DE2926852A1 - Verfahren zur herstellung von cyclopropannitrilen - Google Patents
Verfahren zur herstellung von cyclopropannitrilenInfo
- Publication number
- DE2926852A1 DE2926852A1 DE2926852A DE2926852A DE2926852A1 DE 2926852 A1 DE2926852 A1 DE 2926852A1 DE 2926852 A DE2926852 A DE 2926852A DE 2926852 A DE2926852 A DE 2926852A DE 2926852 A1 DE2926852 A1 DE 2926852A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- carboxylic acid
- cyclopropanenitrile
- reaction
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000004519 manufacturing process Methods 0.000 title description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 16
- 238000006243 chemical reaction Methods 0.000 claims description 12
- -1 cyclopropanenitrile carboxylic acid ester Chemical class 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 10
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 9
- 150000001879 copper Chemical class 0.000 claims description 7
- 239000003513 alkali Substances 0.000 claims description 6
- 238000006114 decarboxylation reaction Methods 0.000 claims description 6
- 229910001508 alkali metal halide Inorganic materials 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 229910001615 alkaline earth metal halide Inorganic materials 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 238000009835 boiling Methods 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 claims description 2
- 239000000010 aprotic solvent Substances 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims description 2
- 150000008045 alkali metal halides Chemical class 0.000 claims 1
- 230000004048 modification Effects 0.000 claims 1
- 238000012986 modification Methods 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical group [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 239000003880 polar aprotic solvent Substances 0.000 description 5
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 125000004093 cyano group Chemical group *C#N 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 230000001476 alcoholic effect Effects 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical compound OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 239000003518 caustics Substances 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 2
- AUQDITHEDVOTCU-UHFFFAOYSA-N cyclopropyl cyanide Chemical compound N#CC1CC1 AUQDITHEDVOTCU-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000012485 toluene extract Substances 0.000 description 2
- KSJJMSKNZVXAND-UHFFFAOYSA-N 1-cyanocyclopropane-1-carboxylic acid Chemical compound OC(=O)C1(C#N)CC1 KSJJMSKNZVXAND-UHFFFAOYSA-N 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 229910000366 copper(II) sulfate Inorganic materials 0.000 description 1
- JZCCFEFSEZPSOG-UHFFFAOYSA-L copper(II) sulfate pentahydrate Chemical compound O.O.O.O.O.[Cu+2].[O-]S([O-])(=O)=O JZCCFEFSEZPSOG-UHFFFAOYSA-L 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- ZIUSEGSNTOUIPT-UHFFFAOYSA-N ethyl 2-cyanoacetate Chemical compound CCOC(=O)CC#N ZIUSEGSNTOUIPT-UHFFFAOYSA-N 0.000 description 1
- LDDOSDVZPSGLFZ-UHFFFAOYSA-N ethyl cyclopropanecarboxylate Chemical compound CCOC(=O)C1CC1 LDDOSDVZPSGLFZ-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000003444 phase transfer catalyst Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/45—Carboxylic acid nitriles having cyano groups bound to carbon atoms of rings other than six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7830210 | 1978-07-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2926852A1 true DE2926852A1 (de) | 1980-02-07 |
Family
ID=10498489
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2926852A Withdrawn DE2926852A1 (de) | 1978-07-18 | 1979-07-03 | Verfahren zur herstellung von cyclopropannitrilen |
Country Status (7)
| Country | Link |
|---|---|
| JP (1) | JPS5515498A (it) |
| AU (1) | AU4853579A (it) |
| DE (1) | DE2926852A1 (it) |
| DK (1) | DK276879A (it) |
| FR (1) | FR2431486A1 (it) |
| IT (1) | IT1207205B (it) |
| NL (1) | NL7905372A (it) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0021114A1 (de) * | 1979-06-12 | 1981-01-07 | Bayer Ag | Verfahren zur Herstellung von 2-Cyano-3,3-dimethyl-cyclopropan-1-carbonsäureestern, Zwischenprodukte hierfür und deren Herstellung |
| EP0021115A1 (de) * | 1979-06-12 | 1981-01-07 | Bayer Ag | Verfahren zur Herstellung von 3,3-Dimethyl-cyclopropan-1,1,2-tricarbonsäurederivaten sowie Alpha-Halogen-nitrile als neue Zwischenprodukte hierfür und Verfahren zu deren Herstellung |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5642550A (en) * | 1994-02-28 | 1997-07-01 | Ricoh Company, Ltd. | Apparatus for removing image forming substance from image holding member |
| JP3685448B2 (ja) | 2000-11-17 | 2005-08-17 | キヤノン株式会社 | 電気泳動表示装置 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4000180A (en) * | 1974-08-14 | 1976-12-28 | Imperial Chemical Industries Limited | Process for preparing 2-dihalovinyl-3,3-dimethyl cyclo propane derivatives |
| AU511383B2 (en) * | 1975-05-16 | 1980-08-14 | Imperial Chemical Industries Ltd | Intermediates inthe preparation of cyclopropanoid insecticides |
| GB1580203A (en) * | 1976-06-22 | 1980-11-26 | Shell Int Research | Preparation of cyclopropane derivatives |
| NZ185635A (en) * | 1976-11-18 | 1980-04-28 | Ici Ltd | Preparation of 3-dihalovinyl-2,2-dimethylcyclopropane carboxylic acid derivatives |
-
1979
- 1979-06-29 AU AU48535/79A patent/AU4853579A/en not_active Abandoned
- 1979-06-29 DK DK276879A patent/DK276879A/da unknown
- 1979-07-03 DE DE2926852A patent/DE2926852A1/de not_active Withdrawn
- 1979-07-06 IT IT7924156A patent/IT1207205B/it active
- 1979-07-10 NL NL7905372A patent/NL7905372A/nl not_active Application Discontinuation
- 1979-07-17 FR FR7918482A patent/FR2431486A1/fr active Pending
- 1979-07-18 JP JP9048679A patent/JPS5515498A/ja active Pending
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0021114A1 (de) * | 1979-06-12 | 1981-01-07 | Bayer Ag | Verfahren zur Herstellung von 2-Cyano-3,3-dimethyl-cyclopropan-1-carbonsäureestern, Zwischenprodukte hierfür und deren Herstellung |
| EP0021115A1 (de) * | 1979-06-12 | 1981-01-07 | Bayer Ag | Verfahren zur Herstellung von 3,3-Dimethyl-cyclopropan-1,1,2-tricarbonsäurederivaten sowie Alpha-Halogen-nitrile als neue Zwischenprodukte hierfür und Verfahren zu deren Herstellung |
Also Published As
| Publication number | Publication date |
|---|---|
| IT7924156A0 (it) | 1979-07-06 |
| FR2431486A1 (fr) | 1980-02-15 |
| IT1207205B (it) | 1989-05-17 |
| JPS5515498A (en) | 1980-02-02 |
| NL7905372A (nl) | 1980-01-22 |
| AU4853579A (en) | 1980-01-24 |
| DK276879A (da) | 1980-01-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2858248C2 (it) | ||
| DE1468553C2 (it) | ||
| DE2536145A1 (de) | Verfahren zur herstellung von cyclopropanderivaten | |
| DE2751610A1 (de) | Verfahren zur herstellung von cyclopropanderivaten | |
| DE2437882B2 (de) | Verfahren zur herstellung von estern des 3-phenoxybenzylalkohols | |
| DE2926852A1 (de) | Verfahren zur herstellung von cyclopropannitrilen | |
| EP1002786B1 (de) | Verfahren zur Herstellung von Trifluorbenzoesäuren | |
| DE2827101A1 (de) | Verfahren zur herstellung von chloro-styryl-cyclopropan-carbonsaeure- derivaten | |
| DE2630981C2 (de) | 4-β,β-Dichlor- und 4-β,β-Dibromvinyl-3,3-dimethylbutyrolactone, Verfahren zu ihrer Herstellung und deren Verwendung zur Herstellung von Estern der 3-β,β-Dichlor- oder 3-β,β-Dibrom-vinyl-2,2-dimethylcyclopropancarbonsäure | |
| CH633528A5 (de) | Verfahren zur herstellung von cyclopropanderivaten. | |
| DE2613817A1 (de) | Phenylpropionsaeuren, pyruvatverfahren zu ihrer herstellung und verwendung | |
| DE2443142C2 (de) | Verfahren zur Herstellung von Cyclopropancarbonsäurenitril | |
| DE2621830A1 (de) | Verfahren zur herstellung von cyclopropanderivaten | |
| EP0024588B1 (de) | Verfahren zur Herstellung von substituierten Cyclopropyl-carbonsäure-(alpha-cyano-3-phenoxy-benzyl)-estern | |
| DE1950280A1 (de) | Verfahren zur Herstellung von alpha-N-Formylaminosaeureverbindungen | |
| EP0302227B1 (de) | 5-Halogen-6-amino-nikotin-säurehalogenide, ihre Herstellung und ihre Verwendung | |
| DE2636384C2 (de) | Verfahren zur Herstellung von N,N-Diethyl-2-(α-naphthoxy)-propionamid | |
| EP0021114B1 (de) | Verfahren zur Herstellung von 2-Cyano-3,3-dimethyl-cyclopropan-1-carbonsäureestern, Zwischenprodukte hierfür und deren Herstellung | |
| DE2638453A1 (de) | Verfahren zur decarbalkoxylierung von carbonsaeureestern | |
| DE2926890C2 (it) | ||
| DE830193C (de) | Verfahren zur Herstellung von basischen Verbindungen | |
| EP0103749B1 (de) | Dialkoxymethyl-butyrolactone, Verfahren zu ihrer Herstellung, Zwischenprodukte dafür und ihre Verwendung | |
| DE2727613A1 (de) | Cyanosubstituierte cyclopropanderivate und verfahren zu ihrer herstellung | |
| DE2462459C3 (de) | 5-Halogen-pyrazo!-4-carboxa!dehyde und Verfahren zu ihrer Herstellung | |
| DE2458209A1 (de) | Verfahren zur herstellung von 3-alkylcyclopentan-1,2-dionen und ihre verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |