DE2948925C2 - Rohrförmiges Filterelement aus Verbundmaterial mit Abstandshaltern zwischen den Wellungen des Verbundmaterials - Google Patents
Rohrförmiges Filterelement aus Verbundmaterial mit Abstandshaltern zwischen den Wellungen des VerbundmaterialsInfo
- Publication number
- DE2948925C2 DE2948925C2 DE2948925A DE2948925A DE2948925C2 DE 2948925 C2 DE2948925 C2 DE 2948925C2 DE 2948925 A DE2948925 A DE 2948925A DE 2948925 A DE2948925 A DE 2948925A DE 2948925 C2 DE2948925 C2 DE 2948925C2
- Authority
- DE
- Germany
- Prior art keywords
- filter element
- support
- filter
- groups
- composite material
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000002131 composite material Substances 0.000 title claims description 18
- 125000006850 spacer group Chemical group 0.000 title claims description 11
- 239000000463 material Substances 0.000 claims description 58
- 238000006073 displacement reaction Methods 0.000 claims description 6
- 239000011343 solid material Substances 0.000 claims description 5
- 229920001169 thermoplastic Polymers 0.000 claims description 5
- 239000004416 thermosoftening plastic Substances 0.000 claims description 5
- 239000012815 thermoplastic material Substances 0.000 claims description 3
- 239000000945 filler Substances 0.000 claims 1
- -1 polyethylene Polymers 0.000 description 16
- 239000011148 porous material Substances 0.000 description 10
- 239000012530 fluid Substances 0.000 description 8
- 229920003023 plastic Polymers 0.000 description 8
- 239000004033 plastic Substances 0.000 description 8
- 229920005989 resin Polymers 0.000 description 8
- 239000011347 resin Substances 0.000 description 8
- 239000004743 Polypropylene Substances 0.000 description 7
- 229920001155 polypropylene Polymers 0.000 description 7
- 239000004793 Polystyrene Substances 0.000 description 6
- 239000004952 Polyamide Substances 0.000 description 5
- 239000004698 Polyethylene Substances 0.000 description 5
- 229920002647 polyamide Polymers 0.000 description 5
- 229920000573 polyethylene Polymers 0.000 description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 229920001807 Urea-formaldehyde Polymers 0.000 description 4
- 239000011230 binding agent Substances 0.000 description 4
- 238000005470 impregnation Methods 0.000 description 4
- 239000012528 membrane Substances 0.000 description 4
- 239000000123 paper Substances 0.000 description 4
- 229920001568 phenolic resin Polymers 0.000 description 4
- 229920000728 polyester Polymers 0.000 description 4
- 239000004800 polyvinyl chloride Substances 0.000 description 4
- 229920000915 polyvinyl chloride Polymers 0.000 description 4
- 229920003002 synthetic resin Polymers 0.000 description 4
- 239000000057 synthetic resin Substances 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 3
- 229910045601 alloy Inorganic materials 0.000 description 3
- 239000000956 alloy Substances 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical compound O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 description 3
- 239000011236 particulate material Substances 0.000 description 3
- ODGAOXROABLFNM-UHFFFAOYSA-N polynoxylin Chemical compound O=C.NC(N)=O ODGAOXROABLFNM-UHFFFAOYSA-N 0.000 description 3
- 239000005033 polyvinylidene chloride Substances 0.000 description 3
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 229920000877 Melamine resin Polymers 0.000 description 2
- 229920002367 Polyisobutene Polymers 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 229920002301 cellulose acetate Polymers 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000007769 metal material Substances 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 239000004417 polycarbonate Substances 0.000 description 2
- 229920000515 polycarbonate Polymers 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 1
- 229910001369 Brass Inorganic materials 0.000 description 1
- 229910000906 Bronze Inorganic materials 0.000 description 1
- 229920008347 Cellulose acetate propionate Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- 229910000640 Fe alloy Inorganic materials 0.000 description 1
- 229910000792 Monel Inorganic materials 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- WAIPAZQMEIHHTJ-UHFFFAOYSA-N [Cr].[Co] Chemical compound [Cr].[Co] WAIPAZQMEIHHTJ-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- 239000010974 bronze Substances 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 239000013013 elastic material Substances 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920006379 extruded polypropylene Polymers 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- IVJISJACKSSFGE-UHFFFAOYSA-N formaldehyde;1,3,5-triazine-2,4,6-triamine Chemical compound O=C.NC1=NC(N)=NC(N)=N1 IVJISJACKSSFGE-UHFFFAOYSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000011799 hole material Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012567 medical material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 229920002492 poly(sulfone) Polymers 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 1
- 239000004810 polytetrafluoroethylene Substances 0.000 description 1
- 238000001223 reverse osmosis Methods 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 210000002435 tendon Anatomy 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 238000000108 ultra-filtration Methods 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- 239000011800 void material Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D29/00—Filters with filtering elements stationary during filtration, e.g. pressure or suction filters, not covered by groups B01D24/00 - B01D27/00; Filtering elements therefor
- B01D29/11—Filters with filtering elements stationary during filtration, e.g. pressure or suction filters, not covered by groups B01D24/00 - B01D27/00; Filtering elements therefor with bag, cage, hose, tube, sleeve or like filtering elements
- B01D29/13—Supported filter elements
- B01D29/15—Supported filter elements arranged for inward flow filtration
- B01D29/21—Supported filter elements arranged for inward flow filtration with corrugated, folded or wound sheets
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D39/00—Filtering material for liquid or gaseous fluids
- B01D39/14—Other self-supporting filtering material ; Other filtering material
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D63/00—Apparatus in general for separation processes using semi-permeable membranes
- B01D63/06—Tubular membrane modules
- B01D63/067—Tubular membrane modules with pleated membranes
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D2201/00—Details relating to filtering apparatus
- B01D2201/04—Supports for the filtering elements
- B01D2201/0407—Perforated supports on both sides of the filtering element
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Filtering Materials (AREA)
- Filtering Of Dispersed Particles In Gases (AREA)
- Separation Using Semi-Permeable Membranes (AREA)
- Filtration Of Liquid (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/872,863 US4154688A (en) | 1978-01-27 | 1978-01-27 | Collapse-resistant corrugated filter element |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2948925A1 DE2948925A1 (de) | 1980-06-26 |
| DE2948925C2 true DE2948925C2 (de) | 1983-08-04 |
Family
ID=25360464
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2948925A Expired DE2948925C2 (de) | 1978-01-27 | 1979-01-18 | Rohrförmiges Filterelement aus Verbundmaterial mit Abstandshaltern zwischen den Wellungen des Verbundmaterials |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4154688A (enExample) |
| EP (1) | EP0003959A1 (enExample) |
| JP (1) | JPS54116779A (enExample) |
| AU (1) | AU521300B2 (enExample) |
| BE (1) | BE41T1 (enExample) |
| CA (1) | CA1114302A (enExample) |
| DE (1) | DE2948925C2 (enExample) |
| DK (1) | DK149461C (enExample) |
| FI (1) | FI790262A7 (enExample) |
| FR (1) | FR2443269A1 (enExample) |
| GB (1) | GB2041230B (enExample) |
| IT (1) | IT1113742B (enExample) |
| NL (1) | NL174525C (enExample) |
| SE (1) | SE431404B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE29905892U1 (de) | 1999-03-31 | 1999-06-24 | Sartorius AG, 37075 Göttingen | Druckstabile äußere Rückstausicherung für patronenartige Filterelemente |
Families Citing this family (109)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4244820A (en) * | 1978-05-16 | 1981-01-13 | Gelman Instrument Company | Fluid purification system |
| JPS5524563A (en) * | 1978-08-09 | 1980-02-21 | Nitto Electric Ind Co Ltd | Tubular membrane separating module |
| CA1175756A (en) * | 1980-01-24 | 1984-10-09 | John I. Schaeffer | Filter pleat support means |
| US4402830A (en) * | 1982-01-13 | 1983-09-06 | Pall Corporation | Corrugated filter element with external spiral tape support |
| AU1773483A (en) * | 1982-05-28 | 1983-12-16 | Amf Inc. | Filter element having microporous filter membrane |
| US4906371A (en) * | 1982-05-28 | 1990-03-06 | Cuno, Incorporated | Filter element having microporous membrane |
| US4929354A (en) * | 1982-05-28 | 1990-05-29 | Cuno, Incorporated | Filter element having microporous membrane |
| US4555342A (en) * | 1982-06-28 | 1985-11-26 | Grant Blake F | Ribbon filter apparatus |
| AU540096B2 (en) * | 1982-08-04 | 1984-11-01 | Nippondenso Co. Ltd. | Filter device and manufacturing method |
| US4707268A (en) * | 1982-10-18 | 1987-11-17 | Baxter Travenol Laboratories, Inc. | Hollow fiber potted microfilter |
| DK150009C (da) * | 1982-11-22 | 1987-05-25 | Pm Filter Konstr Ag | Indlaeg til filterpatroner |
| US4522719A (en) * | 1982-12-24 | 1985-06-11 | Nihon Schumacher K.K. | Filter with a tubular filter element |
| DE3310727A1 (de) * | 1983-03-24 | 1984-10-04 | B. Braun Melsungen Ag, 3508 Melsungen | Verfahren und vorrichtung zur selektiven, extrakorporalen abtrennung pathologischer und/oder toxischer blutbestandteile |
| DE3318940A1 (de) * | 1983-05-25 | 1984-11-29 | Sartorius GmbH, 3400 Göttingen | Rohrfoermiges filterelement |
| JPS6058208A (ja) * | 1983-09-09 | 1985-04-04 | Kurabo Ind Ltd | フイルタ−エレメントとその製法 |
| US4559138A (en) * | 1983-10-03 | 1985-12-17 | Harmsco, Inc. | End connected filter cartridges |
| AU565494B2 (en) * | 1983-10-18 | 1987-09-17 | Nippondenso Co. Ltd. | Filter element |
| US4609465A (en) * | 1984-05-21 | 1986-09-02 | Pall Corporation | Filter cartridge with a connector seal |
| JPS6115021U (ja) * | 1984-07-03 | 1986-01-28 | 東京濾器株式会社 | フイルタエレメント |
| ATE53775T1 (de) * | 1984-09-10 | 1990-06-15 | Hr Textron Inc | Vollstaendig aus fluorkohlenstoffharz hergestelltes filterelement. |
| JPS6197003A (ja) * | 1984-10-19 | 1986-05-15 | Jun Taga | カ−トリツジフイルタ− |
| EP0187358A3 (en) * | 1984-12-24 | 1987-03-18 | Kurashiki Boseki Kabushiki Kaisha | Filter element and its production |
| KR930007663Y1 (ko) * | 1985-06-25 | 1993-11-12 | 닛뽕 덴소오 가부시기가이샤 | 여과 엘레멘트 |
| US4673503A (en) * | 1985-07-18 | 1987-06-16 | Tokyo Roki Co., Ltd. | Variant length pleated filter element |
| JPS6249922A (ja) * | 1985-08-28 | 1987-03-04 | Kurabo Ind Ltd | 多層構造フイルタ−エレメント |
| US4678564A (en) * | 1985-11-15 | 1987-07-07 | Fairchild Filter Corporation | Cast filter and automatic self-cleaning backflush control system therefor |
| US4735720A (en) * | 1986-03-17 | 1988-04-05 | Nelson Industries Inc. | Pleated filter element having improved side seam seal |
| US4874517A (en) * | 1986-05-27 | 1989-10-17 | Avk Filtertechnik Gmbh | Filter arrangement with pleat distance piece |
| DE3623346C2 (de) * | 1986-07-11 | 1993-11-18 | Kernforschungsz Karlsruhe | Filtereinsatz für Kesselfiltergehäuse |
| US4963258A (en) * | 1987-02-24 | 1990-10-16 | Aisaburo Yagishita | Filter with perforated fin portions extending from outer cylindrical wall |
| DE3878899T2 (de) * | 1987-07-30 | 1993-07-22 | Toray Industries | Poroese polytetrafluoraethylen-membran, trennvorrichtung unter verwendung dieser membran sowie verfahren zur herstellung. |
| US5043000A (en) * | 1987-09-18 | 1991-08-27 | Toyo Roki Seizo K.K. | Air cleaner element and method of manufacturing the same |
| US5552048A (en) * | 1988-06-15 | 1996-09-03 | Pall Corporation | Two pleated filter composite having cushioning layers |
| US5084178A (en) * | 1988-06-15 | 1992-01-28 | Pall Corporation | Corrugated filter arrangement with support layer and flow channels |
| US5252207A (en) * | 1988-06-15 | 1993-10-12 | Pall Corporation | Wrap member having openings |
| US5130023A (en) * | 1989-04-03 | 1992-07-14 | Pall Corporation | Filter cartridge with end densification ring |
| US5225077A (en) * | 1989-04-03 | 1993-07-06 | Pall Corporation | Filter cartridge with end densification ring |
| DE3916744C2 (de) * | 1989-05-23 | 1994-02-03 | Sartorius Gmbh | Rohrförmiges Filterelement |
| GB2258166B8 (en) * | 1991-08-02 | 1995-07-17 | Ac Delco Systems Overseas Corp | Disposable oil filter |
| US5250179A (en) * | 1992-03-27 | 1993-10-05 | Porous Media Corporation | Compactable filter and compactable filter mounting means |
| CN1067291C (zh) * | 1992-11-06 | 2001-06-20 | 帕尔公司 | 过滤器 |
| US5543047A (en) * | 1992-11-06 | 1996-08-06 | Pall Corporation | Filter with over-laid pleats in intimate contact |
| DE19507485A1 (de) * | 1995-03-03 | 1996-09-05 | Hoechst Ag | Formkörper mit Filtervorrichtung |
| JP2000500385A (ja) * | 1995-11-09 | 2000-01-18 | ユーエスエフ フィルトレイション アンド セパレイションズ グループ インク. | 逆流可能なフィルターカートリッジ及びその逆流方法 |
| US5904846A (en) * | 1996-01-16 | 1999-05-18 | Corning Costar Corporation | Filter cartridge having track etched membranes and methods of making same |
| US6099729A (en) * | 1996-03-01 | 2000-08-08 | Parker-Hannifin Corporation | Coreless non-metallic filter element |
| US5702603A (en) * | 1996-03-22 | 1997-12-30 | Johnson; Todd W. | Self-sealing liquid filter |
| US5824232A (en) * | 1996-04-15 | 1998-10-20 | Filtration Technologies Corporation | Corrugated filter sheet configured into a cylindrical filter media having near circular concentric channels |
| USD417715S (en) * | 1996-09-25 | 1999-12-14 | Pall Corporation | Cylindrical filter element |
| USD404796S (en) * | 1996-09-25 | 1999-01-26 | Pall Corporation | Cylindrical filter element |
| BR9806721A (pt) * | 1997-01-20 | 2000-04-04 | Cuno Inc | Aparelho e método compreendendo etapas para formação de cartuchos de filtro pregueado helicoidal |
| US5835549A (en) * | 1997-03-06 | 1998-11-10 | Combustion Engineering, Inc. | BWR emergency core cooling system strainer |
| US6863758B1 (en) * | 1997-08-25 | 2005-03-08 | Hydac Filtertechnik Gmbh | Method of assembling plastic filter element with plastic casing |
| US5855635A (en) * | 1997-09-19 | 1999-01-05 | Jason, Inc. | Non-blocking filter |
| US6010548A (en) * | 1998-01-30 | 2000-01-04 | Freudenberg Nonwovens Limited Partnership | Spaced pocket filter assembly and method of manufacturing same |
| EP1113859B1 (en) * | 1998-09-09 | 2007-01-03 | Pall Corporation | Methods for treating fluids |
| EP1762293A3 (en) | 1998-09-09 | 2007-10-03 | Pall Corporation | Elements and methods for treating fluids |
| USD420095S (en) * | 1998-11-18 | 2000-02-01 | Pall Corporation | Cylindrical filter element |
| USD415245S (en) * | 1998-11-18 | 1999-10-12 | Pall Corporation | Cylindrical filter element |
| USD418197S (en) * | 1998-11-18 | 1999-12-28 | Pall Corporation | Cylindrical filter element |
| USD415819S (en) * | 1998-11-18 | 1999-10-26 | Pall Corporation | Cylindrical filter element |
| US6143106A (en) * | 1999-02-08 | 2000-11-07 | Parker-Hannifin Corporation | Filter cartridge with structurally attached outer sleeve and method of assembly |
| US6387144B1 (en) | 2000-03-16 | 2002-05-14 | Nelson Industries, Inc. | Enhanced performance fibrous filter media and extended life fluid filter assembly |
| US6910589B1 (en) * | 2000-06-22 | 2005-06-28 | Oberlin Filter Company | Annular pleated filter cartridge for liquid filtration apparatus |
| DE60125052T2 (de) | 2000-09-15 | 2007-06-28 | 3M Innovative Properties Co., St. Paul | Spiralförmig gefaltete filterpatronen |
| BR0213733B1 (pt) * | 2001-11-06 | 2010-12-14 | elemento de filtro e mÉtodo para montar um elemento de filtro com luva interna fixada de modo adesivo. | |
| US6763875B2 (en) | 2002-02-06 | 2004-07-20 | Andersen Corporation | Reduced visibility insect screen |
| US20050098277A1 (en) * | 2002-02-06 | 2005-05-12 | Alex Bredemus | Reduced visibility insect screen |
| US7473360B2 (en) * | 2002-03-26 | 2009-01-06 | Pall Corporation | Length-adjustable filter cartridge end caps, filter cartridges employing, and methods of making, the same |
| US6870614B2 (en) * | 2002-05-30 | 2005-03-22 | General Electric Company | Method, system and computer product for formulating a bi-directional color match |
| US20040163372A1 (en) * | 2003-02-25 | 2004-08-26 | Nguyen Ledu Q. | Environmentally friendly air filter for an internal combustion engine |
| US7182858B2 (en) * | 2003-03-04 | 2007-02-27 | Kinetico Incorporated | Multiple barrier filter apparatus |
| TW200505554A (en) * | 2003-04-22 | 2005-02-16 | Mykrolis Corp | Pleated construction for effecting gas transfer membrane |
| WO2005037408A1 (en) * | 2003-10-14 | 2005-04-28 | Donaldson Company, Inc. | Filter assembly with pleated media v-packs, and methods |
| RU2283683C2 (ru) * | 2005-01-17 | 2006-09-20 | Владимир Валентинович Чекалов | Фильтрующий элемент |
| WO2006096466A1 (en) * | 2005-03-04 | 2006-09-14 | Pall Corporation | Corrugated fluid treatment packs and methods of making them |
| EP2040813A2 (en) * | 2006-06-21 | 2009-04-01 | Entegris, Inc. | System and method for liquid filtration with reduced hold-up volume |
| US7967152B2 (en) * | 2006-09-12 | 2011-06-28 | Cummins Filtration Ip, Inc. | Fluid filter support layer |
| US7959702B2 (en) | 2007-02-02 | 2011-06-14 | Donaldson Company, Inc. | Air filtration media pack, filter element, air filtration media, and methods |
| US20080272048A1 (en) * | 2007-05-01 | 2008-11-06 | Bha Group, Inc. | Filter cartridge media retention system |
| CA2691867C (en) | 2007-06-26 | 2016-10-04 | Donaldson Company, Inc. | Filtration media pack, filter element, and methods |
| US9409115B2 (en) * | 2007-11-20 | 2016-08-09 | Filtration Technology Corporation | Filter with exterior and interior media components and method of filtering |
| US8425644B2 (en) * | 2008-01-31 | 2013-04-23 | Anders Sundvik | High flow V-bank filter |
| BRPI0907653B1 (pt) | 2008-02-04 | 2019-07-02 | Donaldson Company, Inc | Método para formar meios de filtração encanelados |
| CA2731554A1 (en) * | 2008-07-25 | 2010-01-28 | Donaldson Company, Inc. | Pleated filtration media, media packs, filter elements, and methods for filtering fluids |
| US8021456B2 (en) * | 2008-11-21 | 2011-09-20 | Bha Group, Inc. | Filter element with high temperature polymer retaining straps and method of manufacture |
| US8051989B1 (en) | 2009-05-11 | 2011-11-08 | Davco Technology, Llc | Support structure for a filter |
| DE102009032778B4 (de) * | 2009-07-10 | 2019-03-28 | Carl Freudenberg Kg | Verwendung einer Filterpatrone mit einem Filtermedium aus gesplitteten Fasern |
| US10363513B2 (en) | 2009-08-03 | 2019-07-30 | Donaldson Company, Inc. | Method and apparatus for forming fluted filtration media having tapered flutes |
| CA2787822A1 (en) * | 2010-01-25 | 2011-07-28 | Donaldson Company, Inc. | Pleated filtration media having tapered flutes |
| US7935161B1 (en) * | 2010-03-23 | 2011-05-03 | Bulkmatic Transport Company | Filter cartridge with mounting apparatus and method of filter replacement for a cyclonic separation system |
| DE102011077710A1 (de) | 2011-06-17 | 2012-12-20 | Mahle International Gmbh | Ringfilterelement |
| DE102014009888B4 (de) * | 2013-07-15 | 2025-07-03 | Mann+Hummel Gmbh | Filterelement eines Filters, mehrlagiges Filtermedium eines Filters und Filter |
| US10328377B2 (en) * | 2013-10-15 | 2019-06-25 | Airsept, Inc. | Segmented bendable filter |
| DE102013017577A1 (de) * | 2013-10-24 | 2015-04-30 | Mann + Hummel Gmbh | Filterelement und Verfahren zum Hestellen desselben |
| CA2931811C (en) * | 2013-11-27 | 2019-04-02 | Atlas Copco Airpower N.V. | High bulk coalescing filter media and use thereof |
| US10654725B2 (en) | 2013-12-18 | 2020-05-19 | Brita Lp | Filter assembly for filter as you pour filtration |
| US10604420B2 (en) | 2013-12-18 | 2020-03-31 | Brita Lp | Method and apparatus for reservoir free and ventless water filtering |
| AU2014366932B2 (en) | 2013-12-18 | 2019-03-07 | Brita Lp | Flow control device for filter as you pour system |
| US11066311B2 (en) | 2013-12-18 | 2021-07-20 | Brita I.P | Method of using a filter media for filtration |
| US10351442B2 (en) | 2013-12-18 | 2019-07-16 | Brita Lp | Flow control device for filter as you pour system |
| DE102014007373B4 (de) * | 2014-05-21 | 2018-01-18 | Mann + Hummel Gmbh | Faltenförmiges Filterelement |
| CN106413843B (zh) * | 2014-05-21 | 2019-08-09 | 曼·胡默尔有限公司 | 过滤元件和过滤器组件 |
| US10427951B2 (en) | 2015-08-20 | 2019-10-01 | Brita Lp | Water purification filter and system |
| AU2016330144A1 (en) | 2015-09-30 | 2018-04-05 | Brita Lp | Filter core configuration |
| WO2017055915A1 (en) | 2015-09-30 | 2017-04-06 | Brita Lp | Filter cartridge placement in filter as you pour system |
| CN208865251U (zh) | 2015-09-30 | 2019-05-17 | 碧然德公司 | 芯盖、过滤器组件和流体容器 |
| WO2017194165A1 (en) * | 2016-05-13 | 2017-11-16 | Nkt Hv Cables Gmbh | Joint, termination or cross-connection arrangement for a cable and method for providing a joint, termination or cross-connection arrangement |
| KR102893950B1 (ko) * | 2019-11-06 | 2025-12-03 | 엔테그리스, 아이엔씨. | 유체 흐름이 개선된 필터 |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE732135C (de) * | 1938-08-25 | 1943-02-22 | Ig Farbenindustrie Ag | Fluessigkeitsfilter |
| US2936855A (en) * | 1957-10-23 | 1960-05-17 | Gen Motors Corp | Pleated filter and mechanism for forming same |
| US2988227A (en) * | 1958-03-03 | 1961-06-13 | Harold H Harms | Pleated filter |
| US3057481A (en) * | 1958-06-12 | 1962-10-09 | Pall Corp | Corrugated filter and method of forming the same |
| US3292792A (en) * | 1963-04-10 | 1966-12-20 | Falkenberg | Filter cartridge |
| US3288299A (en) * | 1963-07-05 | 1966-11-29 | Fram Corp | Oil filter cartridge |
| US3313421A (en) * | 1963-12-09 | 1967-04-11 | Falkenberg | Cartridge for filtering medium |
| US3302796A (en) * | 1964-02-28 | 1967-02-07 | Aero Flow Dynamics Inc | Barrier filter element assembly |
| US3314546A (en) * | 1964-06-02 | 1967-04-18 | Stone Filter Co Inc | Cartridge filter |
| GB1036350A (en) * | 1964-07-17 | 1966-07-20 | Gen Motors Ltd | Filter units for liquid filters |
| DE1436317A1 (de) * | 1965-04-01 | 1968-10-31 | Mann & Hummel Filter | Ringfoermiger Filtereinsatz fuer Gase oder Fluessigkeiten |
| US3321088A (en) * | 1966-05-16 | 1967-05-23 | Gen Motors Corp | Filter cartridge |
| GB1188525A (en) * | 1966-05-26 | 1970-04-15 | Gen Motors Ltd | Filters for Liquids |
| GB1389199A (en) * | 1971-06-22 | 1975-04-03 | Crosland Filters Ltd | Filter assembly |
| US3807150A (en) * | 1972-02-28 | 1974-04-30 | Hepa Corp | Absolute filter pack structure having a toroidal section |
| BE795372A (fr) * | 1972-03-01 | 1973-05-29 | Knecht Filterwerke Gmbh | Cartouche filtrante a element filtrant plie en etoile pour filtre a air de moteurs a combustion interne et moteurs analogues |
| DE2339192A1 (de) * | 1972-08-03 | 1974-02-14 | Crossland Filters Ltd | Ringfoermiges filterelement |
| US3867294A (en) * | 1973-05-09 | 1975-02-18 | Pall Corp | Cylindrical filter elements with improved side seam seal |
| US4033881A (en) * | 1975-01-06 | 1977-07-05 | Pall Corporation | Multilayer paper sheet filter cartridges |
| DE2536276C3 (de) * | 1975-08-14 | 1978-03-09 | Sintermetallwerk Krebsoege Gmbh, 5608 Radevormwald | Verfahren zur Herstellung einer aus Sintermetall aufgebauten Filterpatrone |
-
1978
- 1978-01-27 US US05/872,863 patent/US4154688A/en not_active Expired - Lifetime
-
1979
- 1979-01-18 NL NLAANVRAGE7915008,A patent/NL174525C/xx not_active IP Right Cessation
- 1979-01-18 EP EP79100139A patent/EP0003959A1/en not_active Withdrawn
- 1979-01-18 GB GB8001754A patent/GB2041230B/en not_active Expired
- 1979-01-18 BE BEBTR41A patent/BE41T1/xx not_active IP Right Cessation
- 1979-01-18 DE DE2948925A patent/DE2948925C2/de not_active Expired
- 1979-01-25 IT IT47776/79A patent/IT1113742B/it active
- 1979-01-26 FI FI790262A patent/FI790262A7/fi unknown
- 1979-01-26 DK DK35179A patent/DK149461C/da not_active IP Right Cessation
- 1979-01-26 AU AU43703/79A patent/AU521300B2/en not_active Ceased
- 1979-01-26 JP JP811479A patent/JPS54116779A/ja active Granted
- 1979-01-26 CA CA320,337A patent/CA1114302A/en not_active Expired
-
1980
- 1980-01-03 FR FR8000189A patent/FR2443269A1/fr active Granted
- 1980-01-24 SE SE8000566A patent/SE431404B/sv not_active IP Right Cessation
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE29905892U1 (de) | 1999-03-31 | 1999-06-24 | Sartorius AG, 37075 Göttingen | Druckstabile äußere Rückstausicherung für patronenartige Filterelemente |
Also Published As
| Publication number | Publication date |
|---|---|
| SE8000566L (sv) | 1980-01-24 |
| GB2041230B (en) | 1982-06-03 |
| AU521300B2 (en) | 1982-03-25 |
| NL174525B (nl) | 1984-02-01 |
| GB2041230A (en) | 1980-09-10 |
| US4154688A (en) | 1979-05-15 |
| DE2948925A1 (de) | 1980-06-26 |
| SE431404B (sv) | 1984-02-06 |
| FR2443269B1 (enExample) | 1984-04-13 |
| DK149461B (da) | 1986-06-23 |
| DK35179A (da) | 1979-07-28 |
| JPS5739808B2 (enExample) | 1982-08-24 |
| DK149461C (da) | 1986-12-08 |
| EP0003959A1 (en) | 1979-09-19 |
| CA1114302A (en) | 1981-12-15 |
| IT1113742B (it) | 1986-01-20 |
| IT7947776A0 (it) | 1979-01-25 |
| NL7915008A (nl) | 1980-03-31 |
| FI790262A7 (fi) | 1979-07-28 |
| JPS54116779A (en) | 1979-09-11 |
| NL174525C (nl) | 1984-07-02 |
| AU4370379A (en) | 1979-08-02 |
| FR2443269A1 (fr) | 1980-07-04 |
| BE41T1 (fr) | 1980-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2948925C2 (de) | Rohrförmiges Filterelement aus Verbundmaterial mit Abstandshaltern zwischen den Wellungen des Verbundmaterials | |
| DE4319261C2 (de) | Schraubenförmig umwickeltes Filterelement | |
| DE69122459T3 (de) | Filter | |
| DE69029455T2 (de) | Filteranlage | |
| DE3128546C2 (enExample) | ||
| DE2353610C3 (de) | Endkappe zur Abdeckung von rohrförmigen Filterelementen | |
| DE68929119T2 (de) | Filterzelle und Zellenfilterkartusche | |
| EP0382331B1 (de) | Filtereinsatz | |
| EP1525041B1 (de) | Filterelement und verfahren zu dessen herstellung | |
| EP2477718A1 (de) | Filter zur filtrierung von fluiden | |
| DE2651910C3 (de) | Rohrförmiges Einwegfilterelement und Streifen aus Filterpapier für ein Einwegfilterelement | |
| DE3726865A1 (de) | Filterpatrone | |
| DE3728825A1 (de) | Filterpatrone | |
| DE2513618B2 (de) | Filterstruktur aus porösem Folienwerkstoff | |
| DE3525682A1 (de) | Wickelmembran-filterkerze | |
| DE2213165A1 (de) | Spiralförmig gewickelter Filter | |
| DE4345130C1 (de) | Hohlzylindrisches Filterelement | |
| DE2444224C3 (de) | Trennvorrichtung | |
| DE2600228A1 (de) | Rohrartiges filter | |
| DE2553941C3 (de) | Vorrichtung zum Filtern eines viskosen, polymeren Fluids | |
| DE2603505C3 (de) | Flachmembranmodul für umgekehrte Osmose und Ultrafiltration | |
| DE3502777C2 (de) | Filtervorrichtung in Segmentbauweise | |
| EP1495792B1 (de) | Filtertasche für einen Abgasfilter und Verfahren zu ihrer Herstellung | |
| DE2653875B2 (de) | Vorrichtung für die Ultrafiltration | |
| EP0152903B1 (de) | Filtervorrichtung in Segmentbauweise |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OAM | Search report available | ||
| OC | Search report available | ||
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |