DE2904052C2 - - Google Patents
Info
- Publication number
- DE2904052C2 DE2904052C2 DE2904052A DE2904052A DE2904052C2 DE 2904052 C2 DE2904052 C2 DE 2904052C2 DE 2904052 A DE2904052 A DE 2904052A DE 2904052 A DE2904052 A DE 2904052A DE 2904052 C2 DE2904052 C2 DE 2904052C2
- Authority
- DE
- Germany
- Prior art keywords
- acid
- methacrylate
- copolymer
- electrochromic
- layer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 239000000463 material Substances 0.000 claims description 32
- 229920001577 copolymer Polymers 0.000 claims description 24
- 239000000178 monomer Substances 0.000 claims description 16
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical group CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 claims description 15
- 239000003792 electrolyte Substances 0.000 claims description 13
- XHZPRMZZQOIPDS-UHFFFAOYSA-N 2-Methyl-2-[(1-oxo-2-propenyl)amino]-1-propanesulfonic acid Chemical compound OS(=O)(=O)CC(C)(C)NC(=O)C=C XHZPRMZZQOIPDS-UHFFFAOYSA-N 0.000 claims description 9
- 229920000536 2-Acrylamido-2-methylpropane sulfonic acid Polymers 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 8
- 229920002554 vinyl polymer Polymers 0.000 claims description 8
- 230000005684 electric field Effects 0.000 claims description 7
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 6
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 6
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 5
- 239000003906 humectant Substances 0.000 claims description 5
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims description 4
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 claims description 4
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 229920001223 polyethylene glycol Polymers 0.000 claims description 3
- PRAMZQXXPOLCIY-UHFFFAOYSA-N 2-(2-methylprop-2-enoyloxy)ethanesulfonic acid Chemical compound CC(=C)C(=O)OCCS(O)(=O)=O PRAMZQXXPOLCIY-UHFFFAOYSA-N 0.000 claims description 2
- OMIGHNLMNHATMP-UHFFFAOYSA-N 2-hydroxyethyl prop-2-enoate Chemical compound OCCOC(=O)C=C OMIGHNLMNHATMP-UHFFFAOYSA-N 0.000 claims description 2
- VHSHLMUCYSAUQU-UHFFFAOYSA-N 2-hydroxypropyl methacrylate Chemical compound CC(O)COC(=O)C(C)=C VHSHLMUCYSAUQU-UHFFFAOYSA-N 0.000 claims description 2
- GWZMWHWAWHPNHN-UHFFFAOYSA-N 2-hydroxypropyl prop-2-enoate Chemical compound CC(O)COC(=O)C=C GWZMWHWAWHPNHN-UHFFFAOYSA-N 0.000 claims description 2
- WLPQGZNMXPKVBI-UHFFFAOYSA-N 4-ethenyl-2-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(C=C)C=C1O WLPQGZNMXPKVBI-UHFFFAOYSA-N 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- UWHCKJMYHZGTIT-UHFFFAOYSA-N tetraethylene glycol Chemical compound OCCOCCOCCOCCO UWHCKJMYHZGTIT-UHFFFAOYSA-N 0.000 claims description 2
- SZTBMYHIYNGYIA-UHFFFAOYSA-N 2-chloroacrylic acid Chemical compound OC(=O)C(Cl)=C SZTBMYHIYNGYIA-UHFFFAOYSA-N 0.000 claims 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 claims 1
- 239000005518 polymer electrolyte Substances 0.000 claims 1
- 239000010410 layer Substances 0.000 description 34
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 29
- 229920000642 polymer Polymers 0.000 description 17
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 14
- -1 polyethylene Polymers 0.000 description 14
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 12
- 239000010408 film Substances 0.000 description 11
- 235000019441 ethanol Nutrition 0.000 description 10
- 229910052751 metal Inorganic materials 0.000 description 9
- 239000002184 metal Substances 0.000 description 9
- 229920002818 (Hydroxyethyl)methacrylate Polymers 0.000 description 8
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 7
- QGLKJKCYBOYXKC-UHFFFAOYSA-N nonaoxidotritungsten Chemical compound O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1 QGLKJKCYBOYXKC-UHFFFAOYSA-N 0.000 description 7
- 229910001930 tungsten oxide Inorganic materials 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 6
- 239000011521 glass Substances 0.000 description 6
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 6
- 229910052737 gold Inorganic materials 0.000 description 6
- 239000010931 gold Substances 0.000 description 6
- 230000003647 oxidation Effects 0.000 description 6
- 238000007254 oxidation reaction Methods 0.000 description 6
- 229910052763 palladium Inorganic materials 0.000 description 6
- 239000011248 coating agent Substances 0.000 description 5
- 238000000576 coating method Methods 0.000 description 5
- 239000012212 insulator Substances 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 238000006116 polymerization reaction Methods 0.000 description 5
- 239000011241 protective layer Substances 0.000 description 5
- 239000000758 substrate Substances 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000004020 conductor Substances 0.000 description 4
- 229910001873 dinitrogen Inorganic materials 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- 229910052723 transition metal Inorganic materials 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 229930006000 Sucrose Natural products 0.000 description 3
- 239000003431 cross linking reagent Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 230000005670 electromagnetic radiation Effects 0.000 description 3
- 229910003437 indium oxide Inorganic materials 0.000 description 3
- PJXISJQVUVHSOJ-UHFFFAOYSA-N indium(iii) oxide Chemical compound [O-2].[O-2].[O-2].[In+3].[In+3] PJXISJQVUVHSOJ-UHFFFAOYSA-N 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000005720 sucrose Substances 0.000 description 3
- 150000004763 sulfides Chemical class 0.000 description 3
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- LEJBBGNFPAFPKQ-UHFFFAOYSA-N 2-(2-prop-2-enoyloxyethoxy)ethyl prop-2-enoate Chemical compound C=CC(=O)OCCOCCOC(=O)C=C LEJBBGNFPAFPKQ-UHFFFAOYSA-N 0.000 description 2
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 2
- XFCMNSHQOZQILR-UHFFFAOYSA-N 2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCOC(=O)C(C)=C XFCMNSHQOZQILR-UHFFFAOYSA-N 0.000 description 2
- KUDUQBURMYMBIJ-UHFFFAOYSA-N 2-prop-2-enoyloxyethyl prop-2-enoate Chemical compound C=CC(=O)OCCOC(=O)C=C KUDUQBURMYMBIJ-UHFFFAOYSA-N 0.000 description 2
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- YGCOKJWKWLYHTG-UHFFFAOYSA-N [[4,6-bis[bis(hydroxymethyl)amino]-1,3,5-triazin-2-yl]-(hydroxymethyl)amino]methanol Chemical compound OCN(CO)C1=NC(N(CO)CO)=NC(N(CO)CO)=N1 YGCOKJWKWLYHTG-UHFFFAOYSA-N 0.000 description 2
- 239000002250 absorbent Substances 0.000 description 2
- 230000002745 absorbent Effects 0.000 description 2
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 2
- 230000005540 biological transmission Effects 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical compound O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 238000009413 insulation Methods 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 229910052747 lanthanoid Inorganic materials 0.000 description 2
- 150000002602 lanthanoids Chemical class 0.000 description 2
- ORUIBWPALBXDOA-UHFFFAOYSA-L magnesium fluoride Chemical compound [F-].[F-].[Mg+2] ORUIBWPALBXDOA-UHFFFAOYSA-L 0.000 description 2
- 229910001635 magnesium fluoride Inorganic materials 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- MEFBJEMVZONFCJ-UHFFFAOYSA-N molybdate Chemical compound [O-][Mo]([O-])(=O)=O MEFBJEMVZONFCJ-UHFFFAOYSA-N 0.000 description 2
- 230000006911 nucleation Effects 0.000 description 2
- 238000010899 nucleation Methods 0.000 description 2
- 239000000123 paper Substances 0.000 description 2
- 230000000737 periodic effect Effects 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 150000003346 selenoethers Chemical class 0.000 description 2
- 229910052814 silicon oxide Inorganic materials 0.000 description 2
- 125000005402 stannate group Chemical group 0.000 description 2
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 2
- 229910001887 tin oxide Inorganic materials 0.000 description 2
- 150000003624 transition metals Chemical class 0.000 description 2
- WRXCBRHBHGNNQA-UHFFFAOYSA-N (2,4-dichlorobenzoyl) 2,4-dichlorobenzenecarboperoxoate Chemical compound ClC1=CC(Cl)=CC=C1C(=O)OOC(=O)C1=CC=C(Cl)C=C1Cl WRXCBRHBHGNNQA-UHFFFAOYSA-N 0.000 description 1
- 239000001124 (E)-prop-1-ene-1,2,3-tricarboxylic acid Substances 0.000 description 1
- OMAWWKIPXLIPDE-UHFFFAOYSA-N (ethyldiselanyl)ethane Chemical compound CC[Se][Se]CC OMAWWKIPXLIPDE-UHFFFAOYSA-N 0.000 description 1
- YTLQLPQIPGNALG-UHFFFAOYSA-N (prop-2-enoylamino)methylphosphonous acid Chemical compound OP(O)CNC(=O)C=C YTLQLPQIPGNALG-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- VDYWHVQKENANGY-UHFFFAOYSA-N 1,3-Butyleneglycol dimethacrylate Chemical compound CC(=C)C(=O)OC(C)CCOC(=O)C(C)=C VDYWHVQKENANGY-UHFFFAOYSA-N 0.000 description 1
- FYBFGAFWCBMEDG-UHFFFAOYSA-N 1-[3,5-di(prop-2-enoyl)-1,3,5-triazinan-1-yl]prop-2-en-1-one Chemical compound C=CC(=O)N1CN(C(=O)C=C)CN(C(=O)C=C)C1 FYBFGAFWCBMEDG-UHFFFAOYSA-N 0.000 description 1
- ZUOBHRXEMDNEGE-UHFFFAOYSA-N 2,2-difluorobut-3-enoic acid Chemical compound OC(=O)C(F)(F)C=C ZUOBHRXEMDNEGE-UHFFFAOYSA-N 0.000 description 1
- NEBBLNDVSSWJLL-UHFFFAOYSA-N 2,3-bis(2-methylprop-2-enoyloxy)propyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC(OC(=O)C(C)=C)COC(=O)C(C)=C NEBBLNDVSSWJLL-UHFFFAOYSA-N 0.000 description 1
- QRIMLDXJAPZHJE-UHFFFAOYSA-N 2,3-dihydroxypropyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC(O)CO QRIMLDXJAPZHJE-UHFFFAOYSA-N 0.000 description 1
- OLQFXOWPTQTLDP-UHFFFAOYSA-N 2-(2-hydroxyethoxy)ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCO OLQFXOWPTQTLDP-UHFFFAOYSA-N 0.000 description 1
- RWXMAAYKJDQVTF-UHFFFAOYSA-N 2-(2-hydroxyethoxy)ethyl prop-2-enoate Chemical compound OCCOCCOC(=O)C=C RWXMAAYKJDQVTF-UHFFFAOYSA-N 0.000 description 1
- ZKLMKZINKNMVKA-UHFFFAOYSA-N 2-(2-hydroxypropoxy)propan-1-ol;2-methylprop-2-enoic acid Chemical compound CC(=C)C(O)=O.CC(O)COC(C)CO ZKLMKZINKNMVKA-UHFFFAOYSA-N 0.000 description 1
- YATYDCQGPUOZGZ-UHFFFAOYSA-N 2-(2-hydroxypropoxy)propan-1-ol;prop-2-enoic acid Chemical compound OC(=O)C=C.CC(O)COC(C)CO YATYDCQGPUOZGZ-UHFFFAOYSA-N 0.000 description 1
- IEXIIPOUMNDEEJ-UHFFFAOYSA-N 2-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OC(CC)COC(=O)C(C)=C IEXIIPOUMNDEEJ-UHFFFAOYSA-N 0.000 description 1
- JJBFVQSGPLGDNX-UHFFFAOYSA-N 2-(2-methylprop-2-enoyloxy)propyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OC(C)COC(=O)C(C)=C JJBFVQSGPLGDNX-UHFFFAOYSA-N 0.000 description 1
- XSCRXCDDATUDLB-UHFFFAOYSA-N 2-(2-methylpropoxymethyl)prop-2-enamide Chemical compound CC(C)COCC(=C)C(N)=O XSCRXCDDATUDLB-UHFFFAOYSA-N 0.000 description 1
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 description 1
- JFZBUNLOTDDXNY-UHFFFAOYSA-N 2-[2-(2-methylprop-2-enoyloxy)propoxy]propyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC(C)OCC(C)OC(=O)C(C)=C JFZBUNLOTDDXNY-UHFFFAOYSA-N 0.000 description 1
- HMENQNSSJFLQOP-UHFFFAOYSA-N 2-bromoprop-2-enoic acid Chemical compound OC(=O)C(Br)=C HMENQNSSJFLQOP-UHFFFAOYSA-N 0.000 description 1
- OGTWBSIKKGENPC-UHFFFAOYSA-N 2-chlorobuta-1,3-dienylphosphonic acid Chemical compound OP(O)(=O)C=C(Cl)C=C OGTWBSIKKGENPC-UHFFFAOYSA-N 0.000 description 1
- IJVRPNIWWODHHA-UHFFFAOYSA-N 2-cyanoprop-2-enoic acid Chemical compound OC(=O)C(=C)C#N IJVRPNIWWODHHA-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- TYCFGHUTYSLISP-UHFFFAOYSA-N 2-fluoroprop-2-enoic acid Chemical compound OC(=O)C(F)=C TYCFGHUTYSLISP-UHFFFAOYSA-N 0.000 description 1
- WFUGQJXVXHBTEM-UHFFFAOYSA-N 2-hydroperoxy-2-(2-hydroperoxybutan-2-ylperoxy)butane Chemical compound CCC(C)(OO)OOC(C)(CC)OO WFUGQJXVXHBTEM-UHFFFAOYSA-N 0.000 description 1
- GQWNPIKWYPQUPI-UHFFFAOYSA-N 2-methylbut-3-enoic acid Chemical compound C=CC(C)C(O)=O GQWNPIKWYPQUPI-UHFFFAOYSA-N 0.000 description 1
- BNCADMBVWNPPIZ-UHFFFAOYSA-N 2-n,2-n,4-n,4-n,6-n,6-n-hexakis(methoxymethyl)-1,3,5-triazine-2,4,6-triamine Chemical compound COCN(COC)C1=NC(N(COC)COC)=NC(N(COC)COC)=N1 BNCADMBVWNPPIZ-UHFFFAOYSA-N 0.000 description 1
- RGGSSHZYQIOCQA-UHFFFAOYSA-N 2-nitroprop-2-enoic acid Chemical compound OC(=O)C(=C)[N+]([O-])=O RGGSSHZYQIOCQA-UHFFFAOYSA-N 0.000 description 1
- NYNJMVZFPBGZPU-UHFFFAOYSA-N 2-prop-2-enoxypropanoic acid Chemical compound OC(=O)C(C)OCC=C NYNJMVZFPBGZPU-UHFFFAOYSA-N 0.000 description 1
- VFZKVQVQOMDJEG-UHFFFAOYSA-N 2-prop-2-enoyloxypropyl prop-2-enoate Chemical compound C=CC(=O)OC(C)COC(=O)C=C VFZKVQVQOMDJEG-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 1
- GNSFRPWPOGYVLO-UHFFFAOYSA-N 3-hydroxypropyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCO GNSFRPWPOGYVLO-UHFFFAOYSA-N 0.000 description 1
- QZPSOSOOLFHYRR-UHFFFAOYSA-N 3-hydroxypropyl prop-2-enoate Chemical compound OCCCOC(=O)C=C QZPSOSOOLFHYRR-UHFFFAOYSA-N 0.000 description 1
- XOJWAAUYNWGQAU-UHFFFAOYSA-N 4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCCOC(=O)C(C)=C XOJWAAUYNWGQAU-UHFFFAOYSA-N 0.000 description 1
- DBCAQXHNJOFNGC-UHFFFAOYSA-N 4-bromo-1,1,1-trifluorobutane Chemical compound FC(F)(F)CCCBr DBCAQXHNJOFNGC-UHFFFAOYSA-N 0.000 description 1
- DZBFGWQDTFSLBD-UHFFFAOYSA-N 4-bromobut-3-enoic acid Chemical compound OC(=O)CC=CBr DZBFGWQDTFSLBD-UHFFFAOYSA-N 0.000 description 1
- MSNHXOWRTKCJRK-UHFFFAOYSA-N 4-chlorobut-3-enoic acid Chemical compound OC(=O)CC=CCl MSNHXOWRTKCJRK-UHFFFAOYSA-N 0.000 description 1
- VPPHKHDARGZSFK-UHFFFAOYSA-N 5,5-bis(hydroxymethyl)imidazolidine-2,4-dione Chemical compound OCC1(CO)NC(=O)NC1=O VPPHKHDARGZSFK-UHFFFAOYSA-N 0.000 description 1
- OHNKSVVCUPOUDJ-UHFFFAOYSA-N 5-nitro-1h-indene Chemical compound [O-][N+](=O)C1=CC=C2CC=CC2=C1 OHNKSVVCUPOUDJ-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- CVCYKTXEAQWEGM-FAOVPRGRSA-N CC(=C)C(O)=O.CC(=C)C(O)=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O Chemical compound CC(=C)C(O)=O.CC(=C)C(O)=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O CVCYKTXEAQWEGM-FAOVPRGRSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- SQBTXCUEVWXKBM-UHFFFAOYSA-N FC=CCC(=O)O Chemical compound FC=CCC(=O)O SQBTXCUEVWXKBM-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- HBBGRARXTFLTSG-UHFFFAOYSA-N Lithium ion Chemical compound [Li+] HBBGRARXTFLTSG-UHFFFAOYSA-N 0.000 description 1
- CNCOEDDPFOAUMB-UHFFFAOYSA-N N-Methylolacrylamide Chemical compound OCNC(=O)C=C CNCOEDDPFOAUMB-UHFFFAOYSA-N 0.000 description 1
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
- QLZHNIAADXEJJP-UHFFFAOYSA-N Phenylphosphonic acid Chemical compound OP(O)(=O)C1=CC=CC=C1 QLZHNIAADXEJJP-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical group OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- 229920002845 Poly(methacrylic acid) Polymers 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004642 Polyimide Substances 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- KNSXNCFKSZZHEA-UHFFFAOYSA-N [3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] prop-2-enoate Chemical compound C=CC(=O)OCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C KNSXNCFKSZZHEA-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229940091181 aconitic acid Drugs 0.000 description 1
- 229910052768 actinide Inorganic materials 0.000 description 1
- 150000001255 actinides Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- BFHRUCFCIXWADD-UHFFFAOYSA-N bis(ethenyl) 2,3-dihydroxybutanedioate Chemical compound C=COC(=O)C(O)C(O)C(=O)OC=C BFHRUCFCIXWADD-UHFFFAOYSA-N 0.000 description 1
- ZPOLOEWJWXZUSP-AATRIKPKSA-N bis(prop-2-enyl) (e)-but-2-enedioate Chemical compound C=CCOC(=O)\C=C\C(=O)OCC=C ZPOLOEWJWXZUSP-AATRIKPKSA-N 0.000 description 1
- ZPOLOEWJWXZUSP-WAYWQWQTSA-N bis(prop-2-enyl) (z)-but-2-enedioate Chemical compound C=CCOC(=O)\C=C/C(=O)OCC=C ZPOLOEWJWXZUSP-WAYWQWQTSA-N 0.000 description 1
- VPPSHXIFIAJKMX-UHFFFAOYSA-N bis(prop-2-enyl) 2,3-dihydroxybutanedioate Chemical compound C=CCOC(=O)C(O)C(O)C(=O)OCC=C VPPSHXIFIAJKMX-UHFFFAOYSA-N 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- PVEOYINWKBTPIZ-UHFFFAOYSA-N but-3-enoic acid Chemical compound OC(=O)CC=C PVEOYINWKBTPIZ-UHFFFAOYSA-N 0.000 description 1
- WUKWITHWXAAZEY-UHFFFAOYSA-L calcium difluoride Chemical compound [F-].[F-].[Ca+2] WUKWITHWXAAZEY-UHFFFAOYSA-L 0.000 description 1
- 229910001634 calcium fluoride Inorganic materials 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000012461 cellulose resin Substances 0.000 description 1
- 229910000420 cerium oxide Inorganic materials 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical class [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- GTZCVFVGUGFEME-IWQZZHSRSA-N cis-aconitic acid Chemical compound OC(=O)C\C(C(O)=O)=C\C(O)=O GTZCVFVGUGFEME-IWQZZHSRSA-N 0.000 description 1
- 229940018560 citraconate Drugs 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 125000004386 diacrylate group Chemical group 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- AFOSIXZFDONLBT-UHFFFAOYSA-N divinyl sulfone Chemical compound C=CS(=O)(=O)C=C AFOSIXZFDONLBT-UHFFFAOYSA-N 0.000 description 1
- 239000007772 electrode material Substances 0.000 description 1
- 239000008151 electrolyte solution Substances 0.000 description 1
- 238000010894 electron beam technology Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Substances CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 239000011953 free-radical catalyst Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- VOZRXNHHFUQHIL-UHFFFAOYSA-N glycidyl methacrylate Chemical compound CC(=C)C(=O)OCC1CO1 VOZRXNHHFUQHIL-UHFFFAOYSA-N 0.000 description 1
- 229940015043 glyoxal Drugs 0.000 description 1
- PYGSKMBEVAICCR-UHFFFAOYSA-N hexa-1,5-diene Chemical group C=CCCC=C PYGSKMBEVAICCR-UHFFFAOYSA-N 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 230000010220 ion permeability Effects 0.000 description 1
- 230000005865 ionizing radiation Effects 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229910001416 lithium ion Inorganic materials 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 1
- 150000001247 metal acetylides Chemical class 0.000 description 1
- 229910001092 metal group alloy Inorganic materials 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 229910052976 metal sulfide Inorganic materials 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- ZIUHHBKFKCYYJD-UHFFFAOYSA-N n,n'-methylenebisacrylamide Chemical compound C=CC(=O)NCNC(=O)C=C ZIUHHBKFKCYYJD-UHFFFAOYSA-N 0.000 description 1
- XFHJDMUEHUHAJW-UHFFFAOYSA-N n-tert-butylprop-2-enamide Chemical compound CC(C)(C)NC(=O)C=C XFHJDMUEHUHAJW-UHFFFAOYSA-N 0.000 description 1
- 150000004767 nitrides Chemical class 0.000 description 1
- 239000000615 nonconductor Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- BMMGVYCKOGBVEV-UHFFFAOYSA-N oxo(oxoceriooxy)cerium Chemical compound [Ce]=O.O=[Ce]=O BMMGVYCKOGBVEV-UHFFFAOYSA-N 0.000 description 1
- QUBQYFYWUJJAAK-UHFFFAOYSA-N oxymethurea Chemical compound OCNC(=O)NCO QUBQYFYWUJJAAK-UHFFFAOYSA-N 0.000 description 1
- 229950005308 oxymethurea Drugs 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- HVAMZGADVCBITI-UHFFFAOYSA-N pent-4-enoic acid Chemical compound OC(=O)CCC=C HVAMZGADVCBITI-UHFFFAOYSA-N 0.000 description 1
- DBSDMAPJGHBWAL-UHFFFAOYSA-N penta-1,4-dien-3-ylbenzene Chemical compound C=CC(C=C)C1=CC=CC=C1 DBSDMAPJGHBWAL-UHFFFAOYSA-N 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- FSDNTQSJGHSJBG-UHFFFAOYSA-N piperidine-4-carbonitrile Chemical compound N#CC1CCNCC1 FSDNTQSJGHSJBG-UHFFFAOYSA-N 0.000 description 1
- 239000011505 plaster Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 1
- 229920000172 poly(styrenesulfonic acid) Polymers 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920001721 polyimide Polymers 0.000 description 1
- 229940005642 polystyrene sulfonic acid Drugs 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- XWCIXXXLOAAWPU-UHFFFAOYSA-N prop-1-enylphosphonic acid Chemical compound CC=CP(O)(O)=O XWCIXXXLOAAWPU-UHFFFAOYSA-N 0.000 description 1
- FBCQUCJYYPMKRO-UHFFFAOYSA-N prop-2-enyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC=C FBCQUCJYYPMKRO-UHFFFAOYSA-N 0.000 description 1
- KADVUADSGCRCHA-UHFFFAOYSA-N prop-2-enylarsonic acid Chemical compound O[As](O)(=O)CC=C KADVUADSGCRCHA-UHFFFAOYSA-N 0.000 description 1
- RZKYDQNMAUSEDZ-UHFFFAOYSA-N prop-2-enylphosphonic acid Chemical compound OP(O)(=O)CC=C RZKYDQNMAUSEDZ-UHFFFAOYSA-N 0.000 description 1
- BWJUFXUULUEGMA-UHFFFAOYSA-N propan-2-yl propan-2-yloxycarbonyloxy carbonate Chemical compound CC(C)OC(=O)OOC(=O)OC(C)C BWJUFXUULUEGMA-UHFFFAOYSA-N 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 238000002310 reflectometry Methods 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 229940071182 stannate Drugs 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 238000010557 suspension polymerization reaction Methods 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 150000004772 tellurides Chemical class 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- GTZCVFVGUGFEME-UHFFFAOYSA-N trans-aconitic acid Natural products OC(=O)CC(C(O)=O)=CC(O)=O GTZCVFVGUGFEME-UHFFFAOYSA-N 0.000 description 1
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 description 1
- 150000003623 transition metal compounds Chemical class 0.000 description 1
- 229910000314 transition metal oxide Inorganic materials 0.000 description 1
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 1
- KJWHEZXBZQXVSA-UHFFFAOYSA-N tris(prop-2-enyl) phosphite Chemical compound C=CCOP(OCC=C)OCC=C KJWHEZXBZQXVSA-UHFFFAOYSA-N 0.000 description 1
- 238000001771 vacuum deposition Methods 0.000 description 1
- LSGOVYNHVSXFFJ-UHFFFAOYSA-N vanadate(3-) Chemical class [O-][V]([O-])([O-])=O LSGOVYNHVSXFFJ-UHFFFAOYSA-N 0.000 description 1
- 229960000834 vinyl ether Drugs 0.000 description 1
- KAKZBPTYRLMSJV-UHFFFAOYSA-N vinyl-ethylene Natural products C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 1
- ZTWTYVWXUKTLCP-UHFFFAOYSA-N vinylphosphonic acid Chemical compound OP(O)(=O)C=C ZTWTYVWXUKTLCP-UHFFFAOYSA-N 0.000 description 1
- NLVXSWCKKBEXTG-UHFFFAOYSA-N vinylsulfonic acid Chemical compound OS(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-N 0.000 description 1
- 238000001429 visible spectrum Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G02—OPTICS
- G02F—OPTICAL DEVICES OR ARRANGEMENTS FOR THE CONTROL OF LIGHT BY MODIFICATION OF THE OPTICAL PROPERTIES OF THE MEDIA OF THE ELEMENTS INVOLVED THEREIN; NON-LINEAR OPTICS; FREQUENCY-CHANGING OF LIGHT; OPTICAL LOGIC ELEMENTS; OPTICAL ANALOGUE/DIGITAL CONVERTERS
- G02F1/00—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics
- G02F1/01—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour
- G02F1/15—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour based on an electrochromic effect
- G02F1/1514—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour based on an electrochromic effect characterised by the electrochromic material, e.g. by the electrodeposited material
- G02F1/1523—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour based on an electrochromic effect characterised by the electrochromic material, e.g. by the electrodeposited material comprising inorganic material
- G02F1/1525—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour based on an electrochromic effect characterised by the electrochromic material, e.g. by the electrodeposited material comprising inorganic material characterised by a particular ion transporting layer, e.g. electrolyte
Landscapes
- Physics & Mathematics (AREA)
- Chemical & Material Sciences (AREA)
- Nonlinear Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Inorganic Chemistry (AREA)
- General Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Electrochromic Elements, Electrophoresis, Or Variable Reflection Or Absorption Elements (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Devices For Indicating Variable Information By Combining Individual Elements (AREA)
- Control Of Indicators Other Than Cathode Ray Tubes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/877,139 US4174152A (en) | 1978-02-13 | 1978-02-13 | Electrochromic devices with polymeric electrolytes |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2904052A1 DE2904052A1 (de) | 1979-08-16 |
| DE2904052C2 true DE2904052C2 (en:Method) | 1991-01-31 |
Family
ID=25369337
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19792904052 Granted DE2904052A1 (de) | 1978-02-13 | 1979-02-02 | Elektrochrome vorrichtung |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4174152A (en:Method) |
| JP (1) | JPS54115147A (en:Method) |
| AR (1) | AR222023A1 (en:Method) |
| AT (1) | AT378618B (en:Method) |
| AU (1) | AU525796B2 (en:Method) |
| BE (1) | BE874089A (en:Method) |
| BR (1) | BR7807833A (en:Method) |
| CA (1) | CA1105601A (en:Method) |
| CH (1) | CH639209A5 (en:Method) |
| DE (1) | DE2904052A1 (en:Method) |
| ES (1) | ES477636A1 (en:Method) |
| FR (1) | FR2417154A1 (en:Method) |
| GB (1) | GB2014326B (en:Method) |
| IL (1) | IL55855A (en:Method) |
| IT (1) | IT1116845B (en:Method) |
| MX (1) | MX151432A (en:Method) |
| NL (1) | NL7811270A (en:Method) |
| NO (1) | NO151482C (en:Method) |
| PH (1) | PH15117A (en:Method) |
| PT (1) | PT69064A (en:Method) |
| SE (1) | SE445496B (en:Method) |
| SU (1) | SU814288A3 (en:Method) |
| ZA (1) | ZA785837B (en:Method) |
Families Citing this family (84)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1153427A (en) * | 1978-12-11 | 1983-09-06 | Patrick T. Cahalan | Tape electrode |
| US4297006A (en) * | 1978-12-28 | 1981-10-27 | Timex Corporation | Protective membrane for electrochromic displays |
| US4335938A (en) * | 1979-08-30 | 1982-06-22 | American Cyanamid Company | Electrochromic cells with improved electrolyte system |
| JPS5662229A (en) * | 1979-10-25 | 1981-05-28 | Asahi Glass Co Ltd | Electro-optical dimming panel |
| US4344674A (en) * | 1980-07-18 | 1982-08-17 | American Cyanamid Company | Electrochromic display device with improved erasing characteristic |
| US4361385A (en) * | 1980-10-23 | 1982-11-30 | American Cyanamid Company | Electrochromic device containing acid copolymer electrolyte |
| DE3374447D1 (en) * | 1982-01-11 | 1987-12-17 | Seiko Instr Inc | Electrochromic display device |
| US4488781A (en) * | 1982-01-25 | 1984-12-18 | American Cyanamid Company | Method for manufacturing an electrochromic display device and device produced thereby |
| JPS5950486A (ja) * | 1982-09-17 | 1984-03-23 | 株式会社東芝 | 電気発色表示素子 |
| JPS608267B2 (ja) * | 1982-11-30 | 1985-03-01 | 株式会社東芝 | 電気発色表示素子 |
| EP0229438A1 (en) * | 1986-01-17 | 1987-07-22 | The Signal Companies Inc. | Electrochromic devices using solid electrolytes |
| JPS60179703A (ja) * | 1984-02-28 | 1985-09-13 | Seiko Instr & Electronics Ltd | 多色表示装置の製造方法 |
| GB2170017B (en) * | 1984-12-24 | 1988-09-14 | Canon Kk | Optical device |
| US4902108A (en) * | 1986-03-31 | 1990-02-20 | Gentex Corporation | Single-compartment, self-erasing, solution-phase electrochromic devices, solutions for use therein, and uses thereof |
| JPS63271321A (ja) * | 1987-04-30 | 1988-11-09 | Hidetoshi Tsuchida | 全固体高分子系エレクトロクロミツク表示素子 |
| US4768865A (en) * | 1987-06-10 | 1988-09-06 | Ppg Industries, Inc. | Electrochromic window with metal grid counter electrode |
| SE8801637D0 (sv) * | 1988-04-29 | 1988-04-29 | Jim Stevens | Electrochromic device and a method to manufacture the same |
| FR2642890B1 (fr) * | 1989-02-09 | 1991-04-12 | Saint Gobain Vitrage | Materiau colloide conducteur de cations alcalins et applications a titre d'electrolytes |
| US5066111A (en) * | 1989-09-13 | 1991-11-19 | Ppg Industries, Inc. | Electrochromic window with integrated bus bars |
| US5124832A (en) * | 1989-09-29 | 1992-06-23 | Ppg Industries, Inc. | Laminated and sealed electrochromic window |
| AU615622B2 (en) * | 1989-09-13 | 1991-10-03 | Ppg Industries, Inc. | Electrochromic window with polymer layer |
| US5189549A (en) * | 1990-02-26 | 1993-02-23 | Molecular Displays, Inc. | Electrochromic, electroluminescent and electrochemiluminescent displays |
| US5157540A (en) * | 1990-07-11 | 1992-10-20 | Toray Industries, Inc. | Electrochromic display device with improved absorption spectrum and method of producing it |
| AU643093B2 (en) * | 1990-12-26 | 1993-11-04 | Ppg Industries Ohio, Inc. | Solid-state electrochromic device with protong-conducting polymer electrolyte |
| US5161048A (en) * | 1990-12-26 | 1992-11-03 | Ppg Industries, Inc. | Electrochromic window with metal grid counter electrode and acidic polyelectrolyte |
| US5311350A (en) * | 1991-01-16 | 1994-05-10 | Hamamatsu Photonics K.K. | Optical device and apparatus using the optical device |
| EP0555114B1 (en) * | 1992-01-20 | 1996-11-13 | Nippon Telegraph And Telephone Corporation | Solid polymer electrolyte and method of manufacture thereof |
| US5327281A (en) * | 1992-04-23 | 1994-07-05 | Eic Laboratories | Solid polymeric electrolytes for electrochromic devices having reduced acidity and high anodic stability |
| EP0612826B1 (en) * | 1993-02-26 | 2000-10-04 | Donnelly Corporation | Electrochromic polymeric solid films, manufacturing electrochromic devices using such solid films, and processing for making such solid films and devices |
| US5910854A (en) | 1993-02-26 | 1999-06-08 | Donnelly Corporation | Electrochromic polymeric solid films, manufacturing electrochromic devices using such solid films, and processes for making such solid films and devices |
| WO1995013562A1 (en) * | 1993-11-12 | 1995-05-18 | Ppg Industries, Inc. | Iridium oxide film for electrochromic device |
| US5471554A (en) * | 1993-11-12 | 1995-11-28 | Ppg Industries, Inc. | Primer for electrochromic device with plastic substrate |
| US5471338A (en) * | 1993-11-12 | 1995-11-28 | Ppg Industries, Inc. | Electrochromic device with plastic substrate |
| US5668663A (en) | 1994-05-05 | 1997-09-16 | Donnelly Corporation | Electrochromic mirrors and devices |
| US5679283A (en) * | 1994-07-22 | 1997-10-21 | Gentex Corporation | Electrochromic layer and devices comprising same |
| US6891563B2 (en) | 1996-05-22 | 2005-05-10 | Donnelly Corporation | Vehicular vision system |
| US5798860A (en) * | 1996-01-16 | 1998-08-25 | Ppg Industries, Inc. | Iridium oxide film for electrochromic device |
| US5928572A (en) | 1996-03-15 | 1999-07-27 | Gentex Corporation | Electrochromic layer and devices comprising same |
| EP0923754A1 (en) | 1996-08-20 | 1999-06-23 | Donnelly Corporation | Window assembly with controllable optical transmission |
| US6326613B1 (en) | 1998-01-07 | 2001-12-04 | Donnelly Corporation | Vehicle interior mirror assembly adapted for containing a rain sensor |
| US6124886A (en) | 1997-08-25 | 2000-09-26 | Donnelly Corporation | Modular rearview mirror assembly |
| US8294975B2 (en) | 1997-08-25 | 2012-10-23 | Donnelly Corporation | Automotive rearview mirror assembly |
| US6172613B1 (en) | 1998-02-18 | 2001-01-09 | Donnelly Corporation | Rearview mirror assembly incorporating vehicle information display |
| US5953150A (en) * | 1997-12-22 | 1999-09-14 | Ppg Industries Ohio, Inc. | Edge design for electrochromic devices |
| US5969847A (en) * | 1997-12-22 | 1999-10-19 | Ppg Industries Ohio, Inc. | Method for sealing a laminated electrochromic device edge |
| US8288711B2 (en) | 1998-01-07 | 2012-10-16 | Donnelly Corporation | Interior rearview mirror system with forwardly-viewing camera and a control |
| US6445287B1 (en) | 2000-02-28 | 2002-09-03 | Donnelly Corporation | Tire inflation assistance monitoring system |
| US6214261B1 (en) | 1998-03-23 | 2001-04-10 | Ppg Industries Ohio, Inc. | Method for forming a molded edge seal |
| US6329925B1 (en) | 1999-11-24 | 2001-12-11 | Donnelly Corporation | Rearview mirror assembly with added feature modular display |
| US6693517B2 (en) | 2000-04-21 | 2004-02-17 | Donnelly Corporation | Vehicle mirror assembly communicating wirelessly with vehicle accessories and occupants |
| US6477464B2 (en) | 2000-03-09 | 2002-11-05 | Donnelly Corporation | Complete mirror-based global-positioning system (GPS) navigation solution |
| US6317248B1 (en) | 1998-07-02 | 2001-11-13 | Donnelly Corporation | Busbars for electrically powered cells |
| DE19840186C2 (de) | 1998-09-03 | 2003-03-13 | Daimler Chrysler Ag | Verbundglasscheibe mit elektrisch steuerbarem Reflexionsgrad |
| WO2001064481A2 (en) | 2000-03-02 | 2001-09-07 | Donnelly Corporation | Video mirror systems incorporating an accessory module |
| US7167796B2 (en) | 2000-03-09 | 2007-01-23 | Donnelly Corporation | Vehicle navigation system for use with a telematics system |
| US7855755B2 (en) | 2005-11-01 | 2010-12-21 | Donnelly Corporation | Interior rearview mirror assembly with display |
| US7370983B2 (en) | 2000-03-02 | 2008-05-13 | Donnelly Corporation | Interior mirror assembly with display |
| US6515787B1 (en) | 2000-03-07 | 2003-02-04 | Eclipse Energy Systems, Inc. | Electrochromic layer |
| US7581859B2 (en) | 2005-09-14 | 2009-09-01 | Donnelly Corp. | Display device for exterior rearview mirror |
| US7255451B2 (en) | 2002-09-20 | 2007-08-14 | Donnelly Corporation | Electro-optic mirror cell |
| ES2287266T3 (es) | 2001-01-23 | 2007-12-16 | Donnelly Corporation | Sistema de iluminacion de vehiculos mejorado. |
| US6918674B2 (en) | 2002-05-03 | 2005-07-19 | Donnelly Corporation | Vehicle rearview mirror system |
| US7329013B2 (en) | 2002-06-06 | 2008-02-12 | Donnelly Corporation | Interior rearview mirror system with compass |
| WO2003105099A1 (en) | 2002-06-06 | 2003-12-18 | Donnelly Corporation | Interior rearview mirror system with compass |
| US7274501B2 (en) | 2002-09-20 | 2007-09-25 | Donnelly Corporation | Mirror reflective element assembly |
| WO2004103772A2 (en) | 2003-05-19 | 2004-12-02 | Donnelly Corporation | Mirror assembly for vehicle |
| US7310177B2 (en) | 2002-09-20 | 2007-12-18 | Donnelly Corporation | Electro-optic reflective element assembly |
| US7009750B1 (en) | 2002-10-25 | 2006-03-07 | Eclipse Energy Systems, Inc. | Apparatus and methods for modulating refractive index |
| US7446924B2 (en) | 2003-10-02 | 2008-11-04 | Donnelly Corporation | Mirror reflective element assembly including electronic component |
| US7308341B2 (en) * | 2003-10-14 | 2007-12-11 | Donnelly Corporation | Vehicle communication system |
| US20070231354A1 (en) * | 2005-04-21 | 2007-10-04 | Atsushi Sogabe | Water-Soluble Thickener and Cosmetic Preparation Containing Same |
| US7372610B2 (en) | 2005-02-23 | 2008-05-13 | Sage Electrochromics, Inc. | Electrochromic devices and methods |
| ATE517368T1 (de) | 2005-05-16 | 2011-08-15 | Donnelly Corp | Fahrzeugspiegelanordnung mit zeichen am reflektierenden teil |
| DE102006044069A1 (de) * | 2006-09-20 | 2008-03-27 | Bayer Materialscience Ag | Elektrochrome Anordnung |
| WO2009002556A1 (en) * | 2007-06-27 | 2008-12-31 | Gentex Corporation | Electrochromic device having an improved fill port plug |
| US8345345B2 (en) | 2007-06-27 | 2013-01-01 | Gentex Corporation | Electrochromic device having an improved fill port plug |
| US8154418B2 (en) | 2008-03-31 | 2012-04-10 | Magna Mirrors Of America, Inc. | Interior rearview mirror system |
| US9487144B2 (en) | 2008-10-16 | 2016-11-08 | Magna Mirrors Of America, Inc. | Interior mirror assembly with display |
| DE102009008740A1 (de) * | 2009-02-12 | 2010-08-19 | Clariant International Limited | Leicht dispergierbare feste Pigmentzubereitungen |
| US9057925B2 (en) | 2013-03-15 | 2015-06-16 | Gentex Corporation | Fill port plugs for electrochromic devices |
| RU2524963C1 (ru) * | 2013-03-29 | 2014-08-10 | Общество с ограниченной ответственностью "СмартЭлектроГласс" | Электропроводящий адгезив для электрохромных устройств |
| US9454054B2 (en) | 2013-11-18 | 2016-09-27 | Magna Mirrors Of America, Inc. | Electro-optic mirror element and process of making same |
| US10732477B2 (en) | 2018-03-19 | 2020-08-04 | Oktopolymer Llc | Electrochromic device and method of its manufacturing |
| KR102829345B1 (ko) * | 2020-11-03 | 2025-07-02 | 현대자동차주식회사 | 색상 가변 플라스틱 |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2527300A (en) * | 1948-03-18 | 1950-10-24 | American Cyanamid Co | Copolymers of unsaturated sulfonic acids and polyunsaturated compounds |
| US3282160A (en) * | 1963-01-07 | 1966-11-01 | Dow Chemical Co | Color reversible electrochemical light filter utilizing electrolytic solution |
| US3419431A (en) * | 1964-01-27 | 1968-12-31 | Amicon Corp | Polyelectrolyte gel separator and battery therewith |
| US3453038A (en) * | 1966-06-15 | 1969-07-01 | Du Pont | Compartmented electrochromic device |
| FR1536863A (fr) * | 1966-09-16 | 1968-08-16 | Bayer Ag | Polymères contenant des groupes acide sulfonique |
| US3521941A (en) * | 1967-02-07 | 1970-07-28 | American Cyanamid Co | Electro-optical device having variable optical density |
| US3629082A (en) * | 1969-04-22 | 1971-12-21 | Valentin Alexeevich Kargin | Process for producing homogeneous polymeric cation-exchange materials |
| US3684747A (en) * | 1970-04-22 | 1972-08-15 | Du Pont | Method for increasing the liquid absorptive capacity of linear fluorocarbon sulfonic acid polymer |
| US3708220A (en) * | 1970-05-25 | 1973-01-02 | American Cyanamid Co | High conductivity electrolyte gel materials |
| US3689810A (en) * | 1971-04-23 | 1972-09-05 | Wilhelm E Walles | All-plastic electric capacitor |
| BE786002A (fr) * | 1971-07-08 | 1973-01-08 | Montedison Spa | Copolymeres d'alcenylsulfonates, membranes permeables selectivement auxcations a base de ces copolymeres et procede de preparation de membranes a permeabilite selective a partir de ces copolymeres |
| US3840288A (en) * | 1973-07-30 | 1974-10-08 | Optel Corp | Electrochromic display having electro-catalyst |
| US3931092A (en) * | 1974-04-29 | 1976-01-06 | Basf Wyandotte Corporation | Finely-divided polymeric solids having improved physical properties |
| CH573155A5 (en:Method) * | 1974-06-12 | 1976-02-27 | Bbc Brown Boveri & Cie | |
| US4010117A (en) * | 1974-09-02 | 1977-03-01 | Nippon Gohsei Kagaku Kogyo Kabushiki Kaisha | Electroconductive material |
| US4071508A (en) * | 1975-02-11 | 1978-01-31 | Plastomedical Sciences, Inc. | Anionic hydrogels based on hydroxyalkyl acrylates and methacrylates |
| CH594263A5 (en:Method) * | 1975-11-29 | 1977-12-30 | Ebauches Sa | |
| US4116545A (en) * | 1976-10-27 | 1978-09-26 | American Cyanamid Company | Polymeric electrolyte for electrochromic display devices |
-
1978
- 1978-02-13 US US05/877,139 patent/US4174152A/en not_active Expired - Lifetime
- 1978-10-16 CA CA313,515A patent/CA1105601A/en not_active Expired
- 1978-10-17 ZA ZA00785837A patent/ZA785837B/xx unknown
- 1978-10-19 AU AU40854/78A patent/AU525796B2/en not_active Expired
- 1978-10-23 GB GB7841557A patent/GB2014326B/en not_active Expired
- 1978-10-31 AR AR274295A patent/AR222023A1/es active
- 1978-11-02 IL IL55855A patent/IL55855A/xx unknown
- 1978-11-14 NL NL7811270A patent/NL7811270A/xx not_active Application Discontinuation
- 1978-11-29 BR BR7807833A patent/BR7807833A/pt unknown
- 1978-12-28 NO NO784396A patent/NO151482C/no unknown
-
1979
- 1979-01-05 MX MX176195A patent/MX151432A/es unknown
- 1979-01-12 PT PT69064A patent/PT69064A/pt unknown
- 1979-01-31 FR FR7902463A patent/FR2417154A1/fr active Granted
- 1979-02-02 DE DE19792904052 patent/DE2904052A1/de active Granted
- 1979-02-06 IT IT47901/79A patent/IT1116845B/it active
- 1979-02-07 JP JP1235279A patent/JPS54115147A/ja active Granted
- 1979-02-09 PH PH22181A patent/PH15117A/en unknown
- 1979-02-12 SU SU792728453A patent/SU814288A3/ru active
- 1979-02-12 BE BE0/193395A patent/BE874089A/xx not_active IP Right Cessation
- 1979-02-12 SE SE7901210A patent/SE445496B/sv not_active IP Right Cessation
- 1979-02-12 CH CH134679A patent/CH639209A5/de not_active IP Right Cessation
- 1979-02-12 ES ES477636A patent/ES477636A1/es not_active Expired
- 1979-02-12 AT AT0106579A patent/AT378618B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| SE7901210L (sv) | 1979-08-14 |
| ES477636A1 (es) | 1979-10-16 |
| IL55855A0 (en) | 1979-01-31 |
| CA1105601A (en) | 1981-07-21 |
| SU814288A3 (ru) | 1981-03-15 |
| JPS54115147A (en) | 1979-09-07 |
| MX151432A (es) | 1984-11-21 |
| AU4085478A (en) | 1980-04-24 |
| NO151482B (no) | 1985-01-02 |
| BE874089A (fr) | 1979-08-13 |
| NL7811270A (nl) | 1979-08-15 |
| IL55855A (en) | 1982-07-30 |
| PT69064A (en) | 1979-02-01 |
| AT378618B (de) | 1985-09-10 |
| AU525796B2 (en) | 1982-12-02 |
| US4174152A (en) | 1979-11-13 |
| FR2417154A1 (fr) | 1979-09-07 |
| IT1116845B (it) | 1986-02-10 |
| ATA106579A (de) | 1985-01-15 |
| SE445496B (sv) | 1986-06-23 |
| IT7947901A0 (it) | 1979-02-06 |
| AR222023A1 (es) | 1981-04-15 |
| ZA785837B (en) | 1979-09-26 |
| BR7807833A (pt) | 1979-09-25 |
| NO784396L (no) | 1979-08-14 |
| JPS6145814B2 (en:Method) | 1986-10-09 |
| CH639209A5 (de) | 1983-10-31 |
| GB2014326A (en) | 1979-08-22 |
| GB2014326B (en) | 1982-09-08 |
| FR2417154B1 (en:Method) | 1985-03-22 |
| NO151482C (no) | 1985-04-17 |
| PH15117A (en) | 1982-08-10 |
| DE2904052A1 (de) | 1979-08-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2904052C2 (en:Method) | ||
| DE2846665C2 (en:Method) | ||
| DE69328902T2 (de) | Lichtmodulierender film mit erhöhter transparenz für ein lichtventil | |
| DE3855669T2 (de) | Optische Flüssigkristallvorrichtung und ihr Herstellungsverfahren | |
| DE3615379C2 (en:Method) | ||
| DE69610193T2 (de) | Verfahren zur herstellung eines schaltbaren cholesterischen filters, sowie auch einer beleuchtungsanlage mit solchen filtern | |
| DE69028213T2 (de) | Elektrochromes Element, Materialien zur Verwendung in einem solchen Element, Herstellungsverfahren eines derartigen Elementes sowie derartiger Materialien und die Verwendung eines solchem Elementes in einem elektrochromen Gerät | |
| DE3789858T2 (de) | Platten für Lichtkontrolle. | |
| DE69609275T2 (de) | Lichtmodulierender Film mit erhöhter UV Beständigkeit für ein Lichtventil | |
| DE2746973A1 (de) | Variabel lichtmodulierende vorrichtung auf basis eines elektrochromen materials | |
| DE68917233T2 (de) | Flüssigkristallvorrichtung. | |
| DE60209127T2 (de) | Biegsame elektrochrome struktur und verfahren zu deren herstellung | |
| DE2519403A1 (de) | Traegermaterial und dessen verwendung in einem photographischen aufzeichnungsmaterial | |
| CH640642A5 (de) | Elektrochrome anzeigevorrichtung und verfahren zu deren herstellung. | |
| DE69736169T2 (de) | Flüssigkristall-anzeigeelement und abstandhalter dafür | |
| DE2600637A1 (de) | Elektrochrome vorrichtung | |
| DE69105632T2 (de) | Elektrochromes Fenster mit Polyepoxy-Polymerelektrolyt. | |
| DE69132341T2 (de) | Elektrochrome Festkörpervorrichtung | |
| DE2363092A1 (de) | Positiv wirkende elektronenreserve | |
| DE2846101A1 (de) | Elektrochrome vorrichtung und verfahren zu ihrer herstellung | |
| DE2724160A1 (de) | Bildaufzeichnungsmaterial | |
| DE69814694T2 (de) | Verfahren zur herstellung lithiumhaltiger vanadiumoxyd-schichten mit optischer qualität | |
| DE3716356C2 (en:Method) | ||
| EP0499115B1 (de) | Polymerer Festelektrolyt | |
| DE4435376B4 (de) | Zusammensetzung zur Bildung leitfähiger Filme |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |