DE2851788A1 - Verfahren zur herstellung von aryloxiessigsaeuren - Google Patents
Verfahren zur herstellung von aryloxiessigsaeurenInfo
- Publication number
- DE2851788A1 DE2851788A1 DE19782851788 DE2851788A DE2851788A1 DE 2851788 A1 DE2851788 A1 DE 2851788A1 DE 19782851788 DE19782851788 DE 19782851788 DE 2851788 A DE2851788 A DE 2851788A DE 2851788 A1 DE2851788 A1 DE 2851788A1
- Authority
- DE
- Germany
- Prior art keywords
- platinum
- lead
- bismuth
- catalysts
- metal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 39
- 239000002253 acid Substances 0.000 title description 16
- 238000004519 manufacturing process Methods 0.000 title description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 60
- 239000003054 catalyst Substances 0.000 claims description 41
- 239000012190 activator Substances 0.000 claims description 38
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 28
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 26
- 230000003647 oxidation Effects 0.000 claims description 21
- 238000007254 oxidation reaction Methods 0.000 claims description 21
- 229910052697 platinum Inorganic materials 0.000 claims description 21
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 16
- 239000001301 oxygen Substances 0.000 claims description 16
- 229910052760 oxygen Inorganic materials 0.000 claims description 16
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 14
- 229910052797 bismuth Inorganic materials 0.000 claims description 13
- 229910052763 palladium Inorganic materials 0.000 claims description 13
- 239000011541 reaction mixture Substances 0.000 claims description 12
- 229910052751 metal Inorganic materials 0.000 claims description 11
- 239000002184 metal Substances 0.000 claims description 11
- 229910052793 cadmium Inorganic materials 0.000 claims description 10
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 9
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 150000002736 metal compounds Chemical class 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 3
- 125000005129 aryl carbonyl group Chemical group 0.000 claims description 3
- 125000004104 aryloxy group Chemical group 0.000 claims description 3
- 238000009835 boiling Methods 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 239000007789 gas Substances 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 1
- -1 aryloxy acetic acids Chemical class 0.000 description 42
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 32
- LCPDWSOZIOUXRV-UHFFFAOYSA-N phenoxyacetic acid Chemical compound OC(=O)COC1=CC=CC=C1 LCPDWSOZIOUXRV-UHFFFAOYSA-N 0.000 description 32
- 238000006243 chemical reaction Methods 0.000 description 21
- 229960005323 phenoxyethanol Drugs 0.000 description 15
- QCDWFXQBSFUVSP-UHFFFAOYSA-N 2-phenoxyethanol Chemical compound OCCOC1=CC=CC=C1 QCDWFXQBSFUVSP-UHFFFAOYSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- 239000003513 alkali Substances 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 239000012071 phase Substances 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 238000007792 addition Methods 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 230000000052 comparative effect Effects 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 238000010626 work up procedure Methods 0.000 description 4
- PCCMNBRZMKANQD-UHFFFAOYSA-N 2-(2,4-dichlorophenoxy)ethanol Chemical compound OCCOC1=CC=C(Cl)C=C1Cl PCCMNBRZMKANQD-UHFFFAOYSA-N 0.000 description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 235000011054 acetic acid Nutrition 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- 125000001624 naphthyl group Chemical group 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- KOCUJDQGNNGICL-UHFFFAOYSA-N 1-(4-methylphenoxy)ethanol Chemical compound CC(O)OC1=CC=C(C)C=C1 KOCUJDQGNNGICL-UHFFFAOYSA-N 0.000 description 2
- ATKFMEGWDYLXBP-UHFFFAOYSA-N 2-(2,4,5-trichlorophenoxy)ethanol Chemical compound OCCOC1=CC(Cl)=C(Cl)C=C1Cl ATKFMEGWDYLXBP-UHFFFAOYSA-N 0.000 description 2
- BQPBZDSDFCDSAO-UHFFFAOYSA-N 2-naphthalen-2-yloxyethanol Chemical compound C1=CC=CC2=CC(OCCO)=CC=C21 BQPBZDSDFCDSAO-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- PPNKDDZCLDMRHS-UHFFFAOYSA-N bismuth(III) nitrate Inorganic materials [Bi+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O PPNKDDZCLDMRHS-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- XIEPJMXMMWZAAV-UHFFFAOYSA-N cadmium nitrate Chemical compound [Cd+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XIEPJMXMMWZAAV-UHFFFAOYSA-N 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- RLJMLMKIBZAXJO-UHFFFAOYSA-N lead nitrate Chemical compound [O-][N+](=O)O[Pb]O[N+]([O-])=O RLJMLMKIBZAXJO-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 150000004780 naphthols Chemical class 0.000 description 2
- 238000010525 oxidative degradation reaction Methods 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- SMYMJHWAQXWPDB-UHFFFAOYSA-N (2,4,5-trichlorophenoxy)acetic acid Chemical compound OC(=O)COC1=CC(Cl)=C(Cl)C=C1Cl SMYMJHWAQXWPDB-UHFFFAOYSA-N 0.000 description 1
- XMLUZDBYNTZUSI-UHFFFAOYSA-N 1,2,4-trichloro-5-ethoxybenzene Chemical compound CCOC1=CC(Cl)=C(Cl)C=C1Cl XMLUZDBYNTZUSI-UHFFFAOYSA-N 0.000 description 1
- NEFJRUJOQNOETG-UHFFFAOYSA-N 1-(2,3,4-trichlorophenoxy)ethanol Chemical compound CC(O)OC1=CC=C(Cl)C(Cl)=C1Cl NEFJRUJOQNOETG-UHFFFAOYSA-N 0.000 description 1
- IOYMAPCBEBLMLV-UHFFFAOYSA-N 1-(2,3-dichlorophenoxy)ethanol Chemical compound CC(O)OC1=CC=CC(Cl)=C1Cl IOYMAPCBEBLMLV-UHFFFAOYSA-N 0.000 description 1
- DPNIGJLGMQBNNY-UHFFFAOYSA-N 1-(2,3-dimethylphenoxy)ethanol Chemical compound CC(O)OC1=CC=CC(C)=C1C DPNIGJLGMQBNNY-UHFFFAOYSA-N 0.000 description 1
- HHHHVMHXVSMNEM-UHFFFAOYSA-N 1-(2,4,6-trichlorophenoxy)ethanol Chemical compound CC(O)OC1=C(Cl)C=C(Cl)C=C1Cl HHHHVMHXVSMNEM-UHFFFAOYSA-N 0.000 description 1
- DPCNHKNXCOWUCA-UHFFFAOYSA-N 1-(2,4-dimethylphenoxy)ethanol Chemical compound CC(O)OC1=CC=C(C)C=C1C DPCNHKNXCOWUCA-UHFFFAOYSA-N 0.000 description 1
- MSIHEIRFFJFPFC-UHFFFAOYSA-N 1-(2,5-dichlorophenoxy)ethanol Chemical compound CC(O)OC1=CC(Cl)=CC=C1Cl MSIHEIRFFJFPFC-UHFFFAOYSA-N 0.000 description 1
- GRCCRGZIGHCSEO-UHFFFAOYSA-N 1-(2,5-dimethylphenoxy)ethanol Chemical compound CC(O)OC1=CC(C)=CC=C1C GRCCRGZIGHCSEO-UHFFFAOYSA-N 0.000 description 1
- ULXSCTNDWWKLNA-UHFFFAOYSA-N 1-(2,6-dichloro-3-methylphenoxy)ethanol Chemical compound CC(O)OC1=C(Cl)C=CC(C)=C1Cl ULXSCTNDWWKLNA-UHFFFAOYSA-N 0.000 description 1
- FQYSISQTFSGRPD-UHFFFAOYSA-N 1-(2,6-dichloro-4-methylphenoxy)ethanol Chemical compound CC(O)OC1=C(Cl)C=C(C)C=C1Cl FQYSISQTFSGRPD-UHFFFAOYSA-N 0.000 description 1
- PUPHBIGWZCKPOC-UHFFFAOYSA-N 1-(2,6-dichlorophenoxy)ethanol Chemical compound CC(O)OC1=C(Cl)C=CC=C1Cl PUPHBIGWZCKPOC-UHFFFAOYSA-N 0.000 description 1
- MMLWQANUZJTBLY-UHFFFAOYSA-N 1-(2,6-dimethylphenoxy)ethanol Chemical compound CC(O)OC1=C(C)C=CC=C1C MMLWQANUZJTBLY-UHFFFAOYSA-N 0.000 description 1
- VTYUIKQNIVYVDN-UHFFFAOYSA-N 1-(2-chloro-4,6-dimethylphenoxy)ethanol Chemical compound CC(O)OC1=C(C)C=C(C)C=C1Cl VTYUIKQNIVYVDN-UHFFFAOYSA-N 0.000 description 1
- GCKAIQHJBSVQHH-UHFFFAOYSA-N 1-(2-chloro-4-fluorophenoxy)ethanol Chemical compound CC(O)OC1=CC=C(F)C=C1Cl GCKAIQHJBSVQHH-UHFFFAOYSA-N 0.000 description 1
- VBEQOIJIYZWPQD-UHFFFAOYSA-N 1-(2-chloro-4-methylphenoxy)ethanol Chemical compound CC(O)OC1=CC=C(C)C=C1Cl VBEQOIJIYZWPQD-UHFFFAOYSA-N 0.000 description 1
- FAVAPDDFWHSCMQ-UHFFFAOYSA-N 1-(2-chloro-5-methylphenoxy)ethanol Chemical compound CC(O)OC1=CC(C)=CC=C1Cl FAVAPDDFWHSCMQ-UHFFFAOYSA-N 0.000 description 1
- ZKRKASLTCFKILG-UHFFFAOYSA-N 1-(2-chloro-6-methylphenoxy)ethanol Chemical compound CC(O)OC1=C(C)C=CC=C1Cl ZKRKASLTCFKILG-UHFFFAOYSA-N 0.000 description 1
- RIRAHMNUJYKRJK-UHFFFAOYSA-N 1-(2-chlorophenoxy)ethanol Chemical compound CC(O)OC1=CC=CC=C1Cl RIRAHMNUJYKRJK-UHFFFAOYSA-N 0.000 description 1
- MNKBBAWHQLFABF-UHFFFAOYSA-N 1-(3,4,5-trichlorophenoxy)ethanol Chemical compound CC(O)OC1=CC(Cl)=C(Cl)C(Cl)=C1 MNKBBAWHQLFABF-UHFFFAOYSA-N 0.000 description 1
- BXQJOBXGDHVCEY-UHFFFAOYSA-N 1-(3,4-dichlorophenoxy)ethanol Chemical compound CC(O)OC1=CC=C(Cl)C(Cl)=C1 BXQJOBXGDHVCEY-UHFFFAOYSA-N 0.000 description 1
- JGULAMJMBVOVRC-UHFFFAOYSA-N 1-(3,4-dimethylphenoxy)ethanol Chemical compound CC(O)OC1=CC=C(C)C(C)=C1 JGULAMJMBVOVRC-UHFFFAOYSA-N 0.000 description 1
- MWIZRZPCJMZUNG-UHFFFAOYSA-N 1-(3,5-dichlorophenoxy)ethanol Chemical compound CC(O)OC1=CC(Cl)=CC(Cl)=C1 MWIZRZPCJMZUNG-UHFFFAOYSA-N 0.000 description 1
- FKENYJOSNLGAKM-UHFFFAOYSA-N 1-(3,5-dimethylphenoxy)ethanol Chemical compound CC(O)OC1=CC(C)=CC(C)=C1 FKENYJOSNLGAKM-UHFFFAOYSA-N 0.000 description 1
- ZJEFBQJHAIDDIG-UHFFFAOYSA-N 1-(3-chlorophenoxy)ethanol Chemical compound CC(O)OC1=CC=CC(Cl)=C1 ZJEFBQJHAIDDIG-UHFFFAOYSA-N 0.000 description 1
- LKJDBVNNYVCLRZ-UHFFFAOYSA-N 1-(3-methylphenoxy)ethanol Chemical compound CC(O)OC1=CC=CC(C)=C1 LKJDBVNNYVCLRZ-UHFFFAOYSA-N 0.000 description 1
- MDCURMJKMJBKQM-UHFFFAOYSA-N 1-(4-chloro-2,6-dimethylphenoxy)ethanol Chemical compound CC(O)OC1=C(C)C=C(Cl)C=C1C MDCURMJKMJBKQM-UHFFFAOYSA-N 0.000 description 1
- NZMPNKRVSNTBMG-UHFFFAOYSA-N 1-(4-chloro-3-methylphenoxy)ethanol Chemical compound CC(O)OC1=CC=C(Cl)C(C)=C1 NZMPNKRVSNTBMG-UHFFFAOYSA-N 0.000 description 1
- SUVCHWSDLYPSEC-UHFFFAOYSA-N 1-(4-nitrophenoxy)ethanol Chemical compound CC(O)OC1=CC=C([N+]([O-])=O)C=C1 SUVCHWSDLYPSEC-UHFFFAOYSA-N 0.000 description 1
- 239000003559 2,4,5-trichlorophenoxyacetic acid Substances 0.000 description 1
- GEGSSUSEWOHAFE-UHFFFAOYSA-N 2-(4-chlorphenoxy)-ethanol Chemical compound OCCOC1=CC=C(Cl)C=C1 GEGSSUSEWOHAFE-UHFFFAOYSA-N 0.000 description 1
- 125000003229 2-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- RZCJYMOBWVJQGV-UHFFFAOYSA-N 2-naphthyloxyacetic acid Chemical compound C1=CC=CC2=CC(OCC(=O)O)=CC=C21 RZCJYMOBWVJQGV-UHFFFAOYSA-N 0.000 description 1
- NCEZLKAFGZROQM-UHFFFAOYSA-N 2-phenoxybutan-2-ol Chemical compound CCC(C)(O)OC1=CC=CC=C1 NCEZLKAFGZROQM-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- DJHGAFSJWGLOIV-UHFFFAOYSA-K Arsenate3- Chemical class [O-][As]([O-])([O-])=O DJHGAFSJWGLOIV-UHFFFAOYSA-K 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical class CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical class [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001887 cyclopentyloxy group Chemical group C1(CCCC1)O* 0.000 description 1
- 238000004042 decolorization Methods 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 235000021384 green leafy vegetables Nutrition 0.000 description 1
- 230000017525 heat dissipation Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000004715 keto acids Chemical class 0.000 description 1
- 150000003893 lactate salts Chemical class 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 229940105082 medicinal charcoal Drugs 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 150000002826 nitrites Chemical class 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 150000002926 oxygen Chemical class 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000036632 reaction speed Effects 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 150000003873 salicylate salts Chemical class 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- QYHFIVBSNOWOCQ-UHFFFAOYSA-N selenic acid Chemical class O[Se](O)(=O)=O QYHFIVBSNOWOCQ-UHFFFAOYSA-N 0.000 description 1
- 150000003346 selenoethers Chemical class 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- BGIZDFRICLAMPH-UHFFFAOYSA-M sodium 2-chloroacetate hydrochloride Chemical compound [Cl-].[Na+].ClCC(=O)O BGIZDFRICLAMPH-UHFFFAOYSA-M 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 229910052566 spinel group Inorganic materials 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005329 tetralinyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- LSGOVYNHVSXFFJ-UHFFFAOYSA-N vanadate(3-) Chemical class [O-][V]([O-])([O-])=O LSGOVYNHVSXFFJ-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/16—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation
- C07C51/21—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen
- C07C51/255—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/16—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation
- C07C51/21—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen
- C07C51/23—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of oxygen-containing groups to carboxyl groups
- C07C51/235—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of oxygen-containing groups to carboxyl groups of —CHO groups or primary alcohol groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782851788 DE2851788A1 (de) | 1978-11-30 | 1978-11-30 | Verfahren zur herstellung von aryloxiessigsaeuren |
| US06/092,783 US4238625A (en) | 1978-11-30 | 1979-11-08 | Process for the preparation of aryloxyacetic acid |
| DE7979104562T DE2960757D1 (en) | 1978-11-30 | 1979-11-19 | Process for preparing aryloxyacetic acids |
| EP79104562A EP0011793B1 (de) | 1978-11-30 | 1979-11-19 | Verfahren zur Herstellung von Aryloxyessigsäuren |
| IL58813A IL58813A (en) | 1978-11-30 | 1979-11-27 | Preparation of aryloxyacetic acids |
| JP15306679A JPS5576841A (en) | 1978-11-30 | 1979-11-28 | Manufacture of aryloxyacetic acids |
| BR7907754A BR7907754A (pt) | 1978-11-30 | 1979-11-29 | Processo para a preparacao de acidos ariloxiaceticos |
| DK507979A DK507979A (da) | 1978-11-30 | 1979-11-29 | Fremgangsmaade til fremstilling af aryloxyeddikesyrer ved oxidation af aryloxyethanoler |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782851788 DE2851788A1 (de) | 1978-11-30 | 1978-11-30 | Verfahren zur herstellung von aryloxiessigsaeuren |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2851788A1 true DE2851788A1 (de) | 1980-06-12 |
Family
ID=6055941
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782851788 Withdrawn DE2851788A1 (de) | 1978-11-30 | 1978-11-30 | Verfahren zur herstellung von aryloxiessigsaeuren |
| DE7979104562T Expired DE2960757D1 (en) | 1978-11-30 | 1979-11-19 | Process for preparing aryloxyacetic acids |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE7979104562T Expired DE2960757D1 (en) | 1978-11-30 | 1979-11-19 | Process for preparing aryloxyacetic acids |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4238625A (enExample) |
| EP (1) | EP0011793B1 (enExample) |
| JP (1) | JPS5576841A (enExample) |
| BR (1) | BR7907754A (enExample) |
| DE (2) | DE2851788A1 (enExample) |
| DK (1) | DK507979A (enExample) |
| IL (1) | IL58813A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4976893A (en) * | 1985-06-20 | 1990-12-11 | Hoechst Aktiengesellschaft | Process for preparing carboxylic acids |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH075511B2 (ja) * | 1986-02-26 | 1995-01-25 | 花王株式会社 | カルボン酸塩の製造法 |
| DE3618114A1 (de) * | 1986-05-30 | 1987-12-10 | Bayer Ag | Verfahren zur herstellung von carbonsaeure-derivaten |
| DE3618135A1 (de) * | 1986-05-30 | 1987-12-03 | Bayer Ag | Verfahren zur herstellung von oxetan-3-carbonsaeuren |
| US4804777A (en) * | 1987-10-09 | 1989-02-14 | Eastman Kodak Company | Process for the preparation of aryloxyacetic acid |
| US4791224A (en) * | 1988-04-07 | 1988-12-13 | Eastman Kodak Company | Process for preparation of an oxyacetic acid/hydroxyethyl ether compound |
| US4935540A (en) * | 1988-12-12 | 1990-06-19 | Sumner Jr Charles E | Process for the preparation of aryloxyacetic acid |
| JPH0338544A (ja) * | 1989-07-03 | 1991-02-19 | Mitsubishi Kasei Corp | フェニレンジオキシジ酢酸類の製造方法 |
| JPH03123770A (ja) * | 1989-10-06 | 1991-05-27 | Mercian Corp | アゼチジノン誘導体及びその製法 |
| AR019660A1 (es) | 1998-06-15 | 2002-03-13 | Eastman Chem Co | Una composicion de combinacion de poliester fenilendi(oxiacetico, acido), de alta barrera |
| US6476258B1 (en) * | 1999-07-07 | 2002-11-05 | Sumitomo Chemical Company, Limited | Process for producing aryloxyacetic acids |
| CN102180789A (zh) * | 2011-03-25 | 2011-09-14 | 山东潍坊润丰化工有限公司 | 一种芳氧羧酸原药的制备方法 |
| KR20190132376A (ko) | 2017-03-21 | 2019-11-27 | 바스프 에스이 | 동결방지제용 부식방지 성분을 제조하는 방법 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1618589A1 (de) * | 1967-04-01 | 1971-02-25 | Knapsack Ag | Verfahren zur Herstellung von Carbonsaeuren |
| US3919305A (en) * | 1970-07-21 | 1975-11-11 | Rhone Poulenc Sa | Process for the preparation of phenylacetic acid |
| JPS5028936A (enExample) * | 1973-07-13 | 1975-03-24 | ||
| DE2620254C2 (de) * | 1976-05-07 | 1984-03-15 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Hydroxybenzaldehyden |
-
1978
- 1978-11-30 DE DE19782851788 patent/DE2851788A1/de not_active Withdrawn
-
1979
- 1979-11-08 US US06/092,783 patent/US4238625A/en not_active Expired - Lifetime
- 1979-11-19 EP EP79104562A patent/EP0011793B1/de not_active Expired
- 1979-11-19 DE DE7979104562T patent/DE2960757D1/de not_active Expired
- 1979-11-27 IL IL58813A patent/IL58813A/xx not_active IP Right Cessation
- 1979-11-28 JP JP15306679A patent/JPS5576841A/ja active Granted
- 1979-11-29 BR BR7907754A patent/BR7907754A/pt unknown
- 1979-11-29 DK DK507979A patent/DK507979A/da unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4976893A (en) * | 1985-06-20 | 1990-12-11 | Hoechst Aktiengesellschaft | Process for preparing carboxylic acids |
Also Published As
| Publication number | Publication date |
|---|---|
| EP0011793B1 (de) | 1981-09-02 |
| JPS6228940B2 (enExample) | 1987-06-23 |
| DK507979A (da) | 1980-05-31 |
| IL58813A (en) | 1982-11-30 |
| IL58813A0 (en) | 1980-02-29 |
| US4238625A (en) | 1980-12-09 |
| JPS5576841A (en) | 1980-06-10 |
| BR7907754A (pt) | 1980-07-22 |
| DE2960757D1 (en) | 1981-11-26 |
| EP0011793A1 (de) | 1980-06-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0011793B1 (de) | Verfahren zur Herstellung von Aryloxyessigsäuren | |
| DE3135946A1 (de) | Verfahren zur herstellung von alkoxyessigsaeuren | |
| EP0028714B1 (de) | Verfahren zur Herstellung von 3-Phenoxy-benzaldehyden | |
| DE2620254A1 (de) | Verfahren zur herstellung von hydroxybenzaldehyden | |
| EP0008699B1 (de) | Verfahren zur Herstellung von Arylglyoxylsäuren | |
| DE3030463A1 (de) | Verfahren zur herstellung von aromatischen polycarbonsaeuren | |
| EP0005779B1 (de) | Verfahren zur Herstellung von Arylglyoxylsäuren | |
| DE3602180C2 (enExample) | ||
| DE2642672A1 (de) | Selektive oxidation von chrysanthemylalkohol | |
| EP0247485B1 (de) | Verfahren zur Herstellung von Oxetan-3-carbonsäuren | |
| EP0247481B1 (de) | Verfahren zur Herstellung von 2,2-Bis-chlormethylalkan-carbonsäurechloriden | |
| DE68907900T2 (de) | Verfahren zur herstellung von oxyessigsäure/hydroxyethyletherverbindung. | |
| DE3643206C1 (de) | Verfahren zur Herstellung von substituierten Dihydroxybenzolen | |
| AT256076B (de) | Verfahren zur Herstellung von Benzolcarbonsäuren | |
| EP0078993A1 (de) | Verfahren zur Herstellung von Benzoylchlorid | |
| EP0247472B1 (de) | Verfahren zur Herstellung von Carbonsäure-Derivaten | |
| EP1398308A1 (de) | Verfahren zur Herstellung von 3,3 Dimethyl-2-oxobuttersäure | |
| DE910290C (de) | Verfahren zur Herstellung von ª‰-Acyloxyaldehyden | |
| AT256079B (de) | Verfahren zur Herstellung von Terephthalsäure | |
| EP0530559B1 (de) | Verfahren zur Herstellung von 1-Nitroanthrachinon-2-carbonsäuren | |
| DE1543952B (de) | Verfahren zur Herstellung von Nitrophenolen | |
| DE2708115A1 (de) | Verfahren zur herstellung von o-nitrobenzaldehyd | |
| DE1229061B (de) | Verfahren zur Herstellung von aromatischen Aldehyden | |
| DE1207935B (de) | Verfahren zur Herstellung von Oxychinoxalincarbonsaeuren | |
| DE1058996B (de) | Verfahren zur Herstellung von Pyrrol-ª, ª'-dicarbonsaeuren und deren Salzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |