JPS6145814B2 - - Google Patents
Info
- Publication number
- JPS6145814B2 JPS6145814B2 JP54012352A JP1235279A JPS6145814B2 JP S6145814 B2 JPS6145814 B2 JP S6145814B2 JP 54012352 A JP54012352 A JP 54012352A JP 1235279 A JP1235279 A JP 1235279A JP S6145814 B2 JPS6145814 B2 JP S6145814B2
- Authority
- JP
- Japan
- Prior art keywords
- acid
- methacrylate
- layer
- acrylate
- vinyl polymer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920001577 copolymer Polymers 0.000 claims description 20
- 239000000463 material Substances 0.000 claims description 19
- 239000000178 monomer Substances 0.000 claims description 18
- -1 hydroxypropyl Chemical group 0.000 claims description 15
- 229920002554 vinyl polymer Polymers 0.000 claims description 13
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical group CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 claims description 12
- 230000005684 electric field Effects 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 10
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 9
- 239000005518 polymer electrolyte Substances 0.000 claims description 8
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 8
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 7
- XHZPRMZZQOIPDS-UHFFFAOYSA-N 2-Methyl-2-[(1-oxo-2-propenyl)amino]-1-propanesulfonic acid Chemical compound OS(=O)(=O)CC(C)(C)NC(=O)C=C XHZPRMZZQOIPDS-UHFFFAOYSA-N 0.000 claims description 6
- 239000003792 electrolyte Substances 0.000 claims description 6
- PEDCQBHIVMGVHV-UHFFFAOYSA-N glycerol group Chemical group OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 6
- 239000000126 substance Substances 0.000 claims description 6
- 229920000536 2-Acrylamido-2-methylpropane sulfonic acid Polymers 0.000 claims description 5
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 5
- 239000000080 wetting agent Substances 0.000 claims description 5
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 4
- DZSVIVLGBJKQAP-UHFFFAOYSA-N 1-(2-methyl-5-propan-2-ylcyclohex-2-en-1-yl)propan-1-one Chemical group CCC(=O)C1CC(C(C)C)CC=C1C DZSVIVLGBJKQAP-UHFFFAOYSA-N 0.000 claims description 2
- PRAMZQXXPOLCIY-UHFFFAOYSA-N 2-(2-methylprop-2-enoyloxy)ethanesulfonic acid Chemical compound CC(=C)C(=O)OCCS(O)(=O)=O PRAMZQXXPOLCIY-UHFFFAOYSA-N 0.000 claims description 2
- OMIGHNLMNHATMP-UHFFFAOYSA-N 2-hydroxyethyl prop-2-enoate Chemical compound OCCOC(=O)C=C OMIGHNLMNHATMP-UHFFFAOYSA-N 0.000 claims description 2
- GWZMWHWAWHPNHN-UHFFFAOYSA-N 2-hydroxypropyl prop-2-enoate Chemical compound CC(O)COC(=O)C=C GWZMWHWAWHPNHN-UHFFFAOYSA-N 0.000 claims description 2
- WLPQGZNMXPKVBI-UHFFFAOYSA-N 4-ethenyl-2-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(C=C)C=C1O WLPQGZNMXPKVBI-UHFFFAOYSA-N 0.000 claims description 2
- UWHCKJMYHZGTIT-UHFFFAOYSA-N Tetraethylene glycol, Natural products OCCOCCOCCOCCO UWHCKJMYHZGTIT-UHFFFAOYSA-N 0.000 claims description 2
- SZTBMYHIYNGYIA-UHFFFAOYSA-N 2-chloroacrylic acid Chemical compound OC(=O)C(Cl)=C SZTBMYHIYNGYIA-UHFFFAOYSA-N 0.000 claims 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- ZNOKGRXACCSDPY-UHFFFAOYSA-N tungsten trioxide Chemical group O=[W](=O)=O ZNOKGRXACCSDPY-UHFFFAOYSA-N 0.000 claims 1
- 239000010410 layer Substances 0.000 description 34
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 29
- 229920000642 polymer Polymers 0.000 description 17
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 12
- 235000019441 ethanol Nutrition 0.000 description 10
- 229910001873 dinitrogen Inorganic materials 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 8
- 229910052751 metal Inorganic materials 0.000 description 8
- 239000002184 metal Substances 0.000 description 8
- QGLKJKCYBOYXKC-UHFFFAOYSA-N nonaoxidotritungsten Chemical compound O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1 QGLKJKCYBOYXKC-UHFFFAOYSA-N 0.000 description 7
- 229910001930 tungsten oxide Inorganic materials 0.000 description 7
- 229920002818 (Hydroxyethyl)methacrylate Polymers 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 6
- 229910052737 gold Inorganic materials 0.000 description 6
- 239000010931 gold Substances 0.000 description 6
- 229910052763 palladium Inorganic materials 0.000 description 6
- 239000011521 glass Substances 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 238000006116 polymerization reaction Methods 0.000 description 5
- 239000011241 protective layer Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 4
- 238000004132 cross linking Methods 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 239000003431 cross linking reagent Substances 0.000 description 3
- 230000005670 electromagnetic radiation Effects 0.000 description 3
- 229910003437 indium oxide Inorganic materials 0.000 description 3
- PJXISJQVUVHSOJ-UHFFFAOYSA-N indium(iii) oxide Chemical compound [O-2].[O-2].[O-2].[In+3].[In+3] PJXISJQVUVHSOJ-UHFFFAOYSA-N 0.000 description 3
- 239000012212 insulator Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 230000006911 nucleation Effects 0.000 description 3
- 238000010899 nucleation Methods 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000000123 paper Substances 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 229910052814 silicon oxide Inorganic materials 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 150000003568 thioethers Chemical class 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- 229910052723 transition metal Inorganic materials 0.000 description 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- LEJBBGNFPAFPKQ-UHFFFAOYSA-N 2-(2-prop-2-enoyloxyethoxy)ethyl prop-2-enoate Chemical compound C=CC(=O)OCCOCCOC(=O)C=C LEJBBGNFPAFPKQ-UHFFFAOYSA-N 0.000 description 2
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 2
- XFCMNSHQOZQILR-UHFFFAOYSA-N 2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCOC(=O)C(C)=C XFCMNSHQOZQILR-UHFFFAOYSA-N 0.000 description 2
- HDEFKPTUGHCBCD-UHFFFAOYSA-N 2-ethenoxy-n-methylethanamine Chemical compound CNCCOC=C HDEFKPTUGHCBCD-UHFFFAOYSA-N 0.000 description 2
- KUDUQBURMYMBIJ-UHFFFAOYSA-N 2-prop-2-enoyloxyethyl prop-2-enoate Chemical compound C=CC(=O)OCCOC(=O)C=C KUDUQBURMYMBIJ-UHFFFAOYSA-N 0.000 description 2
- DBCAQXHNJOFNGC-UHFFFAOYSA-N 4-bromo-1,1,1-trifluorobutane Chemical compound FC(F)(F)CCCBr DBCAQXHNJOFNGC-UHFFFAOYSA-N 0.000 description 2
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 2
- YGCOKJWKWLYHTG-UHFFFAOYSA-N [[4,6-bis[bis(hydroxymethyl)amino]-1,3,5-triazin-2-yl]-(hydroxymethyl)amino]methanol Chemical compound OCN(CO)C1=NC(N(CO)CO)=NC(N(CO)CO)=N1 YGCOKJWKWLYHTG-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 125000004386 diacrylate group Chemical group 0.000 description 2
- ONWSXQXQPJHQPU-UHFFFAOYSA-N ethane-1,2-diol;2-hydroxypropane-1,2,3-tricarboxylic acid Chemical compound OCCO.OC(=O)CC(O)(C(O)=O)CC(O)=O ONWSXQXQPJHQPU-UHFFFAOYSA-N 0.000 description 2
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Substances CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 description 2
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical compound O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000003384 imaging method Methods 0.000 description 2
- 239000003999 initiator Substances 0.000 description 2
- 229910052747 lanthanoid Inorganic materials 0.000 description 2
- ORUIBWPALBXDOA-UHFFFAOYSA-L magnesium fluoride Chemical compound [F-].[F-].[Mg+2] ORUIBWPALBXDOA-UHFFFAOYSA-L 0.000 description 2
- 229910001635 magnesium fluoride Inorganic materials 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 2
- 230000000737 periodic effect Effects 0.000 description 2
- 230000035699 permeability Effects 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 238000002310 reflectometry Methods 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 150000003346 selenoethers Chemical class 0.000 description 2
- 229940071182 stannate Drugs 0.000 description 2
- 125000005402 stannate group Chemical group 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 229920001897 terpolymer Polymers 0.000 description 2
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 2
- 229910001887 tin oxide Inorganic materials 0.000 description 2
- 150000003624 transition metals Chemical class 0.000 description 2
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 2
- 229960000834 vinyl ether Drugs 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- WRXCBRHBHGNNQA-UHFFFAOYSA-N (2,4-dichlorobenzoyl) 2,4-dichlorobenzenecarboperoxoate Chemical compound ClC1=CC(Cl)=CC=C1C(=O)OOC(=O)C1=CC=C(Cl)C=C1Cl WRXCBRHBHGNNQA-UHFFFAOYSA-N 0.000 description 1
- 239000001124 (E)-prop-1-ene-1,2,3-tricarboxylic acid Substances 0.000 description 1
- OMAWWKIPXLIPDE-UHFFFAOYSA-N (ethyldiselanyl)ethane Chemical compound CC[Se][Se]CC OMAWWKIPXLIPDE-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- MYWOJODOMFBVCB-UHFFFAOYSA-N 1,2,6-trimethylphenanthrene Chemical compound CC1=CC=C2C3=CC(C)=CC=C3C=CC2=C1C MYWOJODOMFBVCB-UHFFFAOYSA-N 0.000 description 1
- VDYWHVQKENANGY-UHFFFAOYSA-N 1,3-Butyleneglycol dimethacrylate Chemical compound CC(=C)C(=O)OC(C)CCOC(=O)C(C)=C VDYWHVQKENANGY-UHFFFAOYSA-N 0.000 description 1
- FYBFGAFWCBMEDG-UHFFFAOYSA-N 1-[3,5-di(prop-2-enoyl)-1,3,5-triazinan-1-yl]prop-2-en-1-one Chemical compound C=CC(=O)N1CN(C(=O)C=C)CN(C(=O)C=C)C1 FYBFGAFWCBMEDG-UHFFFAOYSA-N 0.000 description 1
- VSDMVRFSCLVCOF-UHFFFAOYSA-N 1-ethenoxybutan-2-amine Chemical compound CCC(N)COC=C VSDMVRFSCLVCOF-UHFFFAOYSA-N 0.000 description 1
- LMAUULKNZLEMGN-UHFFFAOYSA-N 1-ethyl-3,5-dimethylbenzene Chemical compound CCC1=CC(C)=CC(C)=C1 LMAUULKNZLEMGN-UHFFFAOYSA-N 0.000 description 1
- OHLFPDWWJLXNKV-UHFFFAOYSA-N 10-ethenoxydecan-1-amine Chemical compound NCCCCCCCCCCOC=C OHLFPDWWJLXNKV-UHFFFAOYSA-N 0.000 description 1
- ZUOBHRXEMDNEGE-UHFFFAOYSA-N 2,2-difluorobut-3-enoic acid Chemical compound OC(=O)C(F)(F)C=C ZUOBHRXEMDNEGE-UHFFFAOYSA-N 0.000 description 1
- NEBBLNDVSSWJLL-UHFFFAOYSA-N 2,3-bis(2-methylprop-2-enoyloxy)propyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC(OC(=O)C(C)=C)COC(=O)C(C)=C NEBBLNDVSSWJLL-UHFFFAOYSA-N 0.000 description 1
- QRIMLDXJAPZHJE-UHFFFAOYSA-N 2,3-dihydroxypropyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC(O)CO QRIMLDXJAPZHJE-UHFFFAOYSA-N 0.000 description 1
- OWPUOLBODXJOKH-UHFFFAOYSA-N 2,3-dihydroxypropyl prop-2-enoate Chemical compound OCC(O)COC(=O)C=C OWPUOLBODXJOKH-UHFFFAOYSA-N 0.000 description 1
- OLQFXOWPTQTLDP-UHFFFAOYSA-N 2-(2-hydroxyethoxy)ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCO OLQFXOWPTQTLDP-UHFFFAOYSA-N 0.000 description 1
- RWXMAAYKJDQVTF-UHFFFAOYSA-N 2-(2-hydroxyethoxy)ethyl prop-2-enoate Chemical compound OCCOCCOC(=O)C=C RWXMAAYKJDQVTF-UHFFFAOYSA-N 0.000 description 1
- ZKLMKZINKNMVKA-UHFFFAOYSA-N 2-(2-hydroxypropoxy)propan-1-ol;2-methylprop-2-enoic acid Chemical compound CC(=C)C(O)=O.CC(O)COC(C)CO ZKLMKZINKNMVKA-UHFFFAOYSA-N 0.000 description 1
- YATYDCQGPUOZGZ-UHFFFAOYSA-N 2-(2-hydroxypropoxy)propan-1-ol;prop-2-enoic acid Chemical compound OC(=O)C=C.CC(O)COC(C)CO YATYDCQGPUOZGZ-UHFFFAOYSA-N 0.000 description 1
- IEXIIPOUMNDEEJ-UHFFFAOYSA-N 2-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OC(CC)COC(=O)C(C)=C IEXIIPOUMNDEEJ-UHFFFAOYSA-N 0.000 description 1
- JJBFVQSGPLGDNX-UHFFFAOYSA-N 2-(2-methylprop-2-enoyloxy)propyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OC(C)COC(=O)C(C)=C JJBFVQSGPLGDNX-UHFFFAOYSA-N 0.000 description 1
- XSCRXCDDATUDLB-UHFFFAOYSA-N 2-(2-methylpropoxymethyl)prop-2-enamide Chemical compound CC(C)COCC(=C)C(N)=O XSCRXCDDATUDLB-UHFFFAOYSA-N 0.000 description 1
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 description 1
- UATUCIKYJLUTBD-UHFFFAOYSA-N 2-(dibutylamino)ethyl 2-methylprop-2-enoate Chemical compound CCCCN(CCCC)CCOC(=O)C(C)=C UATUCIKYJLUTBD-UHFFFAOYSA-N 0.000 description 1
- UOZJCRSVUOQDNJ-UHFFFAOYSA-N 2-(dibutylamino)ethyl prop-2-enoate Chemical compound CCCCN(CCCC)CCOC(=O)C=C UOZJCRSVUOQDNJ-UHFFFAOYSA-N 0.000 description 1
- SJIXRGNQPBQWMK-UHFFFAOYSA-N 2-(diethylamino)ethyl 2-methylprop-2-enoate Chemical compound CCN(CC)CCOC(=O)C(C)=C SJIXRGNQPBQWMK-UHFFFAOYSA-N 0.000 description 1
- QHVBLSNVXDSMEB-UHFFFAOYSA-N 2-(diethylamino)ethyl prop-2-enoate Chemical compound CCN(CC)CCOC(=O)C=C QHVBLSNVXDSMEB-UHFFFAOYSA-N 0.000 description 1
- JKNCOURZONDCGV-UHFFFAOYSA-N 2-(dimethylamino)ethyl 2-methylprop-2-enoate Chemical compound CN(C)CCOC(=O)C(C)=C JKNCOURZONDCGV-UHFFFAOYSA-N 0.000 description 1
- DPBJAVGHACCNRL-UHFFFAOYSA-N 2-(dimethylamino)ethyl prop-2-enoate Chemical compound CN(C)CCOC(=O)C=C DPBJAVGHACCNRL-UHFFFAOYSA-N 0.000 description 1
- HPGIOSOCXHTQGW-UHFFFAOYSA-N 2-(dipropylamino)ethyl prop-2-enoate Chemical compound CCCN(CCC)CCOC(=O)C=C HPGIOSOCXHTQGW-UHFFFAOYSA-N 0.000 description 1
- KZUIKPMQAIEBOE-UHFFFAOYSA-N 2-(ethylamino)ethyl 2-methylprop-2-enoate Chemical compound CCNCCOC(=O)C(C)=C KZUIKPMQAIEBOE-UHFFFAOYSA-N 0.000 description 1
- BEWCNXNIQCLWHP-UHFFFAOYSA-N 2-(tert-butylamino)ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCNC(C)(C)C BEWCNXNIQCLWHP-UHFFFAOYSA-N 0.000 description 1
- KDAKDBASXBEFFK-UHFFFAOYSA-N 2-(tert-butylamino)ethyl prop-2-enoate Chemical compound CC(C)(C)NCCOC(=O)C=C KDAKDBASXBEFFK-UHFFFAOYSA-N 0.000 description 1
- GOXQRTZXKQZDDN-UHFFFAOYSA-N 2-Ethylhexyl acrylate Chemical compound CCCCC(CC)COC(=O)C=C GOXQRTZXKQZDDN-UHFFFAOYSA-N 0.000 description 1
- VETIYACESIPJSO-UHFFFAOYSA-N 2-[2-(2-hydroxyethoxy)ethoxy]ethyl prop-2-enoate Chemical compound OCCOCCOCCOC(=O)C=C VETIYACESIPJSO-UHFFFAOYSA-N 0.000 description 1
- JFZBUNLOTDDXNY-UHFFFAOYSA-N 2-[2-(2-methylprop-2-enoyloxy)propoxy]propyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC(C)OCC(C)OC(=O)C(C)=C JFZBUNLOTDDXNY-UHFFFAOYSA-N 0.000 description 1
- XYLUFBWQMNTICR-UHFFFAOYSA-N 2-[di(butan-2-yl)amino]ethyl prop-2-enoate Chemical compound CCC(C)N(C(C)CC)CCOC(=O)C=C XYLUFBWQMNTICR-UHFFFAOYSA-N 0.000 description 1
- QLIBJPGWWSHWBF-UHFFFAOYSA-N 2-aminoethyl methacrylate Chemical compound CC(=C)C(=O)OCCN QLIBJPGWWSHWBF-UHFFFAOYSA-N 0.000 description 1
- UGIJCMNGQCUTPI-UHFFFAOYSA-N 2-aminoethyl prop-2-enoate Chemical compound NCCOC(=O)C=C UGIJCMNGQCUTPI-UHFFFAOYSA-N 0.000 description 1
- HMENQNSSJFLQOP-UHFFFAOYSA-N 2-bromoprop-2-enoic acid Chemical compound OC(=O)C(Br)=C HMENQNSSJFLQOP-UHFFFAOYSA-N 0.000 description 1
- OGTWBSIKKGENPC-UHFFFAOYSA-N 2-chlorobuta-1,3-dienylphosphonic acid Chemical compound OP(O)(=O)C=C(Cl)C=C OGTWBSIKKGENPC-UHFFFAOYSA-N 0.000 description 1
- IJVRPNIWWODHHA-UHFFFAOYSA-N 2-cyanoprop-2-enoic acid Chemical compound OC(=O)C(=C)C#N IJVRPNIWWODHHA-UHFFFAOYSA-N 0.000 description 1
- PLWQJHWLGRXAMP-UHFFFAOYSA-N 2-ethenoxy-n,n-diethylethanamine Chemical compound CCN(CC)CCOC=C PLWQJHWLGRXAMP-UHFFFAOYSA-N 0.000 description 1
- JWCDUUFOAZFFMX-UHFFFAOYSA-N 2-ethenoxy-n,n-dimethylethanamine Chemical compound CN(C)CCOC=C JWCDUUFOAZFFMX-UHFFFAOYSA-N 0.000 description 1
- CEYHHQSTMVVZQP-UHFFFAOYSA-N 2-ethenoxyethanamine Chemical compound NCCOC=C CEYHHQSTMVVZQP-UHFFFAOYSA-N 0.000 description 1
- KURPPWHPIYBYBS-UHFFFAOYSA-N 2-ethenylaniline Chemical compound NC1=CC=CC=C1C=C KURPPWHPIYBYBS-UHFFFAOYSA-N 0.000 description 1
- GQAOCNJRHMZKBR-UHFFFAOYSA-N 2-ethenylsulfanyl-n,n-diethylethanamine Chemical compound CCN(CC)CCSC=C GQAOCNJRHMZKBR-UHFFFAOYSA-N 0.000 description 1
- OHWBJBZVYGDDNO-UHFFFAOYSA-N 2-ethenylsulfanyl-n-methylethanamine Chemical compound CNCCSC=C OHWBJBZVYGDDNO-UHFFFAOYSA-N 0.000 description 1
- JEIWZOOQUZYRFS-UHFFFAOYSA-N 2-ethenylsulfanylethanamine Chemical compound NCCSC=C JEIWZOOQUZYRFS-UHFFFAOYSA-N 0.000 description 1
- SFPNZPQIIAJXGL-UHFFFAOYSA-N 2-ethoxyethyl 2-methylprop-2-enoate Chemical compound CCOCCOC(=O)C(C)=C SFPNZPQIIAJXGL-UHFFFAOYSA-N 0.000 description 1
- FWWXYLGCHHIKNY-UHFFFAOYSA-N 2-ethoxyethyl prop-2-enoate Chemical compound CCOCCOC(=O)C=C FWWXYLGCHHIKNY-UHFFFAOYSA-N 0.000 description 1
- TYCFGHUTYSLISP-UHFFFAOYSA-N 2-fluoroprop-2-enoic acid Chemical compound OC(=O)C(F)=C TYCFGHUTYSLISP-UHFFFAOYSA-N 0.000 description 1
- WFUGQJXVXHBTEM-UHFFFAOYSA-N 2-hydroperoxy-2-(2-hydroperoxybutan-2-ylperoxy)butane Chemical compound CCC(C)(OO)OOC(C)(CC)OO WFUGQJXVXHBTEM-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- VHSHLMUCYSAUQU-UHFFFAOYSA-N 2-hydroxypropyl methacrylate Chemical compound CC(O)COC(=O)C(C)=C VHSHLMUCYSAUQU-UHFFFAOYSA-N 0.000 description 1
- YXYJVFYWCLAXHO-UHFFFAOYSA-N 2-methoxyethyl 2-methylprop-2-enoate Chemical compound COCCOC(=O)C(C)=C YXYJVFYWCLAXHO-UHFFFAOYSA-N 0.000 description 1
- HFCUBKYHMMPGBY-UHFFFAOYSA-N 2-methoxyethyl prop-2-enoate Chemical compound COCCOC(=O)C=C HFCUBKYHMMPGBY-UHFFFAOYSA-N 0.000 description 1
- JNDVNJWCRZQGFQ-UHFFFAOYSA-N 2-methyl-N,N-bis(methylamino)hex-2-enamide Chemical compound CCCC=C(C)C(=O)N(NC)NC JNDVNJWCRZQGFQ-UHFFFAOYSA-N 0.000 description 1
- YQIGLEFUZMIVHU-UHFFFAOYSA-N 2-methyl-n-propan-2-ylprop-2-enamide Chemical compound CC(C)NC(=O)C(C)=C YQIGLEFUZMIVHU-UHFFFAOYSA-N 0.000 description 1
- CCIDRBFZPRURMU-UHFFFAOYSA-N 2-methyl-n-propylprop-2-enamide Chemical compound CCCNC(=O)C(C)=C CCIDRBFZPRURMU-UHFFFAOYSA-N 0.000 description 1
- GQWNPIKWYPQUPI-UHFFFAOYSA-N 2-methylbut-3-enoic acid Chemical compound C=CC(C)C(O)=O GQWNPIKWYPQUPI-UHFFFAOYSA-N 0.000 description 1
- LPNSCOVIJFIXTJ-UHFFFAOYSA-N 2-methylidenebutanamide Chemical compound CCC(=C)C(N)=O LPNSCOVIJFIXTJ-UHFFFAOYSA-N 0.000 description 1
- YICILWNDMQTUIY-UHFFFAOYSA-N 2-methylidenepentanamide Chemical compound CCCC(=C)C(N)=O YICILWNDMQTUIY-UHFFFAOYSA-N 0.000 description 1
- SFUUDZYXHNYCTM-UHFFFAOYSA-N 2-methylprop-2-enamide;prop-2-enamide Chemical compound NC(=O)C=C.CC(=C)C(N)=O SFUUDZYXHNYCTM-UHFFFAOYSA-N 0.000 description 1
- HWNIMFWVBMOWHI-UHFFFAOYSA-N 2-morpholin-4-ylethyl prop-2-enoate Chemical compound C=CC(=O)OCCN1CCOCC1 HWNIMFWVBMOWHI-UHFFFAOYSA-N 0.000 description 1
- BNCADMBVWNPPIZ-UHFFFAOYSA-N 2-n,2-n,4-n,4-n,6-n,6-n-hexakis(methoxymethyl)-1,3,5-triazine-2,4,6-triamine Chemical compound COCN(COC)C1=NC(N(COC)COC)=NC(N(COC)COC)=N1 BNCADMBVWNPPIZ-UHFFFAOYSA-N 0.000 description 1
- RGGSSHZYQIOCQA-UHFFFAOYSA-N 2-nitroprop-2-enoic acid Chemical compound OC(=O)C(=C)[N+]([O-])=O RGGSSHZYQIOCQA-UHFFFAOYSA-N 0.000 description 1
- GMTJKMKNOIUGPG-UHFFFAOYSA-N 2-piperidin-1-ylethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCN1CCCCC1 GMTJKMKNOIUGPG-UHFFFAOYSA-N 0.000 description 1
- FGSBZZTYGCQZPD-UHFFFAOYSA-N 2-piperidin-1-ylethyl prop-2-enoate Chemical compound C=CC(=O)OCCN1CCCCC1 FGSBZZTYGCQZPD-UHFFFAOYSA-N 0.000 description 1
- NYNJMVZFPBGZPU-UHFFFAOYSA-N 2-prop-2-enoxypropanoic acid Chemical compound OC(=O)C(C)OCC=C NYNJMVZFPBGZPU-UHFFFAOYSA-N 0.000 description 1
- VFZKVQVQOMDJEG-UHFFFAOYSA-N 2-prop-2-enoyloxypropyl prop-2-enoate Chemical compound C=CC(=O)OC(C)COC(=O)C=C VFZKVQVQOMDJEG-UHFFFAOYSA-N 0.000 description 1
- QIOZUJXHOJBKRG-UHFFFAOYSA-N 2-pyrrolidin-1-ylethyl prop-2-enoate Chemical compound C=CC(=O)OCCN1CCCC1 QIOZUJXHOJBKRG-UHFFFAOYSA-N 0.000 description 1
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 1
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 1
- WWJCRUKUIQRCGP-UHFFFAOYSA-N 3-(dimethylamino)propyl 2-methylprop-2-enoate Chemical compound CN(C)CCCOC(=O)C(C)=C WWJCRUKUIQRCGP-UHFFFAOYSA-N 0.000 description 1
- UFQHFMGRRVQFNA-UHFFFAOYSA-N 3-(dimethylamino)propyl prop-2-enoate Chemical compound CN(C)CCCOC(=O)C=C UFQHFMGRRVQFNA-UHFFFAOYSA-N 0.000 description 1
- JPVNTYZOJCDQBK-UHFFFAOYSA-N 3-ethenoxypropan-1-amine Chemical compound NCCCOC=C JPVNTYZOJCDQBK-UHFFFAOYSA-N 0.000 description 1
- DPZYLEIWHTWHCU-UHFFFAOYSA-N 3-ethenylpyridine Chemical compound C=CC1=CC=CN=C1 DPZYLEIWHTWHCU-UHFFFAOYSA-N 0.000 description 1
- GNSFRPWPOGYVLO-UHFFFAOYSA-N 3-hydroxypropyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCO GNSFRPWPOGYVLO-UHFFFAOYSA-N 0.000 description 1
- QZPSOSOOLFHYRR-UHFFFAOYSA-N 3-hydroxypropyl prop-2-enoate Chemical compound OCCCOC(=O)C=C QZPSOSOOLFHYRR-UHFFFAOYSA-N 0.000 description 1
- XOJWAAUYNWGQAU-UHFFFAOYSA-N 4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCCOC(=O)C(C)=C XOJWAAUYNWGQAU-UHFFFAOYSA-N 0.000 description 1
- LBSXSAXOLABXMF-UHFFFAOYSA-N 4-Vinylaniline Chemical compound NC1=CC=C(C=C)C=C1 LBSXSAXOLABXMF-UHFFFAOYSA-N 0.000 description 1
- DZBFGWQDTFSLBD-UHFFFAOYSA-N 4-bromobut-3-enoic acid Chemical compound OC(=O)CC=CBr DZBFGWQDTFSLBD-UHFFFAOYSA-N 0.000 description 1
- MSNHXOWRTKCJRK-UHFFFAOYSA-N 4-chlorobut-3-enoic acid Chemical compound OC(=O)CC=CCl MSNHXOWRTKCJRK-UHFFFAOYSA-N 0.000 description 1
- NSCJJSJTGIJRRX-UHFFFAOYSA-N 4-ethenoxybutan-1-amine Chemical compound NCCCCOC=C NSCJJSJTGIJRRX-UHFFFAOYSA-N 0.000 description 1
- KFDVPJUYSDEJTH-UHFFFAOYSA-N 4-ethenylpyridine Chemical compound C=CC1=CC=NC=C1 KFDVPJUYSDEJTH-UHFFFAOYSA-N 0.000 description 1
- VPPHKHDARGZSFK-UHFFFAOYSA-N 5,5-bis(hydroxymethyl)imidazolidine-2,4-dione Chemical compound OCC1(CO)NC(=O)NC1=O VPPHKHDARGZSFK-UHFFFAOYSA-N 0.000 description 1
- HRTHDIYBNJQCTF-UHFFFAOYSA-N 5-ethenoxypentan-1-amine Chemical compound NCCCCCOC=C HRTHDIYBNJQCTF-UHFFFAOYSA-N 0.000 description 1
- YOQXWFAPUCIKIH-UHFFFAOYSA-N 5-ethenyl-2-ethylpyridine Chemical compound CCC1=CC=C(C=C)C=N1 YOQXWFAPUCIKIH-UHFFFAOYSA-N 0.000 description 1
- SGMGVYDSPXFBMU-UHFFFAOYSA-N 5-ethenyl-2-methylaniline Chemical compound CC1=CC=C(C=C)C=C1N SGMGVYDSPXFBMU-UHFFFAOYSA-N 0.000 description 1
- OHNKSVVCUPOUDJ-UHFFFAOYSA-N 5-nitro-1h-indene Chemical compound [O-][N+](=O)C1=CC=C2CC=CC2=C1 OHNKSVVCUPOUDJ-UHFFFAOYSA-N 0.000 description 1
- IALWCWDHZPFHSY-UHFFFAOYSA-N 8-ethenoxyoctan-1-amine Chemical compound NCCCCCCCCOC=C IALWCWDHZPFHSY-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- KLYCPFXDDDMZNQ-UHFFFAOYSA-N Benzyne Chemical compound C1=CC#CC=C1 KLYCPFXDDDMZNQ-UHFFFAOYSA-N 0.000 description 1
- OPYFPKKTVMBNFI-UHFFFAOYSA-N C(C(=C)C)(=O)OCCN(C(C)CC)C(C)CC Chemical compound C(C(=C)C)(=O)OCCN(C(C)CC)C(C)CC OPYFPKKTVMBNFI-UHFFFAOYSA-N 0.000 description 1
- CVCYKTXEAQWEGM-FAOVPRGRSA-N CC(=C)C(O)=O.CC(=C)C(O)=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O Chemical compound CC(=C)C(O)=O.CC(=C)C(O)=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O CVCYKTXEAQWEGM-FAOVPRGRSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- SQBTXCUEVWXKBM-UHFFFAOYSA-N FC=CCC(=O)O Chemical compound FC=CCC(=O)O SQBTXCUEVWXKBM-UHFFFAOYSA-N 0.000 description 1
- IWYRWIUNAVNFPE-UHFFFAOYSA-N Glycidaldehyde Chemical compound O=CC1CO1 IWYRWIUNAVNFPE-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- CNCOEDDPFOAUMB-UHFFFAOYSA-N N-Methylolacrylamide Chemical compound OCNC(=O)C=C CNCOEDDPFOAUMB-UHFFFAOYSA-N 0.000 description 1
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
- QLZHNIAADXEJJP-UHFFFAOYSA-N Phenylphosphonic acid Chemical compound OP(O)(=O)C1=CC=CC=C1 QLZHNIAADXEJJP-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical group OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004642 Polyimide Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- KKCBVBFXQQLKLN-UHFFFAOYSA-N [5-(dimethylamino)-2-hydroxypentyl] 2-methylprop-2-enoate Chemical compound CN(C)CCCC(O)COC(=O)C(C)=C KKCBVBFXQQLKLN-UHFFFAOYSA-N 0.000 description 1
- CUIYHFBYLNLDRK-UHFFFAOYSA-N [5-(dimethylamino)-2-hydroxypentyl] prop-2-enoate Chemical compound CN(C)CCCC(O)COC(=O)C=C CUIYHFBYLNLDRK-UHFFFAOYSA-N 0.000 description 1
- 229940091179 aconitate Drugs 0.000 description 1
- 229940091181 aconitic acid Drugs 0.000 description 1
- 150000003926 acrylamides Chemical class 0.000 description 1
- 229910052768 actinide Inorganic materials 0.000 description 1
- 150000001255 actinides Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000000278 alkyl amino alkyl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000000746 allylic group Chemical group 0.000 description 1
- FTWHFXMUJQRNBK-UHFFFAOYSA-N alpha-Methylen-gamma-aminobuttersaeure Natural products NCCC(=C)C(O)=O FTWHFXMUJQRNBK-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229920003180 amino resin Polymers 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- BFHRUCFCIXWADD-UHFFFAOYSA-N bis(ethenyl) 2,3-dihydroxybutanedioate Chemical compound C=COC(=O)C(O)C(O)C(=O)OC=C BFHRUCFCIXWADD-UHFFFAOYSA-N 0.000 description 1
- ZPOLOEWJWXZUSP-AATRIKPKSA-N bis(prop-2-enyl) (e)-but-2-enedioate Chemical compound C=CCOC(=O)\C=C\C(=O)OCC=C ZPOLOEWJWXZUSP-AATRIKPKSA-N 0.000 description 1
- ZPOLOEWJWXZUSP-WAYWQWQTSA-N bis(prop-2-enyl) (z)-but-2-enedioate Chemical compound C=CCOC(=O)\C=C/C(=O)OCC=C ZPOLOEWJWXZUSP-WAYWQWQTSA-N 0.000 description 1
- VPPSHXIFIAJKMX-UHFFFAOYSA-N bis(prop-2-enyl) 2,3-dihydroxybutanedioate Chemical compound C=CCOC(=O)C(O)C(O)C(=O)OCC=C VPPSHXIFIAJKMX-UHFFFAOYSA-N 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- PVEOYINWKBTPIZ-UHFFFAOYSA-N but-3-enoic acid Chemical compound OC(=O)CC=C PVEOYINWKBTPIZ-UHFFFAOYSA-N 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- WUKWITHWXAAZEY-UHFFFAOYSA-L calcium difluoride Chemical compound [F-].[F-].[Ca+2] WUKWITHWXAAZEY-UHFFFAOYSA-L 0.000 description 1
- 229910001634 calcium fluoride Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 229910000420 cerium oxide Inorganic materials 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical class [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- GTZCVFVGUGFEME-IWQZZHSRSA-N cis-aconitic acid Chemical compound OC(=O)C\C(C(O)=O)=C\C(O)=O GTZCVFVGUGFEME-IWQZZHSRSA-N 0.000 description 1
- 229940018560 citraconate Drugs 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000000151 deposition Methods 0.000 description 1
- VVYDVQWJZWRVPE-UHFFFAOYSA-L dimethyltin(2+);diiodide Chemical compound C[Sn](C)(I)I VVYDVQWJZWRVPE-UHFFFAOYSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- AFOSIXZFDONLBT-UHFFFAOYSA-N divinyl sulfone Chemical compound C=CS(=O)(=O)C=C AFOSIXZFDONLBT-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010894 electron beam technology Methods 0.000 description 1
- FKIRSCKRJJUCNI-UHFFFAOYSA-N ethyl 7-bromo-1h-indole-2-carboxylate Chemical compound C1=CC(Br)=C2NC(C(=O)OCC)=CC2=C1 FKIRSCKRJJUCNI-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 239000011953 free-radical catalyst Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000011245 gel electrolyte Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 229940015043 glyoxal Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 150000002602 lanthanoids Chemical class 0.000 description 1
- 230000031700 light absorption Effects 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 150000001247 metal acetylides Chemical class 0.000 description 1
- 229910001092 metal group alloy Inorganic materials 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 229910052976 metal sulfide Inorganic materials 0.000 description 1
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- MEFBJEMVZONFCJ-UHFFFAOYSA-N molybdate Chemical compound [O-][Mo]([O-])(=O)=O MEFBJEMVZONFCJ-UHFFFAOYSA-N 0.000 description 1
- WFKDPJRCBCBQNT-UHFFFAOYSA-N n,2-dimethylprop-2-enamide Chemical compound CNC(=O)C(C)=C WFKDPJRCBCBQNT-UHFFFAOYSA-N 0.000 description 1
- ZIUHHBKFKCYYJD-UHFFFAOYSA-N n,n'-methylenebisacrylamide Chemical compound C=CC(=O)NCNC(=O)C=C ZIUHHBKFKCYYJD-UHFFFAOYSA-N 0.000 description 1
- WTZRKXMQMQBYDE-UHFFFAOYSA-N n-(2-ethenoxyethyl)-2,4,4-trimethylpentan-2-amine Chemical compound CC(C)(C)CC(C)(C)NCCOC=C WTZRKXMQMQBYDE-UHFFFAOYSA-N 0.000 description 1
- OOAVGGXQQIGUNC-UHFFFAOYSA-N n-(2-ethenoxyethyl)-2-methylpropan-2-amine Chemical compound CC(C)(C)NCCOC=C OOAVGGXQQIGUNC-UHFFFAOYSA-N 0.000 description 1
- JZBRIWIUZQBVQE-UHFFFAOYSA-N n-(2-ethenoxyethyl)-3,5,5-trimethylhexan-1-amine Chemical compound CC(C)(C)CC(C)CCNCCOC=C JZBRIWIUZQBVQE-UHFFFAOYSA-N 0.000 description 1
- KPOVTZIQXUMXON-UHFFFAOYSA-N n-(2-ethenoxyethyl)-n-ethylhexan-1-amine Chemical compound CCCCCCN(CC)CCOC=C KPOVTZIQXUMXON-UHFFFAOYSA-N 0.000 description 1
- OHVSEVQRQJMLGP-UHFFFAOYSA-N n-(2-ethenoxyethyl)cyclohexanamine Chemical compound C=COCCNC1CCCCC1 OHVSEVQRQJMLGP-UHFFFAOYSA-N 0.000 description 1
- BSCJIBOZTKGXQP-UHFFFAOYSA-N n-(2-hydroxyethyl)-2-methylprop-2-enamide Chemical compound CC(=C)C(=O)NCCO BSCJIBOZTKGXQP-UHFFFAOYSA-N 0.000 description 1
- UUORTJUPDJJXST-UHFFFAOYSA-N n-(2-hydroxyethyl)prop-2-enamide Chemical compound OCCNC(=O)C=C UUORTJUPDJJXST-UHFFFAOYSA-N 0.000 description 1
- OMNKZBIFPJNNIO-UHFFFAOYSA-N n-(2-methyl-4-oxopentan-2-yl)prop-2-enamide Chemical compound CC(=O)CC(C)(C)NC(=O)C=C OMNKZBIFPJNNIO-UHFFFAOYSA-N 0.000 description 1
- KCTMTGOHHMRJHZ-UHFFFAOYSA-N n-(2-methylpropoxymethyl)prop-2-enamide Chemical compound CC(C)COCNC(=O)C=C KCTMTGOHHMRJHZ-UHFFFAOYSA-N 0.000 description 1
- YRVUCYWJQFRCOB-UHFFFAOYSA-N n-butylprop-2-enamide Chemical compound CCCCNC(=O)C=C YRVUCYWJQFRCOB-UHFFFAOYSA-N 0.000 description 1
- YPHQUSNPXDGUHL-UHFFFAOYSA-N n-methylprop-2-enamide Chemical compound CNC(=O)C=C YPHQUSNPXDGUHL-UHFFFAOYSA-N 0.000 description 1
- QNILTEGFHQSKFF-UHFFFAOYSA-N n-propan-2-ylprop-2-enamide Chemical compound CC(C)NC(=O)C=C QNILTEGFHQSKFF-UHFFFAOYSA-N 0.000 description 1
- WDFKEEALECCKTJ-UHFFFAOYSA-N n-propylprop-2-enamide Chemical compound CCCNC(=O)C=C WDFKEEALECCKTJ-UHFFFAOYSA-N 0.000 description 1
- 150000004767 nitrides Chemical class 0.000 description 1
- 239000000615 nonconductor Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000000075 oxide glass Substances 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- BMMGVYCKOGBVEV-UHFFFAOYSA-N oxo(oxoceriooxy)cerium Chemical compound [Ce]=O.O=[Ce]=O BMMGVYCKOGBVEV-UHFFFAOYSA-N 0.000 description 1
- QUBQYFYWUJJAAK-UHFFFAOYSA-N oxymethurea Chemical compound OCNC(=O)NCO QUBQYFYWUJJAAK-UHFFFAOYSA-N 0.000 description 1
- 229950005308 oxymethurea Drugs 0.000 description 1
- HVAMZGADVCBITI-UHFFFAOYSA-N pent-4-enoic acid Chemical compound OC(=O)CCC=C HVAMZGADVCBITI-UHFFFAOYSA-N 0.000 description 1
- DBSDMAPJGHBWAL-UHFFFAOYSA-N penta-1,4-dien-3-ylbenzene Chemical compound C=CC(C=C)C1=CC=CC=C1 DBSDMAPJGHBWAL-UHFFFAOYSA-N 0.000 description 1
- GYDSPAVLTMAXHT-UHFFFAOYSA-N pentyl 2-methylprop-2-enoate Chemical compound CCCCCOC(=O)C(C)=C GYDSPAVLTMAXHT-UHFFFAOYSA-N 0.000 description 1
- ULDDEWDFUNBUCM-UHFFFAOYSA-N pentyl prop-2-enoate Chemical compound CCCCCOC(=O)C=C ULDDEWDFUNBUCM-UHFFFAOYSA-N 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- FSDNTQSJGHSJBG-UHFFFAOYSA-N piperidine-4-carbonitrile Chemical compound N#CC1CCNCC1 FSDNTQSJGHSJBG-UHFFFAOYSA-N 0.000 description 1
- 239000011505 plaster Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920001721 polyimide Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- XWCIXXXLOAAWPU-UHFFFAOYSA-N prop-1-enylphosphonic acid Chemical compound CC=CP(O)(O)=O XWCIXXXLOAAWPU-UHFFFAOYSA-N 0.000 description 1
- FBCQUCJYYPMKRO-UHFFFAOYSA-N prop-2-enyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC=C FBCQUCJYYPMKRO-UHFFFAOYSA-N 0.000 description 1
- KADVUADSGCRCHA-UHFFFAOYSA-N prop-2-enylarsonic acid Chemical compound O[As](O)(=O)CC=C KADVUADSGCRCHA-UHFFFAOYSA-N 0.000 description 1
- RZKYDQNMAUSEDZ-UHFFFAOYSA-N prop-2-enylphosphonic acid Chemical compound OP(O)(=O)CC=C RZKYDQNMAUSEDZ-UHFFFAOYSA-N 0.000 description 1
- BOQSSGDQNWEFSX-UHFFFAOYSA-N propan-2-yl 2-methylprop-2-enoate Chemical compound CC(C)OC(=O)C(C)=C BOQSSGDQNWEFSX-UHFFFAOYSA-N 0.000 description 1
- LYBIZMNPXTXVMV-UHFFFAOYSA-N propan-2-yl prop-2-enoate Chemical compound CC(C)OC(=O)C=C LYBIZMNPXTXVMV-UHFFFAOYSA-N 0.000 description 1
- CYLRAHJFPJNCGS-UHFFFAOYSA-N propan-2-yloxy hydrogen carbonate Chemical compound CC(C)OOC(O)=O CYLRAHJFPJNCGS-UHFFFAOYSA-N 0.000 description 1
- NHARPDSAXCBDDR-UHFFFAOYSA-N propyl 2-methylprop-2-enoate Chemical compound CCCOC(=O)C(C)=C NHARPDSAXCBDDR-UHFFFAOYSA-N 0.000 description 1
- PNXMTCDJUBJHQJ-UHFFFAOYSA-N propyl prop-2-enoate Chemical compound CCCOC(=O)C=C PNXMTCDJUBJHQJ-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000004528 spin coating Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- XTQHKBHJIVJGKJ-UHFFFAOYSA-N sulfur monoxide Chemical class S=O XTQHKBHJIVJGKJ-UHFFFAOYSA-N 0.000 description 1
- 238000010557 suspension polymerization reaction Methods 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 150000004772 tellurides Chemical class 0.000 description 1
- 229920006027 ternary co-polymer Polymers 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- GTZCVFVGUGFEME-UHFFFAOYSA-N trans-aconitic acid Natural products OC(=O)CC(C(O)=O)=CC(O)=O GTZCVFVGUGFEME-UHFFFAOYSA-N 0.000 description 1
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 description 1
- 150000003623 transition metal compounds Chemical class 0.000 description 1
- 238000002834 transmittance Methods 0.000 description 1
- 239000012780 transparent material Substances 0.000 description 1
- KJWHEZXBZQXVSA-UHFFFAOYSA-N tris(prop-2-enyl) phosphite Chemical compound C=CCOP(OCC=C)OCC=C KJWHEZXBZQXVSA-UHFFFAOYSA-N 0.000 description 1
- PBYZMCDFOULPGH-UHFFFAOYSA-N tungstate Chemical compound [O-][W]([O-])(=O)=O PBYZMCDFOULPGH-UHFFFAOYSA-N 0.000 description 1
- 238000001771 vacuum deposition Methods 0.000 description 1
- LSGOVYNHVSXFFJ-UHFFFAOYSA-N vanadate(3-) Chemical compound [O-][V]([O-])([O-])=O LSGOVYNHVSXFFJ-UHFFFAOYSA-N 0.000 description 1
- KAKZBPTYRLMSJV-UHFFFAOYSA-N vinyl-ethylene Natural products C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 1
- ZTWTYVWXUKTLCP-UHFFFAOYSA-N vinylphosphonic acid Chemical compound OP(O)(=O)C=C ZTWTYVWXUKTLCP-UHFFFAOYSA-N 0.000 description 1
- 238000001429 visible spectrum Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G02—OPTICS
- G02F—OPTICAL DEVICES OR ARRANGEMENTS FOR THE CONTROL OF LIGHT BY MODIFICATION OF THE OPTICAL PROPERTIES OF THE MEDIA OF THE ELEMENTS INVOLVED THEREIN; NON-LINEAR OPTICS; FREQUENCY-CHANGING OF LIGHT; OPTICAL LOGIC ELEMENTS; OPTICAL ANALOGUE/DIGITAL CONVERTERS
- G02F1/00—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics
- G02F1/01—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour
- G02F1/15—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour based on an electrochromic effect
- G02F1/1514—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour based on an electrochromic effect characterised by the electrochromic material, e.g. by the electrodeposited material
- G02F1/1523—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour based on an electrochromic effect characterised by the electrochromic material, e.g. by the electrodeposited material comprising inorganic material
- G02F1/1525—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour based on an electrochromic effect characterised by the electrochromic material, e.g. by the electrodeposited material comprising inorganic material characterised by a particular ion transporting layer, e.g. electrolyte
Landscapes
- Physics & Mathematics (AREA)
- Chemical & Material Sciences (AREA)
- Nonlinear Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Inorganic Chemistry (AREA)
- General Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Electrochromic Elements, Electrophoresis, Or Variable Reflection Or Absorption Elements (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Devices For Indicating Variable Information By Combining Individual Elements (AREA)
- Control Of Indicators Other Than Cathode Ray Tubes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/877,139 US4174152A (en) | 1978-02-13 | 1978-02-13 | Electrochromic devices with polymeric electrolytes |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS54115147A JPS54115147A (en) | 1979-09-07 |
| JPS6145814B2 true JPS6145814B2 (en:Method) | 1986-10-09 |
Family
ID=25369337
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP1235279A Granted JPS54115147A (en) | 1978-02-13 | 1979-02-07 | Electrochrom apparatus |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4174152A (en:Method) |
| JP (1) | JPS54115147A (en:Method) |
| AR (1) | AR222023A1 (en:Method) |
| AT (1) | AT378618B (en:Method) |
| AU (1) | AU525796B2 (en:Method) |
| BE (1) | BE874089A (en:Method) |
| BR (1) | BR7807833A (en:Method) |
| CA (1) | CA1105601A (en:Method) |
| CH (1) | CH639209A5 (en:Method) |
| DE (1) | DE2904052A1 (en:Method) |
| ES (1) | ES477636A1 (en:Method) |
| FR (1) | FR2417154A1 (en:Method) |
| GB (1) | GB2014326B (en:Method) |
| IL (1) | IL55855A (en:Method) |
| IT (1) | IT1116845B (en:Method) |
| MX (1) | MX151432A (en:Method) |
| NL (1) | NL7811270A (en:Method) |
| NO (1) | NO151482C (en:Method) |
| PH (1) | PH15117A (en:Method) |
| PT (1) | PT69064A (en:Method) |
| SE (1) | SE445496B (en:Method) |
| SU (1) | SU814288A3 (en:Method) |
| ZA (1) | ZA785837B (en:Method) |
Families Citing this family (84)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1153427A (en) * | 1978-12-11 | 1983-09-06 | Patrick T. Cahalan | Tape electrode |
| US4297006A (en) * | 1978-12-28 | 1981-10-27 | Timex Corporation | Protective membrane for electrochromic displays |
| US4335938A (en) * | 1979-08-30 | 1982-06-22 | American Cyanamid Company | Electrochromic cells with improved electrolyte system |
| JPS5662229A (en) * | 1979-10-25 | 1981-05-28 | Asahi Glass Co Ltd | Electro-optical dimming panel |
| US4344674A (en) * | 1980-07-18 | 1982-08-17 | American Cyanamid Company | Electrochromic display device with improved erasing characteristic |
| US4361385A (en) * | 1980-10-23 | 1982-11-30 | American Cyanamid Company | Electrochromic device containing acid copolymer electrolyte |
| DE3374447D1 (en) * | 1982-01-11 | 1987-12-17 | Seiko Instr Inc | Electrochromic display device |
| US4488781A (en) * | 1982-01-25 | 1984-12-18 | American Cyanamid Company | Method for manufacturing an electrochromic display device and device produced thereby |
| JPS5950486A (ja) * | 1982-09-17 | 1984-03-23 | 株式会社東芝 | 電気発色表示素子 |
| JPS608267B2 (ja) * | 1982-11-30 | 1985-03-01 | 株式会社東芝 | 電気発色表示素子 |
| EP0229438A1 (en) * | 1986-01-17 | 1987-07-22 | The Signal Companies Inc. | Electrochromic devices using solid electrolytes |
| JPS60179703A (ja) * | 1984-02-28 | 1985-09-13 | Seiko Instr & Electronics Ltd | 多色表示装置の製造方法 |
| GB2170017B (en) * | 1984-12-24 | 1988-09-14 | Canon Kk | Optical device |
| US4902108A (en) * | 1986-03-31 | 1990-02-20 | Gentex Corporation | Single-compartment, self-erasing, solution-phase electrochromic devices, solutions for use therein, and uses thereof |
| JPS63271321A (ja) * | 1987-04-30 | 1988-11-09 | Hidetoshi Tsuchida | 全固体高分子系エレクトロクロミツク表示素子 |
| US4768865A (en) * | 1987-06-10 | 1988-09-06 | Ppg Industries, Inc. | Electrochromic window with metal grid counter electrode |
| SE8801637D0 (sv) * | 1988-04-29 | 1988-04-29 | Jim Stevens | Electrochromic device and a method to manufacture the same |
| FR2642890B1 (fr) * | 1989-02-09 | 1991-04-12 | Saint Gobain Vitrage | Materiau colloide conducteur de cations alcalins et applications a titre d'electrolytes |
| US5066111A (en) * | 1989-09-13 | 1991-11-19 | Ppg Industries, Inc. | Electrochromic window with integrated bus bars |
| US5124832A (en) * | 1989-09-29 | 1992-06-23 | Ppg Industries, Inc. | Laminated and sealed electrochromic window |
| AU615622B2 (en) * | 1989-09-13 | 1991-10-03 | Ppg Industries, Inc. | Electrochromic window with polymer layer |
| US5189549A (en) * | 1990-02-26 | 1993-02-23 | Molecular Displays, Inc. | Electrochromic, electroluminescent and electrochemiluminescent displays |
| US5157540A (en) * | 1990-07-11 | 1992-10-20 | Toray Industries, Inc. | Electrochromic display device with improved absorption spectrum and method of producing it |
| AU643093B2 (en) * | 1990-12-26 | 1993-11-04 | Ppg Industries Ohio, Inc. | Solid-state electrochromic device with protong-conducting polymer electrolyte |
| US5161048A (en) * | 1990-12-26 | 1992-11-03 | Ppg Industries, Inc. | Electrochromic window with metal grid counter electrode and acidic polyelectrolyte |
| US5311350A (en) * | 1991-01-16 | 1994-05-10 | Hamamatsu Photonics K.K. | Optical device and apparatus using the optical device |
| EP0555114B1 (en) * | 1992-01-20 | 1996-11-13 | Nippon Telegraph And Telephone Corporation | Solid polymer electrolyte and method of manufacture thereof |
| US5327281A (en) * | 1992-04-23 | 1994-07-05 | Eic Laboratories | Solid polymeric electrolytes for electrochromic devices having reduced acidity and high anodic stability |
| EP0612826B1 (en) * | 1993-02-26 | 2000-10-04 | Donnelly Corporation | Electrochromic polymeric solid films, manufacturing electrochromic devices using such solid films, and processing for making such solid films and devices |
| US5910854A (en) | 1993-02-26 | 1999-06-08 | Donnelly Corporation | Electrochromic polymeric solid films, manufacturing electrochromic devices using such solid films, and processes for making such solid films and devices |
| WO1995013562A1 (en) * | 1993-11-12 | 1995-05-18 | Ppg Industries, Inc. | Iridium oxide film for electrochromic device |
| US5471554A (en) * | 1993-11-12 | 1995-11-28 | Ppg Industries, Inc. | Primer for electrochromic device with plastic substrate |
| US5471338A (en) * | 1993-11-12 | 1995-11-28 | Ppg Industries, Inc. | Electrochromic device with plastic substrate |
| US5668663A (en) | 1994-05-05 | 1997-09-16 | Donnelly Corporation | Electrochromic mirrors and devices |
| US5679283A (en) * | 1994-07-22 | 1997-10-21 | Gentex Corporation | Electrochromic layer and devices comprising same |
| US6891563B2 (en) | 1996-05-22 | 2005-05-10 | Donnelly Corporation | Vehicular vision system |
| US5798860A (en) * | 1996-01-16 | 1998-08-25 | Ppg Industries, Inc. | Iridium oxide film for electrochromic device |
| US5928572A (en) | 1996-03-15 | 1999-07-27 | Gentex Corporation | Electrochromic layer and devices comprising same |
| EP0923754A1 (en) | 1996-08-20 | 1999-06-23 | Donnelly Corporation | Window assembly with controllable optical transmission |
| US6326613B1 (en) | 1998-01-07 | 2001-12-04 | Donnelly Corporation | Vehicle interior mirror assembly adapted for containing a rain sensor |
| US6124886A (en) | 1997-08-25 | 2000-09-26 | Donnelly Corporation | Modular rearview mirror assembly |
| US8294975B2 (en) | 1997-08-25 | 2012-10-23 | Donnelly Corporation | Automotive rearview mirror assembly |
| US6172613B1 (en) | 1998-02-18 | 2001-01-09 | Donnelly Corporation | Rearview mirror assembly incorporating vehicle information display |
| US5953150A (en) * | 1997-12-22 | 1999-09-14 | Ppg Industries Ohio, Inc. | Edge design for electrochromic devices |
| US5969847A (en) * | 1997-12-22 | 1999-10-19 | Ppg Industries Ohio, Inc. | Method for sealing a laminated electrochromic device edge |
| US8288711B2 (en) | 1998-01-07 | 2012-10-16 | Donnelly Corporation | Interior rearview mirror system with forwardly-viewing camera and a control |
| US6445287B1 (en) | 2000-02-28 | 2002-09-03 | Donnelly Corporation | Tire inflation assistance monitoring system |
| US6214261B1 (en) | 1998-03-23 | 2001-04-10 | Ppg Industries Ohio, Inc. | Method for forming a molded edge seal |
| US6329925B1 (en) | 1999-11-24 | 2001-12-11 | Donnelly Corporation | Rearview mirror assembly with added feature modular display |
| US6693517B2 (en) | 2000-04-21 | 2004-02-17 | Donnelly Corporation | Vehicle mirror assembly communicating wirelessly with vehicle accessories and occupants |
| US6477464B2 (en) | 2000-03-09 | 2002-11-05 | Donnelly Corporation | Complete mirror-based global-positioning system (GPS) navigation solution |
| US6317248B1 (en) | 1998-07-02 | 2001-11-13 | Donnelly Corporation | Busbars for electrically powered cells |
| DE19840186C2 (de) | 1998-09-03 | 2003-03-13 | Daimler Chrysler Ag | Verbundglasscheibe mit elektrisch steuerbarem Reflexionsgrad |
| WO2001064481A2 (en) | 2000-03-02 | 2001-09-07 | Donnelly Corporation | Video mirror systems incorporating an accessory module |
| US7167796B2 (en) | 2000-03-09 | 2007-01-23 | Donnelly Corporation | Vehicle navigation system for use with a telematics system |
| US7855755B2 (en) | 2005-11-01 | 2010-12-21 | Donnelly Corporation | Interior rearview mirror assembly with display |
| US7370983B2 (en) | 2000-03-02 | 2008-05-13 | Donnelly Corporation | Interior mirror assembly with display |
| US6515787B1 (en) | 2000-03-07 | 2003-02-04 | Eclipse Energy Systems, Inc. | Electrochromic layer |
| US7581859B2 (en) | 2005-09-14 | 2009-09-01 | Donnelly Corp. | Display device for exterior rearview mirror |
| US7255451B2 (en) | 2002-09-20 | 2007-08-14 | Donnelly Corporation | Electro-optic mirror cell |
| ES2287266T3 (es) | 2001-01-23 | 2007-12-16 | Donnelly Corporation | Sistema de iluminacion de vehiculos mejorado. |
| US6918674B2 (en) | 2002-05-03 | 2005-07-19 | Donnelly Corporation | Vehicle rearview mirror system |
| US7329013B2 (en) | 2002-06-06 | 2008-02-12 | Donnelly Corporation | Interior rearview mirror system with compass |
| WO2003105099A1 (en) | 2002-06-06 | 2003-12-18 | Donnelly Corporation | Interior rearview mirror system with compass |
| US7274501B2 (en) | 2002-09-20 | 2007-09-25 | Donnelly Corporation | Mirror reflective element assembly |
| WO2004103772A2 (en) | 2003-05-19 | 2004-12-02 | Donnelly Corporation | Mirror assembly for vehicle |
| US7310177B2 (en) | 2002-09-20 | 2007-12-18 | Donnelly Corporation | Electro-optic reflective element assembly |
| US7009750B1 (en) | 2002-10-25 | 2006-03-07 | Eclipse Energy Systems, Inc. | Apparatus and methods for modulating refractive index |
| US7446924B2 (en) | 2003-10-02 | 2008-11-04 | Donnelly Corporation | Mirror reflective element assembly including electronic component |
| US7308341B2 (en) * | 2003-10-14 | 2007-12-11 | Donnelly Corporation | Vehicle communication system |
| US20070231354A1 (en) * | 2005-04-21 | 2007-10-04 | Atsushi Sogabe | Water-Soluble Thickener and Cosmetic Preparation Containing Same |
| US7372610B2 (en) | 2005-02-23 | 2008-05-13 | Sage Electrochromics, Inc. | Electrochromic devices and methods |
| ATE517368T1 (de) | 2005-05-16 | 2011-08-15 | Donnelly Corp | Fahrzeugspiegelanordnung mit zeichen am reflektierenden teil |
| DE102006044069A1 (de) * | 2006-09-20 | 2008-03-27 | Bayer Materialscience Ag | Elektrochrome Anordnung |
| WO2009002556A1 (en) * | 2007-06-27 | 2008-12-31 | Gentex Corporation | Electrochromic device having an improved fill port plug |
| US8345345B2 (en) | 2007-06-27 | 2013-01-01 | Gentex Corporation | Electrochromic device having an improved fill port plug |
| US8154418B2 (en) | 2008-03-31 | 2012-04-10 | Magna Mirrors Of America, Inc. | Interior rearview mirror system |
| US9487144B2 (en) | 2008-10-16 | 2016-11-08 | Magna Mirrors Of America, Inc. | Interior mirror assembly with display |
| DE102009008740A1 (de) * | 2009-02-12 | 2010-08-19 | Clariant International Limited | Leicht dispergierbare feste Pigmentzubereitungen |
| US9057925B2 (en) | 2013-03-15 | 2015-06-16 | Gentex Corporation | Fill port plugs for electrochromic devices |
| RU2524963C1 (ru) * | 2013-03-29 | 2014-08-10 | Общество с ограниченной ответственностью "СмартЭлектроГласс" | Электропроводящий адгезив для электрохромных устройств |
| US9454054B2 (en) | 2013-11-18 | 2016-09-27 | Magna Mirrors Of America, Inc. | Electro-optic mirror element and process of making same |
| US10732477B2 (en) | 2018-03-19 | 2020-08-04 | Oktopolymer Llc | Electrochromic device and method of its manufacturing |
| KR102829345B1 (ko) * | 2020-11-03 | 2025-07-02 | 현대자동차주식회사 | 색상 가변 플라스틱 |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2527300A (en) * | 1948-03-18 | 1950-10-24 | American Cyanamid Co | Copolymers of unsaturated sulfonic acids and polyunsaturated compounds |
| US3282160A (en) * | 1963-01-07 | 1966-11-01 | Dow Chemical Co | Color reversible electrochemical light filter utilizing electrolytic solution |
| US3419431A (en) * | 1964-01-27 | 1968-12-31 | Amicon Corp | Polyelectrolyte gel separator and battery therewith |
| US3453038A (en) * | 1966-06-15 | 1969-07-01 | Du Pont | Compartmented electrochromic device |
| FR1536863A (fr) * | 1966-09-16 | 1968-08-16 | Bayer Ag | Polymères contenant des groupes acide sulfonique |
| US3521941A (en) * | 1967-02-07 | 1970-07-28 | American Cyanamid Co | Electro-optical device having variable optical density |
| US3629082A (en) * | 1969-04-22 | 1971-12-21 | Valentin Alexeevich Kargin | Process for producing homogeneous polymeric cation-exchange materials |
| US3684747A (en) * | 1970-04-22 | 1972-08-15 | Du Pont | Method for increasing the liquid absorptive capacity of linear fluorocarbon sulfonic acid polymer |
| US3708220A (en) * | 1970-05-25 | 1973-01-02 | American Cyanamid Co | High conductivity electrolyte gel materials |
| US3689810A (en) * | 1971-04-23 | 1972-09-05 | Wilhelm E Walles | All-plastic electric capacitor |
| BE786002A (fr) * | 1971-07-08 | 1973-01-08 | Montedison Spa | Copolymeres d'alcenylsulfonates, membranes permeables selectivement auxcations a base de ces copolymeres et procede de preparation de membranes a permeabilite selective a partir de ces copolymeres |
| US3840288A (en) * | 1973-07-30 | 1974-10-08 | Optel Corp | Electrochromic display having electro-catalyst |
| US3931092A (en) * | 1974-04-29 | 1976-01-06 | Basf Wyandotte Corporation | Finely-divided polymeric solids having improved physical properties |
| CH573155A5 (en:Method) * | 1974-06-12 | 1976-02-27 | Bbc Brown Boveri & Cie | |
| US4010117A (en) * | 1974-09-02 | 1977-03-01 | Nippon Gohsei Kagaku Kogyo Kabushiki Kaisha | Electroconductive material |
| US4071508A (en) * | 1975-02-11 | 1978-01-31 | Plastomedical Sciences, Inc. | Anionic hydrogels based on hydroxyalkyl acrylates and methacrylates |
| CH594263A5 (en:Method) * | 1975-11-29 | 1977-12-30 | Ebauches Sa | |
| US4116545A (en) * | 1976-10-27 | 1978-09-26 | American Cyanamid Company | Polymeric electrolyte for electrochromic display devices |
-
1978
- 1978-02-13 US US05/877,139 patent/US4174152A/en not_active Expired - Lifetime
- 1978-10-16 CA CA313,515A patent/CA1105601A/en not_active Expired
- 1978-10-17 ZA ZA00785837A patent/ZA785837B/xx unknown
- 1978-10-19 AU AU40854/78A patent/AU525796B2/en not_active Expired
- 1978-10-23 GB GB7841557A patent/GB2014326B/en not_active Expired
- 1978-10-31 AR AR274295A patent/AR222023A1/es active
- 1978-11-02 IL IL55855A patent/IL55855A/xx unknown
- 1978-11-14 NL NL7811270A patent/NL7811270A/xx not_active Application Discontinuation
- 1978-11-29 BR BR7807833A patent/BR7807833A/pt unknown
- 1978-12-28 NO NO784396A patent/NO151482C/no unknown
-
1979
- 1979-01-05 MX MX176195A patent/MX151432A/es unknown
- 1979-01-12 PT PT69064A patent/PT69064A/pt unknown
- 1979-01-31 FR FR7902463A patent/FR2417154A1/fr active Granted
- 1979-02-02 DE DE19792904052 patent/DE2904052A1/de active Granted
- 1979-02-06 IT IT47901/79A patent/IT1116845B/it active
- 1979-02-07 JP JP1235279A patent/JPS54115147A/ja active Granted
- 1979-02-09 PH PH22181A patent/PH15117A/en unknown
- 1979-02-12 SU SU792728453A patent/SU814288A3/ru active
- 1979-02-12 BE BE0/193395A patent/BE874089A/xx not_active IP Right Cessation
- 1979-02-12 SE SE7901210A patent/SE445496B/sv not_active IP Right Cessation
- 1979-02-12 CH CH134679A patent/CH639209A5/de not_active IP Right Cessation
- 1979-02-12 ES ES477636A patent/ES477636A1/es not_active Expired
- 1979-02-12 AT AT0106579A patent/AT378618B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| SE7901210L (sv) | 1979-08-14 |
| ES477636A1 (es) | 1979-10-16 |
| IL55855A0 (en) | 1979-01-31 |
| CA1105601A (en) | 1981-07-21 |
| DE2904052C2 (en:Method) | 1991-01-31 |
| SU814288A3 (ru) | 1981-03-15 |
| JPS54115147A (en) | 1979-09-07 |
| MX151432A (es) | 1984-11-21 |
| AU4085478A (en) | 1980-04-24 |
| NO151482B (no) | 1985-01-02 |
| BE874089A (fr) | 1979-08-13 |
| NL7811270A (nl) | 1979-08-15 |
| IL55855A (en) | 1982-07-30 |
| PT69064A (en) | 1979-02-01 |
| AT378618B (de) | 1985-09-10 |
| AU525796B2 (en) | 1982-12-02 |
| US4174152A (en) | 1979-11-13 |
| FR2417154A1 (fr) | 1979-09-07 |
| IT1116845B (it) | 1986-02-10 |
| ATA106579A (de) | 1985-01-15 |
| SE445496B (sv) | 1986-06-23 |
| IT7947901A0 (it) | 1979-02-06 |
| AR222023A1 (es) | 1981-04-15 |
| ZA785837B (en) | 1979-09-26 |
| BR7807833A (pt) | 1979-09-25 |
| NO784396L (no) | 1979-08-14 |
| CH639209A5 (de) | 1983-10-31 |
| GB2014326A (en) | 1979-08-22 |
| GB2014326B (en) | 1982-09-08 |
| FR2417154B1 (en:Method) | 1985-03-22 |
| NO151482C (no) | 1985-04-17 |
| PH15117A (en) | 1982-08-10 |
| DE2904052A1 (de) | 1979-08-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6145814B2 (en:Method) | ||
| JPS636857B2 (en:Method) | ||
| US5471338A (en) | Electrochromic device with plastic substrate | |
| JP3779392B2 (ja) | ライトバルブ用の改善された紫外線安定性光変調フィルム | |
| US4522691A (en) | Method for manufacturing a multicolor filter and a multicolor display device | |
| US5471554A (en) | Primer for electrochromic device with plastic substrate | |
| US5777038A (en) | High dielectric graft copolymer | |
| EP0735408B1 (en) | Solid-state electrochromic device | |
| JP4191383B2 (ja) | 光学的品質のリチウム化バナジウム酸化物被覆基材を調製する方法 | |
| US6007927A (en) | Organic dispersion-type electroluminescence element having reflective insulating layer eliminating bad effects of impurities from inorganic high dielectric powder | |
| KR810000777B1 (ko) | 전기 광학장치 | |
| JPH01230691A (ja) | エレクトロクロミック表示素子 | |
| SU1022669A3 (ru) | Электрохромное устройство | |
| JPS59114572A (ja) | 多色表示装置の製造方法 | |
| JP3879303B2 (ja) | 体積変調型調光材料、体積変調型調光組成物および光学素子 | |
| JPH11323196A (ja) | 光散乱膜用塗液 | |
| JPS61143727A (ja) | エレクトロクロミツクデイスプレイ素子 | |
| JP2515665B2 (ja) | 光学素子用分散体およびこれを使用する光学素子とその駆動方法 | |
| JPH06313904A (ja) | 光学素子用分散体およびこれを使用する光学素子とその駆動方法 | |
| JPS61138237A (ja) | エレクトロクロミツクデイスプレイ素子 | |
| JPH0344498A (ja) | カラーフィルターの製造方法 | |
| JPS5950486A (ja) | 電気発色表示素子 | |
| JPS6284176A (ja) | 高分子錯体膜及びエレクトロクロミツク表示素子 | |
| JPH06273733A (ja) | 液晶光学素子及びその製造方法 | |
| JPS6188223A (ja) | 多色表示方法 |