DE2943030C2 - - Google Patents
Info
- Publication number
- DE2943030C2 DE2943030C2 DE2943030A DE2943030A DE2943030C2 DE 2943030 C2 DE2943030 C2 DE 2943030C2 DE 2943030 A DE2943030 A DE 2943030A DE 2943030 A DE2943030 A DE 2943030A DE 2943030 C2 DE2943030 C2 DE 2943030C2
- Authority
- DE
- Germany
- Prior art keywords
- weight
- parts
- alkyl
- monomers
- polymerization
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000178 monomer Substances 0.000 claims description 56
- 238000000034 method Methods 0.000 claims description 44
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 30
- 238000006116 polymerization reaction Methods 0.000 claims description 24
- -1 alkyl methacrylates Chemical class 0.000 claims description 19
- 229920000642 polymer Polymers 0.000 claims description 15
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 12
- 230000008569 process Effects 0.000 claims description 12
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 claims description 11
- 239000004094 surface-active agent Substances 0.000 claims description 11
- 239000003999 initiator Substances 0.000 claims description 10
- FXDQRDVXOHKKEV-UHFFFAOYSA-N CC(C)COC=C(CO)C(N)=O Chemical compound CC(C)COC=C(CO)C(N)=O FXDQRDVXOHKKEV-UHFFFAOYSA-N 0.000 claims description 9
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 7
- 239000003638 chemical reducing agent Substances 0.000 claims description 7
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 6
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 claims description 6
- CNCOEDDPFOAUMB-UHFFFAOYSA-N N-Methylolacrylamide Chemical compound OCNC(=O)C=C CNCOEDDPFOAUMB-UHFFFAOYSA-N 0.000 claims description 5
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 5
- 125000005250 alkyl acrylate group Chemical group 0.000 claims description 5
- 150000005215 alkyl ethers Chemical class 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium peroxydisulfate Substances [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 239000000839 emulsion Substances 0.000 claims description 5
- 150000002978 peroxides Chemical class 0.000 claims description 5
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 claims description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 4
- DNTMQTKDNSEIFO-UHFFFAOYSA-N n-(hydroxymethyl)-2-methylprop-2-enamide Chemical compound CC(=C)C(=O)NCO DNTMQTKDNSEIFO-UHFFFAOYSA-N 0.000 claims description 4
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 claims description 4
- GOXQRTZXKQZDDN-UHFFFAOYSA-N 2-Ethylhexyl acrylate Chemical compound CCCCC(CC)COC(=O)C=C GOXQRTZXKQZDDN-UHFFFAOYSA-N 0.000 claims description 3
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 claims description 3
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 claims description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 3
- 239000005977 Ethylene Substances 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 claims description 3
- 229910001870 ammonium persulfate Inorganic materials 0.000 claims description 3
- 150000002432 hydroperoxides Chemical class 0.000 claims description 3
- 150000007522 mineralic acids Chemical class 0.000 claims description 3
- 150000007524 organic acids Chemical class 0.000 claims description 3
- 150000001451 organic peroxides Chemical class 0.000 claims description 3
- 150000004965 peroxy acids Chemical class 0.000 claims description 3
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical class S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- 229920001567 vinyl ester resin Polymers 0.000 claims description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 3
- MLSUZVRUIHFFTA-UHFFFAOYSA-N 4-hydroxy-2-methyl-3-(2-methylpropoxy)but-2-enamide Chemical compound CC(C)COC(CO)=C(C)C(N)=O MLSUZVRUIHFFTA-UHFFFAOYSA-N 0.000 claims description 2
- NHRVDGVVAWHMDO-UHFFFAOYSA-N CCCCOC(CO)=C(C)C(N)=O Chemical compound CCCCOC(CO)=C(C)C(N)=O NHRVDGVVAWHMDO-UHFFFAOYSA-N 0.000 claims description 2
- VMYXVJASSBAHHD-UHFFFAOYSA-N CCCCOC=C(CO)C(N)=O Chemical compound CCCCOC=C(CO)C(N)=O VMYXVJASSBAHHD-UHFFFAOYSA-N 0.000 claims description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 claims description 2
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical class C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 claims description 2
- 150000007513 acids Chemical class 0.000 claims description 2
- 229910001413 alkali metal ion Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 229910001420 alkaline earth metal ion Inorganic materials 0.000 claims description 2
- 239000012736 aqueous medium Substances 0.000 claims description 2
- 229940017705 formaldehyde sulfoxylate Drugs 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- SBGKURINHGJRFN-UHFFFAOYSA-N hydroxymethanesulfinic acid Chemical compound OCS(O)=O SBGKURINHGJRFN-UHFFFAOYSA-N 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 230000000379 polymerizing effect Effects 0.000 claims description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 claims description 2
- 150000004764 thiosulfuric acid derivatives Chemical class 0.000 claims description 2
- 229920002818 (Hydroxyethyl)methacrylate Polymers 0.000 claims 1
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical class CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 claims 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 claims 1
- BAPJBEWLBFYGME-UHFFFAOYSA-N acrylic acid methyl ester Natural products COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 claims 1
- VAZSKTXWXKYQJF-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)OOS([O-])=O VAZSKTXWXKYQJF-UHFFFAOYSA-N 0.000 claims 1
- 229920000126 latex Polymers 0.000 description 31
- 239000004816 latex Substances 0.000 description 25
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- 229920001577 copolymer Polymers 0.000 description 19
- 238000006243 chemical reaction Methods 0.000 description 16
- 239000000203 mixture Substances 0.000 description 15
- 238000004519 manufacturing process Methods 0.000 description 13
- 239000000243 solution Substances 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 12
- 229940063559 methacrylic acid Drugs 0.000 description 12
- 238000000576 coating method Methods 0.000 description 10
- 239000002320 enamel (paints) Substances 0.000 description 10
- 239000003973 paint Substances 0.000 description 9
- 229920003270 Cymel® Polymers 0.000 description 8
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 8
- 239000002585 base Substances 0.000 description 8
- 239000011248 coating agent Substances 0.000 description 8
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 8
- 238000009472 formulation Methods 0.000 description 7
- 238000009833 condensation Methods 0.000 description 6
- 230000005494 condensation Effects 0.000 description 6
- 239000004615 ingredient Substances 0.000 description 6
- 229920005989 resin Polymers 0.000 description 6
- 239000011347 resin Substances 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 238000000227 grinding Methods 0.000 description 5
- 230000002028 premature Effects 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 4
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 229940063557 methacrylate Drugs 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- IVJISJACKSSFGE-UHFFFAOYSA-N formaldehyde;1,3,5-triazine-2,4,6-triamine Chemical compound O=C.NC1=NC(N)=NC(N)=N1 IVJISJACKSSFGE-UHFFFAOYSA-N 0.000 description 3
- ARZLUCYKIWYSHR-UHFFFAOYSA-N hydroxymethoxymethanol Chemical group OCOCO ARZLUCYKIWYSHR-UHFFFAOYSA-N 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 239000012966 redox initiator Substances 0.000 description 3
- JMHCCAYJTTWMCX-QWPJCUCISA-M sodium;(2s)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoate;pentahydrate Chemical compound O.O.O.O.O.[Na+].IC1=CC(C[C@H](N)C([O-])=O)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 JMHCCAYJTTWMCX-QWPJCUCISA-M 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 3
- 229920001187 thermosetting polymer Polymers 0.000 description 3
- OMIGHNLMNHATMP-UHFFFAOYSA-N 2-hydroxyethyl prop-2-enoate Chemical compound OCCOC(=O)C=C OMIGHNLMNHATMP-UHFFFAOYSA-N 0.000 description 2
- QZPSOSOOLFHYRR-UHFFFAOYSA-N 3-hydroxypropyl prop-2-enoate Chemical group OCCCOC(=O)C=C QZPSOSOOLFHYRR-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 229920006243 acrylic copolymer Polymers 0.000 description 2
- 239000012190 activator Substances 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 239000011324 bead Substances 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- 210000003298 dental enamel Anatomy 0.000 description 2
- ZQMIGQNCOMNODD-UHFFFAOYSA-N diacetyl peroxide Chemical compound CC(=O)OOC(C)=O ZQMIGQNCOMNODD-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 238000007654 immersion Methods 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 230000006855 networking Effects 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 230000000717 retained effect Effects 0.000 description 2
- 239000004576 sand Substances 0.000 description 2
- 229910001415 sodium ion Inorganic materials 0.000 description 2
- 239000002966 varnish Substances 0.000 description 2
- WRXCBRHBHGNNQA-UHFFFAOYSA-N (2,4-dichlorobenzoyl) 2,4-dichlorobenzenecarboperoxoate Chemical compound ClC1=CC(Cl)=CC=C1C(=O)OOC(=O)C1=CC=C(Cl)C=C1Cl WRXCBRHBHGNNQA-UHFFFAOYSA-N 0.000 description 1
- AOSFMYBATFLTAQ-UHFFFAOYSA-N 1-amino-3-(benzimidazol-1-yl)propan-2-ol Chemical compound C1=CC=C2N(CC(O)CN)C=NC2=C1 AOSFMYBATFLTAQ-UHFFFAOYSA-N 0.000 description 1
- PRFSAQZQEVZPEZ-UHFFFAOYSA-N 2-(hydroxymethyl)-n-(2-methylpropoxy)prop-2-enamide Chemical compound CC(C)CONC(=O)C(=C)CO PRFSAQZQEVZPEZ-UHFFFAOYSA-N 0.000 description 1
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 description 1
- WDQMWEYDKDCEHT-UHFFFAOYSA-N 2-ethylhexyl 2-methylprop-2-enoate Chemical compound CCCCC(CC)COC(=O)C(C)=C WDQMWEYDKDCEHT-UHFFFAOYSA-N 0.000 description 1
- KTOQRRDVVIDEAA-UHFFFAOYSA-N 2-methylpropane Chemical group [CH2]C(C)C KTOQRRDVVIDEAA-UHFFFAOYSA-N 0.000 description 1
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 1
- GNSFRPWPOGYVLO-UHFFFAOYSA-N 3-hydroxypropyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCO GNSFRPWPOGYVLO-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 229910052684 Cerium Inorganic materials 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229910016876 Fe(NH4)2(SO4)2 Inorganic materials 0.000 description 1
- YIVJZNGAASQVEM-UHFFFAOYSA-N Lauroyl peroxide Chemical compound CCCCCCCCCCCC(=O)OOC(=O)CCCCCCCCCCC YIVJZNGAASQVEM-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 238000007171 acid catalysis Methods 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 238000012644 addition polymerization Methods 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 230000003113 alkalizing effect Effects 0.000 description 1
- 125000005011 alkyl ether group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- BSVQJWUUZCXSOL-UHFFFAOYSA-N cyclohexylsulfonyl ethaneperoxoate Chemical compound CC(=O)OOS(=O)(=O)C1CCCCC1 BSVQJWUUZCXSOL-UHFFFAOYSA-N 0.000 description 1
- 229960002887 deanol Drugs 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- LSXWFXONGKSEMY-UHFFFAOYSA-N di-tert-butyl peroxide Chemical compound CC(C)(C)OOC(C)(C)C LSXWFXONGKSEMY-UHFFFAOYSA-N 0.000 description 1
- 239000012972 dimethylethanolamine Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000007720 emulsion polymerization reaction Methods 0.000 description 1
- 238000003912 environmental pollution Methods 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- MQLVWQSVRZVNIP-UHFFFAOYSA-L ferrous ammonium sulfate hexahydrate Chemical compound [NH4+].[NH4+].O.O.O.O.O.O.[Fe+2].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O MQLVWQSVRZVNIP-UHFFFAOYSA-L 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000009477 glass transition Effects 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 239000011259 mixed solution Substances 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 230000006911 nucleation Effects 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 239000003505 polymerization initiator Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 235000002639 sodium chloride Nutrition 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- QEGWXXRNPXRLHH-UHFFFAOYSA-N triazine;1,3,5-triazine-2,4,6-triamine Chemical compound C1=CN=NN=C1.NC1=NC(N)=NC(N)=N1 QEGWXXRNPXRLHH-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F2/00—Processes of polymerisation
- C08F2/12—Polymerisation in non-solvents
- C08F2/16—Aqueous medium
- C08F2/22—Emulsion polymerisation
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F246/00—Copolymers in which the nature of only the monomers in minority is defined
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Polymerisation Methods In General (AREA)
- Paints Or Removers (AREA)
- Polymerization Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7841770 | 1978-10-24 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2943030A1 DE2943030A1 (de) | 1980-05-08 |
| DE2943030C2 true DE2943030C2 (enExample) | 1989-01-19 |
Family
ID=10500554
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19792943030 Granted DE2943030A1 (de) | 1978-10-24 | 1979-10-24 | Verfahren zur herstellung einer waessrigen emulsion eines mischpolymers |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4305859A (enExample) |
| JP (1) | JPS5565209A (enExample) |
| AU (1) | AU525388B2 (enExample) |
| BE (1) | BE879575A (enExample) |
| CA (1) | CA1145871A (enExample) |
| DE (1) | DE2943030A1 (enExample) |
| FR (1) | FR2439793A1 (enExample) |
| IT (1) | IT1207274B (enExample) |
| MX (1) | MX152295A (enExample) |
| NZ (1) | NZ191816A (enExample) |
| ZA (1) | ZA795542B (enExample) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ205206A (en) * | 1982-08-12 | 1986-07-11 | Scm Corp | Water-dispersed coating compositions containing alkylol acrylamide-containing copolymers |
| US4447065A (en) * | 1983-02-28 | 1984-05-08 | The General Tire & Rubber Company | Sealing strip |
| US4503173A (en) * | 1983-12-19 | 1985-03-05 | Scm Corporation | Self-curing water dispersed polymer blends |
| US5053448A (en) * | 1989-07-21 | 1991-10-01 | S. C. Johnson & Son, Inc. | Polymeric thickener and methods of producing the same |
| US5232972A (en) * | 1989-08-31 | 1993-08-03 | Bridgestone Corporation | Adhesive composition |
| CA2065100A1 (en) * | 1991-04-05 | 1992-10-06 | Masami Uemae | Aqueous dispersion of acrylic polymer |
| DE4206766A1 (de) * | 1991-11-21 | 1993-09-09 | Basf Ag | Schlagzaeh modifizierte thermoplastische formmasse |
| US5266628A (en) * | 1992-03-31 | 1993-11-30 | Ppg Industries, Inc. | Water based coating composition with improved process resistance |
| US5636895A (en) * | 1992-10-27 | 1997-06-10 | Toyoda Gosei Co., Ltd. | Seal structure for weather strip |
| DE69420378T2 (de) * | 1993-12-23 | 1999-12-30 | Nitto Denko Corp., Ibaraki | Verfahren zur Herstellung einer wässrigen Dispersion eines Acrylpolymeren, Acrylpolymer so hergestellt, und druckempfindlicher Klebstoff, der dieses Polymer enthält |
| US5800873A (en) * | 1994-10-03 | 1998-09-01 | Basf Lacke+Farben Ag | Process for the production of sealed packaging containers and the use of a sealing coating for coating plastics films |
| EP1615966B2 (en) | 2003-04-02 | 2019-10-09 | Swimc Llc | Aqueous dispersions and coatings |
| US7270937B2 (en) * | 2003-10-17 | 2007-09-18 | Hynix Semiconductor Inc. | Over-coating composition for photoresist and process for forming photoresist pattern using the same |
| BRPI0517414B1 (pt) | 2004-10-20 | 2016-11-16 | Valspar Sourcing Inc | método para revestir lata para alimento ou bebida, lata para alimento ou bebida, e, composição para pulverização na parte interna para uso no revestimento de uma lata para alimento ou bebida |
| KR101440645B1 (ko) | 2006-09-19 | 2014-09-22 | 발스파 소싱 인코포레이티드 | 식품 및 음료의 코팅된 용기, 그의 코팅 방법 및 코팅 조성물 |
| US9029470B2 (en) | 2009-02-24 | 2015-05-12 | Akzo Nobel Coatings International B.V. | Latex emulsions and coating compositions formed from latex emulsions |
| EP3208289A1 (en) | 2009-07-17 | 2017-08-23 | Valspar Sourcing, Inc. | Coating composition and articles coated therewith |
| CN105377922B (zh) | 2013-07-02 | 2019-06-28 | 宣伟投资管理有限公司 | 用于包装制品诸如食品和饮料容器的涂料组合物 |
| WO2015002958A1 (en) | 2013-07-02 | 2015-01-08 | Valspar Sourcing, Inc. | Coating compositions for packaging articles such as food and beverage containers |
| EP4516861A3 (en) | 2014-12-24 | 2025-03-26 | Swimc LLC | Coating compositions for packaging articles such as food and beverage containers |
| CN107109104B (zh) | 2014-12-24 | 2021-01-26 | 宣伟投资管理有限公司 | 用于包装制品例如食品和饮料容器的不含苯乙烯的涂料组合物 |
| US11059989B2 (en) | 2017-06-30 | 2021-07-13 | Valspar Sourcing, Inc. | Crosslinked coating compositions for packaging articles such as food and beverage containers |
| US11981822B2 (en) | 2014-12-24 | 2024-05-14 | Swimc Llc | Crosslinked coating compositions for packaging articles such as food and beverage containers |
| AR108133A1 (es) | 2016-04-15 | 2018-07-18 | Valspar Sourcing Inc | Composiciones de revestimiento que contienen copolímeros libres de estireno |
| MX2019004562A (es) | 2016-10-19 | 2019-08-05 | Swimc Llc | Polimeros acrilicos y composiciones que contienen tales polimeros. |
| JP7703322B2 (ja) | 2017-09-01 | 2025-07-07 | エスダブリューアイエムシー・エルエルシー | 多段階ポリマーラテックス、そのようなラテックスを含有するコーティング組成物、及びそれによりコーティングされた物品 |
| KR102697657B1 (ko) | 2017-09-01 | 2024-08-23 | 에스더블유아이엠씨 엘엘씨 | 멀티-스테이지 중합체 라텍스, 그러한 라텍스를 함유하는 코팅 조성물, 및 이로 코팅된 물품 |
| CN113072901A (zh) * | 2021-04-12 | 2021-07-06 | 东莞市冠力胶业有限公司 | 一种吸塑卡纸用水性胶水 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE539963A (enExample) * | 1954-07-23 | |||
| US3247139A (en) * | 1962-01-02 | 1966-04-19 | Pittsburgh Plate Glass Co | Interpolymers of etherified aldehydemodified carboxylic acid amides |
| GB1252153A (enExample) * | 1968-04-30 | 1971-11-03 | ||
| US3970628A (en) * | 1972-07-14 | 1976-07-20 | Canadian Industries, Ltd. | Aqueous dispersions of thermosettable synthetic addition polymers with 1,2-epoxy resin plasticizer |
| US3882070A (en) * | 1973-05-23 | 1975-05-06 | Arco Polymers Inc | Persulfate stabilized latices |
| US3845066A (en) * | 1973-10-01 | 1974-10-29 | Du Pont | Aqueous based thermosetting acrylamide-acrylic copolymer coating composition |
| US3865772A (en) * | 1973-12-05 | 1975-02-11 | Dart Ind Inc | Polymerization process |
| US4097438A (en) * | 1974-05-16 | 1978-06-27 | Ppg Industries, Inc. | Water-based liners for beverage containers |
| US4125696A (en) * | 1977-01-06 | 1978-11-14 | Pennwalt Corporation | Polymerization process using di-t-butyl diperoxycarbonate as a finishing catalyst |
-
1979
- 1979-10-10 NZ NZ191816A patent/NZ191816A/xx unknown
- 1979-10-10 CA CA000337321A patent/CA1145871A/en not_active Expired
- 1979-10-17 ZA ZA00795542A patent/ZA795542B/xx unknown
- 1979-10-18 AU AU51899/79A patent/AU525388B2/en not_active Ceased
- 1979-10-22 BE BE0/197775A patent/BE879575A/fr not_active IP Right Cessation
- 1979-10-23 FR FR7926264A patent/FR2439793A1/fr active Granted
- 1979-10-23 MX MX179736A patent/MX152295A/es unknown
- 1979-10-23 US US06/087,570 patent/US4305859A/en not_active Expired - Lifetime
- 1979-10-24 IT IT7926748A patent/IT1207274B/it active
- 1979-10-24 JP JP13652079A patent/JPS5565209A/ja active Granted
- 1979-10-24 DE DE19792943030 patent/DE2943030A1/de active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| AU5189979A (en) | 1980-05-01 |
| FR2439793A1 (fr) | 1980-05-23 |
| NZ191816A (en) | 1981-03-16 |
| US4305859A (en) | 1981-12-15 |
| CA1145871A (en) | 1983-05-03 |
| ZA795542B (en) | 1980-10-29 |
| MX152295A (es) | 1985-06-24 |
| JPS6327368B2 (enExample) | 1988-06-02 |
| IT1207274B (it) | 1989-05-17 |
| DE2943030A1 (de) | 1980-05-08 |
| BE879575A (fr) | 1980-04-22 |
| IT7926748A0 (it) | 1979-10-24 |
| AU525388B2 (en) | 1982-11-04 |
| JPS5565209A (en) | 1980-05-16 |
| FR2439793B1 (enExample) | 1983-06-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2943030A1 (de) | Verfahren zur herstellung einer waessrigen emulsion eines mischpolymers | |
| EP0795568B1 (de) | Wässrige Polymerdispersionen als Bindemittel für elastische block- und kratzfeste Beschichtungen | |
| DE2640967C2 (de) | Verfahren zur Herstellung von hitzehärtbaren, selbstvernetzenden Harzen | |
| DE2760188C2 (enExample) | ||
| DE69304688T2 (de) | Beschichtungszusammensetzung auf wasserbasis mit verbesserter verarbeitungsbeständigkeit | |
| DE2709308C2 (enExample) | ||
| EP0003235A1 (de) | Wasserlösliche Copolymerisate auf der Basis von hydrophilen äthylenisch ungesättigten Monomeren;Verfahren zur Herstellung dieser Copolymerisate und ihre Verwendung | |
| DE2513515B2 (de) | Waessrige ueberzugsmasse | |
| DE4027594A1 (de) | Wasserverduennbares copolymerisat, dessen herstellung und verwendung, sowie waessrige ueberzugsmittel | |
| EP0727441A2 (de) | Verfahren zur Herstellung von emulgatorfreien wässrigen Polymerdispersionen | |
| EP0208194B1 (de) | Bindemittel für wässrige, physikalisch trocknende Korrosionsschutzanstriche auf Basis einer Phosphorsäure-monoalkylester enthaltenden Polymer-Dispersion | |
| EP0332011B1 (de) | Herstellung von wässrigen Polyalkylmethacrylat-Dispersionen durch Emulsionspolymerisation in zwei Stufen und deren Verwendung in Holzlacken | |
| DE2524432B2 (de) | Wäßrige Anstrichsdispersion, sowie Verfahren zur Herstellung einer wäßrigen Anstrichsdispersion | |
| EP0655481A1 (de) | Wässrige Polymerdispersionen als Bindemittel für blockfeste, kratzfeste und chemikalienbeständige Beschichtungen | |
| DE2854989C3 (de) | Pulverüberzugspräparat | |
| EP0022514B1 (de) | Wässrige Dispersion auf Grundlage von (Meth-)Acrylsäurederivaten, ihre Herstellung und Verwendung | |
| DE3622566C2 (enExample) | ||
| DE2840574A1 (de) | Zusammensetzung eines wasser-reduzierbaren acryl-emaillelackes | |
| DE2633267A1 (de) | Modifizierte vinylpolymere, sie enthaltende zusammensetzungen und herstellungsverfahren | |
| DE2306808B2 (de) | Copolymere auf Vinylchloridbasis | |
| DE2913751C2 (de) | Verfahren zur Herstellung eines Pfropfcopolymerisats und dessen Verwendung als Grundiermittel | |
| DE2531802A1 (de) | Beschichtungszusammensetzungen auf wasserbasis | |
| DE2355813A1 (de) | Verfahren zur herstellung von dispersionen, die monomerenfreie polymerisate bzw. copolymerisate im waesserigen medium enthalten | |
| DE1949497A1 (de) | Dispersions-Anstrichstoffe | |
| DE2316919B2 (de) | Copolymere auf der Basis von Vinylchlorid sowie Verfahren zu ihrer Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OAM | Search report available | ||
| OC | Search report available | ||
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |