DE2918133C2 - Opake extrudierbare Zahnpasta - Google Patents
Opake extrudierbare ZahnpastaInfo
- Publication number
- DE2918133C2 DE2918133C2 DE2918133A DE2918133A DE2918133C2 DE 2918133 C2 DE2918133 C2 DE 2918133C2 DE 2918133 A DE2918133 A DE 2918133A DE 2918133 A DE2918133 A DE 2918133A DE 2918133 C2 DE2918133 C2 DE 2918133C2
- Authority
- DE
- Germany
- Prior art keywords
- toothpaste
- amount
- weight
- sodium
- opaque
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000606 toothpaste Substances 0.000 title claims description 46
- 229940034610 toothpaste Drugs 0.000 title claims description 34
- 239000003795 chemical substances by application Substances 0.000 claims description 21
- 235000019739 Dicalciumphosphate Nutrition 0.000 claims description 13
- 239000001506 calcium phosphate Substances 0.000 claims description 13
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 claims description 13
- 229940038472 dicalcium phosphate Drugs 0.000 claims description 13
- 229910000390 dicalcium phosphate Inorganic materials 0.000 claims description 13
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 9
- 238000005498 polishing Methods 0.000 claims description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 7
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 claims description 6
- 229910000503 Na-aluminosilicate Inorganic materials 0.000 claims description 5
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 5
- 239000000429 sodium aluminium silicate Substances 0.000 claims description 5
- 235000012217 sodium aluminium silicate Nutrition 0.000 claims description 5
- 239000000377 silicon dioxide Substances 0.000 claims description 4
- AQMNWCRSESPIJM-UHFFFAOYSA-M sodium metaphosphate Chemical compound [Na+].[O-]P(=O)=O AQMNWCRSESPIJM-UHFFFAOYSA-M 0.000 claims description 4
- 150000004684 trihydrates Chemical class 0.000 claims description 4
- 235000012239 silicon dioxide Nutrition 0.000 claims description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- -1 fatty acid esters Chemical class 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 230000000694 effects Effects 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 4
- 239000000194 fatty acid Substances 0.000 description 4
- 229930195729 fatty acid Natural products 0.000 description 4
- 235000011187 glycerol Nutrition 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000000600 sorbitol Substances 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- XGRSAFKZAGGXJV-UHFFFAOYSA-N 3-azaniumyl-3-cyclohexylpropanoate Chemical compound OC(=O)CC(N)C1CCCCC1 XGRSAFKZAGGXJV-UHFFFAOYSA-N 0.000 description 3
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 3
- MXRIRQGCELJRSN-UHFFFAOYSA-N O.O.O.[Al] Chemical compound O.O.O.[Al] MXRIRQGCELJRSN-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000003082 abrasive agent Substances 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 210000003298 dental enamel Anatomy 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 229940091249 fluoride supplement Drugs 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 229960004711 sodium monofluorophosphate Drugs 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 2
- BACYUWVYYTXETD-UHFFFAOYSA-N N-Lauroylsarcosine Chemical compound CCCCCCCCCCCC(=O)N(C)CC(O)=O BACYUWVYYTXETD-UHFFFAOYSA-N 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 210000004268 dentin Anatomy 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 210000000214 mouth Anatomy 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- ANOBYBYXJXCGBS-UHFFFAOYSA-L stannous fluoride Chemical compound F[Sn]F ANOBYBYXJXCGBS-UHFFFAOYSA-L 0.000 description 2
- JLPAMKUIIFHLBH-UHFFFAOYSA-N 1,2-dihydroxypropane-1-sulfonic acid Chemical class CC(O)C(O)S(O)(=O)=O JLPAMKUIIFHLBH-UHFFFAOYSA-N 0.000 description 1
- LDVVTQMJQSCDMK-UHFFFAOYSA-N 1,3-dihydroxypropan-2-yl formate Chemical compound OCC(CO)OC=O LDVVTQMJQSCDMK-UHFFFAOYSA-N 0.000 description 1
- LFJJOPDNPVFCNZ-UHFFFAOYSA-N 2-[hexadecanoyl(methyl)amino]acetic acid Chemical class CCCCCCCCCCCCCCCC(=O)N(C)CC(O)=O LFJJOPDNPVFCNZ-UHFFFAOYSA-N 0.000 description 1
- NGOZDSMNMIRDFP-UHFFFAOYSA-N 2-[methyl(tetradecanoyl)amino]acetic acid Chemical class CCCCCCCCCCCCCC(=O)N(C)CC(O)=O NGOZDSMNMIRDFP-UHFFFAOYSA-N 0.000 description 1
- UBLAMKHIFZBBSS-UHFFFAOYSA-N 3-Methylbutyl pentanoate Chemical compound CCCCC(=O)OCCC(C)C UBLAMKHIFZBBSS-UHFFFAOYSA-N 0.000 description 1
- DDFHBQSCUXNBSA-UHFFFAOYSA-N 5-(5-carboxythiophen-2-yl)thiophene-2-carboxylic acid Chemical compound S1C(C(=O)O)=CC=C1C1=CC=C(C(O)=O)S1 DDFHBQSCUXNBSA-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 241000206575 Chondrus crispus Species 0.000 description 1
- 229910021594 Copper(II) fluoride Inorganic materials 0.000 description 1
- 239000005696 Diammonium phosphate Substances 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- HVUMOYIDDBPOLL-XWVZOOPGSA-N Sorbitan monostearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O HVUMOYIDDBPOLL-XWVZOOPGSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- LGPZRLBWEIWWRS-UHFFFAOYSA-H [F-].[Zn+2].[Sn+4].[F-].[F-].[F-].[F-].[F-] Chemical compound [F-].[Zn+2].[Sn+4].[F-].[F-].[F-].[F-].[F-] LGPZRLBWEIWWRS-UHFFFAOYSA-H 0.000 description 1
- HFIGWKOFZLNOQK-UHFFFAOYSA-K [O-]P([O-])(=O)OP(=O)([O-])O.[Ca+2].[Na+] Chemical class [O-]P([O-])(=O)OP(=O)([O-])O.[Ca+2].[Na+] HFIGWKOFZLNOQK-UHFFFAOYSA-K 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- DNEHKUCSURWDGO-UHFFFAOYSA-N aluminum sodium Chemical compound [Na].[Al] DNEHKUCSURWDGO-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000002280 amphoteric surfactant Substances 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- OYLGJCQECKOTOL-UHFFFAOYSA-L barium fluoride Chemical compound [F-].[F-].[Ba+2] OYLGJCQECKOTOL-UHFFFAOYSA-L 0.000 description 1
- 229910001632 barium fluoride Inorganic materials 0.000 description 1
- UREZNYTWGJKWBI-UHFFFAOYSA-M benzethonium chloride Chemical compound [Cl-].C1=CC(C(C)(C)CC(C)(C)C)=CC=C1OCCOCC[N+](C)(C)CC1=CC=CC=C1 UREZNYTWGJKWBI-UHFFFAOYSA-M 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- ATNHDLDRLWWWCB-AENOIHSZSA-M chlorophyll a Chemical class C1([C@@H](C(=O)OC)C(=O)C2=C3C)=C2N2C3=CC(C(CC)=C3C)=[N+]4C3=CC3=C(C=C)C(C)=C5N3[Mg-2]42[N+]2=C1[C@@H](CCC(=O)OC\C=C(/C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C@H](C)C2=C5 ATNHDLDRLWWWCB-AENOIHSZSA-M 0.000 description 1
- 230000001609 comparable effect Effects 0.000 description 1
- GWFAVIIMQDUCRA-UHFFFAOYSA-L copper(ii) fluoride Chemical compound [F-].[F-].[Cu+2] GWFAVIIMQDUCRA-UHFFFAOYSA-L 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- UOCIZHQMWNPGEN-UHFFFAOYSA-N dialuminum;oxygen(2-);trihydrate Chemical compound O.O.O.[O-2].[O-2].[O-2].[Al+3].[Al+3] UOCIZHQMWNPGEN-UHFFFAOYSA-N 0.000 description 1
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 1
- 229910000388 diammonium phosphate Inorganic materials 0.000 description 1
- 235000019838 diammonium phosphate Nutrition 0.000 description 1
- DGTVXEHQMSJRPE-UHFFFAOYSA-M difluorophosphinate Chemical compound [O-]P(F)(F)=O DGTVXEHQMSJRPE-UHFFFAOYSA-M 0.000 description 1
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229910001506 inorganic fluoride Inorganic materials 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 125000005341 metaphosphate group Chemical group 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 230000003020 moisturizing effect Effects 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000006353 oxyethylene group Chemical group 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- FSYKKLYZXJSNPZ-UHFFFAOYSA-N sarcosine Chemical class C[NH2+]CC([O-])=O FSYKKLYZXJSNPZ-UHFFFAOYSA-N 0.000 description 1
- 108700004121 sarkosyl Proteins 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
- 239000001587 sorbitan monostearate Substances 0.000 description 1
- 235000011076 sorbitan monostearate Nutrition 0.000 description 1
- 229940035048 sorbitan monostearate Drugs 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- SFVFIFLLYFPGHH-UHFFFAOYSA-M stearalkonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 SFVFIFLLYFPGHH-UHFFFAOYSA-M 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- YUOWTJMRMWQJDA-UHFFFAOYSA-J tin(iv) fluoride Chemical class [F-].[F-].[F-].[F-].[Sn+4] YUOWTJMRMWQJDA-UHFFFAOYSA-J 0.000 description 1
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q11/00—Preparations for care of the teeth, of the oral cavity or of dentures; Dentifrices, e.g. toothpastes; Mouth rinses
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/19—Cosmetics or similar toiletry preparations characterised by the composition containing inorganic ingredients
- A61K8/26—Aluminium; Compounds thereof
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Birds (AREA)
- Epidemiology (AREA)
- Oral & Maxillofacial Surgery (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB24226/78A GB1587980A (en) | 1978-05-30 | 1978-05-30 | Dentifrices |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2918133A1 DE2918133A1 (de) | 1979-12-13 |
| DE2918133C2 true DE2918133C2 (de) | 1982-12-02 |
Family
ID=10208384
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2918133A Expired DE2918133C2 (de) | 1978-05-30 | 1979-05-05 | Opake extrudierbare Zahnpasta |
Country Status (19)
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4425324A (en) | 1981-05-11 | 1984-01-10 | Colgate-Palmolive Company | Hazed toothpaste |
| US4356168A (en) * | 1981-05-11 | 1982-10-26 | Colgate-Palmolive Company | Opacified dental cream containing a binary fluorine-providing system |
| GB2109683B (en) * | 1981-11-19 | 1985-09-11 | Colgate Palmolive Co | Stable dentifrice |
| GB2109682B (en) * | 1981-11-19 | 1985-09-11 | Colgate Palmolive Co | Stable dentifrice |
| JPH10500993A (ja) * | 1994-08-31 | 1998-01-27 | ジエイ エム ヒユーバー コーポレイシヨン | 新規なアルミノ珪酸ナトリウム塩類を含む費用効果性の高い歯科用組成物 |
| US6342205B1 (en) * | 1999-10-29 | 2002-01-29 | J. M. Huber Corporation | High water content dentifrice composition and method of making the same |
| RU2153322C1 (ru) * | 1999-12-22 | 2000-07-27 | Общество с ограниченной ответственностью Институт фармацевтических реактивов "Рефарм" | Зубная паста |
| US6174515B1 (en) | 2000-06-05 | 2001-01-16 | Amway Corporation | Toothpaste composition |
| GB0400408D0 (en) * | 2004-01-09 | 2004-02-11 | Ineos Silicas Ltd | Dentifrice compositions containing zeolites |
| MX359752B (es) * | 2013-12-23 | 2018-10-01 | Colgate Palmolive Co | Composiciones para el cuidado oral con tincion de superficie reducida. |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2107827B1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1970-09-21 | 1976-06-04 | Colgate Palmolive Co | |
| ZA722246B (en) * | 1971-04-30 | 1973-11-28 | Colgate Palmolive Co | Clear dentifrice |
| BE789477A (fr) * | 1971-10-01 | 1973-01-15 | Colgate Palmolive Co | Procede de fabrication de dentifrices exempts de gaz |
| US3946108A (en) * | 1971-11-26 | 1976-03-23 | Colgate-Palmolive Company | Dentifrice |
| US3929987A (en) * | 1972-07-03 | 1975-12-30 | Colgate Palmolive Co | Toothpaste |
| US3935305A (en) * | 1972-10-04 | 1976-01-27 | Colgate-Palmolive Company | Toothpaste |
| US3935304A (en) * | 1972-10-04 | 1976-01-27 | Colgate-Palmolive Company | Dental creams |
| US3944661A (en) * | 1972-12-29 | 1976-03-16 | Colgate-Palmolive Company | Dentifrices containing iridescent flakes |
| US4020154A (en) * | 1973-01-22 | 1977-04-26 | Colgate-Palmolive Company | Manufacture of gas-free dentifrice |
| US4069311A (en) * | 1974-11-04 | 1978-01-17 | Colgate Palmolive Company | Oral dentifrice containing uniform particles of speckling material |
| US4144322A (en) * | 1975-01-28 | 1979-03-13 | Colgate Palmolive Company | Reduction of abrasiveness in dentrifices |
| US4060599A (en) * | 1975-03-25 | 1977-11-29 | Colgate-Palmolive Company | Dentifrices |
| GB1476063A (en) * | 1976-01-26 | 1977-06-10 | Boots Co Ltd | Dentifrice |
| US4130636A (en) * | 1977-07-27 | 1978-12-19 | Colgate-Palmolive Company | Dentifrice |
| DE2757290A1 (de) * | 1977-12-22 | 1979-07-05 | Blendax Werke Schneider Co | Zahnpasta |
-
1978
- 1978-05-30 GB GB24226/78A patent/GB1587980A/en not_active Expired
-
1979
- 1979-04-17 ZA ZA791806A patent/ZA791806B/xx unknown
- 1979-04-20 NZ NZ190241A patent/NZ190241A/xx unknown
- 1979-05-01 AU AU46622/79A patent/AU523150B2/en not_active Ceased
- 1979-05-05 DE DE2918133A patent/DE2918133C2/de not_active Expired
- 1979-05-09 MX MX177586A patent/MX152644A/es unknown
- 1979-05-10 AT AT0347179A patent/AT375015B/de not_active IP Right Cessation
- 1979-05-11 NL NL7903744A patent/NL7903744A/xx not_active Application Discontinuation
- 1979-05-15 SE SE7904250A patent/SE442586C/sv not_active IP Right Cessation
- 1979-05-21 IT IT49107/79A patent/IT1116875B/it active
- 1979-05-24 PH PH22560A patent/PH18249A/en unknown
- 1979-05-24 CA CA328,250A patent/CA1123340A/en not_active Expired
- 1979-05-29 JP JP6670379A patent/JPS54157844A/ja active Granted
- 1979-05-29 DK DK220379A patent/DK155818C/da not_active IP Right Cessation
- 1979-05-29 FR FR7913641A patent/FR2427093B1/fr not_active Expired
- 1979-05-29 CH CH501579A patent/CH641040A5/de not_active IP Right Cessation
- 1979-05-29 BE BE0/195451A patent/BE876612A/xx not_active IP Right Cessation
- 1979-12-17 US US06/104,492 patent/US4264579A/en not_active Expired - Lifetime
-
1983
- 1983-12-30 MY MY67/83A patent/MY8300067A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS54157844A (en) | 1979-12-13 |
| IT7949107A0 (it) | 1979-05-21 |
| AU523150B2 (en) | 1982-07-15 |
| MX152644A (es) | 1985-10-04 |
| SE7904250L (sv) | 1979-12-01 |
| SE442586B (sv) | 1986-01-20 |
| DE2918133A1 (de) | 1979-12-13 |
| US4264579A (en) | 1981-04-28 |
| JPS635370B2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1988-02-03 |
| CA1123340A (en) | 1982-05-11 |
| DK220379A (da) | 1979-12-01 |
| CH641040A5 (de) | 1984-02-15 |
| NZ190241A (en) | 1981-02-11 |
| AU4662279A (en) | 1980-03-20 |
| AT375015B (de) | 1984-06-25 |
| MY8300067A (en) | 1983-12-31 |
| ZA791806B (en) | 1980-11-26 |
| DK155818C (da) | 1989-10-02 |
| BE876612A (fr) | 1979-09-17 |
| PH18249A (en) | 1985-05-03 |
| GB1587980A (en) | 1981-04-15 |
| IT1116875B (it) | 1986-02-10 |
| ATA347179A (de) | 1982-07-15 |
| DK155818B (da) | 1989-05-22 |
| NL7903744A (nl) | 1979-12-04 |
| FR2427093B1 (fr) | 1985-08-30 |
| FR2427093A1 (fr) | 1979-12-28 |
| SE442586C (sv) | 1987-11-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3017417C2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| DE69522967T2 (de) | Zahnpasta | |
| CH640728A5 (de) | Zahnpflegemittel. | |
| DE69514387T2 (de) | Bildung stabiler wässriger lösungen von zinnverbindungen | |
| DE3044448C2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| EP0036439B1 (de) | Zahncreme mit hohem Schaumvermögen | |
| DE2600709A1 (de) | Zahnpasta | |
| DE69917465T2 (de) | Zahnpasta auf basis von feinteiligem und grossteiligem kalziumcarbonat | |
| DE2918133C2 (de) | Opake extrudierbare Zahnpasta | |
| DE3222794A1 (de) | Zahnpflegemittel | |
| DE3610385A1 (de) | Zahnpflegemittel | |
| DE3310617A1 (de) | Zahnpflegemittel | |
| DE3102557A1 (de) | Keine flecken bildendes, gegen zahnfleischentzuendungen wirkendes mundpflegemittel | |
| DE3046770C2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| CH644753A5 (de) | Zahnpasta. | |
| DE1492027B2 (de) | Natriummonofluorphosphat enthaltende zahnpaste | |
| CH649705A5 (de) | Zahnpflegemittel. | |
| DE2146224B2 (de) | Zahnpflegemittel | |
| DE2918132C2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| DE3212486A1 (de) | Zahnpflegemittel | |
| DE2402273C2 (de) | Zahnreinigungsmittel | |
| DE2347787A1 (de) | Zahnpasta | |
| DE2254109A1 (de) | Koerniges material, insbesondere zur verwendung in zahnreinigungsmitteln, sowie verfahren zu dessen herstellung | |
| DE2011003A1 (de) | Zahnpflegemittel | |
| DE2218604B2 (de) | Klares Zahngel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8339 | Ceased/non-payment of the annual fee |