DE295492A - - Google Patents
Info
- Publication number
- DE295492A DE295492A DE295492A DE 295492 A DE295492 A DE 295492A DE 295492 A DE295492 A DE 295492A
- Authority
- DE
- Germany
- Prior art keywords
- acids
- barbituric
- derivatives
- acid
- parts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000002253 acid Substances 0.000 claims description 11
- 150000007656 barbituric acids Chemical class 0.000 claims description 10
- 150000002148 esters Chemical class 0.000 claims description 8
- -1 monosubstituted barbituric acids Chemical class 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 7
- 150000007513 acids Chemical class 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 claims description 4
- 230000029936 alkylation Effects 0.000 claims description 3
- 238000005804 alkylation reaction Methods 0.000 claims description 3
- 150000001805 chlorine compounds Chemical class 0.000 claims description 2
- 150000002691 malonic acids Chemical class 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 239000000543 intermediate Substances 0.000 claims 2
- 150000001721 carbon Chemical class 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- NDEMNVPZDAFUKN-UHFFFAOYSA-N guanidine;nitric acid Chemical compound NC(N)=N.O[N+]([O-])=O.O[N+]([O-])=O NDEMNVPZDAFUKN-UHFFFAOYSA-N 0.000 description 4
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- JVEQWIQHHWNMQX-UHFFFAOYSA-N 1-bromo-2-ethoxybenzene Chemical compound CCOC1=CC=CC=C1Br JVEQWIQHHWNMQX-UHFFFAOYSA-N 0.000 description 1
- BTYNVOQLMBUUMS-UHFFFAOYSA-N 2-amino-1h-pyrimidine-4,6-dione Chemical compound NC1=NC(=O)CC(=O)N1 BTYNVOQLMBUUMS-UHFFFAOYSA-N 0.000 description 1
- FMTLDVACNZDTQL-UHFFFAOYSA-N 5-ethyl-1,3-diazinane-2,4,6-trione Chemical compound CCC1C(=O)NC(=O)NC1=O FMTLDVACNZDTQL-UHFFFAOYSA-N 0.000 description 1
- JSVFGUVEXOEQEC-UHFFFAOYSA-N 5-imino-1,3-diazinane-2,4,6-trione Chemical class N=C1C(=O)NC(=O)NC1=O JSVFGUVEXOEQEC-UHFFFAOYSA-N 0.000 description 1
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical compound NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 231100000956 nontoxicity Toxicity 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1493579B1 (de) | Verfahren zur Herstellung neuer pharmazeutisch wertvoller Verbindungen | |
| DE2619724C2 (de) | 2-(Phenylimino)-thiazoline | |
| DE1963193A1 (de) | N-substituierte 2-Arylimino-oxazolidine,Verfahren zu ihrer Herstellung und ihre Verwendung als Ektoparasiticide | |
| DE295492A (enExample) | ||
| DE1212984B (de) | Verfahren zur Herstellung von basisch substituierten Cumaronen | |
| DE2627935A1 (de) | 2-aminotetramethylenthiophen-derivate | |
| DE2717437A1 (de) | Substituierte n-phenylformamidoxime und verfahren zu ihrer herstellung | |
| DE1158083B (de) | Verfahren zur Herstellung basisch substituierter Phenylacetonitrile | |
| DE1768787C3 (de) | (o-Carboxy-phenyl)-acetamidine, Verfahren zu deren Herstellung und (o-CarboxyphenyO-acetamidine enthaltende Präparate | |
| DE945235C (de) | Verfahren zur Herstellung von Hydrazodicarbonamid | |
| DE681125C (de) | Verfahren zur Herstellung von kapillaraktiven Verbindungen aus Eiweissspaltprodukten | |
| AT165069B (de) | Verfahren zur Herstellung neuer Phenoxyacetamidine | |
| AT167100B (de) | Verfahren zur Herstellung von in Stellung 2 substituierten Imidazolinen | |
| CH437354A (de) | Verfahren zur Herstellung von 1-(Acylphenyl)-2-amino-1,3-propandiolen | |
| DE442655C (de) | Verfahren zur Herstellung von Cyclohexenylalkylbarbitursaeuren | |
| DE431166C (de) | Verfahren zur Darstellung von Alkaminestern N-monoalkylierter und N-monoalkyloxyalkylierter Derivate der p-Aminobenzoesaeure | |
| DE1768200C (de) | 3,4-Methylendioxybenzyl-biguanide und deren pharmakologisch nicht giftige Salze | |
| DE1445581A1 (de) | N-[5-Methyloxazolinyl-(2)]-N'-aryl-Harnstoffderivate und Verfahren zu deren Herstellung | |
| DE1289844B (de) | Thioharnstoffe sowie Verfahren zu ihrer Herstellung | |
| DE1445426C (de) | Verfahren zur Herstellnng von Den vaten der 2 Thiobarbitursaure | |
| DE1135917B (de) | Verfahren zur Herstellung von neuen, blutdrucksenkenden 2-Amino-imidazolinen-(2) | |
| DE293163A (enExample) | ||
| DE1112987B (de) | Verfahren zur Herstellung zentralstimulierend wirkender neuer Aminonitrile | |
| CH347180A (de) | Verfahren zur Herstellung von Buttersäureamiden | |
| DE1768787B2 (de) | (o-Carboxy-phenyl)-acetamidine, Verfahren zu deren Herstellung und (o-Carboxyphenyl)-acetamidine enthaltende Präparate |