DE2918000C2 - Nematische kristallin-flüssige Mischungen - Google Patents
Nematische kristallin-flüssige MischungenInfo
- Publication number
- DE2918000C2 DE2918000C2 DE2918000A DE2918000A DE2918000C2 DE 2918000 C2 DE2918000 C2 DE 2918000C2 DE 2918000 A DE2918000 A DE 2918000A DE 2918000 A DE2918000 A DE 2918000A DE 2918000 C2 DE2918000 C2 DE 2918000C2
- Authority
- DE
- Germany
- Prior art keywords
- nematic
- crystalline
- liquid
- tetrazine
- liquid mixtures
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000007788 liquid Substances 0.000 title claims description 14
- 239000000203 mixture Substances 0.000 title claims description 12
- 239000000126 substance Substances 0.000 claims description 10
- 239000000975 dye Substances 0.000 claims description 8
- 230000000694 effects Effects 0.000 claims description 7
- 239000011159 matrix material Substances 0.000 claims description 3
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical class C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 claims description 2
- 239000004973 liquid crystal related substance Substances 0.000 description 6
- 230000033458 reproduction Effects 0.000 description 5
- 230000005684 electric field Effects 0.000 description 4
- 230000005693 optoelectronics Effects 0.000 description 4
- -1 4-cyano-phenyl ester Chemical class 0.000 description 3
- 239000004988 Nematic liquid crystal Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 230000007774 longterm Effects 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- 230000010287 polarization Effects 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- 150000004905 tetrazines Chemical class 0.000 description 2
- HTJMXYRLEDBSLT-UHFFFAOYSA-N 1,2,4,5-tetrazine Chemical class C1=NN=CN=N1 HTJMXYRLEDBSLT-UHFFFAOYSA-N 0.000 description 1
- LGCWNHQHPFBPBP-UHFFFAOYSA-N 2-(4-hexoxyphenyl)-5-hexylpyrimidine Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NC=C(CCCCCC)C=N1 LGCWNHQHPFBPBP-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- BALGERHMIXFENA-UHFFFAOYSA-N 4-butylcyclohexane-1-carboxylic acid Chemical compound CCCCC1CCC(C(O)=O)CC1 BALGERHMIXFENA-UHFFFAOYSA-N 0.000 description 1
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- RVLAXPQGTRTHEV-UHFFFAOYSA-N 4-pentylcyclohexane-1-carboxylic acid Chemical compound CCCCCC1CCC(C(O)=O)CC1 RVLAXPQGTRTHEV-UHFFFAOYSA-N 0.000 description 1
- QCNUKEGGHOLBES-UHFFFAOYSA-N 4-propylcyclohexane-1-carboxylic acid Chemical compound CCCC1CCC(C(O)=O)CC1 QCNUKEGGHOLBES-UHFFFAOYSA-N 0.000 description 1
- IBHYWHYCYDQWOR-UHFFFAOYSA-N 5-hexyl-2-(4-nonylphenyl)pyrimidine Chemical compound C1=CC(CCCCCCCCC)=CC=C1C1=NC=C(CCCCCC)C=N1 IBHYWHYCYDQWOR-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K19/00—Liquid crystal materials
- C09K19/52—Liquid crystal materials characterised by components which are not liquid crystals, e.g. additives with special physical aspect: solvents, solid particles
- C09K19/60—Pleochroic dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Crystallography & Structural Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Liquid Crystal (AREA)
- Liquid Crystal Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DD20603878A DD137242B1 (de) | 1978-06-16 | 1978-06-16 | Nematische kristallin-fluessige mischungen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2918000A1 DE2918000A1 (de) | 1980-01-03 |
| DE2918000C2 true DE2918000C2 (de) | 1986-11-27 |
Family
ID=5513094
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2918000A Expired DE2918000C2 (de) | 1978-06-16 | 1979-05-04 | Nematische kristallin-flüssige Mischungen |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4348298A (OSRAM) |
| JP (1) | JPS5516079A (OSRAM) |
| CH (1) | CH645399A5 (OSRAM) |
| DD (1) | DD137242B1 (OSRAM) |
| DE (1) | DE2918000C2 (OSRAM) |
| FR (1) | FR2428666A1 (OSRAM) |
| GB (1) | GB2025449B (OSRAM) |
| HU (1) | HU185202B (OSRAM) |
| SU (1) | SU1484827A1 (OSRAM) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD137118B1 (de) * | 1978-02-06 | 1980-10-01 | Hermann Schubert | Elektrooptische anordnung zur lichtmodulation oder symbolanzeige |
| US4358589A (en) * | 1979-02-02 | 1982-11-09 | Veb Werk Fur Fernsehelektronik Im Veb Kombinat Mikroelektronik | Nematic liquid crystal compounds |
| US4273929A (en) * | 1979-02-05 | 1981-06-16 | Hoffmann-La Roche Inc. | Heterocyclic compounds |
| JPS5662874A (en) * | 1979-10-29 | 1981-05-29 | Sharp Corp | Display device of liquid crystal |
| DE3152228A1 (de) * | 1980-07-31 | 1983-01-13 | L Blinov | Derivatives of 2,2-azoimidazole,method for the preparation thereof,liquid crystal material and electro-optical device |
| CH645102A5 (de) * | 1980-10-14 | 1984-09-14 | Hoffmann La Roche | Disubstituierte pyrimidine. |
| CH651025A5 (de) * | 1982-05-14 | 1985-08-30 | Hoffmann La Roche | Pyridazine und ihre verwendung als komponenten fluessigkristalliner gemische. |
| US4452718A (en) * | 1981-07-31 | 1984-06-05 | Hoffmann-La Roche Inc. | Pyridazines |
| JPS5857488A (ja) * | 1981-10-02 | 1983-04-05 | Mitsubishi Chem Ind Ltd | ゲスト−ホスト型液晶組成物 |
| DE3380031D1 (en) * | 1982-06-30 | 1989-07-13 | Hitachi Ltd | Liquid crystal composition |
| JPS5939876A (ja) * | 1982-08-26 | 1984-03-05 | Chisso Corp | ピリミジン誘導体 |
| DE3524489A1 (de) * | 1984-07-12 | 1986-01-23 | Kabushiki Kaisha Suwa Seikosha, Tokio/Tokyo | 2-phenylpyridinderivate und verfahren zu ihrer herstellung |
| DE3889490T2 (de) * | 1987-03-31 | 1994-12-01 | Ajinomoto Kk | Phenylpyrimidin-Flüssigkristall-Verbindungen und sie enthaltende Flüssigkristall-Zusammensetzungen. |
| DE3930119A1 (de) * | 1989-04-08 | 1990-10-11 | Merck Patent Gmbh | Trifluormethylcyclohexan-derivate |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1052877A (OSRAM) * | 1962-12-03 | |||
| US3703329A (en) * | 1969-12-29 | 1972-11-21 | Rca Corp | Liquid crystal color display |
| ZA73911B (en) * | 1972-03-15 | 1973-11-28 | Minnesota Mining & Mfg | Electrographic development process |
| JPS5328102B2 (OSRAM) * | 1973-04-16 | 1978-08-12 | ||
| DD105701A1 (OSRAM) * | 1973-07-02 | 1974-05-05 | ||
| SU498300A1 (ru) * | 1973-11-27 | 1976-01-05 | Институт Органической Химии Ан Украинской Сср | Способ получени производных 3,6-диарил-симм-тетразина |
| US4145114A (en) * | 1975-06-17 | 1979-03-20 | The Secretary Of State For Defence In Her Britannic Majesty's Government Of The United Kingdom Of Great Britain And Northern Ireland | Pleochroic dyes |
| CH594897A5 (OSRAM) * | 1976-06-23 | 1978-01-31 | Bbc Brown Boveri & Cie | |
| DD132591A1 (de) * | 1977-08-31 | 1978-10-11 | Dietrich Demus | Nematische fluessig-kristalline gemische |
| DD138558A1 (de) * | 1977-12-08 | 1979-11-07 | Frank Kuschel | Nematische fluessig-kristalline gemische |
| DD137117B1 (de) * | 1978-01-23 | 1980-10-01 | Hermann Schubert | Nematische kristallin-fluessige substanzen |
| DD137118B1 (de) * | 1978-02-06 | 1980-10-01 | Hermann Schubert | Elektrooptische anordnung zur lichtmodulation oder symbolanzeige |
-
1978
- 1978-06-16 DD DD20603878A patent/DD137242B1/de not_active IP Right Cessation
-
1979
- 1979-05-04 DE DE2918000A patent/DE2918000C2/de not_active Expired
- 1979-05-22 SU SU797770594A patent/SU1484827A1/ru active
- 1979-05-23 GB GB7917962A patent/GB2025449B/en not_active Expired
- 1979-05-29 CH CH497079A patent/CH645399A5/de not_active IP Right Cessation
- 1979-06-13 HU HU79FE1047A patent/HU185202B/hu not_active IP Right Cessation
- 1979-06-15 FR FR7915429A patent/FR2428666A1/fr active Granted
- 1979-06-15 JP JP7478379A patent/JPS5516079A/ja active Pending
-
1980
- 1980-03-31 US US06/136,036 patent/US4348298A/en not_active Expired - Lifetime
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2918000A1 (de) | 1980-01-03 |
| HU185202B (en) | 1984-12-28 |
| DD137242B1 (de) | 1980-10-29 |
| US4348298A (en) | 1982-09-07 |
| SU1484827A1 (ru) | 1989-06-07 |
| CH645399A5 (de) | 1984-09-28 |
| GB2025449B (en) | 1983-04-27 |
| FR2428666B1 (OSRAM) | 1985-05-10 |
| FR2428666A1 (fr) | 1980-01-11 |
| DD137242A1 (de) | 1979-08-22 |
| GB2025449A (en) | 1980-01-23 |
| JPS5516079A (en) | 1980-02-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2854310C2 (OSRAM) | ||
| EP0026004B1 (de) | Flüssigkristallmischung | |
| DE2918000C2 (de) | Nematische kristallin-flüssige Mischungen | |
| DD148060A5 (de) | Fluessigkristallmischung | |
| DE69431941T2 (de) | Anzeigevorrichtung und elektronischer apparat | |
| DE2502904C2 (OSRAM) | ||
| DE3150803C2 (OSRAM) | ||
| DE3238702C2 (OSRAM) | ||
| DE2631428A1 (de) | Verwendung von farbstoffen | |
| DE2418364B2 (de) | Elektrooptisches Anzeigeelement mit einem nematischen Flüssigkristallsystem mit positiver dielektrischer Anisotropie | |
| DE2429093A1 (de) | Nematische fluessig-kristalline substanzen | |
| DE2046566A1 (de) | Farbwiedergabevorrichtung auf Basis flussiger Kristalle | |
| DE2913753A1 (de) | Gast-wirts-fluessigkristall-darstellungsvorrichtung | |
| DD148059A5 (de) | Fluessigkristallmischung | |
| DE2439703A1 (de) | Elektrooptisches element | |
| DE3327300A1 (de) | Fluessigkristall-anzeige | |
| DE3101290C2 (OSRAM) | ||
| DE3241027A1 (de) | Fluessigkristalline, chirale verbindung, insbesondere als bestandteil eines fluessigkristallinen gast/wirt-materials und elektro-optische anzeigeeinheit mit diesem material | |
| DE3441937A1 (de) | Fluessigkristallines material | |
| DE2456083A1 (de) | Nematisches fluessigkristallgemisch | |
| DD223726A5 (de) | Fluessigkristalline guest-host-systeme | |
| DE3034249A1 (de) | Fluessigkristall-zusammensetzung | |
| CH640258A5 (de) | Kristallin-fluessige substanzen. | |
| DE2310733A1 (de) | Verfahren zur elektrooptischen lichtmodulation und farbwiedergabevorrichtung | |
| DD144423A1 (de) | Nematische kristallin-fluessige substanzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee | ||
| 8380 | Miscellaneous part iii |
Free format text: IM HEFT 24/92, SEITE 6755, SP.3: DIE VEROEFFENTLICHUNG IST ZU STREICHEN |
|
| 8339 | Ceased/non-payment of the annual fee |