UHFFFAOYSA-N acetylcarbamic acid Chemical compound CC(=O)NC(O)=O KJNSHVJSFPXZRZ-UHFFFAOYSA-N 0.000 claims 1
- 125000005907 alkyl ester group Chemical group 0.000 claims 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims 1
- 238000002360 preparation method Methods 0.000 claims 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- 235000002639 sodium chloride Nutrition 0.000 description 10
- 239000004280 Sodium formate Substances 0.000 description 9
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 9
- 235000019254 sodium formate Nutrition 0.000 description 9
- 229960000583 acetic acid Drugs 0.000 description 8
- 239000011780 sodium chloride Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 239000012362 glacial acetic acid Substances 0.000 description 6
- ZTUKGBOUHWYFGC-UHFFFAOYSA-N 1,3,3-trimethyl-2-methylideneindole Chemical compound C1=CC=C2N(C)C(=C)C(C)(C)C2=C1 ZTUKGBOUHWYFGC-UHFFFAOYSA-N 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 150000002476 indolines Chemical class 0.000 description 3
- 229920002239 polyacrylonitrile Polymers 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- BGXWEEHVMWADRH-UHFFFAOYSA-N 5-methoxy-1,3,3-trimethyl-2-methylideneindole Chemical compound COC1=CC=C2N(C)C(=C)C(C)(C)C2=C1 BGXWEEHVMWADRH-UHFFFAOYSA-N 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- YADSGOSSYOOKMP-UHFFFAOYSA-N dioxolead Chemical compound O=[Pb]=O YADSGOSSYOOKMP-UHFFFAOYSA-N 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- CVHDZBBLDJRKOS-UHFFFAOYSA-N methyl 1,3,3-trimethyl-2-methylideneindole-5-carboxylate Chemical compound COC(=O)C1=CC=C2N(C)C(=C)C(C)(C)C2=C1 CVHDZBBLDJRKOS-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 1
- UGNHNSABUPPNQM-UHFFFAOYSA-N 1,3,3,4,5,7-hexamethyl-2-methylideneindole Chemical compound CC1=CC(C)=C(C)C2=C1N(C)C(=C)C2(C)C UGNHNSABUPPNQM-UHFFFAOYSA-N 0.000 description 1
- QXIIGEKIDDEAGK-UHFFFAOYSA-N 1,3,3,4,6,7-hexamethyl-2-methylideneindole Chemical compound CC1=C(C)C=C(C)C2=C1N(C)C(=C)C2(C)C QXIIGEKIDDEAGK-UHFFFAOYSA-N 0.000 description 1
- GWWPFKGZQQOHKB-UHFFFAOYSA-N 1,3,3,5-tetramethyl-2-methylidene-4-phenylmethoxyindole Chemical compound CN1C(=C)C(C)(C)C2=C1C=CC(C)=C2OCC1=CC=CC=C1 GWWPFKGZQQOHKB-UHFFFAOYSA-N 0.000 description 1
- RTSITCUERRCAIP-UHFFFAOYSA-N 1,3,3,5-tetramethyl-2-methylidene-6-phenylmethoxyindole Chemical compound C1=C2N(C)C(=C)C(C)(C)C2=CC(C)=C1OCC1=CC=CC=C1 RTSITCUERRCAIP-UHFFFAOYSA-N 0.000 description 1
- YYLKYJXVNOCHAW-UHFFFAOYSA-N 1,3,3,5-tetramethyl-2-methylideneindole Chemical compound CC1=CC=C2N(C)C(=C)C(C)(C)C2=C1 YYLKYJXVNOCHAW-UHFFFAOYSA-N 0.000 description 1
- QYKYAJNYIKHLKL-UHFFFAOYSA-N 1,3,3,7-tetramethyl-2-methylideneindole Chemical compound C1=CC(C)=C2N(C)C(=C)C(C)(C)C2=C1 QYKYAJNYIKHLKL-UHFFFAOYSA-N 0.000 description 1
- WFUGRIPBSMZWPZ-UHFFFAOYSA-N 1,3,3-trimethyl-2-methylidene-4-phenylmethoxyindole Chemical compound CN1C(=C)C(C)(C)C2=C1C=CC=C2OCC1=CC=CC=C1 WFUGRIPBSMZWPZ-UHFFFAOYSA-N 0.000 description 1
- NFUUCYKMCJAMSA-UHFFFAOYSA-N 1,3,3-trimethyl-2-methylidene-5-(4-methylphenoxy)indole Chemical compound C=1C=C2N(C)C(=C)C(C)(C)C2=CC=1OC1=CC=C(C)C=C1 NFUUCYKMCJAMSA-UHFFFAOYSA-N 0.000 description 1
- PNNXTZJILDAJAQ-UHFFFAOYSA-N 1,3,3-trimethyl-2-methylidene-5-(trifluoromethyl)indole Chemical compound FC(F)(F)C1=CC=C2N(C)C(=C)C(C)(C)C2=C1 PNNXTZJILDAJAQ-UHFFFAOYSA-N 0.000 description 1
- YODFDYLQTNPQIW-UHFFFAOYSA-N 1,3,3-trimethyl-2-methylidene-5-[(4-methylphenyl)methoxy]indole Chemical compound C=1C=C2N(C)C(=C)C(C)(C)C2=CC=1OCC1=CC=C(C)C=C1 YODFDYLQTNPQIW-UHFFFAOYSA-N 0.000 description 1
- LDBCIMDXLNDQPJ-UHFFFAOYSA-N 1,3,3-trimethyl-2-methylidene-5-methylsulfonylindole Chemical compound CS(=O)(=O)C1=CC=C2N(C)C(=C)C(C)(C)C2=C1 LDBCIMDXLNDQPJ-UHFFFAOYSA-N 0.000 description 1
- JVLMSZABUAXYSR-UHFFFAOYSA-N 1,3,3-trimethyl-2-methylidene-5-phenylmethoxyindole Chemical compound C=1C=C2N(C)C(=C)C(C)(C)C2=CC=1OCC1=CC=CC=C1 JVLMSZABUAXYSR-UHFFFAOYSA-N 0.000 description 1
- YXMDBGGLHHGNJJ-UHFFFAOYSA-N 1,3,3-trimethyl-2-methylidene-6-phenylmethoxyindole Chemical compound C1=C2N(C)C(=C)C(C)(C)C2=CC=C1OCC1=CC=CC=C1 YXMDBGGLHHGNJJ-UHFFFAOYSA-N 0.000 description 1
- LRBNGGRKZWMAIY-UHFFFAOYSA-N 1,3,3-trimethyl-2-methylidene-7-(3-methylphenoxy)indole Chemical compound C=12N(C)C(=C)C(C)(C)C2=CC=CC=1OC1=CC=CC(C)=C1 LRBNGGRKZWMAIY-UHFFFAOYSA-N 0.000 description 1
- VHJGRXJISPYXDQ-UHFFFAOYSA-N 1,3,3-trimethyl-2-methylidene-7-[(4-methylphenyl)methoxy]indole Chemical compound C=12N(C)C(=C)C(C)(C)C2=CC=CC=1OCC1=CC=C(C)C=C1 VHJGRXJISPYXDQ-UHFFFAOYSA-N 0.000 description 1
- ZKIIVRMKCWDZBV-UHFFFAOYSA-N 1,3,3-trimethyl-2-methylidene-7-phenoxyindole Chemical compound C=12N(C)C(=C)C(C)(C)C2=CC=CC=1OC1=CC=CC=C1 ZKIIVRMKCWDZBV-UHFFFAOYSA-N 0.000 description 1
- LVHCQVZBRXGEAY-UHFFFAOYSA-N 1,3,3-trimethyl-2-methylidene-7-phenylmethoxyindole Chemical compound C=12N(C)C(=C)C(C)(C)C2=CC=CC=1OCC1=CC=CC=C1 LVHCQVZBRXGEAY-UHFFFAOYSA-N 0.000 description 1
- WCCZCMXUUXNPNI-UHFFFAOYSA-N 1,3,3-trimethyl-2-methylideneindole-5-carbonitrile Chemical compound N#CC1=CC=C2N(C)C(=C)C(C)(C)C2=C1 WCCZCMXUUXNPNI-UHFFFAOYSA-N 0.000 description 1
- DAKVLNNTRFHLBZ-UHFFFAOYSA-N 1-ethyl-3,3,5-trimethyl-2-methylideneindole Chemical compound CC1=CC=C2N(CC)C(=C)C(C)(C)C2=C1 DAKVLNNTRFHLBZ-UHFFFAOYSA-N 0.000 description 1
- WHJDBUBDXQZUHW-UHFFFAOYSA-N 1-ethyl-3,3-dimethyl-2-methylidene-5-phenylmethoxyindole Chemical compound C=1C=C2N(CC)C(=C)C(C)(C)C2=CC=1OCC1=CC=CC=C1 WHJDBUBDXQZUHW-UHFFFAOYSA-N 0.000 description 1
- MWYTVFRHPLPLKF-UHFFFAOYSA-N 1-ethyl-3,3-dimethyl-2-methylideneindole Chemical compound C1=CC=C2N(CC)C(=C)C(C)(C)C2=C1 MWYTVFRHPLPLKF-UHFFFAOYSA-N 0.000 description 1
- GPIUUHHSYVVTOT-UHFFFAOYSA-N 1-ethyl-5-methoxy-3,3-dimethyl-2-methylideneindole Chemical compound COC1=CC=C2N(CC)C(=C)C(C)(C)C2=C1 GPIUUHHSYVVTOT-UHFFFAOYSA-N 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- GPLIMIJPIZGPIF-UHFFFAOYSA-N 2-hydroxy-1,4-benzoquinone Chemical compound OC1=CC(=O)C=CC1=O GPLIMIJPIZGPIF-UHFFFAOYSA-N 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- JNRLEMMIVRBKJE-UHFFFAOYSA-N 4,4'-Methylenebis(N,N-dimethylaniline) Chemical compound C1=CC(N(C)C)=CC=C1CC1=CC=C(N(C)C)C=C1 JNRLEMMIVRBKJE-UHFFFAOYSA-N 0.000 description 1
- NVEYQIARTWKCSO-UHFFFAOYSA-N 4-chloro-7-methoxy-1,3,3-trimethyl-2-methylideneindole Chemical compound COC1=CC=C(Cl)C2=C1N(C)C(=C)C2(C)C NVEYQIARTWKCSO-UHFFFAOYSA-N 0.000 description 1
- DKBVUUICZUINKG-UHFFFAOYSA-N 4-methoxy-1,3,3-trimethyl-2-methylidene-5-phenylmethoxyindole Chemical compound COC1=C(C(C(=C)N2C)(C)C)C2=CC=C1OCC1=CC=CC=C1 DKBVUUICZUINKG-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- RCPZTVOXKDKDHC-UHFFFAOYSA-N 5-(3-methoxyphenoxy)-1,3,3-trimethyl-2-methylideneindole Chemical compound COC1=CC=CC(OC=2C=C3C(C)(C)C(=C)N(C)C3=CC=2)=C1 RCPZTVOXKDKDHC-UHFFFAOYSA-N 0.000 description 1
- XTVRCGGLOLJVPJ-UHFFFAOYSA-N 5-(4-methoxyphenoxy)-1,3,3-trimethyl-2-methylideneindole Chemical compound C1=CC(OC)=CC=C1OC1=CC=C(N(C)C(=C)C2(C)C)C2=C1 XTVRCGGLOLJVPJ-UHFFFAOYSA-N 0.000 description 1
- PYHOOYYQXCVOKC-UHFFFAOYSA-N 5-(benzenesulfonyl)-1,3,3-trimethyl-2-methylideneindole Chemical compound C=1C=C2N(C)C(=C)C(C)(C)C2=CC=1S(=O)(=O)C1=CC=CC=C1 PYHOOYYQXCVOKC-UHFFFAOYSA-N 0.000 description 1
- VDMXGJJMPKAYQP-UHFFFAOYSA-N 5-chloro-1,3,3-trimethyl-2-methylideneindole Chemical compound ClC1=CC=C2N(C)C(=C)C(C)(C)C2=C1 VDMXGJJMPKAYQP-UHFFFAOYSA-N 0.000 description 1
- MBUSVAPELROCNL-UHFFFAOYSA-N 5-chloro-1-ethyl-3,3-dimethyl-2-methylideneindole Chemical compound ClC1=CC=C2N(CC)C(=C)C(C)(C)C2=C1 MBUSVAPELROCNL-UHFFFAOYSA-N 0.000 description 1
- YPUBATNFOOXMGJ-UHFFFAOYSA-N 5-chloro-4,7-dimethoxy-1,3,3-trimethyl-2-methylideneindole Chemical compound COC1=CC(Cl)=C(OC)C2=C1N(C)C(=C)C2(C)C YPUBATNFOOXMGJ-UHFFFAOYSA-N 0.000 description 1
- QLCIZXUNCWTFPJ-UHFFFAOYSA-N 5-chloro-7-methoxy-1,3,3-trimethyl-2-methylideneindole Chemical compound COC1=CC(Cl)=CC2=C1N(C)C(=C)C2(C)C QLCIZXUNCWTFPJ-UHFFFAOYSA-N 0.000 description 1
- LTXILFIYGZDZDR-UHFFFAOYSA-N 5-ethoxy-1,3,3-trimethyl-2-methylideneindole Chemical compound CCOC1=CC=C2N(C)C(=C)C(C)(C)C2=C1 LTXILFIYGZDZDR-UHFFFAOYSA-N 0.000 description 1
- BEBDLIAJHTXGPI-UHFFFAOYSA-N 5-fluoro-1,3,3-trimethyl-2-methylideneindole Chemical compound FC1=CC=C2N(C)C(=C)C(C)(C)C2=C1 BEBDLIAJHTXGPI-UHFFFAOYSA-N 0.000 description 1
- BSJHLFOYBXLMLB-UHFFFAOYSA-N 7-(4-methoxyphenoxy)-1,3,3-trimethyl-2-methylideneindole Chemical compound C1=CC(OC)=CC=C1OC1=CC=CC2=C1N(C)C(=C)C2(C)C BSJHLFOYBXLMLB-UHFFFAOYSA-N 0.000 description 1
- BVIIVCKOFONQNP-UHFFFAOYSA-N 7-[(2-chlorophenyl)methoxy]-1,3,3-trimethyl-2-methylideneindole Chemical compound C=12N(C)C(=C)C(C)(C)C2=CC=CC=1OCC1=CC=CC=C1Cl BVIIVCKOFONQNP-UHFFFAOYSA-N 0.000 description 1
- XEYQFIVOTRMCRR-UHFFFAOYSA-N 7-[(4-chlorophenyl)methoxy]-1,3,3-trimethyl-2-methylideneindole Chemical compound C=12N(C)C(=C)C(C)(C)C2=CC=CC=1OCC1=CC=C(Cl)C=C1 XEYQFIVOTRMCRR-UHFFFAOYSA-N 0.000 description 1
- YEVPIZQNLAZHNP-UHFFFAOYSA-N 7-benzyl-1,3,3-trimethyl-2-methylideneindole Chemical compound C=12N(C)C(=C)C(C)(C)C2=CC=CC=1CC1=CC=CC=C1 YEVPIZQNLAZHNP-UHFFFAOYSA-N 0.000 description 1
- ZSGZWZBIELQTKZ-UHFFFAOYSA-N 7-chloro-1,3,3-trimethyl-2-methylideneindole Chemical compound C1=CC(Cl)=C2N(C)C(=C)C(C)(C)C2=C1 ZSGZWZBIELQTKZ-UHFFFAOYSA-N 0.000 description 1
- DPDQDPMYBJDSSK-UHFFFAOYSA-N 7-ethoxy-1,3,3-trimethyl-2-methylideneindole Chemical compound CCOC1=CC=CC2=C1N(C)C(=C)C2(C)C DPDQDPMYBJDSSK-UHFFFAOYSA-N 0.000 description 1
- PKMPVTRGPHOQAN-UHFFFAOYSA-N 7-ethyl-1,3,3-trimethyl-2-methylideneindole Chemical compound CCC1=CC=CC2=C1N(C)C(=C)C2(C)C PKMPVTRGPHOQAN-UHFFFAOYSA-N 0.000 description 1
- WZHBOQBUFKRGLF-UHFFFAOYSA-N 7-methoxy-1,3,3-trimethyl-2-methylideneindole Chemical compound COC1=CC=CC2=C1N(C)C(=C)C2(C)C WZHBOQBUFKRGLF-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 229930192627 Naphthoquinone Natural products 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000003570 air Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical group 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- QOXBJAPPZUAUIO-UHFFFAOYSA-N dimethyl 1,3,3-trimethyl-2-methylideneindole-4,6-dicarboxylate Chemical compound COC(=O)C1=CC(C(=O)OC)=CC2=C1C(C)(C)C(=C)N2C QOXBJAPPZUAUIO-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- XQESPCFYFLNJFF-UHFFFAOYSA-N ethyl 1,3,3-trimethyl-2-methylideneindole-5-carboxylate Chemical compound CCOC(=O)C1=CC=C2N(C)C(=C)C(C)(C)C2=C1 XQESPCFYFLNJFF-UHFFFAOYSA-N 0.000 description 1
- XECLMCNOVVMITK-UHFFFAOYSA-N ethyl 1-ethyl-3,3-dimethyl-2-methylideneindole-5-carboxylate Chemical compound CCOC(=O)C1=CC=C2N(CC)C(=C)C(C)(C)C2=C1 XECLMCNOVVMITK-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000265 homogenisation Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- LPAGFVYQRIESJQ-UHFFFAOYSA-N indoline Chemical compound C1=CC=C2NCCC2=C1 LPAGFVYQRIESJQ-UHFFFAOYSA-N 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- KPJPHPFMCOKUMW-UHFFFAOYSA-N iodomethane Chemical compound I[CH2] KPJPHPFMCOKUMW-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000002791 naphthoquinones Chemical class 0.000 description 1
- NLRKCXQQSUWLCH-UHFFFAOYSA-N nitrosobenzene Chemical compound O=NC1=CC=CC=C1 NLRKCXQQSUWLCH-UHFFFAOYSA-N 0.000 description 1
- 229940055577 oleyl alcohol Drugs 0.000 description 1
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical group 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- WFIZEGIEIOHZCP-UHFFFAOYSA-M potassium formate Chemical class [K+].[O-]C=O WFIZEGIEIOHZCP-UHFFFAOYSA-M 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000004053 quinones Chemical class 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- CQLFBEKRDQMJLZ-UHFFFAOYSA-M silver acetate Chemical compound [Ag+].CC([O-])=O CQLFBEKRDQMJLZ-UHFFFAOYSA-M 0.000 description 1
- 229940071536 silver acetate Drugs 0.000 description 1
- 229910001923 silver oxide Inorganic materials 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B23/00—Methine or polymethine dyes, e.g. cyanine dyes
- C09B23/02—Methine or polymethine dyes, e.g. cyanine dyes the polymethine chain containing an odd number of >CH- or >C[alkyl]- groups
- C09B23/06—Methine or polymethine dyes, e.g. cyanine dyes the polymethine chain containing an odd number of >CH- or >C[alkyl]- groups three >CH- groups, e.g. carbocyanines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Indole Compounds (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19813105778 DE3105778A1 (de) | 1981-02-17 | 1981-02-17 | Verfahren zur herstellung von trimethinfarbstoffen |
| US06/344,262 US4419511A (en) | 1981-02-17 | 1982-01-28 | Process for the preparation of trimethine dyestuffs |
| EP82100892A EP0058863B1 (de) | 1981-02-17 | 1982-02-08 | Verfahren zur Herstellung von Trimethinfarbstoffen |
| DE8282100892T DE3261984D1 (en) | 1981-02-17 | 1982-02-08 | Process for the preparation of trimethine dyestuffs |
| JP57021343A JPS57153051A (en) | 1981-02-17 | 1982-02-15 | Manufacture of trimethine dye |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19813105778 DE3105778A1 (de) | 1981-02-17 | 1981-02-17 | Verfahren zur herstellung von trimethinfarbstoffen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3105778A1 true DE3105778A1 (de) | 1982-09-02 |
Family
ID=6125079
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19813105778 Withdrawn DE3105778A1 (de) | 1981-02-17 | 1981-02-17 | Verfahren zur herstellung von trimethinfarbstoffen |
| DE8282100892T Expired DE3261984D1 (en) | 1981-02-17 | 1982-02-08 | Process for the preparation of trimethine dyestuffs |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8282100892T Expired DE3261984D1 (en) | 1981-02-17 | 1982-02-08 | Process for the preparation of trimethine dyestuffs |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4419511A (enExample) |
| EP (1) | EP0058863B1 (enExample) |
| JP (1) | JPS57153051A (enExample) |
| DE (2) | DE3105778A1 (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP3038339B2 (ja) * | 1988-05-02 | 2000-05-08 | ザイナクシス・テクノロジーズ・インコーポレーテッド | バイオ粒子の表面膜に対してバイオアフェクティング物質を結合する化合物 |
| US5229522A (en) * | 1989-03-08 | 1993-07-20 | Appleton Papers Inc. | Bis-(indolyl)ethylenes: process for their preparation |
| US4981977A (en) * | 1989-06-09 | 1991-01-01 | Carnegie-Mellon University | Intermediate for and fluorescent cyanine dyes containing carboxylic acid groups |
| US5120858A (en) * | 1991-03-25 | 1992-06-09 | Miles Inc. | Process for the preparation of trimethine dyestuffs |
| CN101012207B (zh) * | 2007-01-04 | 2010-09-15 | 山东师范大学 | 检测超氧阴离子自由基的荧光探针及合成方法和用途 |
| US9754084B2 (en) | 2012-10-02 | 2017-09-05 | Covestro Deutschland Ag | Method for selecting photoinitiator systems |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE415534C (de) * | 1924-03-11 | 1925-06-22 | Farbenfab Vorm Bayer F & Co | Verfahren zur Darstellung von Polymethinfarbstoffen |
| DE511078C (de) * | 1929-07-06 | 1930-10-25 | Knorr Bremse Akt Ges | Bremsventil fuer Druckluft- oder Saugluftbremsen, insbesondere fuer Kraftfahrzeuge |
| FR669272A (fr) * | 1929-02-13 | 1929-11-14 | Production de colorants polyméthiniques | |
| BE403179A (enExample) * | 1933-05-16 | |||
| FR1520821A (fr) * | 1966-03-11 | 1968-04-12 | Eastman Kodak Co | Nouvelles émulsions photographiques contenant un colorant du type carbocyanine |
| JPS5534420A (en) * | 1978-09-01 | 1980-03-11 | Hitachi Ltd | Device for supporting lead wire of transformer |
-
1981
- 1981-02-17 DE DE19813105778 patent/DE3105778A1/de not_active Withdrawn
-
1982
- 1982-01-28 US US06/344,262 patent/US4419511A/en not_active Expired - Lifetime
- 1982-02-08 EP EP82100892A patent/EP0058863B1/de not_active Expired
- 1982-02-08 DE DE8282100892T patent/DE3261984D1/de not_active Expired
- 1982-02-15 JP JP57021343A patent/JPS57153051A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| EP0058863B1 (de) | 1985-01-23 |
| JPS57153051A (en) | 1982-09-21 |
| DE3261984D1 (en) | 1985-03-07 |
| EP0058863A1 (de) | 1982-09-01 |
| JPH0225943B2 (enExample) | 1990-06-06 |
| US4419511A (en) | 1983-12-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0252406B1 (de) | Verfahren zur Herstellung polycyclischer Verbindungen | |
| DE1098125B (de) | Verfahren zur Herstellung von fluoreszierenden Verbindungen | |
| DE3105778A1 (de) | Verfahren zur herstellung von trimethinfarbstoffen | |
| DE3213966A1 (de) | Verfahren zur herstellung von kationischen methinfarbstoffen | |
| EP0021304B1 (de) | Cumarinverbindungen sowie deren Herstellung und Verwendung als Farbstoffe | |
| DE2912428A1 (de) | Neue dispersionsfarbstoffe, deren herstellung und verwendung | |
| EP0074569B1 (de) | Kationische Methinfarbstoffe, Verfahren zu ihrer Herstellung sowie deren Verwendung zum Färben von Textilmaterialien und anderen Substraten | |
| DE1695122C3 (de) | Verfahren zur Herstellung von v-Triazolyl-cumarinen | |
| DE2627867A1 (de) | Verfahren zur herstellung von 2-hydroxybenzanthron und derivaten desselben sowie 2-hydroxybenzanthronderivate | |
| DE1225325B (de) | Verfahren zur Herstellung von Farbstoffen | |
| DE2037854A1 (de) | Aufhellungsmittel | |
| DE2247971C3 (de) | Verfahren zur Herstellung von 3'-Hydroxychinophthalonen | |
| DE2064683A1 (de) | 2 5 Bis(2 benzazolyl)hydrochinon verbindungen | |
| DE2040189A1 (de) | Aufhellungsmittel | |
| DE1291316B (de) | Verfahren zur optischen Aufhellung von organischem Fasermaterial | |
| DE883178C (de) | Verfahren zur Herstellung von Anthrachinonkuepenfarbstoffen | |
| DE3210596A1 (de) | Verfahren zur herstellung von kationischen methinfarbstoffen | |
| DE585186C (de) | Verfahren zur Herstellung von Farbstoffen der Polymethinreihe | |
| DE906482C (de) | Verfahren zur Herstellung von Farbstoffen der Anthrapyridonreihe | |
| DE576131C (de) | Verfahren zur Darstellung von Kuepenfarbstoffen der 1,2-Benzanthrachinonreihe | |
| DE893792C (de) | Verfahren zur Herstellung von optischen Bleichmitteln der Bisazolreihe | |
| GB447862A (en) | Manufacture of coloured products | |
| DE2047431A1 (en) | Basic methine dyes - for use on anionic-modified fibres, giving brilliant fluorescent yellow shades | |
| DE2244371C3 (de) | Quaternäres e-Diäthylamino-2 eckige Klammer auf 1,3-dimethylbenzbnldazoUnium (2) eckige Klammer zu -benzofuran -salz | |
| DE626366C (de) | Verfahren zur Herstellung von Zwischenprodukten und Kuepenfarbstoffen der Anthrachinonreihe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |